diff --git a/dist/cleanup/index.js b/dist/cleanup/index.js index da0d743b..919437bc 100644 --- a/dist/cleanup/index.js +++ b/dist/cleanup/index.js @@ -626,7 +626,7 @@ class OidcClient { .catch(error => { throw new Error(`Failed to get ID Token. \n Error Code : ${error.statusCode}\n - Error Message: ${error.result.message}`); + Error Message: ${error.message}`); }); const id_token = (_a = res.result) === null || _a === void 0 ? void 0 : _a.value; if (!id_token) { diff --git a/dist/index.js b/dist/index.js index 6fd57d01..2ed167bf 100644 --- a/dist/index.js +++ b/dist/index.js @@ -777,7 +777,7 @@ class OidcClient { .catch(error => { throw new Error(`Failed to get ID Token. \n Error Code : ${error.statusCode}\n - Error Message: ${error.result.message}`); + Error Message: ${error.message}`); }); const id_token = (_a = res.result) === null || _a === void 0 ? void 0 : _a.value; if (!id_token) { @@ -3799,7 +3799,7 @@ exports.uint32ArrayFrom = uint32ArrayFrom; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.ECRPUBLIC = void 0; -const smithy_client_1 = __nccwpck_require__(4963); +const smithy_client_1 = __nccwpck_require__(63570); const BatchCheckLayerAvailabilityCommand_1 = __nccwpck_require__(25356); const BatchDeleteImageCommand_1 = __nccwpck_require__(56517); const CompleteLayerUploadCommand_1 = __nccwpck_require__(55490); @@ -3864,22 +3864,23 @@ exports.ECRPUBLIC = ECRPUBLIC; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.ECRPUBLICClient = exports.__Client = void 0; -const config_resolver_1 = __nccwpck_require__(56153); -const middleware_content_length_1 = __nccwpck_require__(42245); -const middleware_endpoint_1 = __nccwpck_require__(5497); const middleware_host_header_1 = __nccwpck_require__(22545); const middleware_logger_1 = __nccwpck_require__(20014); const middleware_recursion_detection_1 = __nccwpck_require__(85525); -const middleware_retry_1 = __nccwpck_require__(96064); const middleware_signing_1 = __nccwpck_require__(14935); const middleware_user_agent_1 = __nccwpck_require__(64688); -const smithy_client_1 = __nccwpck_require__(4963); +const config_resolver_1 = __nccwpck_require__(53098); +const middleware_content_length_1 = __nccwpck_require__(82800); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_retry_1 = __nccwpck_require__(96039); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } })); const EndpointParameters_1 = __nccwpck_require__(78258); const runtimeConfig_1 = __nccwpck_require__(49324); +const runtimeExtensions_1 = __nccwpck_require__(22754); class ECRPUBLICClient extends smithy_client_1.Client { - constructor(configuration) { - const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration); + constructor(...[configuration]) { + const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration || {}); const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1); const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2); @@ -3887,8 +3888,9 @@ class ECRPUBLICClient extends smithy_client_1.Client { const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); const _config_6 = (0, middleware_signing_1.resolveAwsAuthConfig)(_config_5); const _config_7 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_6); - super(_config_7); - this.config = _config_7; + const _config_8 = (0, runtimeExtensions_1.resolveRuntimeExtensions)(_config_7, configuration?.extensions || []); + super(_config_8); + this.config = _config_8; this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); @@ -3913,10 +3915,11 @@ exports.ECRPUBLICClient = ECRPUBLICClient; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.BatchCheckLayerAvailabilityCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class BatchCheckLayerAvailabilityCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -3944,6 +3947,10 @@ class BatchCheckLayerAvailabilityCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "BatchCheckLayerAvailability", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -3967,10 +3974,11 @@ exports.BatchCheckLayerAvailabilityCommand = BatchCheckLayerAvailabilityCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.BatchDeleteImageCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class BatchDeleteImageCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -3998,6 +4006,10 @@ class BatchDeleteImageCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "BatchDeleteImage", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4021,10 +4033,11 @@ exports.BatchDeleteImageCommand = BatchDeleteImageCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.CompleteLayerUploadCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class CompleteLayerUploadCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4052,6 +4065,10 @@ class CompleteLayerUploadCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "CompleteLayerUpload", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4075,10 +4092,11 @@ exports.CompleteLayerUploadCommand = CompleteLayerUploadCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.CreateRepositoryCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class CreateRepositoryCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4106,6 +4124,10 @@ class CreateRepositoryCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "CreateRepository", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4129,10 +4151,11 @@ exports.CreateRepositoryCommand = CreateRepositoryCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.DeleteRepositoryCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class DeleteRepositoryCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4160,6 +4183,10 @@ class DeleteRepositoryCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "DeleteRepository", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4183,10 +4210,11 @@ exports.DeleteRepositoryCommand = DeleteRepositoryCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.DeleteRepositoryPolicyCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class DeleteRepositoryPolicyCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4214,6 +4242,10 @@ class DeleteRepositoryPolicyCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "DeleteRepositoryPolicy", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4237,10 +4269,11 @@ exports.DeleteRepositoryPolicyCommand = DeleteRepositoryPolicyCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.DescribeImageTagsCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class DescribeImageTagsCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4268,6 +4301,10 @@ class DescribeImageTagsCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "DescribeImageTags", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4291,10 +4328,11 @@ exports.DescribeImageTagsCommand = DescribeImageTagsCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.DescribeImagesCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class DescribeImagesCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4322,6 +4360,10 @@ class DescribeImagesCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "DescribeImages", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4345,10 +4387,11 @@ exports.DescribeImagesCommand = DescribeImagesCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.DescribeRegistriesCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class DescribeRegistriesCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4376,6 +4419,10 @@ class DescribeRegistriesCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "DescribeRegistries", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4399,10 +4446,11 @@ exports.DescribeRegistriesCommand = DescribeRegistriesCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.DescribeRepositoriesCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class DescribeRepositoriesCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4430,6 +4478,10 @@ class DescribeRepositoriesCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "DescribeRepositories", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4453,10 +4505,11 @@ exports.DescribeRepositoriesCommand = DescribeRepositoriesCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.GetAuthorizationTokenCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class GetAuthorizationTokenCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4484,6 +4537,10 @@ class GetAuthorizationTokenCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "GetAuthorizationToken", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4507,10 +4564,11 @@ exports.GetAuthorizationTokenCommand = GetAuthorizationTokenCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.GetRegistryCatalogDataCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class GetRegistryCatalogDataCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4538,6 +4596,10 @@ class GetRegistryCatalogDataCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "GetRegistryCatalogData", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4561,10 +4623,11 @@ exports.GetRegistryCatalogDataCommand = GetRegistryCatalogDataCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.GetRepositoryCatalogDataCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class GetRepositoryCatalogDataCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4592,6 +4655,10 @@ class GetRepositoryCatalogDataCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "GetRepositoryCatalogData", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4615,10 +4682,11 @@ exports.GetRepositoryCatalogDataCommand = GetRepositoryCatalogDataCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.GetRepositoryPolicyCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class GetRepositoryPolicyCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4646,6 +4714,10 @@ class GetRepositoryPolicyCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "GetRepositoryPolicy", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4669,10 +4741,11 @@ exports.GetRepositoryPolicyCommand = GetRepositoryPolicyCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.InitiateLayerUploadCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class InitiateLayerUploadCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4700,6 +4773,10 @@ class InitiateLayerUploadCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "InitiateLayerUpload", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4723,10 +4800,11 @@ exports.InitiateLayerUploadCommand = InitiateLayerUploadCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.ListTagsForResourceCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class ListTagsForResourceCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4754,6 +4832,10 @@ class ListTagsForResourceCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "ListTagsForResource", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4777,10 +4859,11 @@ exports.ListTagsForResourceCommand = ListTagsForResourceCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.PutImageCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class PutImageCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4808,6 +4891,10 @@ class PutImageCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "PutImage", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4831,10 +4918,11 @@ exports.PutImageCommand = PutImageCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.PutRegistryCatalogDataCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class PutRegistryCatalogDataCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4862,6 +4950,10 @@ class PutRegistryCatalogDataCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "PutRegistryCatalogData", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4885,10 +4977,11 @@ exports.PutRegistryCatalogDataCommand = PutRegistryCatalogDataCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.PutRepositoryCatalogDataCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class PutRepositoryCatalogDataCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4916,6 +5009,10 @@ class PutRepositoryCatalogDataCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "PutRepositoryCatalogData", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4939,10 +5036,11 @@ exports.PutRepositoryCatalogDataCommand = PutRepositoryCatalogDataCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.SetRepositoryPolicyCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class SetRepositoryPolicyCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -4970,6 +5068,10 @@ class SetRepositoryPolicyCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "SetRepositoryPolicy", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -4993,10 +5095,11 @@ exports.SetRepositoryPolicyCommand = SetRepositoryPolicyCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.TagResourceCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class TagResourceCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -5024,6 +5127,10 @@ class TagResourceCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "TagResource", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -5047,10 +5154,11 @@ exports.TagResourceCommand = TagResourceCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.UntagResourceCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class UntagResourceCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -5078,6 +5186,10 @@ class UntagResourceCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "UntagResource", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -5101,10 +5213,11 @@ exports.UntagResourceCommand = UntagResourceCommand; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.UploadLayerPartCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(83399); const Aws_json1_1_1 = __nccwpck_require__(64170); class UploadLayerPartCommand extends smithy_client_1.Command { static getEndpointParameterInstructions() { @@ -5132,6 +5245,10 @@ class UploadLayerPartCommand extends smithy_client_1.Command { commandName, inputFilterSensitiveLog: (_) => _, outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SpencerFrontendService", + operation: "UploadLayerPart", + }, }; const { requestHandler } = configuration; return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); @@ -5231,7 +5348,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); exports.ruleSet = void 0; const q = "required", r = "fn", s = "argv", t = "ref"; const a = "isSet", b = "tree", c = "error", d = "endpoint", e = "PartitionResult", f = { [q]: false, "type": "String" }, g = { [q]: true, "default": false, "type": "Boolean" }, h = { [t]: "Endpoint" }, i = { [r]: "booleanEquals", [s]: [{ [t]: "UseFIPS" }, true] }, j = { [r]: "booleanEquals", [s]: [{ [t]: "UseDualStack" }, true] }, k = {}, l = { [r]: "booleanEquals", [s]: [true, { [r]: "getAttr", [s]: [{ [t]: e }, "supportsFIPS"] }] }, m = { [r]: "booleanEquals", [s]: [true, { [r]: "getAttr", [s]: [{ [t]: e }, "supportsDualStack"] }] }, n = [i], o = [j], p = [{ [t]: "Region" }]; -const _data = { version: "1.0", parameters: { Region: f, UseDualStack: g, UseFIPS: g, Endpoint: f }, rules: [{ conditions: [{ [r]: a, [s]: [h] }], type: b, rules: [{ conditions: n, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: c }, { type: b, rules: [{ conditions: o, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: c }, { endpoint: { url: h, properties: k, headers: k }, type: d }] }] }, { type: b, rules: [{ conditions: [{ [r]: a, [s]: p }], type: b, rules: [{ conditions: [{ [r]: "aws.partition", [s]: p, assign: e }], type: b, rules: [{ conditions: [i, j], type: b, rules: [{ conditions: [l, m], type: b, rules: [{ type: b, rules: [{ endpoint: { url: "https://api.ecr-public-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: k, headers: k }, type: d }] }] }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: c }] }, { conditions: n, type: b, rules: [{ conditions: [l], type: b, rules: [{ type: b, rules: [{ endpoint: { url: "https://api.ecr-public-fips.{Region}.{PartitionResult#dnsSuffix}", properties: k, headers: k }, type: d }] }] }, { error: "FIPS is enabled but this partition does not support FIPS", type: c }] }, { conditions: o, type: b, rules: [{ conditions: [m], type: b, rules: [{ type: b, rules: [{ endpoint: { url: "https://api.ecr-public.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: k, headers: k }, type: d }] }] }, { error: "DualStack is enabled but this partition does not support DualStack", type: c }] }, { type: b, rules: [{ endpoint: { url: "https://api.ecr-public.{Region}.{PartitionResult#dnsSuffix}", properties: k, headers: k }, type: d }] }] }] }, { error: "Invalid Configuration: Missing Region", type: c }] }] }; +const _data = { version: "1.0", parameters: { Region: f, UseDualStack: g, UseFIPS: g, Endpoint: f }, rules: [{ conditions: [{ [r]: a, [s]: [h] }], type: b, rules: [{ conditions: n, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: c }, { conditions: o, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: c }, { endpoint: { url: h, properties: k, headers: k }, type: d }] }, { conditions: [{ [r]: a, [s]: p }], type: b, rules: [{ conditions: [{ [r]: "aws.partition", [s]: p, assign: e }], type: b, rules: [{ conditions: [i, j], type: b, rules: [{ conditions: [l, m], type: b, rules: [{ endpoint: { url: "https://api.ecr-public-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: k, headers: k }, type: d }] }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: c }] }, { conditions: n, type: b, rules: [{ conditions: [l], type: b, rules: [{ endpoint: { url: "https://api.ecr-public-fips.{Region}.{PartitionResult#dnsSuffix}", properties: k, headers: k }, type: d }] }, { error: "FIPS is enabled but this partition does not support FIPS", type: c }] }, { conditions: o, type: b, rules: [{ conditions: [m], type: b, rules: [{ endpoint: { url: "https://api.ecr-public.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: k, headers: k }, type: d }] }, { error: "DualStack is enabled but this partition does not support DualStack", type: c }] }, { endpoint: { url: "https://api.ecr-public.{Region}.{PartitionResult#dnsSuffix}", properties: k, headers: k }, type: d }] }] }, { error: "Invalid Configuration: Missing Region", type: c }] }; exports.ruleSet = _data; @@ -5263,7 +5380,7 @@ Object.defineProperty(exports, "ECRPUBLICServiceException", ({ enumerable: true, Object.defineProperty(exports, "__esModule", ({ value: true })); exports.ECRPUBLICServiceException = exports.__ServiceException = void 0; -const smithy_client_1 = __nccwpck_require__(4963); +const smithy_client_1 = __nccwpck_require__(63570); Object.defineProperty(exports, "__ServiceException", ({ enumerable: true, get: function () { return smithy_client_1.ServiceException; } })); class ECRPUBLICServiceException extends smithy_client_1.ServiceException { constructor(options) { @@ -5819,8 +5936,8 @@ tslib_1.__exportStar(__nccwpck_require__(93463), exports); Object.defineProperty(exports, "__esModule", ({ value: true })); exports.de_UploadLayerPartCommand = exports.de_UntagResourceCommand = exports.de_TagResourceCommand = exports.de_SetRepositoryPolicyCommand = exports.de_PutRepositoryCatalogDataCommand = exports.de_PutRegistryCatalogDataCommand = exports.de_PutImageCommand = exports.de_ListTagsForResourceCommand = exports.de_InitiateLayerUploadCommand = exports.de_GetRepositoryPolicyCommand = exports.de_GetRepositoryCatalogDataCommand = exports.de_GetRegistryCatalogDataCommand = exports.de_GetAuthorizationTokenCommand = exports.de_DescribeRepositoriesCommand = exports.de_DescribeRegistriesCommand = exports.de_DescribeImageTagsCommand = exports.de_DescribeImagesCommand = exports.de_DeleteRepositoryPolicyCommand = exports.de_DeleteRepositoryCommand = exports.de_CreateRepositoryCommand = exports.de_CompleteLayerUploadCommand = exports.de_BatchDeleteImageCommand = exports.de_BatchCheckLayerAvailabilityCommand = exports.se_UploadLayerPartCommand = exports.se_UntagResourceCommand = exports.se_TagResourceCommand = exports.se_SetRepositoryPolicyCommand = exports.se_PutRepositoryCatalogDataCommand = exports.se_PutRegistryCatalogDataCommand = exports.se_PutImageCommand = exports.se_ListTagsForResourceCommand = exports.se_InitiateLayerUploadCommand = exports.se_GetRepositoryPolicyCommand = exports.se_GetRepositoryCatalogDataCommand = exports.se_GetRegistryCatalogDataCommand = exports.se_GetAuthorizationTokenCommand = exports.se_DescribeRepositoriesCommand = exports.se_DescribeRegistriesCommand = exports.se_DescribeImageTagsCommand = exports.se_DescribeImagesCommand = exports.se_DeleteRepositoryPolicyCommand = exports.se_DeleteRepositoryCommand = exports.se_CreateRepositoryCommand = exports.se_CompleteLayerUploadCommand = exports.se_BatchDeleteImageCommand = exports.se_BatchCheckLayerAvailabilityCommand = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const protocol_http_1 = __nccwpck_require__(64418); +const protocol_http_1 = __nccwpck_require__(54483); +const smithy_client_1 = __nccwpck_require__(63570); const ECRPUBLICServiceException_1 = __nccwpck_require__(48278); const models_0_1 = __nccwpck_require__(38818); const se_BatchCheckLayerAvailabilityCommand = async (input, context) => { @@ -7463,21 +7580,21 @@ const loadRestJsonErrorCode = (output, data) => { Object.defineProperty(exports, "__esModule", ({ value: true })); exports.getRuntimeConfig = void 0; const tslib_1 = __nccwpck_require__(4351); -const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(25929)); +const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(9634)); const client_sts_1 = __nccwpck_require__(52209); -const config_resolver_1 = __nccwpck_require__(56153); const credential_provider_node_1 = __nccwpck_require__(75531); -const hash_node_1 = __nccwpck_require__(97442); -const middleware_retry_1 = __nccwpck_require__(96064); -const node_config_provider_1 = __nccwpck_require__(87684); -const node_http_handler_1 = __nccwpck_require__(68805); -const util_body_length_node_1 = __nccwpck_require__(74147); -const util_retry_1 = __nccwpck_require__(99395); const util_user_agent_node_1 = __nccwpck_require__(98095); +const config_resolver_1 = __nccwpck_require__(53098); +const hash_node_1 = __nccwpck_require__(3081); +const middleware_retry_1 = __nccwpck_require__(96039); +const node_config_provider_1 = __nccwpck_require__(33461); +const node_http_handler_1 = __nccwpck_require__(47435); +const util_body_length_node_1 = __nccwpck_require__(68075); +const util_retry_1 = __nccwpck_require__(84902); const runtimeConfig_shared_1 = __nccwpck_require__(76746); -const smithy_client_1 = __nccwpck_require__(4963); -const util_defaults_mode_node_1 = __nccwpck_require__(74243); -const smithy_client_2 = __nccwpck_require__(4963); +const smithy_client_1 = __nccwpck_require__(63570); +const util_defaults_mode_node_1 = __nccwpck_require__(72429); +const smithy_client_2 = __nccwpck_require__(63570); const getRuntimeConfig = (config) => { (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); @@ -7518,10 +7635,10 @@ exports.getRuntimeConfig = getRuntimeConfig; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.getRuntimeConfig = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const url_parser_1 = __nccwpck_require__(2992); -const util_base64_1 = __nccwpck_require__(97727); -const util_utf8_1 = __nccwpck_require__(2855); +const smithy_client_1 = __nccwpck_require__(63570); +const url_parser_1 = __nccwpck_require__(14681); +const util_base64_1 = __nccwpck_require__(75600); +const util_utf8_1 = __nccwpck_require__(41895); const endpointResolver_1 = __nccwpck_require__(87377); const getRuntimeConfig = (config) => ({ apiVersion: "2020-10-30", @@ -7529,6 +7646,7 @@ const getRuntimeConfig = (config) => ({ base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, disableHostPrefix: config?.disableHostPrefix ?? false, endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], logger: config?.logger ?? new smithy_client_1.NoOpLogger(), serviceId: config?.serviceId ?? "ECR PUBLIC", urlParser: config?.urlParser ?? url_parser_1.parseUrl, @@ -7540,10703 +7658,30014 @@ exports.getRuntimeConfig = getRuntimeConfig; /***/ }), -/***/ 59167: +/***/ 22754: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ECR = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const BatchCheckLayerAvailabilityCommand_1 = __nccwpck_require__(63804); -const BatchDeleteImageCommand_1 = __nccwpck_require__(15511); -const BatchGetImageCommand_1 = __nccwpck_require__(78859); -const BatchGetRepositoryScanningConfigurationCommand_1 = __nccwpck_require__(79728); -const CompleteLayerUploadCommand_1 = __nccwpck_require__(49003); -const CreatePullThroughCacheRuleCommand_1 = __nccwpck_require__(71454); -const CreateRepositoryCommand_1 = __nccwpck_require__(5074); -const DeleteLifecyclePolicyCommand_1 = __nccwpck_require__(48981); -const DeletePullThroughCacheRuleCommand_1 = __nccwpck_require__(83793); -const DeleteRegistryPolicyCommand_1 = __nccwpck_require__(31424); -const DeleteRepositoryCommand_1 = __nccwpck_require__(88651); -const DeleteRepositoryPolicyCommand_1 = __nccwpck_require__(36828); -const DescribeImageReplicationStatusCommand_1 = __nccwpck_require__(39694); -const DescribeImageScanFindingsCommand_1 = __nccwpck_require__(72987); -const DescribeImagesCommand_1 = __nccwpck_require__(95353); -const DescribePullThroughCacheRulesCommand_1 = __nccwpck_require__(31484); -const DescribeRegistryCommand_1 = __nccwpck_require__(26166); -const DescribeRepositoriesCommand_1 = __nccwpck_require__(21200); -const GetAuthorizationTokenCommand_1 = __nccwpck_require__(35828); -const GetDownloadUrlForLayerCommand_1 = __nccwpck_require__(51401); -const GetLifecyclePolicyCommand_1 = __nccwpck_require__(48469); -const GetLifecyclePolicyPreviewCommand_1 = __nccwpck_require__(17006); -const GetRegistryPolicyCommand_1 = __nccwpck_require__(33685); -const GetRegistryScanningConfigurationCommand_1 = __nccwpck_require__(82741); -const GetRepositoryPolicyCommand_1 = __nccwpck_require__(46330); -const InitiateLayerUploadCommand_1 = __nccwpck_require__(6936); -const ListImagesCommand_1 = __nccwpck_require__(3854); -const ListTagsForResourceCommand_1 = __nccwpck_require__(97403); -const PutImageCommand_1 = __nccwpck_require__(66844); -const PutImageScanningConfigurationCommand_1 = __nccwpck_require__(87935); -const PutImageTagMutabilityCommand_1 = __nccwpck_require__(66495); -const PutLifecyclePolicyCommand_1 = __nccwpck_require__(33854); -const PutRegistryPolicyCommand_1 = __nccwpck_require__(97928); -const PutRegistryScanningConfigurationCommand_1 = __nccwpck_require__(29529); -const PutReplicationConfigurationCommand_1 = __nccwpck_require__(14030); -const SetRepositoryPolicyCommand_1 = __nccwpck_require__(78300); -const StartImageScanCommand_1 = __nccwpck_require__(47984); -const StartLifecyclePolicyPreviewCommand_1 = __nccwpck_require__(35905); -const TagResourceCommand_1 = __nccwpck_require__(82665); -const UntagResourceCommand_1 = __nccwpck_require__(37225); -const UploadLayerPartCommand_1 = __nccwpck_require__(55825); -const ECRClient_1 = __nccwpck_require__(83391); -const commands = { - BatchCheckLayerAvailabilityCommand: BatchCheckLayerAvailabilityCommand_1.BatchCheckLayerAvailabilityCommand, - BatchDeleteImageCommand: BatchDeleteImageCommand_1.BatchDeleteImageCommand, - BatchGetImageCommand: BatchGetImageCommand_1.BatchGetImageCommand, - BatchGetRepositoryScanningConfigurationCommand: BatchGetRepositoryScanningConfigurationCommand_1.BatchGetRepositoryScanningConfigurationCommand, - CompleteLayerUploadCommand: CompleteLayerUploadCommand_1.CompleteLayerUploadCommand, - CreatePullThroughCacheRuleCommand: CreatePullThroughCacheRuleCommand_1.CreatePullThroughCacheRuleCommand, - CreateRepositoryCommand: CreateRepositoryCommand_1.CreateRepositoryCommand, - DeleteLifecyclePolicyCommand: DeleteLifecyclePolicyCommand_1.DeleteLifecyclePolicyCommand, - DeletePullThroughCacheRuleCommand: DeletePullThroughCacheRuleCommand_1.DeletePullThroughCacheRuleCommand, - DeleteRegistryPolicyCommand: DeleteRegistryPolicyCommand_1.DeleteRegistryPolicyCommand, - DeleteRepositoryCommand: DeleteRepositoryCommand_1.DeleteRepositoryCommand, - DeleteRepositoryPolicyCommand: DeleteRepositoryPolicyCommand_1.DeleteRepositoryPolicyCommand, - DescribeImageReplicationStatusCommand: DescribeImageReplicationStatusCommand_1.DescribeImageReplicationStatusCommand, - DescribeImagesCommand: DescribeImagesCommand_1.DescribeImagesCommand, - DescribeImageScanFindingsCommand: DescribeImageScanFindingsCommand_1.DescribeImageScanFindingsCommand, - DescribePullThroughCacheRulesCommand: DescribePullThroughCacheRulesCommand_1.DescribePullThroughCacheRulesCommand, - DescribeRegistryCommand: DescribeRegistryCommand_1.DescribeRegistryCommand, - DescribeRepositoriesCommand: DescribeRepositoriesCommand_1.DescribeRepositoriesCommand, - GetAuthorizationTokenCommand: GetAuthorizationTokenCommand_1.GetAuthorizationTokenCommand, - GetDownloadUrlForLayerCommand: GetDownloadUrlForLayerCommand_1.GetDownloadUrlForLayerCommand, - GetLifecyclePolicyCommand: GetLifecyclePolicyCommand_1.GetLifecyclePolicyCommand, - GetLifecyclePolicyPreviewCommand: GetLifecyclePolicyPreviewCommand_1.GetLifecyclePolicyPreviewCommand, - GetRegistryPolicyCommand: GetRegistryPolicyCommand_1.GetRegistryPolicyCommand, - GetRegistryScanningConfigurationCommand: GetRegistryScanningConfigurationCommand_1.GetRegistryScanningConfigurationCommand, - GetRepositoryPolicyCommand: GetRepositoryPolicyCommand_1.GetRepositoryPolicyCommand, - InitiateLayerUploadCommand: InitiateLayerUploadCommand_1.InitiateLayerUploadCommand, - ListImagesCommand: ListImagesCommand_1.ListImagesCommand, - ListTagsForResourceCommand: ListTagsForResourceCommand_1.ListTagsForResourceCommand, - PutImageCommand: PutImageCommand_1.PutImageCommand, - PutImageScanningConfigurationCommand: PutImageScanningConfigurationCommand_1.PutImageScanningConfigurationCommand, - PutImageTagMutabilityCommand: PutImageTagMutabilityCommand_1.PutImageTagMutabilityCommand, - PutLifecyclePolicyCommand: PutLifecyclePolicyCommand_1.PutLifecyclePolicyCommand, - PutRegistryPolicyCommand: PutRegistryPolicyCommand_1.PutRegistryPolicyCommand, - PutRegistryScanningConfigurationCommand: PutRegistryScanningConfigurationCommand_1.PutRegistryScanningConfigurationCommand, - PutReplicationConfigurationCommand: PutReplicationConfigurationCommand_1.PutReplicationConfigurationCommand, - SetRepositoryPolicyCommand: SetRepositoryPolicyCommand_1.SetRepositoryPolicyCommand, - StartImageScanCommand: StartImageScanCommand_1.StartImageScanCommand, - StartLifecyclePolicyPreviewCommand: StartLifecyclePolicyPreviewCommand_1.StartLifecyclePolicyPreviewCommand, - TagResourceCommand: TagResourceCommand_1.TagResourceCommand, - UntagResourceCommand: UntagResourceCommand_1.UntagResourceCommand, - UploadLayerPartCommand: UploadLayerPartCommand_1.UploadLayerPartCommand, +exports.resolveRuntimeExtensions = void 0; +const region_config_resolver_1 = __nccwpck_require__(18156); +const protocol_http_1 = __nccwpck_require__(54483); +const smithy_client_1 = __nccwpck_require__(63570); +const asPartial = (t) => t; +const resolveRuntimeExtensions = (runtimeConfig, extensions) => { + const extensionConfiguration = { + ...asPartial((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, smithy_client_1.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig)), + }; + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return { + ...runtimeConfig, + ...(0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), + ...(0, smithy_client_1.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), + }; }; -class ECR extends ECRClient_1.ECRClient { -} -exports.ECR = ECR; -(0, smithy_client_1.createAggregatedClient)(commands, ECR); +exports.resolveRuntimeExtensions = resolveRuntimeExtensions; /***/ }), -/***/ 83391: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 72242: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ECRClient = exports.__Client = void 0; -const config_resolver_1 = __nccwpck_require__(56153); -const middleware_content_length_1 = __nccwpck_require__(42245); -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_host_header_1 = __nccwpck_require__(22545); -const middleware_logger_1 = __nccwpck_require__(20014); -const middleware_recursion_detection_1 = __nccwpck_require__(85525); -const middleware_retry_1 = __nccwpck_require__(96064); -const middleware_signing_1 = __nccwpck_require__(14935); -const middleware_user_agent_1 = __nccwpck_require__(64688); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } })); -const EndpointParameters_1 = __nccwpck_require__(49729); -const runtimeConfig_1 = __nccwpck_require__(869); -class ECRClient extends smithy_client_1.Client { - constructor(configuration) { - const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration); - const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); - const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1); - const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2); - const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3); - const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, middleware_signing_1.resolveAwsAuthConfig)(_config_5); - const _config_7 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_6); - super(_config_7); - this.config = _config_7; - this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); - this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); - this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); - this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); - this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); - this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(this.config)); - this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); - } - destroy() { - super.destroy(); +exports.NODEJS_TIMEOUT_ERROR_CODES = void 0; +exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + + +/***/ }), + +/***/ 36170: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getTransformedHeaders = void 0; +const getTransformedHeaders = (headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; } -} -exports.ECRClient = ECRClient; + return transformedHeaders; +}; +exports.getTransformedHeaders = getTransformedHeaders; /***/ }), -/***/ 63804: +/***/ 47435: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.BatchCheckLayerAvailabilityCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class BatchCheckLayerAvailabilityCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, BatchCheckLayerAvailabilityCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "BatchCheckLayerAvailabilityCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_BatchCheckLayerAvailabilityCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_BatchCheckLayerAvailabilityCommand)(output, context); - } -} -exports.BatchCheckLayerAvailabilityCommand = BatchCheckLayerAvailabilityCommand; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(62111), exports); +tslib_1.__exportStar(__nccwpck_require__(4349), exports); +tslib_1.__exportStar(__nccwpck_require__(16006), exports); /***/ }), -/***/ 15511: +/***/ 62111: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.BatchDeleteImageCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class BatchDeleteImageCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { +exports.NodeHttpHandler = exports.DEFAULT_REQUEST_TIMEOUT = void 0; +const protocol_http_1 = __nccwpck_require__(54483); +const querystring_builder_1 = __nccwpck_require__(78512); +const http_1 = __nccwpck_require__(13685); +const https_1 = __nccwpck_require__(95687); +const constants_1 = __nccwpck_require__(72242); +const get_transformed_headers_1 = __nccwpck_require__(36170); +const set_connection_timeout_1 = __nccwpck_require__(24246); +const set_socket_keep_alive_1 = __nccwpck_require__(93651); +const set_socket_timeout_1 = __nccwpck_require__(83099); +const write_request_body_1 = __nccwpck_require__(53122); +exports.DEFAULT_REQUEST_TIMEOUT = 0; +class NodeHttpHandler { + constructor(options) { + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }) + .catch(reject); + } + else { + resolve(this.resolveDefaultConfig(options)); + } + }); + } + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + connectionTimeout, + requestTimeout: requestTimeout !== null && requestTimeout !== void 0 ? requestTimeout : socketTimeout, + httpAgent: httpAgent || new http_1.Agent({ keepAlive, maxSockets }), + httpsAgent: httpsAgent || new https_1.Agent({ keepAlive, maxSockets }), }; } - constructor(input) { - super(); - this.input = input; + destroy() { + var _a, _b, _c, _d; + (_b = (_a = this.config) === null || _a === void 0 ? void 0 : _a.httpAgent) === null || _b === void 0 ? void 0 : _b.destroy(); + (_d = (_c = this.config) === null || _c === void 0 ? void 0 : _c.httpsAgent) === null || _d === void 0 ? void 0 : _d.destroy(); } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, BatchDeleteImageCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "BatchDeleteImageCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + return new Promise((_resolve, _reject) => { + var _a, _b; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const queryString = (0, querystring_builder_1.buildQueryString)(request.query || {}); + let auth = undefined; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}`; + } + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const nodeHttpsOptions = { + headers: request.headers, + host: request.hostname, + method: request.method, + path, + port: request.port, + agent: isSSL ? this.config.httpsAgent : this.config.httpAgent, + auth, + }; + const requestFunc = isSSL ? https_1.request : http_1.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(res.headers), + body: res, + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } + else { + reject(err); + } + }); + (0, set_connection_timeout_1.setConnectionTimeout)(req, reject, this.config.connectionTimeout); + (0, set_socket_timeout_1.setSocketTimeout)(req, reject, this.config.requestTimeout); + if (abortSignal) { + abortSignal.onabort = () => { + req.abort(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }; + } + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + (0, set_socket_keep_alive_1.setSocketKeepAlive)(req, { + keepAlive: httpAgent.keepAlive, + keepAliveMsecs: httpAgent.keepAliveMsecs, + }); + } + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, this.config.requestTimeout).catch(_reject); + }); } - serialize(input, context) { - return (0, Aws_json1_1_1.se_BatchDeleteImageCommand)(input, context); + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_BatchDeleteImageCommand)(output, context); + httpHandlerConfigs() { + var _a; + return (_a = this.config) !== null && _a !== void 0 ? _a : {}; } } -exports.BatchDeleteImageCommand = BatchDeleteImageCommand; +exports.NodeHttpHandler = NodeHttpHandler; /***/ }), -/***/ 78859: +/***/ 39904: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.BatchGetImageCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class BatchGetImageCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, +exports.NodeHttp2ConnectionManager = void 0; +const tslib_1 = __nccwpck_require__(4351); +const http2_1 = tslib_1.__importDefault(__nccwpck_require__(85158)); +const node_http2_connection_pool_1 = __nccwpck_require__(22893); +class NodeHttp2ConnectionManager { + constructor(config) { + this.sessionCache = new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); + } + } + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; + } + } + const session = http2_1.default.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error("Fail to set maxConcurrentStreams to " + + this.config.maxConcurrency + + "when creating new session for " + + requestContext.destination.toString()); + } + }); + } + session.unref(); + const destroySessionCb = () => { + session.destroy(); + this.deleteSession(url, session); }; + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new node_http2_connection_pool_1.NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; } - constructor(input) { - super(); - this.input = input; + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; + } + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, BatchGetImageCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "BatchGetImageCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + release(requestContext, session) { + var _a; + const cacheKey = this.getUrlString(requestContext); + (_a = this.sessionCache.get(cacheKey)) === null || _a === void 0 ? void 0 : _a.offerLast(session); } - serialize(input, context) { - return (0, Aws_json1_1_1.se_BatchGetImageCommand)(input, context); + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); + } + this.sessionCache.delete(key); + } } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_BatchGetImageCommand)(output, context); + setMaxConcurrentStreams(maxConcurrentStreams) { + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); + } + this.config.maxConcurrency = maxConcurrentStreams; + } + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; + } + getUrlString(request) { + return request.destination.toString(); } } -exports.BatchGetImageCommand = BatchGetImageCommand; +exports.NodeHttp2ConnectionManager = NodeHttp2ConnectionManager; /***/ }), -/***/ 79728: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 22893: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.BatchGetRepositoryScanningConfigurationCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class BatchGetRepositoryScanningConfigurationCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; +exports.NodeHttp2ConnectionPool = void 0; +class NodeHttp2ConnectionPool { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions !== null && sessions !== void 0 ? sessions : []; } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, BatchGetRepositoryScanningConfigurationCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "BatchGetRepositoryScanningConfigurationCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); + } } - serialize(input, context) { - return (0, Aws_json1_1_1.se_BatchGetRepositoryScanningConfigurationCommand)(input, context); + offerLast(session) { + this.sessions.push(session); } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_BatchGetRepositoryScanningConfigurationCommand)(output, context); + contains(session) { + return this.sessions.includes(session); + } + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); + } + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); + } + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } + } + } } } -exports.BatchGetRepositoryScanningConfigurationCommand = BatchGetRepositoryScanningConfigurationCommand; +exports.NodeHttp2ConnectionPool = NodeHttp2ConnectionPool; /***/ }), -/***/ 49003: +/***/ 4349: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.CompleteLayerUploadCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class CompleteLayerUploadCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; +exports.NodeHttp2Handler = void 0; +const protocol_http_1 = __nccwpck_require__(54483); +const querystring_builder_1 = __nccwpck_require__(78512); +const http2_1 = __nccwpck_require__(85158); +const get_transformed_headers_1 = __nccwpck_require__(36170); +const node_http2_connection_manager_1 = __nccwpck_require__(39904); +const write_request_body_1 = __nccwpck_require__(53122); +class NodeHttp2Handler { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new node_http2_connection_manager_1.NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((opts) => { + resolve(opts || {}); + }) + .catch(reject); + } + else { + resolve(options || {}); + } + }); } - constructor(input) { - super(); - this.input = input; + destroy() { + this.connectionManager.destroy(); } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, CompleteLayerUploadCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "CompleteLayerUploadCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } + } + const { requestTimeout, disableConcurrentStreams } = this.config; + return new Promise((_resolve, _reject) => { + var _a, _b, _c; + let fulfilled = false; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request; + let auth = ""; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: (_c = this.config) === null || _c === void 0 ? void 0 : _c.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false, + }); + const rejectWithDestroy = (err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + reject(err); + }; + const queryString = (0, querystring_builder_1.buildQueryString)(query || {}); + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const req = session.request({ + ...request.headers, + [http2_1.constants.HTTP2_HEADER_PATH]: path, + [http2_1.constants.HTTP2_HEADER_METHOD]: method, + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(headers), + body: req, + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (requestTimeout) { + req.setTimeout(requestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + abortSignal.onabort = () => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }; + } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy(new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`)); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, requestTimeout); + }); } - serialize(input, context) { - return (0, Aws_json1_1_1.se_CompleteLayerUploadCommand)(input, context); + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_CompleteLayerUploadCommand)(output, context); + httpHandlerConfigs() { + var _a; + return (_a = this.config) !== null && _a !== void 0 ? _a : {}; + } + destroySession(session) { + if (!session.destroyed) { + session.destroy(); + } } } -exports.CompleteLayerUploadCommand = CompleteLayerUploadCommand; +exports.NodeHttp2Handler = NodeHttp2Handler; /***/ }), -/***/ 71454: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 24246: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.CreatePullThroughCacheRuleCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class CreatePullThroughCacheRuleCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, CreatePullThroughCacheRuleCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "CreatePullThroughCacheRuleCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_CreatePullThroughCacheRuleCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_CreatePullThroughCacheRuleCommand)(output, context); +exports.setConnectionTimeout = void 0; +const setConnectionTimeout = (request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return; } -} -exports.CreatePullThroughCacheRuleCommand = CreatePullThroughCacheRuleCommand; + const timeoutId = setTimeout(() => { + request.destroy(); + reject(Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError", + })); + }, timeoutInMs); + request.on("socket", (socket) => { + if (socket.connecting) { + socket.on("connect", () => { + clearTimeout(timeoutId); + }); + } + else { + clearTimeout(timeoutId); + } + }); +}; +exports.setConnectionTimeout = setConnectionTimeout; /***/ }), -/***/ 5074: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 93651: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.CreateRepositoryCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class CreateRepositoryCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, CreateRepositoryCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "CreateRepositoryCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_CreateRepositoryCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_CreateRepositoryCommand)(output, context); +exports.setSocketKeepAlive = void 0; +const setSocketKeepAlive = (request, { keepAlive, keepAliveMsecs }) => { + if (keepAlive !== true) { + return; } -} -exports.CreateRepositoryCommand = CreateRepositoryCommand; + request.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); +}; +exports.setSocketKeepAlive = setSocketKeepAlive; /***/ }), -/***/ 48981: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 83099: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DeleteLifecyclePolicyCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class DeleteLifecyclePolicyCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DeleteLifecyclePolicyCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "DeleteLifecyclePolicyCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_DeleteLifecyclePolicyCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_DeleteLifecyclePolicyCommand)(output, context); - } -} -exports.DeleteLifecyclePolicyCommand = DeleteLifecyclePolicyCommand; +exports.setSocketTimeout = void 0; +const setSocketTimeout = (request, reject, timeoutInMs = 0) => { + request.setTimeout(timeoutInMs, () => { + request.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }); +}; +exports.setSocketTimeout = setSocketTimeout; /***/ }), -/***/ 83793: +/***/ 52170: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DeletePullThroughCacheRuleCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class DeletePullThroughCacheRuleCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DeletePullThroughCacheRuleCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "DeletePullThroughCacheRuleCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_DeletePullThroughCacheRuleCommand)(input, context); +exports.Collector = void 0; +const stream_1 = __nccwpck_require__(12781); +class Collector extends stream_1.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_DeletePullThroughCacheRuleCommand)(output, context); + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); } } -exports.DeletePullThroughCacheRuleCommand = DeletePullThroughCacheRuleCommand; +exports.Collector = Collector; /***/ }), -/***/ 31424: +/***/ 16006: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DeleteRegistryPolicyCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class DeleteRegistryPolicyCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DeleteRegistryPolicyCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "DeleteRegistryPolicyCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_DeleteRegistryPolicyCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_DeleteRegistryPolicyCommand)(output, context); - } -} -exports.DeleteRegistryPolicyCommand = DeleteRegistryPolicyCommand; +exports.streamCollector = void 0; +const collector_1 = __nccwpck_require__(52170); +const streamCollector = (stream) => new Promise((resolve, reject) => { + const collector = new collector_1.Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function () { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); +}); +exports.streamCollector = streamCollector; /***/ }), -/***/ 88651: +/***/ 53122: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DeleteRepositoryCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class DeleteRepositoryCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DeleteRepositoryCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "DeleteRepositoryCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); +exports.writeRequestBody = void 0; +const stream_1 = __nccwpck_require__(12781); +const MIN_WAIT_TIME = 1000; +async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { + var _a; + const headers = (_a = request.headers) !== null && _a !== void 0 ? _a : {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let hasError = false; + if (expect === "100-continue") { + await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + clearTimeout(timeoutId); + resolve(); + }); + httpRequest.on("error", () => { + hasError = true; + clearTimeout(timeoutId); + resolve(); + }); + }), + ]); } - serialize(input, context) { - return (0, Aws_json1_1_1.se_DeleteRepositoryCommand)(input, context); + if (!hasError) { + writeBody(httpRequest, request.body); } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_DeleteRepositoryCommand)(output, context); +} +exports.writeRequestBody = writeRequestBody; +function writeBody(httpRequest, body) { + if (body instanceof stream_1.Readable) { + body.pipe(httpRequest); + } + else if (body) { + httpRequest.end(Buffer.from(body)); + } + else { + httpRequest.end(); } } -exports.DeleteRepositoryCommand = DeleteRepositoryCommand; /***/ }), -/***/ 36828: +/***/ 80856: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DeleteRepositoryPolicyCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class DeleteRepositoryPolicyCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; +exports.Field = void 0; +const types_1 = __nccwpck_require__(83399); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; } - constructor(input) { - super(); - this.input = input; + add(value) { + this.values.push(value); } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DeleteRepositoryPolicyCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "DeleteRepositoryPolicyCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + set(values) { + this.values = values; } - serialize(input, context) { - return (0, Aws_json1_1_1.se_DeleteRepositoryPolicyCommand)(input, context); + remove(value) { + this.values = this.values.filter((v) => v !== value); } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_DeleteRepositoryPolicyCommand)(output, context); + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; } } -exports.DeleteRepositoryPolicyCommand = DeleteRepositoryPolicyCommand; +exports.Field = Field; /***/ }), -/***/ 39694: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 74313: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DescribeImageReplicationStatusCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class DescribeImageReplicationStatusCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; } - constructor(input) { - super(); - this.input = input; + setField(field) { + this.entries[field.name.toLowerCase()] = field; } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DescribeImageReplicationStatusCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "DescribeImageReplicationStatusCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + getField(name) { + return this.entries[name.toLowerCase()]; } - serialize(input, context) { - return (0, Aws_json1_1_1.se_DescribeImageReplicationStatusCommand)(input, context); + removeField(name) { + delete this.entries[name.toLowerCase()]; } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_DescribeImageReplicationStatusCommand)(output, context); + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); } } -exports.DescribeImageReplicationStatusCommand = DescribeImageReplicationStatusCommand; +exports.Fields = Fields; /***/ }), -/***/ 72987: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 53792: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DescribeImageScanFindingsCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class DescribeImageScanFindingsCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DescribeImageScanFindingsCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "DescribeImageScanFindingsCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_DescribeImageScanFindingsCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_DescribeImageScanFindingsCommand)(output, context); - } -} -exports.DescribeImageScanFindingsCommand = DescribeImageScanFindingsCommand; +exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0; +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; + return { + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + }, + }; +}; +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), + }; +}; +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; /***/ }), -/***/ 95353: +/***/ 6564: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DescribeImagesCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class DescribeImagesCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DescribeImagesCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "DescribeImagesCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_DescribeImagesCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_DescribeImagesCommand)(output, context); - } -} -exports.DescribeImagesCommand = DescribeImagesCommand; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(53792), exports); /***/ }), -/***/ 31484: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 84691: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DescribePullThroughCacheRulesCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class DescribePullThroughCacheRulesCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DescribePullThroughCacheRulesCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "DescribePullThroughCacheRulesCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_DescribePullThroughCacheRulesCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_DescribePullThroughCacheRulesCommand)(output, context); - } -} -exports.DescribePullThroughCacheRulesCommand = DescribePullThroughCacheRulesCommand; /***/ }), -/***/ 26166: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 61458: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DescribeRegistryCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class DescribeRegistryCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DescribeRegistryCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "DescribeRegistryCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; } - serialize(input, context) { - return (0, Aws_json1_1_1.se_DescribeRegistryCommand)(input, context); + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_DescribeRegistryCommand)(output, context); + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; } } -exports.DescribeRegistryCommand = DescribeRegistryCommand; +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} /***/ }), -/***/ 21200: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 79030: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DescribeRepositoriesCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class DescribeRepositoriesCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DescribeRepositoriesCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "DescribeRepositoriesCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_DescribeRepositoriesCommand)(input, context); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_DescribeRepositoriesCommand)(output, context); + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; } } -exports.DescribeRepositoriesCommand = DescribeRepositoriesCommand; +exports.HttpResponse = HttpResponse; /***/ }), -/***/ 35828: +/***/ 54483: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetAuthorizationTokenCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class GetAuthorizationTokenCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetAuthorizationTokenCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "GetAuthorizationTokenCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_GetAuthorizationTokenCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_GetAuthorizationTokenCommand)(output, context); - } +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(6564), exports); +tslib_1.__exportStar(__nccwpck_require__(80856), exports); +tslib_1.__exportStar(__nccwpck_require__(74313), exports); +tslib_1.__exportStar(__nccwpck_require__(84691), exports); +tslib_1.__exportStar(__nccwpck_require__(61458), exports); +tslib_1.__exportStar(__nccwpck_require__(79030), exports); +tslib_1.__exportStar(__nccwpck_require__(57703), exports); +tslib_1.__exportStar(__nccwpck_require__(24021), exports); + + +/***/ }), + +/***/ 57703: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); } -exports.GetAuthorizationTokenCommand = GetAuthorizationTokenCommand; +exports.isValidHostname = isValidHostname; /***/ }), -/***/ 51401: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 24021: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetDownloadUrlForLayerCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class GetDownloadUrlForLayerCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetDownloadUrlForLayerCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "GetDownloadUrlForLayerCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_GetDownloadUrlForLayerCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_GetDownloadUrlForLayerCommand)(output, context); - } -} -exports.GetDownloadUrlForLayerCommand = GetDownloadUrlForLayerCommand; /***/ }), -/***/ 48469: +/***/ 78512: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetLifecyclePolicyCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class GetLifecyclePolicyCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetLifecyclePolicyCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "GetLifecyclePolicyCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_GetLifecyclePolicyCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_GetLifecyclePolicyCommand)(output, context); +exports.buildQueryString = void 0; +const util_uri_escape_1 = __nccwpck_require__(56236); +function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, util_uri_escape_1.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, util_uri_escape_1.escapeUri)(value[i])}`); + } + } + else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, util_uri_escape_1.escapeUri)(value)}`; + } + parts.push(qsEntry); + } } + return parts.join("&"); } -exports.GetLifecyclePolicyCommand = GetLifecyclePolicyCommand; +exports.buildQueryString = buildQueryString; /***/ }), -/***/ 17006: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 83500: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetLifecyclePolicyPreviewCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class GetLifecyclePolicyPreviewCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetLifecyclePolicyPreviewCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "GetLifecyclePolicyPreviewCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_GetLifecyclePolicyPreviewCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_GetLifecyclePolicyPreviewCommand)(output, context); - } -} -exports.GetLifecyclePolicyPreviewCommand = GetLifecyclePolicyPreviewCommand; /***/ }), -/***/ 33685: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 24439: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetRegistryPolicyCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class GetRegistryPolicyCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetRegistryPolicyCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "GetRegistryPolicyCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_GetRegistryPolicyCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_GetRegistryPolicyCommand)(output, context); - } -} -exports.GetRegistryPolicyCommand = GetRegistryPolicyCommand; +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); /***/ }), -/***/ 82741: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 91415: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetRegistryScanningConfigurationCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class GetRegistryScanningConfigurationCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetRegistryScanningConfigurationCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "GetRegistryScanningConfigurationCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_GetRegistryScanningConfigurationCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_GetRegistryScanningConfigurationCommand)(output, context); - } -} -exports.GetRegistryScanningConfigurationCommand = GetRegistryScanningConfigurationCommand; /***/ }), -/***/ 46330: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 32089: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetRepositoryPolicyCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class GetRepositoryPolicyCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetRepositoryPolicyCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "GetRepositoryPolicyCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_GetRepositoryPolicyCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_GetRepositoryPolicyCommand)(output, context); - } -} -exports.GetRepositoryPolicyCommand = GetRepositoryPolicyCommand; /***/ }), -/***/ 6936: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 28518: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.InitiateLayerUploadCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class InitiateLayerUploadCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, InitiateLayerUploadCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "InitiateLayerUploadCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_InitiateLayerUploadCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_InitiateLayerUploadCommand)(output, context); - } -} -exports.InitiateLayerUploadCommand = InitiateLayerUploadCommand; /***/ }), -/***/ 3854: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 91859: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ListImagesCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class ListImagesCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, ListImagesCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "ListImagesCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_ListImagesCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_ListImagesCommand)(output, context); - } -} -exports.ListImagesCommand = ListImagesCommand; /***/ }), -/***/ 97403: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 36815: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ListTagsForResourceCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class ListTagsForResourceCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, ListTagsForResourceCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "ListTagsForResourceCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_ListTagsForResourceCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_ListTagsForResourceCommand)(output, context); - } -} -exports.ListTagsForResourceCommand = ListTagsForResourceCommand; /***/ }), -/***/ 66844: +/***/ 3549: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.PutImageCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class PutImageCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutImageCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "PutImageCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_PutImageCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_PutImageCommand)(output, context); - } -} -exports.PutImageCommand = PutImageCommand; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(36815), exports); +tslib_1.__exportStar(__nccwpck_require__(21211), exports); +tslib_1.__exportStar(__nccwpck_require__(11375), exports); /***/ }), -/***/ 87935: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 21211: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.PutImageScanningConfigurationCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class PutImageScanningConfigurationCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutImageScanningConfigurationCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "PutImageScanningConfigurationCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_PutImageScanningConfigurationCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_PutImageScanningConfigurationCommand)(output, context); - } -} -exports.PutImageScanningConfigurationCommand = PutImageScanningConfigurationCommand; /***/ }), -/***/ 66495: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 11375: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.PutImageTagMutabilityCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class PutImageTagMutabilityCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutImageTagMutabilityCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "PutImageTagMutabilityCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_PutImageTagMutabilityCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_PutImageTagMutabilityCommand)(output, context); - } -} -exports.PutImageTagMutabilityCommand = PutImageTagMutabilityCommand; /***/ }), -/***/ 33854: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 53070: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.PutLifecyclePolicyCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class PutLifecyclePolicyCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutLifecyclePolicyCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "PutLifecyclePolicyCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_PutLifecyclePolicyCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_PutLifecyclePolicyCommand)(output, context); - } -} -exports.PutLifecyclePolicyCommand = PutLifecyclePolicyCommand; /***/ }), -/***/ 97928: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 32673: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.PutRegistryPolicyCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class PutRegistryPolicyCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutRegistryPolicyCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "PutRegistryPolicyCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_PutRegistryPolicyCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_PutRegistryPolicyCommand)(output, context); - } -} -exports.PutRegistryPolicyCommand = PutRegistryPolicyCommand; /***/ }), -/***/ 29529: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 43011: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.PutRegistryScanningConfigurationCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class PutRegistryScanningConfigurationCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutRegistryScanningConfigurationCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "PutRegistryScanningConfigurationCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_PutRegistryScanningConfigurationCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_PutRegistryScanningConfigurationCommand)(output, context); - } -} -exports.PutRegistryScanningConfigurationCommand = PutRegistryScanningConfigurationCommand; +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); /***/ }), -/***/ 14030: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 38203: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.PutReplicationConfigurationCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class PutReplicationConfigurationCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutReplicationConfigurationCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "PutReplicationConfigurationCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_PutReplicationConfigurationCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_PutReplicationConfigurationCommand)(output, context); - } -} -exports.PutReplicationConfigurationCommand = PutReplicationConfigurationCommand; /***/ }), -/***/ 78300: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 41929: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SetRepositoryPolicyCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class SetRepositoryPolicyCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, SetRepositoryPolicyCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "SetRepositoryPolicyCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_SetRepositoryPolicyCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_SetRepositoryPolicyCommand)(output, context); - } -} -exports.SetRepositoryPolicyCommand = SetRepositoryPolicyCommand; /***/ }), -/***/ 47984: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 69357: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.StartImageScanCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class StartImageScanCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, StartImageScanCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "StartImageScanCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_StartImageScanCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_StartImageScanCommand)(output, context); - } -} -exports.StartImageScanCommand = StartImageScanCommand; /***/ }), -/***/ 35905: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 14856: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.StartLifecyclePolicyPreviewCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class StartLifecyclePolicyPreviewCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, StartLifecyclePolicyPreviewCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "StartLifecyclePolicyPreviewCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_StartLifecyclePolicyPreviewCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_StartLifecyclePolicyPreviewCommand)(output, context); - } -} -exports.StartLifecyclePolicyPreviewCommand = StartLifecyclePolicyPreviewCommand; /***/ }), -/***/ 82665: +/***/ 1523: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.TagResourceCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class TagResourceCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, TagResourceCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "TagResourceCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_TagResourceCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_TagResourceCommand)(output, context); - } -} -exports.TagResourceCommand = TagResourceCommand; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(38203), exports); +tslib_1.__exportStar(__nccwpck_require__(41929), exports); +tslib_1.__exportStar(__nccwpck_require__(69357), exports); +tslib_1.__exportStar(__nccwpck_require__(22525), exports); +tslib_1.__exportStar(__nccwpck_require__(14856), exports); /***/ }), -/***/ 37225: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 22525: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.UntagResourceCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class UntagResourceCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, UntagResourceCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "UntagResourceCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_UntagResourceCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_UntagResourceCommand)(output, context); - } -} -exports.UntagResourceCommand = UntagResourceCommand; /***/ }), -/***/ 55825: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 24878: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.UploadLayerPartCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_json1_1_1 = __nccwpck_require__(56704); -class UploadLayerPartCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, UploadLayerPartCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "ECRClient"; - const commandName = "UploadLayerPartCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_json1_1_1.se_UploadLayerPartCommand)(input, context); + + +/***/ }), + +/***/ 20575: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); } - deserialize(output, context) { - return (0, Aws_json1_1_1.de_UploadLayerPartCommand)(output, context); + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); } -} -exports.UploadLayerPartCommand = UploadLayerPartCommand; + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; +}; +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; /***/ }), -/***/ 67407: +/***/ 34702: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(63804), exports); -tslib_1.__exportStar(__nccwpck_require__(15511), exports); -tslib_1.__exportStar(__nccwpck_require__(78859), exports); -tslib_1.__exportStar(__nccwpck_require__(79728), exports); -tslib_1.__exportStar(__nccwpck_require__(49003), exports); -tslib_1.__exportStar(__nccwpck_require__(71454), exports); -tslib_1.__exportStar(__nccwpck_require__(5074), exports); -tslib_1.__exportStar(__nccwpck_require__(48981), exports); -tslib_1.__exportStar(__nccwpck_require__(83793), exports); -tslib_1.__exportStar(__nccwpck_require__(31424), exports); -tslib_1.__exportStar(__nccwpck_require__(88651), exports); -tslib_1.__exportStar(__nccwpck_require__(36828), exports); -tslib_1.__exportStar(__nccwpck_require__(39694), exports); -tslib_1.__exportStar(__nccwpck_require__(72987), exports); -tslib_1.__exportStar(__nccwpck_require__(95353), exports); -tslib_1.__exportStar(__nccwpck_require__(31484), exports); -tslib_1.__exportStar(__nccwpck_require__(26166), exports); -tslib_1.__exportStar(__nccwpck_require__(21200), exports); -tslib_1.__exportStar(__nccwpck_require__(35828), exports); -tslib_1.__exportStar(__nccwpck_require__(51401), exports); -tslib_1.__exportStar(__nccwpck_require__(48469), exports); -tslib_1.__exportStar(__nccwpck_require__(17006), exports); -tslib_1.__exportStar(__nccwpck_require__(33685), exports); -tslib_1.__exportStar(__nccwpck_require__(82741), exports); -tslib_1.__exportStar(__nccwpck_require__(46330), exports); -tslib_1.__exportStar(__nccwpck_require__(6936), exports); -tslib_1.__exportStar(__nccwpck_require__(3854), exports); -tslib_1.__exportStar(__nccwpck_require__(97403), exports); -tslib_1.__exportStar(__nccwpck_require__(66844), exports); -tslib_1.__exportStar(__nccwpck_require__(87935), exports); -tslib_1.__exportStar(__nccwpck_require__(66495), exports); -tslib_1.__exportStar(__nccwpck_require__(33854), exports); -tslib_1.__exportStar(__nccwpck_require__(97928), exports); -tslib_1.__exportStar(__nccwpck_require__(29529), exports); -tslib_1.__exportStar(__nccwpck_require__(14030), exports); -tslib_1.__exportStar(__nccwpck_require__(78300), exports); -tslib_1.__exportStar(__nccwpck_require__(47984), exports); -tslib_1.__exportStar(__nccwpck_require__(35905), exports); -tslib_1.__exportStar(__nccwpck_require__(82665), exports); -tslib_1.__exportStar(__nccwpck_require__(37225), exports); -tslib_1.__exportStar(__nccwpck_require__(55825), exports); +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(20575); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + }; +}; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; +}; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; /***/ }), -/***/ 49729: +/***/ 22226: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveClientEndpointParameters = void 0; -const resolveClientEndpointParameters = (options) => { - return { - ...options, - useDualstackEndpoint: options.useDualstackEndpoint ?? false, - useFipsEndpoint: options.useFipsEndpoint ?? false, - defaultSigningName: "ecr", - }; -}; -exports.resolveClientEndpointParameters = resolveClientEndpointParameters; /***/ }), -/***/ 61610: +/***/ 14985: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultEndpointResolver = void 0; -const util_endpoints_1 = __nccwpck_require__(13350); -const ruleset_1 = __nccwpck_require__(64053); -const defaultEndpointResolver = (endpointParams, context = {}) => { - return (0, util_endpoints_1.resolveEndpoint)(ruleset_1.ruleSet, { - endpointParams: endpointParams, - logger: context.logger, - }); -}; -exports.defaultEndpointResolver = defaultEndpointResolver; +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(34702), exports); +tslib_1.__exportStar(__nccwpck_require__(22226), exports); +var checksum_1 = __nccwpck_require__(20575); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); /***/ }), -/***/ 64053: +/***/ 99312: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ruleSet = void 0; -const t = "required", u = "fn", v = "argv", w = "ref"; -const a = "PartitionResult", b = "tree", c = "error", d = "endpoint", e = "stringEquals", f = { [t]: false, "type": "String" }, g = { [t]: true, "default": false, "type": "Boolean" }, h = { [w]: "Region" }, i = { [w]: "Endpoint" }, j = { [u]: "booleanEquals", [v]: [{ [w]: "UseFIPS" }, true] }, k = { [u]: "booleanEquals", [v]: [{ [w]: "UseDualStack" }, true] }, l = {}, m = { [u]: "booleanEquals", [v]: [true, { [u]: "getAttr", [v]: [{ [w]: a }, "supportsFIPS"] }] }, n = { [u]: "booleanEquals", [v]: [true, { [u]: "getAttr", [v]: [{ [w]: a }, "supportsDualStack"] }] }, o = { [u]: "getAttr", [v]: [{ [w]: a }, "name"] }, p = { "url": "https://ecr-fips.{Region}.{PartitionResult#dnsSuffix}", "properties": {}, "headers": {} }, q = [i], r = [j], s = [k]; -const _data = { version: "1.0", parameters: { Region: f, UseDualStack: g, UseFIPS: g, Endpoint: f }, rules: [{ conditions: [{ [u]: "aws.partition", [v]: [h], assign: a }], type: b, rules: [{ conditions: [{ [u]: "isSet", [v]: q }, { [u]: "parseURL", [v]: q, assign: "url" }], type: b, rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: c }, { type: b, rules: [{ conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: c }, { endpoint: { url: i, properties: l, headers: l }, type: d }] }] }, { conditions: [j, k], type: b, rules: [{ conditions: [m, n], type: b, rules: [{ endpoint: { url: "https://api.ecr-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: l, headers: l }, type: d }] }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: c }] }, { conditions: r, type: b, rules: [{ conditions: [m], type: b, rules: [{ type: b, rules: [{ conditions: [{ [u]: e, [v]: [h, "dkr-us-east-2"] }], endpoint: { url: "https://ecr-fips.us-east-2.amazonaws.com", properties: l, headers: l }, type: d }, { conditions: [{ [u]: e, [v]: [h, "dkr-us-east-1"] }], endpoint: { url: "https://ecr-fips.us-east-1.amazonaws.com", properties: l, headers: l }, type: d }, { conditions: [{ [u]: e, [v]: [h, "dkr-us-west-2"] }], endpoint: { url: "https://ecr-fips.us-west-2.amazonaws.com", properties: l, headers: l }, type: d }, { conditions: [{ [u]: e, [v]: [h, "dkr-us-west-1"] }], endpoint: { url: "https://ecr-fips.us-west-1.amazonaws.com", properties: l, headers: l }, type: d }, { conditions: [{ [u]: e, [v]: ["aws", o] }], endpoint: p, type: d }, { conditions: [{ [u]: e, [v]: [h, "dkr-us-gov-east-1"] }], endpoint: { url: "https://ecr-fips.us-gov-east-1.amazonaws.com", properties: l, headers: l }, type: d }, { conditions: [{ [u]: e, [v]: [h, "dkr-us-gov-west-1"] }], endpoint: { url: "https://ecr-fips.us-gov-west-1.amazonaws.com", properties: l, headers: l }, type: d }, { conditions: [{ [u]: e, [v]: ["aws-us-gov", o] }], endpoint: p, type: d }, { endpoint: { url: "https://api.ecr-fips.{Region}.{PartitionResult#dnsSuffix}", properties: l, headers: l }, type: d }] }] }, { error: "FIPS is enabled but this partition does not support FIPS", type: c }] }, { conditions: s, type: b, rules: [{ conditions: [n], type: b, rules: [{ endpoint: { url: "https://api.ecr.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: l, headers: l }, type: d }] }, { error: "DualStack is enabled but this partition does not support DualStack", type: c }] }, { endpoint: { url: "https://api.ecr.{Region}.{PartitionResult#dnsSuffix}", properties: l, headers: l }, type: d }] }] }; -exports.ruleSet = _data; +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); /***/ }), -/***/ 8923: +/***/ 71090: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 54783: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 11131: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ECRServiceException = void 0; const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(83391), exports); -tslib_1.__exportStar(__nccwpck_require__(59167), exports); -tslib_1.__exportStar(__nccwpck_require__(67407), exports); -tslib_1.__exportStar(__nccwpck_require__(35356), exports); -tslib_1.__exportStar(__nccwpck_require__(28406), exports); -tslib_1.__exportStar(__nccwpck_require__(57451), exports); -var ECRServiceException_1 = __nccwpck_require__(11610); -Object.defineProperty(exports, "ECRServiceException", ({ enumerable: true, get: function () { return ECRServiceException_1.ECRServiceException; } })); +tslib_1.__exportStar(__nccwpck_require__(71090), exports); +tslib_1.__exportStar(__nccwpck_require__(54783), exports); /***/ }), -/***/ 11610: +/***/ 83399: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ECRServiceException = exports.__ServiceException = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "__ServiceException", ({ enumerable: true, get: function () { return smithy_client_1.ServiceException; } })); -class ECRServiceException extends smithy_client_1.ServiceException { - constructor(options) { - super(options); - Object.setPrototypeOf(this, ECRServiceException.prototype); - } -} -exports.ECRServiceException = ECRServiceException; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(83500), exports); +tslib_1.__exportStar(__nccwpck_require__(24439), exports); +tslib_1.__exportStar(__nccwpck_require__(91415), exports); +tslib_1.__exportStar(__nccwpck_require__(32089), exports); +tslib_1.__exportStar(__nccwpck_require__(28518), exports); +tslib_1.__exportStar(__nccwpck_require__(91859), exports); +tslib_1.__exportStar(__nccwpck_require__(3549), exports); +tslib_1.__exportStar(__nccwpck_require__(53070), exports); +tslib_1.__exportStar(__nccwpck_require__(32673), exports); +tslib_1.__exportStar(__nccwpck_require__(43011), exports); +tslib_1.__exportStar(__nccwpck_require__(1523), exports); +tslib_1.__exportStar(__nccwpck_require__(24878), exports); +tslib_1.__exportStar(__nccwpck_require__(14985), exports); +tslib_1.__exportStar(__nccwpck_require__(99312), exports); +tslib_1.__exportStar(__nccwpck_require__(11131), exports); +tslib_1.__exportStar(__nccwpck_require__(50499), exports); +tslib_1.__exportStar(__nccwpck_require__(55118), exports); +tslib_1.__exportStar(__nccwpck_require__(43862), exports); +tslib_1.__exportStar(__nccwpck_require__(28350), exports); +tslib_1.__exportStar(__nccwpck_require__(24610), exports); +tslib_1.__exportStar(__nccwpck_require__(3920), exports); +tslib_1.__exportStar(__nccwpck_require__(63818), exports); +tslib_1.__exportStar(__nccwpck_require__(30132), exports); +tslib_1.__exportStar(__nccwpck_require__(56137), exports); +tslib_1.__exportStar(__nccwpck_require__(21487), exports); +tslib_1.__exportStar(__nccwpck_require__(808), exports); +tslib_1.__exportStar(__nccwpck_require__(77261), exports); +tslib_1.__exportStar(__nccwpck_require__(61266), exports); +tslib_1.__exportStar(__nccwpck_require__(46210), exports); +tslib_1.__exportStar(__nccwpck_require__(32451), exports); +tslib_1.__exportStar(__nccwpck_require__(58183), exports); +tslib_1.__exportStar(__nccwpck_require__(492), exports); +tslib_1.__exportStar(__nccwpck_require__(53534), exports); +tslib_1.__exportStar(__nccwpck_require__(18413), exports); + + +/***/ }), + +/***/ 50499: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 57451: +/***/ 55118: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; + + +/***/ }), + +/***/ 43862: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 28350: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 24610: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 3920: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 63818: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 30132: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 56137: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 21487: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 808: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 77261: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 61266: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 46210: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); + + +/***/ }), + +/***/ 32451: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 58183: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 492: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 53534: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 18413: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 89770: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.escapeUriPath = void 0; +const escape_uri_1 = __nccwpck_require__(79683); +const escapeUriPath = (uri) => uri.split("/").map(escape_uri_1.escapeUri).join("/"); +exports.escapeUriPath = escapeUriPath; + + +/***/ }), + +/***/ 79683: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.escapeUri = void 0; +const escapeUri = (uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode); +exports.escapeUri = escapeUri; +const hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`; + + +/***/ }), + +/***/ 56236: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(79088), exports); +tslib_1.__exportStar(__nccwpck_require__(79683), exports); +tslib_1.__exportStar(__nccwpck_require__(89770), exports); /***/ }), -/***/ 79088: +/***/ 59167: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.InvalidLayerPartException = exports.LifecyclePolicyPreviewInProgressException = exports.UnsupportedImageTypeException = exports.ReferencedImagesNotFoundException = exports.ImageTagAlreadyExistsException = exports.ImageDigestDoesNotMatchException = exports.ImageAlreadyExistsException = exports.ScanType = exports.LifecyclePolicyPreviewNotFoundException = exports.LifecyclePolicyPreviewStatus = exports.ImageActionType = exports.LayersNotFoundException = exports.LayerInaccessibleException = exports.RepositoryFilterType = exports.ScanNotFoundException = exports.ScanStatus = exports.FindingSeverity = exports.TagStatus = exports.ImageNotFoundException = exports.ReplicationStatus = exports.RepositoryPolicyNotFoundException = exports.RepositoryNotEmptyException = exports.RegistryPolicyNotFoundException = exports.PullThroughCacheRuleNotFoundException = exports.LifecyclePolicyNotFoundException = exports.TooManyTagsException = exports.RepositoryAlreadyExistsException = exports.InvalidTagParameterException = exports.ImageTagMutability = exports.EncryptionType = exports.UnsupportedUpstreamRegistryException = exports.PullThroughCacheRuleAlreadyExistsException = exports.LimitExceededException = exports.UploadNotFoundException = exports.LayerPartTooSmallException = exports.LayerAlreadyExistsException = exports.KmsException = exports.InvalidLayerException = exports.EmptyUploadException = exports.ValidationException = exports.ScanFrequency = exports.ScanningRepositoryFilterType = exports.ScanningConfigurationFailureCode = exports.ImageFailureCode = exports.ServerException = exports.RepositoryNotFoundException = exports.InvalidParameterException = exports.LayerAvailability = exports.LayerFailureCode = void 0; -const ECRServiceException_1 = __nccwpck_require__(11610); -exports.LayerFailureCode = { - InvalidLayerDigest: "InvalidLayerDigest", - MissingLayerDigest: "MissingLayerDigest", -}; -exports.LayerAvailability = { - AVAILABLE: "AVAILABLE", - UNAVAILABLE: "UNAVAILABLE", +exports.ECR = void 0; +const smithy_client_1 = __nccwpck_require__(63570); +const BatchCheckLayerAvailabilityCommand_1 = __nccwpck_require__(63804); +const BatchDeleteImageCommand_1 = __nccwpck_require__(15511); +const BatchGetImageCommand_1 = __nccwpck_require__(78859); +const BatchGetRepositoryScanningConfigurationCommand_1 = __nccwpck_require__(79728); +const CompleteLayerUploadCommand_1 = __nccwpck_require__(49003); +const CreatePullThroughCacheRuleCommand_1 = __nccwpck_require__(71454); +const CreateRepositoryCommand_1 = __nccwpck_require__(5074); +const DeleteLifecyclePolicyCommand_1 = __nccwpck_require__(48981); +const DeletePullThroughCacheRuleCommand_1 = __nccwpck_require__(83793); +const DeleteRegistryPolicyCommand_1 = __nccwpck_require__(31424); +const DeleteRepositoryCommand_1 = __nccwpck_require__(88651); +const DeleteRepositoryPolicyCommand_1 = __nccwpck_require__(36828); +const DescribeImageReplicationStatusCommand_1 = __nccwpck_require__(39694); +const DescribeImageScanFindingsCommand_1 = __nccwpck_require__(72987); +const DescribeImagesCommand_1 = __nccwpck_require__(95353); +const DescribePullThroughCacheRulesCommand_1 = __nccwpck_require__(31484); +const DescribeRegistryCommand_1 = __nccwpck_require__(26166); +const DescribeRepositoriesCommand_1 = __nccwpck_require__(21200); +const GetAuthorizationTokenCommand_1 = __nccwpck_require__(35828); +const GetDownloadUrlForLayerCommand_1 = __nccwpck_require__(51401); +const GetLifecyclePolicyCommand_1 = __nccwpck_require__(48469); +const GetLifecyclePolicyPreviewCommand_1 = __nccwpck_require__(17006); +const GetRegistryPolicyCommand_1 = __nccwpck_require__(33685); +const GetRegistryScanningConfigurationCommand_1 = __nccwpck_require__(82741); +const GetRepositoryPolicyCommand_1 = __nccwpck_require__(46330); +const InitiateLayerUploadCommand_1 = __nccwpck_require__(6936); +const ListImagesCommand_1 = __nccwpck_require__(3854); +const ListTagsForResourceCommand_1 = __nccwpck_require__(97403); +const PutImageCommand_1 = __nccwpck_require__(66844); +const PutImageScanningConfigurationCommand_1 = __nccwpck_require__(87935); +const PutImageTagMutabilityCommand_1 = __nccwpck_require__(66495); +const PutLifecyclePolicyCommand_1 = __nccwpck_require__(33854); +const PutRegistryPolicyCommand_1 = __nccwpck_require__(97928); +const PutRegistryScanningConfigurationCommand_1 = __nccwpck_require__(29529); +const PutReplicationConfigurationCommand_1 = __nccwpck_require__(14030); +const SetRepositoryPolicyCommand_1 = __nccwpck_require__(78300); +const StartImageScanCommand_1 = __nccwpck_require__(47984); +const StartLifecyclePolicyPreviewCommand_1 = __nccwpck_require__(35905); +const TagResourceCommand_1 = __nccwpck_require__(82665); +const UntagResourceCommand_1 = __nccwpck_require__(37225); +const UploadLayerPartCommand_1 = __nccwpck_require__(55825); +const ECRClient_1 = __nccwpck_require__(83391); +const commands = { + BatchCheckLayerAvailabilityCommand: BatchCheckLayerAvailabilityCommand_1.BatchCheckLayerAvailabilityCommand, + BatchDeleteImageCommand: BatchDeleteImageCommand_1.BatchDeleteImageCommand, + BatchGetImageCommand: BatchGetImageCommand_1.BatchGetImageCommand, + BatchGetRepositoryScanningConfigurationCommand: BatchGetRepositoryScanningConfigurationCommand_1.BatchGetRepositoryScanningConfigurationCommand, + CompleteLayerUploadCommand: CompleteLayerUploadCommand_1.CompleteLayerUploadCommand, + CreatePullThroughCacheRuleCommand: CreatePullThroughCacheRuleCommand_1.CreatePullThroughCacheRuleCommand, + CreateRepositoryCommand: CreateRepositoryCommand_1.CreateRepositoryCommand, + DeleteLifecyclePolicyCommand: DeleteLifecyclePolicyCommand_1.DeleteLifecyclePolicyCommand, + DeletePullThroughCacheRuleCommand: DeletePullThroughCacheRuleCommand_1.DeletePullThroughCacheRuleCommand, + DeleteRegistryPolicyCommand: DeleteRegistryPolicyCommand_1.DeleteRegistryPolicyCommand, + DeleteRepositoryCommand: DeleteRepositoryCommand_1.DeleteRepositoryCommand, + DeleteRepositoryPolicyCommand: DeleteRepositoryPolicyCommand_1.DeleteRepositoryPolicyCommand, + DescribeImageReplicationStatusCommand: DescribeImageReplicationStatusCommand_1.DescribeImageReplicationStatusCommand, + DescribeImagesCommand: DescribeImagesCommand_1.DescribeImagesCommand, + DescribeImageScanFindingsCommand: DescribeImageScanFindingsCommand_1.DescribeImageScanFindingsCommand, + DescribePullThroughCacheRulesCommand: DescribePullThroughCacheRulesCommand_1.DescribePullThroughCacheRulesCommand, + DescribeRegistryCommand: DescribeRegistryCommand_1.DescribeRegistryCommand, + DescribeRepositoriesCommand: DescribeRepositoriesCommand_1.DescribeRepositoriesCommand, + GetAuthorizationTokenCommand: GetAuthorizationTokenCommand_1.GetAuthorizationTokenCommand, + GetDownloadUrlForLayerCommand: GetDownloadUrlForLayerCommand_1.GetDownloadUrlForLayerCommand, + GetLifecyclePolicyCommand: GetLifecyclePolicyCommand_1.GetLifecyclePolicyCommand, + GetLifecyclePolicyPreviewCommand: GetLifecyclePolicyPreviewCommand_1.GetLifecyclePolicyPreviewCommand, + GetRegistryPolicyCommand: GetRegistryPolicyCommand_1.GetRegistryPolicyCommand, + GetRegistryScanningConfigurationCommand: GetRegistryScanningConfigurationCommand_1.GetRegistryScanningConfigurationCommand, + GetRepositoryPolicyCommand: GetRepositoryPolicyCommand_1.GetRepositoryPolicyCommand, + InitiateLayerUploadCommand: InitiateLayerUploadCommand_1.InitiateLayerUploadCommand, + ListImagesCommand: ListImagesCommand_1.ListImagesCommand, + ListTagsForResourceCommand: ListTagsForResourceCommand_1.ListTagsForResourceCommand, + PutImageCommand: PutImageCommand_1.PutImageCommand, + PutImageScanningConfigurationCommand: PutImageScanningConfigurationCommand_1.PutImageScanningConfigurationCommand, + PutImageTagMutabilityCommand: PutImageTagMutabilityCommand_1.PutImageTagMutabilityCommand, + PutLifecyclePolicyCommand: PutLifecyclePolicyCommand_1.PutLifecyclePolicyCommand, + PutRegistryPolicyCommand: PutRegistryPolicyCommand_1.PutRegistryPolicyCommand, + PutRegistryScanningConfigurationCommand: PutRegistryScanningConfigurationCommand_1.PutRegistryScanningConfigurationCommand, + PutReplicationConfigurationCommand: PutReplicationConfigurationCommand_1.PutReplicationConfigurationCommand, + SetRepositoryPolicyCommand: SetRepositoryPolicyCommand_1.SetRepositoryPolicyCommand, + StartImageScanCommand: StartImageScanCommand_1.StartImageScanCommand, + StartLifecyclePolicyPreviewCommand: StartLifecyclePolicyPreviewCommand_1.StartLifecyclePolicyPreviewCommand, + TagResourceCommand: TagResourceCommand_1.TagResourceCommand, + UntagResourceCommand: UntagResourceCommand_1.UntagResourceCommand, + UploadLayerPartCommand: UploadLayerPartCommand_1.UploadLayerPartCommand, }; -class InvalidParameterException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "InvalidParameterException", - $fault: "client", - ...opts, - }); - this.name = "InvalidParameterException"; - this.$fault = "client"; - Object.setPrototypeOf(this, InvalidParameterException.prototype); - } -} -exports.InvalidParameterException = InvalidParameterException; -class RepositoryNotFoundException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "RepositoryNotFoundException", - $fault: "client", - ...opts, - }); - this.name = "RepositoryNotFoundException"; - this.$fault = "client"; - Object.setPrototypeOf(this, RepositoryNotFoundException.prototype); - } +class ECR extends ECRClient_1.ECRClient { } -exports.RepositoryNotFoundException = RepositoryNotFoundException; -class ServerException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "ServerException", - $fault: "server", - ...opts, - }); - this.name = "ServerException"; - this.$fault = "server"; - Object.setPrototypeOf(this, ServerException.prototype); +exports.ECR = ECR; +(0, smithy_client_1.createAggregatedClient)(commands, ECR); + + +/***/ }), + +/***/ 83391: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ECRClient = exports.__Client = void 0; +const middleware_host_header_1 = __nccwpck_require__(22545); +const middleware_logger_1 = __nccwpck_require__(20014); +const middleware_recursion_detection_1 = __nccwpck_require__(85525); +const middleware_signing_1 = __nccwpck_require__(14935); +const middleware_user_agent_1 = __nccwpck_require__(64688); +const config_resolver_1 = __nccwpck_require__(53098); +const middleware_content_length_1 = __nccwpck_require__(82800); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_retry_1 = __nccwpck_require__(96039); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } })); +const EndpointParameters_1 = __nccwpck_require__(49729); +const runtimeConfig_1 = __nccwpck_require__(869); +const runtimeExtensions_1 = __nccwpck_require__(86506); +class ECRClient extends smithy_client_1.Client { + constructor(...[configuration]) { + const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration || {}); + const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); + const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1); + const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2); + const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3); + const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, middleware_signing_1.resolveAwsAuthConfig)(_config_5); + const _config_7 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_6); + const _config_8 = (0, runtimeExtensions_1.resolveRuntimeExtensions)(_config_7, configuration?.extensions || []); + super(_config_8); + this.config = _config_8; + this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(this.config)); + this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); } -} -exports.ServerException = ServerException; -exports.ImageFailureCode = { - ImageNotFound: "ImageNotFound", - ImageReferencedByManifestList: "ImageReferencedByManifestList", - ImageTagDoesNotMatchDigest: "ImageTagDoesNotMatchDigest", - InvalidImageDigest: "InvalidImageDigest", - InvalidImageTag: "InvalidImageTag", - KmsError: "KmsError", - MissingDigestAndTag: "MissingDigestAndTag", -}; -exports.ScanningConfigurationFailureCode = { - REPOSITORY_NOT_FOUND: "REPOSITORY_NOT_FOUND", -}; -exports.ScanningRepositoryFilterType = { - WILDCARD: "WILDCARD", -}; -exports.ScanFrequency = { - CONTINUOUS_SCAN: "CONTINUOUS_SCAN", - MANUAL: "MANUAL", - SCAN_ON_PUSH: "SCAN_ON_PUSH", -}; -class ValidationException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "ValidationException", - $fault: "client", - ...opts, - }); - this.name = "ValidationException"; - this.$fault = "client"; - Object.setPrototypeOf(this, ValidationException.prototype); + destroy() { + super.destroy(); } } -exports.ValidationException = ValidationException; -class EmptyUploadException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "EmptyUploadException", - $fault: "client", - ...opts, - }); - this.name = "EmptyUploadException"; - this.$fault = "client"; - Object.setPrototypeOf(this, EmptyUploadException.prototype); +exports.ECRClient = ECRClient; + + +/***/ }), + +/***/ 63804: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.BatchCheckLayerAvailabilityCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class BatchCheckLayerAvailabilityCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -} -exports.EmptyUploadException = EmptyUploadException; -class InvalidLayerException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "InvalidLayerException", - $fault: "client", - ...opts, - }); - this.name = "InvalidLayerException"; - this.$fault = "client"; - Object.setPrototypeOf(this, InvalidLayerException.prototype); + constructor(input) { + super(); + this.input = input; } -} -exports.InvalidLayerException = InvalidLayerException; -class KmsException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "KmsException", - $fault: "client", - ...opts, - }); - this.name = "KmsException"; - this.$fault = "client"; - Object.setPrototypeOf(this, KmsException.prototype); - this.kmsError = opts.kmsError; + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, BatchCheckLayerAvailabilityCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "BatchCheckLayerAvailabilityCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "BatchCheckLayerAvailability", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -} -exports.KmsException = KmsException; -class LayerAlreadyExistsException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "LayerAlreadyExistsException", - $fault: "client", - ...opts, - }); - this.name = "LayerAlreadyExistsException"; - this.$fault = "client"; - Object.setPrototypeOf(this, LayerAlreadyExistsException.prototype); + serialize(input, context) { + return (0, Aws_json1_1_1.se_BatchCheckLayerAvailabilityCommand)(input, context); } -} -exports.LayerAlreadyExistsException = LayerAlreadyExistsException; -class LayerPartTooSmallException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "LayerPartTooSmallException", - $fault: "client", - ...opts, - }); - this.name = "LayerPartTooSmallException"; - this.$fault = "client"; - Object.setPrototypeOf(this, LayerPartTooSmallException.prototype); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_BatchCheckLayerAvailabilityCommand)(output, context); } } -exports.LayerPartTooSmallException = LayerPartTooSmallException; -class UploadNotFoundException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "UploadNotFoundException", - $fault: "client", - ...opts, - }); - this.name = "UploadNotFoundException"; - this.$fault = "client"; - Object.setPrototypeOf(this, UploadNotFoundException.prototype); +exports.BatchCheckLayerAvailabilityCommand = BatchCheckLayerAvailabilityCommand; + + +/***/ }), + +/***/ 15511: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.BatchDeleteImageCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class BatchDeleteImageCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -} -exports.UploadNotFoundException = UploadNotFoundException; -class LimitExceededException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "LimitExceededException", - $fault: "client", - ...opts, - }); - this.name = "LimitExceededException"; - this.$fault = "client"; - Object.setPrototypeOf(this, LimitExceededException.prototype); + constructor(input) { + super(); + this.input = input; } -} -exports.LimitExceededException = LimitExceededException; -class PullThroughCacheRuleAlreadyExistsException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "PullThroughCacheRuleAlreadyExistsException", - $fault: "client", - ...opts, - }); - this.name = "PullThroughCacheRuleAlreadyExistsException"; - this.$fault = "client"; - Object.setPrototypeOf(this, PullThroughCacheRuleAlreadyExistsException.prototype); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, BatchDeleteImageCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "BatchDeleteImageCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "BatchDeleteImage", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -} -exports.PullThroughCacheRuleAlreadyExistsException = PullThroughCacheRuleAlreadyExistsException; -class UnsupportedUpstreamRegistryException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "UnsupportedUpstreamRegistryException", - $fault: "client", - ...opts, - }); - this.name = "UnsupportedUpstreamRegistryException"; - this.$fault = "client"; - Object.setPrototypeOf(this, UnsupportedUpstreamRegistryException.prototype); + serialize(input, context) { + return (0, Aws_json1_1_1.se_BatchDeleteImageCommand)(input, context); } -} -exports.UnsupportedUpstreamRegistryException = UnsupportedUpstreamRegistryException; -exports.EncryptionType = { - AES256: "AES256", - KMS: "KMS", -}; -exports.ImageTagMutability = { - IMMUTABLE: "IMMUTABLE", - MUTABLE: "MUTABLE", -}; -class InvalidTagParameterException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "InvalidTagParameterException", - $fault: "client", - ...opts, - }); - this.name = "InvalidTagParameterException"; - this.$fault = "client"; - Object.setPrototypeOf(this, InvalidTagParameterException.prototype); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_BatchDeleteImageCommand)(output, context); } } -exports.InvalidTagParameterException = InvalidTagParameterException; -class RepositoryAlreadyExistsException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "RepositoryAlreadyExistsException", - $fault: "client", - ...opts, - }); - this.name = "RepositoryAlreadyExistsException"; - this.$fault = "client"; - Object.setPrototypeOf(this, RepositoryAlreadyExistsException.prototype); +exports.BatchDeleteImageCommand = BatchDeleteImageCommand; + + +/***/ }), + +/***/ 78859: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.BatchGetImageCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class BatchGetImageCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -} -exports.RepositoryAlreadyExistsException = RepositoryAlreadyExistsException; -class TooManyTagsException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "TooManyTagsException", - $fault: "client", - ...opts, - }); - this.name = "TooManyTagsException"; - this.$fault = "client"; - Object.setPrototypeOf(this, TooManyTagsException.prototype); + constructor(input) { + super(); + this.input = input; } -} -exports.TooManyTagsException = TooManyTagsException; -class LifecyclePolicyNotFoundException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "LifecyclePolicyNotFoundException", - $fault: "client", - ...opts, - }); - this.name = "LifecyclePolicyNotFoundException"; - this.$fault = "client"; - Object.setPrototypeOf(this, LifecyclePolicyNotFoundException.prototype); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, BatchGetImageCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "BatchGetImageCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "BatchGetImage", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -} -exports.LifecyclePolicyNotFoundException = LifecyclePolicyNotFoundException; -class PullThroughCacheRuleNotFoundException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "PullThroughCacheRuleNotFoundException", - $fault: "client", - ...opts, - }); - this.name = "PullThroughCacheRuleNotFoundException"; - this.$fault = "client"; - Object.setPrototypeOf(this, PullThroughCacheRuleNotFoundException.prototype); + serialize(input, context) { + return (0, Aws_json1_1_1.se_BatchGetImageCommand)(input, context); } -} -exports.PullThroughCacheRuleNotFoundException = PullThroughCacheRuleNotFoundException; -class RegistryPolicyNotFoundException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "RegistryPolicyNotFoundException", - $fault: "client", - ...opts, - }); - this.name = "RegistryPolicyNotFoundException"; - this.$fault = "client"; - Object.setPrototypeOf(this, RegistryPolicyNotFoundException.prototype); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_BatchGetImageCommand)(output, context); } } -exports.RegistryPolicyNotFoundException = RegistryPolicyNotFoundException; -class RepositoryNotEmptyException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "RepositoryNotEmptyException", - $fault: "client", - ...opts, - }); - this.name = "RepositoryNotEmptyException"; - this.$fault = "client"; - Object.setPrototypeOf(this, RepositoryNotEmptyException.prototype); +exports.BatchGetImageCommand = BatchGetImageCommand; + + +/***/ }), + +/***/ 79728: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.BatchGetRepositoryScanningConfigurationCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class BatchGetRepositoryScanningConfigurationCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -} -exports.RepositoryNotEmptyException = RepositoryNotEmptyException; -class RepositoryPolicyNotFoundException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "RepositoryPolicyNotFoundException", - $fault: "client", - ...opts, - }); - this.name = "RepositoryPolicyNotFoundException"; - this.$fault = "client"; - Object.setPrototypeOf(this, RepositoryPolicyNotFoundException.prototype); + constructor(input) { + super(); + this.input = input; } -} -exports.RepositoryPolicyNotFoundException = RepositoryPolicyNotFoundException; -exports.ReplicationStatus = { - COMPLETE: "COMPLETE", - FAILED: "FAILED", - IN_PROGRESS: "IN_PROGRESS", -}; -class ImageNotFoundException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "ImageNotFoundException", - $fault: "client", - ...opts, - }); - this.name = "ImageNotFoundException"; - this.$fault = "client"; - Object.setPrototypeOf(this, ImageNotFoundException.prototype); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, BatchGetRepositoryScanningConfigurationCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "BatchGetRepositoryScanningConfigurationCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "BatchGetRepositoryScanningConfiguration", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -} -exports.ImageNotFoundException = ImageNotFoundException; -exports.TagStatus = { - ANY: "ANY", - TAGGED: "TAGGED", - UNTAGGED: "UNTAGGED", -}; -exports.FindingSeverity = { - CRITICAL: "CRITICAL", - HIGH: "HIGH", - INFORMATIONAL: "INFORMATIONAL", - LOW: "LOW", - MEDIUM: "MEDIUM", - UNDEFINED: "UNDEFINED", -}; -exports.ScanStatus = { - ACTIVE: "ACTIVE", - COMPLETE: "COMPLETE", - FAILED: "FAILED", - FINDINGS_UNAVAILABLE: "FINDINGS_UNAVAILABLE", - IN_PROGRESS: "IN_PROGRESS", - PENDING: "PENDING", - SCAN_ELIGIBILITY_EXPIRED: "SCAN_ELIGIBILITY_EXPIRED", - UNSUPPORTED_IMAGE: "UNSUPPORTED_IMAGE", -}; -class ScanNotFoundException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "ScanNotFoundException", - $fault: "client", - ...opts, - }); - this.name = "ScanNotFoundException"; - this.$fault = "client"; - Object.setPrototypeOf(this, ScanNotFoundException.prototype); + serialize(input, context) { + return (0, Aws_json1_1_1.se_BatchGetRepositoryScanningConfigurationCommand)(input, context); } -} -exports.ScanNotFoundException = ScanNotFoundException; -exports.RepositoryFilterType = { - PREFIX_MATCH: "PREFIX_MATCH", -}; -class LayerInaccessibleException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "LayerInaccessibleException", - $fault: "client", - ...opts, - }); - this.name = "LayerInaccessibleException"; - this.$fault = "client"; - Object.setPrototypeOf(this, LayerInaccessibleException.prototype); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_BatchGetRepositoryScanningConfigurationCommand)(output, context); } } -exports.LayerInaccessibleException = LayerInaccessibleException; -class LayersNotFoundException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "LayersNotFoundException", - $fault: "client", - ...opts, - }); - this.name = "LayersNotFoundException"; - this.$fault = "client"; - Object.setPrototypeOf(this, LayersNotFoundException.prototype); +exports.BatchGetRepositoryScanningConfigurationCommand = BatchGetRepositoryScanningConfigurationCommand; + + +/***/ }), + +/***/ 49003: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.CompleteLayerUploadCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class CompleteLayerUploadCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -} -exports.LayersNotFoundException = LayersNotFoundException; -exports.ImageActionType = { - EXPIRE: "EXPIRE", -}; -exports.LifecyclePolicyPreviewStatus = { - COMPLETE: "COMPLETE", - EXPIRED: "EXPIRED", - FAILED: "FAILED", - IN_PROGRESS: "IN_PROGRESS", -}; -class LifecyclePolicyPreviewNotFoundException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "LifecyclePolicyPreviewNotFoundException", - $fault: "client", - ...opts, - }); - this.name = "LifecyclePolicyPreviewNotFoundException"; - this.$fault = "client"; - Object.setPrototypeOf(this, LifecyclePolicyPreviewNotFoundException.prototype); + constructor(input) { + super(); + this.input = input; } -} -exports.LifecyclePolicyPreviewNotFoundException = LifecyclePolicyPreviewNotFoundException; -exports.ScanType = { - BASIC: "BASIC", - ENHANCED: "ENHANCED", -}; -class ImageAlreadyExistsException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "ImageAlreadyExistsException", - $fault: "client", - ...opts, - }); - this.name = "ImageAlreadyExistsException"; - this.$fault = "client"; - Object.setPrototypeOf(this, ImageAlreadyExistsException.prototype); - } -} -exports.ImageAlreadyExistsException = ImageAlreadyExistsException; -class ImageDigestDoesNotMatchException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "ImageDigestDoesNotMatchException", - $fault: "client", - ...opts, - }); - this.name = "ImageDigestDoesNotMatchException"; - this.$fault = "client"; - Object.setPrototypeOf(this, ImageDigestDoesNotMatchException.prototype); - } -} -exports.ImageDigestDoesNotMatchException = ImageDigestDoesNotMatchException; -class ImageTagAlreadyExistsException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "ImageTagAlreadyExistsException", - $fault: "client", - ...opts, - }); - this.name = "ImageTagAlreadyExistsException"; - this.$fault = "client"; - Object.setPrototypeOf(this, ImageTagAlreadyExistsException.prototype); - } -} -exports.ImageTagAlreadyExistsException = ImageTagAlreadyExistsException; -class ReferencedImagesNotFoundException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "ReferencedImagesNotFoundException", - $fault: "client", - ...opts, - }); - this.name = "ReferencedImagesNotFoundException"; - this.$fault = "client"; - Object.setPrototypeOf(this, ReferencedImagesNotFoundException.prototype); - } -} -exports.ReferencedImagesNotFoundException = ReferencedImagesNotFoundException; -class UnsupportedImageTypeException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "UnsupportedImageTypeException", - $fault: "client", - ...opts, - }); - this.name = "UnsupportedImageTypeException"; - this.$fault = "client"; - Object.setPrototypeOf(this, UnsupportedImageTypeException.prototype); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, CompleteLayerUploadCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "CompleteLayerUploadCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "CompleteLayerUpload", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -} -exports.UnsupportedImageTypeException = UnsupportedImageTypeException; -class LifecyclePolicyPreviewInProgressException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "LifecyclePolicyPreviewInProgressException", - $fault: "client", - ...opts, - }); - this.name = "LifecyclePolicyPreviewInProgressException"; - this.$fault = "client"; - Object.setPrototypeOf(this, LifecyclePolicyPreviewInProgressException.prototype); + serialize(input, context) { + return (0, Aws_json1_1_1.se_CompleteLayerUploadCommand)(input, context); } -} -exports.LifecyclePolicyPreviewInProgressException = LifecyclePolicyPreviewInProgressException; -class InvalidLayerPartException extends ECRServiceException_1.ECRServiceException { - constructor(opts) { - super({ - name: "InvalidLayerPartException", - $fault: "client", - ...opts, - }); - this.name = "InvalidLayerPartException"; - this.$fault = "client"; - Object.setPrototypeOf(this, InvalidLayerPartException.prototype); - this.registryId = opts.registryId; - this.repositoryName = opts.repositoryName; - this.uploadId = opts.uploadId; - this.lastValidByteReceived = opts.lastValidByteReceived; + deserialize(output, context) { + return (0, Aws_json1_1_1.de_CompleteLayerUploadCommand)(output, context); } } -exports.InvalidLayerPartException = InvalidLayerPartException; +exports.CompleteLayerUploadCommand = CompleteLayerUploadCommand; /***/ }), -/***/ 30862: +/***/ 71454: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.paginateDescribeImageScanFindings = void 0; -const DescribeImageScanFindingsCommand_1 = __nccwpck_require__(72987); -const ECRClient_1 = __nccwpck_require__(83391); -const makePagedClientRequest = async (client, input, ...args) => { - return await client.send(new DescribeImageScanFindingsCommand_1.DescribeImageScanFindingsCommand(input), ...args); -}; -async function* paginateDescribeImageScanFindings(config, input, ...additionalArguments) { - let token = config.startingToken || undefined; - let hasNext = true; - let page; - while (hasNext) { - input.nextToken = token; - input["maxResults"] = config.pageSize; - if (config.client instanceof ECRClient_1.ECRClient) { - page = await makePagedClientRequest(config.client, input, ...additionalArguments); - } - else { - throw new Error("Invalid client, expected ECR | ECRClient"); - } - yield page; - const prevToken = token; - token = page.nextToken; - hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); +exports.CreatePullThroughCacheRuleCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class CreatePullThroughCacheRuleCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, CreatePullThroughCacheRuleCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "CreatePullThroughCacheRuleCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "CreatePullThroughCacheRule", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_CreatePullThroughCacheRuleCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_CreatePullThroughCacheRuleCommand)(output, context); } - return undefined; } -exports.paginateDescribeImageScanFindings = paginateDescribeImageScanFindings; +exports.CreatePullThroughCacheRuleCommand = CreatePullThroughCacheRuleCommand; /***/ }), -/***/ 51351: +/***/ 5074: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.paginateDescribeImages = void 0; -const DescribeImagesCommand_1 = __nccwpck_require__(95353); -const ECRClient_1 = __nccwpck_require__(83391); -const makePagedClientRequest = async (client, input, ...args) => { - return await client.send(new DescribeImagesCommand_1.DescribeImagesCommand(input), ...args); -}; -async function* paginateDescribeImages(config, input, ...additionalArguments) { - let token = config.startingToken || undefined; - let hasNext = true; - let page; - while (hasNext) { - input.nextToken = token; - input["maxResults"] = config.pageSize; - if (config.client instanceof ECRClient_1.ECRClient) { - page = await makePagedClientRequest(config.client, input, ...additionalArguments); - } - else { - throw new Error("Invalid client, expected ECR | ECRClient"); - } - yield page; - const prevToken = token; - token = page.nextToken; - hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); +exports.CreateRepositoryCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class CreateRepositoryCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, CreateRepositoryCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "CreateRepositoryCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "CreateRepository", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_CreateRepositoryCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_CreateRepositoryCommand)(output, context); } - return undefined; } -exports.paginateDescribeImages = paginateDescribeImages; +exports.CreateRepositoryCommand = CreateRepositoryCommand; /***/ }), -/***/ 59589: +/***/ 48981: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.paginateDescribePullThroughCacheRules = void 0; -const DescribePullThroughCacheRulesCommand_1 = __nccwpck_require__(31484); -const ECRClient_1 = __nccwpck_require__(83391); -const makePagedClientRequest = async (client, input, ...args) => { - return await client.send(new DescribePullThroughCacheRulesCommand_1.DescribePullThroughCacheRulesCommand(input), ...args); -}; -async function* paginateDescribePullThroughCacheRules(config, input, ...additionalArguments) { - let token = config.startingToken || undefined; - let hasNext = true; - let page; - while (hasNext) { - input.nextToken = token; - input["maxResults"] = config.pageSize; - if (config.client instanceof ECRClient_1.ECRClient) { - page = await makePagedClientRequest(config.client, input, ...additionalArguments); - } - else { - throw new Error("Invalid client, expected ECR | ECRClient"); - } - yield page; - const prevToken = token; - token = page.nextToken; - hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); +exports.DeleteLifecyclePolicyCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class DeleteLifecyclePolicyCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DeleteLifecyclePolicyCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "DeleteLifecyclePolicyCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "DeleteLifecyclePolicy", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_DeleteLifecyclePolicyCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_DeleteLifecyclePolicyCommand)(output, context); } - return undefined; } -exports.paginateDescribePullThroughCacheRules = paginateDescribePullThroughCacheRules; +exports.DeleteLifecyclePolicyCommand = DeleteLifecyclePolicyCommand; /***/ }), -/***/ 16404: +/***/ 83793: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.paginateDescribeRepositories = void 0; -const DescribeRepositoriesCommand_1 = __nccwpck_require__(21200); -const ECRClient_1 = __nccwpck_require__(83391); -const makePagedClientRequest = async (client, input, ...args) => { - return await client.send(new DescribeRepositoriesCommand_1.DescribeRepositoriesCommand(input), ...args); -}; -async function* paginateDescribeRepositories(config, input, ...additionalArguments) { - let token = config.startingToken || undefined; - let hasNext = true; - let page; - while (hasNext) { - input.nextToken = token; - input["maxResults"] = config.pageSize; - if (config.client instanceof ECRClient_1.ECRClient) { - page = await makePagedClientRequest(config.client, input, ...additionalArguments); - } - else { - throw new Error("Invalid client, expected ECR | ECRClient"); - } - yield page; - const prevToken = token; - token = page.nextToken; - hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); +exports.DeletePullThroughCacheRuleCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class DeletePullThroughCacheRuleCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DeletePullThroughCacheRuleCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "DeletePullThroughCacheRuleCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "DeletePullThroughCacheRule", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_DeletePullThroughCacheRuleCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_DeletePullThroughCacheRuleCommand)(output, context); } - return undefined; } -exports.paginateDescribeRepositories = paginateDescribeRepositories; +exports.DeletePullThroughCacheRuleCommand = DeletePullThroughCacheRuleCommand; /***/ }), -/***/ 50987: +/***/ 31424: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.paginateGetLifecyclePolicyPreview = void 0; -const GetLifecyclePolicyPreviewCommand_1 = __nccwpck_require__(17006); -const ECRClient_1 = __nccwpck_require__(83391); -const makePagedClientRequest = async (client, input, ...args) => { - return await client.send(new GetLifecyclePolicyPreviewCommand_1.GetLifecyclePolicyPreviewCommand(input), ...args); -}; -async function* paginateGetLifecyclePolicyPreview(config, input, ...additionalArguments) { - let token = config.startingToken || undefined; - let hasNext = true; - let page; - while (hasNext) { - input.nextToken = token; - input["maxResults"] = config.pageSize; - if (config.client instanceof ECRClient_1.ECRClient) { - page = await makePagedClientRequest(config.client, input, ...additionalArguments); - } - else { - throw new Error("Invalid client, expected ECR | ECRClient"); - } - yield page; - const prevToken = token; - token = page.nextToken; - hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); +exports.DeleteRegistryPolicyCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class DeleteRegistryPolicyCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DeleteRegistryPolicyCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "DeleteRegistryPolicyCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "DeleteRegistryPolicy", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_DeleteRegistryPolicyCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_DeleteRegistryPolicyCommand)(output, context); } - return undefined; } -exports.paginateGetLifecyclePolicyPreview = paginateGetLifecyclePolicyPreview; +exports.DeleteRegistryPolicyCommand = DeleteRegistryPolicyCommand; /***/ }), -/***/ 9010: -/***/ ((__unused_webpack_module, exports) => { +/***/ 88651: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.DeleteRepositoryCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class DeleteRepositoryCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DeleteRepositoryCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "DeleteRepositoryCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "DeleteRepository", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_DeleteRepositoryCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_DeleteRepositoryCommand)(output, context); + } +} +exports.DeleteRepositoryCommand = DeleteRepositoryCommand; /***/ }), -/***/ 1066: +/***/ 36828: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.paginateListImages = void 0; -const ListImagesCommand_1 = __nccwpck_require__(3854); -const ECRClient_1 = __nccwpck_require__(83391); -const makePagedClientRequest = async (client, input, ...args) => { - return await client.send(new ListImagesCommand_1.ListImagesCommand(input), ...args); -}; -async function* paginateListImages(config, input, ...additionalArguments) { - let token = config.startingToken || undefined; - let hasNext = true; - let page; - while (hasNext) { - input.nextToken = token; - input["maxResults"] = config.pageSize; - if (config.client instanceof ECRClient_1.ECRClient) { - page = await makePagedClientRequest(config.client, input, ...additionalArguments); - } - else { - throw new Error("Invalid client, expected ECR | ECRClient"); - } - yield page; - const prevToken = token; - token = page.nextToken; - hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); +exports.DeleteRepositoryPolicyCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class DeleteRepositoryPolicyCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DeleteRepositoryPolicyCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "DeleteRepositoryPolicyCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "DeleteRepositoryPolicy", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_DeleteRepositoryPolicyCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_DeleteRepositoryPolicyCommand)(output, context); } - return undefined; } -exports.paginateListImages = paginateListImages; +exports.DeleteRepositoryPolicyCommand = DeleteRepositoryPolicyCommand; /***/ }), -/***/ 35356: +/***/ 39694: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(30862), exports); -tslib_1.__exportStar(__nccwpck_require__(51351), exports); -tslib_1.__exportStar(__nccwpck_require__(59589), exports); -tslib_1.__exportStar(__nccwpck_require__(16404), exports); -tslib_1.__exportStar(__nccwpck_require__(50987), exports); -tslib_1.__exportStar(__nccwpck_require__(9010), exports); -tslib_1.__exportStar(__nccwpck_require__(1066), exports); +exports.DescribeImageReplicationStatusCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class DescribeImageReplicationStatusCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DescribeImageReplicationStatusCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "DescribeImageReplicationStatusCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "DescribeImageReplicationStatus", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_DescribeImageReplicationStatusCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_DescribeImageReplicationStatusCommand)(output, context); + } +} +exports.DescribeImageReplicationStatusCommand = DescribeImageReplicationStatusCommand; /***/ }), -/***/ 56704: +/***/ 72987: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.de_DeletePullThroughCacheRuleCommand = exports.de_DeleteLifecyclePolicyCommand = exports.de_CreateRepositoryCommand = exports.de_CreatePullThroughCacheRuleCommand = exports.de_CompleteLayerUploadCommand = exports.de_BatchGetRepositoryScanningConfigurationCommand = exports.de_BatchGetImageCommand = exports.de_BatchDeleteImageCommand = exports.de_BatchCheckLayerAvailabilityCommand = exports.se_UploadLayerPartCommand = exports.se_UntagResourceCommand = exports.se_TagResourceCommand = exports.se_StartLifecyclePolicyPreviewCommand = exports.se_StartImageScanCommand = exports.se_SetRepositoryPolicyCommand = exports.se_PutReplicationConfigurationCommand = exports.se_PutRegistryScanningConfigurationCommand = exports.se_PutRegistryPolicyCommand = exports.se_PutLifecyclePolicyCommand = exports.se_PutImageTagMutabilityCommand = exports.se_PutImageScanningConfigurationCommand = exports.se_PutImageCommand = exports.se_ListTagsForResourceCommand = exports.se_ListImagesCommand = exports.se_InitiateLayerUploadCommand = exports.se_GetRepositoryPolicyCommand = exports.se_GetRegistryScanningConfigurationCommand = exports.se_GetRegistryPolicyCommand = exports.se_GetLifecyclePolicyPreviewCommand = exports.se_GetLifecyclePolicyCommand = exports.se_GetDownloadUrlForLayerCommand = exports.se_GetAuthorizationTokenCommand = exports.se_DescribeRepositoriesCommand = exports.se_DescribeRegistryCommand = exports.se_DescribePullThroughCacheRulesCommand = exports.se_DescribeImageScanFindingsCommand = exports.se_DescribeImagesCommand = exports.se_DescribeImageReplicationStatusCommand = exports.se_DeleteRepositoryPolicyCommand = exports.se_DeleteRepositoryCommand = exports.se_DeleteRegistryPolicyCommand = exports.se_DeletePullThroughCacheRuleCommand = exports.se_DeleteLifecyclePolicyCommand = exports.se_CreateRepositoryCommand = exports.se_CreatePullThroughCacheRuleCommand = exports.se_CompleteLayerUploadCommand = exports.se_BatchGetRepositoryScanningConfigurationCommand = exports.se_BatchGetImageCommand = exports.se_BatchDeleteImageCommand = exports.se_BatchCheckLayerAvailabilityCommand = void 0; -exports.de_UploadLayerPartCommand = exports.de_UntagResourceCommand = exports.de_TagResourceCommand = exports.de_StartLifecyclePolicyPreviewCommand = exports.de_StartImageScanCommand = exports.de_SetRepositoryPolicyCommand = exports.de_PutReplicationConfigurationCommand = exports.de_PutRegistryScanningConfigurationCommand = exports.de_PutRegistryPolicyCommand = exports.de_PutLifecyclePolicyCommand = exports.de_PutImageTagMutabilityCommand = exports.de_PutImageScanningConfigurationCommand = exports.de_PutImageCommand = exports.de_ListTagsForResourceCommand = exports.de_ListImagesCommand = exports.de_InitiateLayerUploadCommand = exports.de_GetRepositoryPolicyCommand = exports.de_GetRegistryScanningConfigurationCommand = exports.de_GetRegistryPolicyCommand = exports.de_GetLifecyclePolicyPreviewCommand = exports.de_GetLifecyclePolicyCommand = exports.de_GetDownloadUrlForLayerCommand = exports.de_GetAuthorizationTokenCommand = exports.de_DescribeRepositoriesCommand = exports.de_DescribeRegistryCommand = exports.de_DescribePullThroughCacheRulesCommand = exports.de_DescribeImageScanFindingsCommand = exports.de_DescribeImagesCommand = exports.de_DescribeImageReplicationStatusCommand = exports.de_DeleteRepositoryPolicyCommand = exports.de_DeleteRepositoryCommand = exports.de_DeleteRegistryPolicyCommand = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const protocol_http_1 = __nccwpck_require__(64418); -const ECRServiceException_1 = __nccwpck_require__(11610); -const models_0_1 = __nccwpck_require__(79088); -const se_BatchCheckLayerAvailabilityCommand = async (input, context) => { - const headers = sharedHeaders("BatchCheckLayerAvailability"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_BatchCheckLayerAvailabilityCommand = se_BatchCheckLayerAvailabilityCommand; -const se_BatchDeleteImageCommand = async (input, context) => { - const headers = sharedHeaders("BatchDeleteImage"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_BatchDeleteImageCommand = se_BatchDeleteImageCommand; -const se_BatchGetImageCommand = async (input, context) => { - const headers = sharedHeaders("BatchGetImage"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_BatchGetImageCommand = se_BatchGetImageCommand; -const se_BatchGetRepositoryScanningConfigurationCommand = async (input, context) => { - const headers = sharedHeaders("BatchGetRepositoryScanningConfiguration"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_BatchGetRepositoryScanningConfigurationCommand = se_BatchGetRepositoryScanningConfigurationCommand; -const se_CompleteLayerUploadCommand = async (input, context) => { - const headers = sharedHeaders("CompleteLayerUpload"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_CompleteLayerUploadCommand = se_CompleteLayerUploadCommand; -const se_CreatePullThroughCacheRuleCommand = async (input, context) => { - const headers = sharedHeaders("CreatePullThroughCacheRule"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_CreatePullThroughCacheRuleCommand = se_CreatePullThroughCacheRuleCommand; -const se_CreateRepositoryCommand = async (input, context) => { - const headers = sharedHeaders("CreateRepository"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_CreateRepositoryCommand = se_CreateRepositoryCommand; -const se_DeleteLifecyclePolicyCommand = async (input, context) => { - const headers = sharedHeaders("DeleteLifecyclePolicy"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_DeleteLifecyclePolicyCommand = se_DeleteLifecyclePolicyCommand; -const se_DeletePullThroughCacheRuleCommand = async (input, context) => { - const headers = sharedHeaders("DeletePullThroughCacheRule"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_DeletePullThroughCacheRuleCommand = se_DeletePullThroughCacheRuleCommand; -const se_DeleteRegistryPolicyCommand = async (input, context) => { - const headers = sharedHeaders("DeleteRegistryPolicy"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_DeleteRegistryPolicyCommand = se_DeleteRegistryPolicyCommand; -const se_DeleteRepositoryCommand = async (input, context) => { - const headers = sharedHeaders("DeleteRepository"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_DeleteRepositoryCommand = se_DeleteRepositoryCommand; -const se_DeleteRepositoryPolicyCommand = async (input, context) => { - const headers = sharedHeaders("DeleteRepositoryPolicy"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_DeleteRepositoryPolicyCommand = se_DeleteRepositoryPolicyCommand; -const se_DescribeImageReplicationStatusCommand = async (input, context) => { - const headers = sharedHeaders("DescribeImageReplicationStatus"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_DescribeImageReplicationStatusCommand = se_DescribeImageReplicationStatusCommand; -const se_DescribeImagesCommand = async (input, context) => { - const headers = sharedHeaders("DescribeImages"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_DescribeImagesCommand = se_DescribeImagesCommand; -const se_DescribeImageScanFindingsCommand = async (input, context) => { - const headers = sharedHeaders("DescribeImageScanFindings"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_DescribeImageScanFindingsCommand = se_DescribeImageScanFindingsCommand; -const se_DescribePullThroughCacheRulesCommand = async (input, context) => { - const headers = sharedHeaders("DescribePullThroughCacheRules"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_DescribePullThroughCacheRulesCommand = se_DescribePullThroughCacheRulesCommand; -const se_DescribeRegistryCommand = async (input, context) => { - const headers = sharedHeaders("DescribeRegistry"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_DescribeRegistryCommand = se_DescribeRegistryCommand; -const se_DescribeRepositoriesCommand = async (input, context) => { - const headers = sharedHeaders("DescribeRepositories"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_DescribeRepositoriesCommand = se_DescribeRepositoriesCommand; -const se_GetAuthorizationTokenCommand = async (input, context) => { - const headers = sharedHeaders("GetAuthorizationToken"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_GetAuthorizationTokenCommand = se_GetAuthorizationTokenCommand; -const se_GetDownloadUrlForLayerCommand = async (input, context) => { - const headers = sharedHeaders("GetDownloadUrlForLayer"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_GetDownloadUrlForLayerCommand = se_GetDownloadUrlForLayerCommand; -const se_GetLifecyclePolicyCommand = async (input, context) => { - const headers = sharedHeaders("GetLifecyclePolicy"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_GetLifecyclePolicyCommand = se_GetLifecyclePolicyCommand; -const se_GetLifecyclePolicyPreviewCommand = async (input, context) => { - const headers = sharedHeaders("GetLifecyclePolicyPreview"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_GetLifecyclePolicyPreviewCommand = se_GetLifecyclePolicyPreviewCommand; -const se_GetRegistryPolicyCommand = async (input, context) => { - const headers = sharedHeaders("GetRegistryPolicy"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_GetRegistryPolicyCommand = se_GetRegistryPolicyCommand; -const se_GetRegistryScanningConfigurationCommand = async (input, context) => { - const headers = sharedHeaders("GetRegistryScanningConfiguration"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_GetRegistryScanningConfigurationCommand = se_GetRegistryScanningConfigurationCommand; -const se_GetRepositoryPolicyCommand = async (input, context) => { - const headers = sharedHeaders("GetRepositoryPolicy"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_GetRepositoryPolicyCommand = se_GetRepositoryPolicyCommand; -const se_InitiateLayerUploadCommand = async (input, context) => { - const headers = sharedHeaders("InitiateLayerUpload"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_InitiateLayerUploadCommand = se_InitiateLayerUploadCommand; -const se_ListImagesCommand = async (input, context) => { - const headers = sharedHeaders("ListImages"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_ListImagesCommand = se_ListImagesCommand; -const se_ListTagsForResourceCommand = async (input, context) => { - const headers = sharedHeaders("ListTagsForResource"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_ListTagsForResourceCommand = se_ListTagsForResourceCommand; -const se_PutImageCommand = async (input, context) => { - const headers = sharedHeaders("PutImage"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_PutImageCommand = se_PutImageCommand; -const se_PutImageScanningConfigurationCommand = async (input, context) => { - const headers = sharedHeaders("PutImageScanningConfiguration"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_PutImageScanningConfigurationCommand = se_PutImageScanningConfigurationCommand; -const se_PutImageTagMutabilityCommand = async (input, context) => { - const headers = sharedHeaders("PutImageTagMutability"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_PutImageTagMutabilityCommand = se_PutImageTagMutabilityCommand; -const se_PutLifecyclePolicyCommand = async (input, context) => { - const headers = sharedHeaders("PutLifecyclePolicy"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_PutLifecyclePolicyCommand = se_PutLifecyclePolicyCommand; -const se_PutRegistryPolicyCommand = async (input, context) => { - const headers = sharedHeaders("PutRegistryPolicy"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_PutRegistryPolicyCommand = se_PutRegistryPolicyCommand; -const se_PutRegistryScanningConfigurationCommand = async (input, context) => { - const headers = sharedHeaders("PutRegistryScanningConfiguration"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_PutRegistryScanningConfigurationCommand = se_PutRegistryScanningConfigurationCommand; -const se_PutReplicationConfigurationCommand = async (input, context) => { - const headers = sharedHeaders("PutReplicationConfiguration"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_PutReplicationConfigurationCommand = se_PutReplicationConfigurationCommand; -const se_SetRepositoryPolicyCommand = async (input, context) => { - const headers = sharedHeaders("SetRepositoryPolicy"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_SetRepositoryPolicyCommand = se_SetRepositoryPolicyCommand; -const se_StartImageScanCommand = async (input, context) => { - const headers = sharedHeaders("StartImageScan"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_StartImageScanCommand = se_StartImageScanCommand; -const se_StartLifecyclePolicyPreviewCommand = async (input, context) => { - const headers = sharedHeaders("StartLifecyclePolicyPreview"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_StartLifecyclePolicyPreviewCommand = se_StartLifecyclePolicyPreviewCommand; -const se_TagResourceCommand = async (input, context) => { - const headers = sharedHeaders("TagResource"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_TagResourceCommand = se_TagResourceCommand; -const se_UntagResourceCommand = async (input, context) => { - const headers = sharedHeaders("UntagResource"); - let body; - body = JSON.stringify((0, smithy_client_1._json)(input)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_UntagResourceCommand = se_UntagResourceCommand; -const se_UploadLayerPartCommand = async (input, context) => { - const headers = sharedHeaders("UploadLayerPart"); - let body; - body = JSON.stringify(se_UploadLayerPartRequest(input, context)); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_UploadLayerPartCommand = se_UploadLayerPartCommand; -const de_BatchCheckLayerAvailabilityCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_BatchCheckLayerAvailabilityCommandError(output, context); +exports.DescribeImageScanFindingsCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class DescribeImageScanFindingsCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_BatchCheckLayerAvailabilityCommand = de_BatchCheckLayerAvailabilityCommand; -const de_BatchCheckLayerAvailabilityCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + constructor(input) { + super(); + this.input = input; } -}; -const de_BatchDeleteImageCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_BatchDeleteImageCommandError(output, context); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DescribeImageScanFindingsCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "DescribeImageScanFindingsCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "DescribeImageScanFindings", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_BatchDeleteImageCommand = de_BatchDeleteImageCommand; -const de_BatchDeleteImageCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + serialize(input, context) { + return (0, Aws_json1_1_1.se_DescribeImageScanFindingsCommand)(input, context); } -}; -const de_BatchGetImageCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_BatchGetImageCommandError(output, context); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_DescribeImageScanFindingsCommand)(output, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_BatchGetImageCommand = de_BatchGetImageCommand; -const de_BatchGetImageCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); +} +exports.DescribeImageScanFindingsCommand = DescribeImageScanFindingsCommand; + + +/***/ }), + +/***/ 95353: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.DescribeImagesCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class DescribeImagesCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -}; -const de_BatchGetRepositoryScanningConfigurationCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_BatchGetRepositoryScanningConfigurationCommandError(output, context); + constructor(input) { + super(); + this.input = input; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_BatchGetRepositoryScanningConfigurationCommand = de_BatchGetRepositoryScanningConfigurationCommand; -const de_BatchGetRepositoryScanningConfigurationCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DescribeImagesCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "DescribeImagesCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "DescribeImages", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -}; -const de_CompleteLayerUploadCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_CompleteLayerUploadCommandError(output, context); + serialize(input, context) { + return (0, Aws_json1_1_1.se_DescribeImagesCommand)(input, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_CompleteLayerUploadCommand = de_CompleteLayerUploadCommand; -const de_CompleteLayerUploadCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "EmptyUploadException": - case "com.amazonaws.ecr#EmptyUploadException": - throw await de_EmptyUploadExceptionRes(parsedOutput, context); - case "InvalidLayerException": - case "com.amazonaws.ecr#InvalidLayerException": - throw await de_InvalidLayerExceptionRes(parsedOutput, context); - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "KmsException": - case "com.amazonaws.ecr#KmsException": - throw await de_KmsExceptionRes(parsedOutput, context); - case "LayerAlreadyExistsException": - case "com.amazonaws.ecr#LayerAlreadyExistsException": - throw await de_LayerAlreadyExistsExceptionRes(parsedOutput, context); - case "LayerPartTooSmallException": - case "com.amazonaws.ecr#LayerPartTooSmallException": - throw await de_LayerPartTooSmallExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "UploadNotFoundException": - case "com.amazonaws.ecr#UploadNotFoundException": - throw await de_UploadNotFoundExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_DescribeImagesCommand)(output, context); } -}; -const de_CreatePullThroughCacheRuleCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_CreatePullThroughCacheRuleCommandError(output, context); +} +exports.DescribeImagesCommand = DescribeImagesCommand; + + +/***/ }), + +/***/ 31484: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.DescribePullThroughCacheRulesCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class DescribePullThroughCacheRulesCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_CreatePullThroughCacheRuleResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_CreatePullThroughCacheRuleCommand = de_CreatePullThroughCacheRuleCommand; -const de_CreatePullThroughCacheRuleCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "LimitExceededException": - case "com.amazonaws.ecr#LimitExceededException": - throw await de_LimitExceededExceptionRes(parsedOutput, context); - case "PullThroughCacheRuleAlreadyExistsException": - case "com.amazonaws.ecr#PullThroughCacheRuleAlreadyExistsException": - throw await de_PullThroughCacheRuleAlreadyExistsExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "UnsupportedUpstreamRegistryException": - case "com.amazonaws.ecr#UnsupportedUpstreamRegistryException": - throw await de_UnsupportedUpstreamRegistryExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + constructor(input) { + super(); + this.input = input; } -}; -const de_CreateRepositoryCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_CreateRepositoryCommandError(output, context); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DescribePullThroughCacheRulesCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "DescribePullThroughCacheRulesCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "DescribePullThroughCacheRules", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_CreateRepositoryResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_CreateRepositoryCommand = de_CreateRepositoryCommand; -const de_CreateRepositoryCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "InvalidTagParameterException": - case "com.amazonaws.ecr#InvalidTagParameterException": - throw await de_InvalidTagParameterExceptionRes(parsedOutput, context); - case "KmsException": - case "com.amazonaws.ecr#KmsException": - throw await de_KmsExceptionRes(parsedOutput, context); - case "LimitExceededException": - case "com.amazonaws.ecr#LimitExceededException": - throw await de_LimitExceededExceptionRes(parsedOutput, context); - case "RepositoryAlreadyExistsException": - case "com.amazonaws.ecr#RepositoryAlreadyExistsException": - throw await de_RepositoryAlreadyExistsExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "TooManyTagsException": - case "com.amazonaws.ecr#TooManyTagsException": - throw await de_TooManyTagsExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + serialize(input, context) { + return (0, Aws_json1_1_1.se_DescribePullThroughCacheRulesCommand)(input, context); } -}; -const de_DeleteLifecyclePolicyCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_DeleteLifecyclePolicyCommandError(output, context); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_DescribePullThroughCacheRulesCommand)(output, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_DeleteLifecyclePolicyResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_DeleteLifecyclePolicyCommand = de_DeleteLifecyclePolicyCommand; -const de_DeleteLifecyclePolicyCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "LifecyclePolicyNotFoundException": - case "com.amazonaws.ecr#LifecyclePolicyNotFoundException": - throw await de_LifecyclePolicyNotFoundExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); +} +exports.DescribePullThroughCacheRulesCommand = DescribePullThroughCacheRulesCommand; + + +/***/ }), + +/***/ 26166: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.DescribeRegistryCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class DescribeRegistryCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -}; -const de_DeletePullThroughCacheRuleCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_DeletePullThroughCacheRuleCommandError(output, context); + constructor(input) { + super(); + this.input = input; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_DeletePullThroughCacheRuleResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_DeletePullThroughCacheRuleCommand = de_DeletePullThroughCacheRuleCommand; -const de_DeletePullThroughCacheRuleCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "PullThroughCacheRuleNotFoundException": - case "com.amazonaws.ecr#PullThroughCacheRuleNotFoundException": - throw await de_PullThroughCacheRuleNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DescribeRegistryCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "DescribeRegistryCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "DescribeRegistry", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -}; -const de_DeleteRegistryPolicyCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_DeleteRegistryPolicyCommandError(output, context); + serialize(input, context) { + return (0, Aws_json1_1_1.se_DescribeRegistryCommand)(input, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_DeleteRegistryPolicyCommand = de_DeleteRegistryPolicyCommand; -const de_DeleteRegistryPolicyCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RegistryPolicyNotFoundException": - case "com.amazonaws.ecr#RegistryPolicyNotFoundException": - throw await de_RegistryPolicyNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_DescribeRegistryCommand)(output, context); } -}; -const de_DeleteRepositoryCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_DeleteRepositoryCommandError(output, context); +} +exports.DescribeRegistryCommand = DescribeRegistryCommand; + + +/***/ }), + +/***/ 21200: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.DescribeRepositoriesCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class DescribeRepositoriesCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_DeleteRepositoryResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_DeleteRepositoryCommand = de_DeleteRepositoryCommand; -const de_DeleteRepositoryCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "KmsException": - case "com.amazonaws.ecr#KmsException": - throw await de_KmsExceptionRes(parsedOutput, context); - case "RepositoryNotEmptyException": - case "com.amazonaws.ecr#RepositoryNotEmptyException": - throw await de_RepositoryNotEmptyExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + constructor(input) { + super(); + this.input = input; } -}; -const de_DeleteRepositoryPolicyCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_DeleteRepositoryPolicyCommandError(output, context); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DescribeRepositoriesCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "DescribeRepositoriesCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "DescribeRepositories", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_DeleteRepositoryPolicyCommand = de_DeleteRepositoryPolicyCommand; -const de_DeleteRepositoryPolicyCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "RepositoryPolicyNotFoundException": - case "com.amazonaws.ecr#RepositoryPolicyNotFoundException": - throw await de_RepositoryPolicyNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + serialize(input, context) { + return (0, Aws_json1_1_1.se_DescribeRepositoriesCommand)(input, context); } -}; -const de_DescribeImageReplicationStatusCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_DescribeImageReplicationStatusCommandError(output, context); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_DescribeRepositoriesCommand)(output, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_DescribeImageReplicationStatusCommand = de_DescribeImageReplicationStatusCommand; -const de_DescribeImageReplicationStatusCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "ImageNotFoundException": - case "com.amazonaws.ecr#ImageNotFoundException": - throw await de_ImageNotFoundExceptionRes(parsedOutput, context); - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); +} +exports.DescribeRepositoriesCommand = DescribeRepositoriesCommand; + + +/***/ }), + +/***/ 35828: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetAuthorizationTokenCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class GetAuthorizationTokenCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -}; -const de_DescribeImagesCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_DescribeImagesCommandError(output, context); + constructor(input) { + super(); + this.input = input; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_DescribeImagesResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_DescribeImagesCommand = de_DescribeImagesCommand; -const de_DescribeImagesCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "ImageNotFoundException": - case "com.amazonaws.ecr#ImageNotFoundException": - throw await de_ImageNotFoundExceptionRes(parsedOutput, context); - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetAuthorizationTokenCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "GetAuthorizationTokenCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "GetAuthorizationToken", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -}; -const de_DescribeImageScanFindingsCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_DescribeImageScanFindingsCommandError(output, context); + serialize(input, context) { + return (0, Aws_json1_1_1.se_GetAuthorizationTokenCommand)(input, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_DescribeImageScanFindingsResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_DescribeImageScanFindingsCommand = de_DescribeImageScanFindingsCommand; -const de_DescribeImageScanFindingsCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "ImageNotFoundException": - case "com.amazonaws.ecr#ImageNotFoundException": - throw await de_ImageNotFoundExceptionRes(parsedOutput, context); - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ScanNotFoundException": - case "com.amazonaws.ecr#ScanNotFoundException": - throw await de_ScanNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_GetAuthorizationTokenCommand)(output, context); } -}; -const de_DescribePullThroughCacheRulesCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_DescribePullThroughCacheRulesCommandError(output, context); +} +exports.GetAuthorizationTokenCommand = GetAuthorizationTokenCommand; + + +/***/ }), + +/***/ 51401: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetDownloadUrlForLayerCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class GetDownloadUrlForLayerCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_DescribePullThroughCacheRulesResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_DescribePullThroughCacheRulesCommand = de_DescribePullThroughCacheRulesCommand; -const de_DescribePullThroughCacheRulesCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "PullThroughCacheRuleNotFoundException": - case "com.amazonaws.ecr#PullThroughCacheRuleNotFoundException": - throw await de_PullThroughCacheRuleNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + constructor(input) { + super(); + this.input = input; } -}; -const de_DescribeRegistryCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_DescribeRegistryCommandError(output, context); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetDownloadUrlForLayerCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "GetDownloadUrlForLayerCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "GetDownloadUrlForLayer", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_DescribeRegistryCommand = de_DescribeRegistryCommand; -const de_DescribeRegistryCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + serialize(input, context) { + return (0, Aws_json1_1_1.se_GetDownloadUrlForLayerCommand)(input, context); } -}; -const de_DescribeRepositoriesCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_DescribeRepositoriesCommandError(output, context); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_GetDownloadUrlForLayerCommand)(output, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_DescribeRepositoriesResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_DescribeRepositoriesCommand = de_DescribeRepositoriesCommand; -const de_DescribeRepositoriesCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); +} +exports.GetDownloadUrlForLayerCommand = GetDownloadUrlForLayerCommand; + + +/***/ }), + +/***/ 48469: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetLifecyclePolicyCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class GetLifecyclePolicyCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -}; -const de_GetAuthorizationTokenCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_GetAuthorizationTokenCommandError(output, context); + constructor(input) { + super(); + this.input = input; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_GetAuthorizationTokenResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_GetAuthorizationTokenCommand = de_GetAuthorizationTokenCommand; -const de_GetAuthorizationTokenCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetLifecyclePolicyCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "GetLifecyclePolicyCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "GetLifecyclePolicy", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -}; -const de_GetDownloadUrlForLayerCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_GetDownloadUrlForLayerCommandError(output, context); - } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_GetDownloadUrlForLayerCommand = de_GetDownloadUrlForLayerCommand; -const de_GetDownloadUrlForLayerCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "LayerInaccessibleException": - case "com.amazonaws.ecr#LayerInaccessibleException": - throw await de_LayerInaccessibleExceptionRes(parsedOutput, context); - case "LayersNotFoundException": - case "com.amazonaws.ecr#LayersNotFoundException": - throw await de_LayersNotFoundExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); - } -}; -const de_GetLifecyclePolicyCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_GetLifecyclePolicyCommandError(output, context); + serialize(input, context) { + return (0, Aws_json1_1_1.se_GetLifecyclePolicyCommand)(input, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_GetLifecyclePolicyResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_GetLifecyclePolicyCommand = de_GetLifecyclePolicyCommand; -const de_GetLifecyclePolicyCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "LifecyclePolicyNotFoundException": - case "com.amazonaws.ecr#LifecyclePolicyNotFoundException": - throw await de_LifecyclePolicyNotFoundExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_GetLifecyclePolicyCommand)(output, context); } -}; -const de_GetLifecyclePolicyPreviewCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_GetLifecyclePolicyPreviewCommandError(output, context); +} +exports.GetLifecyclePolicyCommand = GetLifecyclePolicyCommand; + + +/***/ }), + +/***/ 17006: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetLifecyclePolicyPreviewCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class GetLifecyclePolicyPreviewCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_GetLifecyclePolicyPreviewResponse(data, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_GetLifecyclePolicyPreviewCommand = de_GetLifecyclePolicyPreviewCommand; -const de_GetLifecyclePolicyPreviewCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "LifecyclePolicyPreviewNotFoundException": - case "com.amazonaws.ecr#LifecyclePolicyPreviewNotFoundException": - throw await de_LifecyclePolicyPreviewNotFoundExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + constructor(input) { + super(); + this.input = input; } -}; -const de_GetRegistryPolicyCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_GetRegistryPolicyCommandError(output, context); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetLifecyclePolicyPreviewCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "GetLifecyclePolicyPreviewCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "GetLifecyclePolicyPreview", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_GetRegistryPolicyCommand = de_GetRegistryPolicyCommand; -const de_GetRegistryPolicyCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RegistryPolicyNotFoundException": - case "com.amazonaws.ecr#RegistryPolicyNotFoundException": - throw await de_RegistryPolicyNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + serialize(input, context) { + return (0, Aws_json1_1_1.se_GetLifecyclePolicyPreviewCommand)(input, context); } -}; -const de_GetRegistryScanningConfigurationCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_GetRegistryScanningConfigurationCommandError(output, context); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_GetLifecyclePolicyPreviewCommand)(output, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_GetRegistryScanningConfigurationCommand = de_GetRegistryScanningConfigurationCommand; -const de_GetRegistryScanningConfigurationCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); +} +exports.GetLifecyclePolicyPreviewCommand = GetLifecyclePolicyPreviewCommand; + + +/***/ }), + +/***/ 33685: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetRegistryPolicyCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class GetRegistryPolicyCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -}; -const de_GetRepositoryPolicyCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_GetRepositoryPolicyCommandError(output, context); + constructor(input) { + super(); + this.input = input; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_GetRepositoryPolicyCommand = de_GetRepositoryPolicyCommand; -const de_GetRepositoryPolicyCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "RepositoryPolicyNotFoundException": - case "com.amazonaws.ecr#RepositoryPolicyNotFoundException": - throw await de_RepositoryPolicyNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetRegistryPolicyCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "GetRegistryPolicyCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "GetRegistryPolicy", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -}; -const de_InitiateLayerUploadCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_InitiateLayerUploadCommandError(output, context); + serialize(input, context) { + return (0, Aws_json1_1_1.se_GetRegistryPolicyCommand)(input, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_InitiateLayerUploadCommand = de_InitiateLayerUploadCommand; -const de_InitiateLayerUploadCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "KmsException": - case "com.amazonaws.ecr#KmsException": - throw await de_KmsExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_GetRegistryPolicyCommand)(output, context); } -}; -const de_ListImagesCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_ListImagesCommandError(output, context); +} +exports.GetRegistryPolicyCommand = GetRegistryPolicyCommand; + + +/***/ }), + +/***/ 82741: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetRegistryScanningConfigurationCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class GetRegistryScanningConfigurationCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_ListImagesCommand = de_ListImagesCommand; -const de_ListImagesCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + constructor(input) { + super(); + this.input = input; } -}; -const de_ListTagsForResourceCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_ListTagsForResourceCommandError(output, context); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetRegistryScanningConfigurationCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "GetRegistryScanningConfigurationCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "GetRegistryScanningConfiguration", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_ListTagsForResourceCommand = de_ListTagsForResourceCommand; -const de_ListTagsForResourceCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + serialize(input, context) { + return (0, Aws_json1_1_1.se_GetRegistryScanningConfigurationCommand)(input, context); } -}; -const de_PutImageCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_PutImageCommandError(output, context); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_GetRegistryScanningConfigurationCommand)(output, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_PutImageCommand = de_PutImageCommand; -const de_PutImageCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "ImageAlreadyExistsException": - case "com.amazonaws.ecr#ImageAlreadyExistsException": - throw await de_ImageAlreadyExistsExceptionRes(parsedOutput, context); - case "ImageDigestDoesNotMatchException": - case "com.amazonaws.ecr#ImageDigestDoesNotMatchException": - throw await de_ImageDigestDoesNotMatchExceptionRes(parsedOutput, context); - case "ImageTagAlreadyExistsException": - case "com.amazonaws.ecr#ImageTagAlreadyExistsException": - throw await de_ImageTagAlreadyExistsExceptionRes(parsedOutput, context); - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "KmsException": - case "com.amazonaws.ecr#KmsException": - throw await de_KmsExceptionRes(parsedOutput, context); - case "LayersNotFoundException": - case "com.amazonaws.ecr#LayersNotFoundException": - throw await de_LayersNotFoundExceptionRes(parsedOutput, context); - case "LimitExceededException": - case "com.amazonaws.ecr#LimitExceededException": - throw await de_LimitExceededExceptionRes(parsedOutput, context); - case "ReferencedImagesNotFoundException": - case "com.amazonaws.ecr#ReferencedImagesNotFoundException": - throw await de_ReferencedImagesNotFoundExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); +} +exports.GetRegistryScanningConfigurationCommand = GetRegistryScanningConfigurationCommand; + + +/***/ }), + +/***/ 46330: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetRepositoryPolicyCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class GetRepositoryPolicyCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -}; -const de_PutImageScanningConfigurationCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_PutImageScanningConfigurationCommandError(output, context); + constructor(input) { + super(); + this.input = input; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_PutImageScanningConfigurationCommand = de_PutImageScanningConfigurationCommand; -const de_PutImageScanningConfigurationCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetRepositoryPolicyCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "GetRepositoryPolicyCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "GetRepositoryPolicy", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -}; -const de_PutImageTagMutabilityCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_PutImageTagMutabilityCommandError(output, context); + serialize(input, context) { + return (0, Aws_json1_1_1.se_GetRepositoryPolicyCommand)(input, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_PutImageTagMutabilityCommand = de_PutImageTagMutabilityCommand; -const de_PutImageTagMutabilityCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_GetRepositoryPolicyCommand)(output, context); } -}; -const de_PutLifecyclePolicyCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_PutLifecyclePolicyCommandError(output, context); +} +exports.GetRepositoryPolicyCommand = GetRepositoryPolicyCommand; + + +/***/ }), + +/***/ 6936: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.InitiateLayerUploadCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class InitiateLayerUploadCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_PutLifecyclePolicyCommand = de_PutLifecyclePolicyCommand; -const de_PutLifecyclePolicyCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + constructor(input) { + super(); + this.input = input; } -}; -const de_PutRegistryPolicyCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_PutRegistryPolicyCommandError(output, context); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, InitiateLayerUploadCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "InitiateLayerUploadCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "InitiateLayerUpload", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_PutRegistryPolicyCommand = de_PutRegistryPolicyCommand; -const de_PutRegistryPolicyCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + serialize(input, context) { + return (0, Aws_json1_1_1.se_InitiateLayerUploadCommand)(input, context); } -}; -const de_PutRegistryScanningConfigurationCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_PutRegistryScanningConfigurationCommandError(output, context); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_InitiateLayerUploadCommand)(output, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_PutRegistryScanningConfigurationCommand = de_PutRegistryScanningConfigurationCommand; -const de_PutRegistryScanningConfigurationCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); +} +exports.InitiateLayerUploadCommand = InitiateLayerUploadCommand; + + +/***/ }), + +/***/ 3854: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ListImagesCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class ListImagesCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -}; -const de_PutReplicationConfigurationCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_PutReplicationConfigurationCommandError(output, context); + constructor(input) { + super(); + this.input = input; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_PutReplicationConfigurationCommand = de_PutReplicationConfigurationCommand; -const de_PutReplicationConfigurationCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, ListImagesCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "ListImagesCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "ListImages", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -}; -const de_SetRepositoryPolicyCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_SetRepositoryPolicyCommandError(output, context); + serialize(input, context) { + return (0, Aws_json1_1_1.se_ListImagesCommand)(input, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_SetRepositoryPolicyCommand = de_SetRepositoryPolicyCommand; -const de_SetRepositoryPolicyCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_ListImagesCommand)(output, context); } -}; -const de_StartImageScanCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_StartImageScanCommandError(output, context); +} +exports.ListImagesCommand = ListImagesCommand; + + +/***/ }), + +/***/ 97403: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ListTagsForResourceCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class ListTagsForResourceCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_StartImageScanCommand = de_StartImageScanCommand; -const de_StartImageScanCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "ImageNotFoundException": - case "com.amazonaws.ecr#ImageNotFoundException": - throw await de_ImageNotFoundExceptionRes(parsedOutput, context); - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "LimitExceededException": - case "com.amazonaws.ecr#LimitExceededException": - throw await de_LimitExceededExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "UnsupportedImageTypeException": - case "com.amazonaws.ecr#UnsupportedImageTypeException": - throw await de_UnsupportedImageTypeExceptionRes(parsedOutput, context); - case "ValidationException": - case "com.amazonaws.ecr#ValidationException": - throw await de_ValidationExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + constructor(input) { + super(); + this.input = input; } -}; -const de_StartLifecyclePolicyPreviewCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_StartLifecyclePolicyPreviewCommandError(output, context); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, ListTagsForResourceCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "ListTagsForResourceCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "ListTagsForResource", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_StartLifecyclePolicyPreviewCommand = de_StartLifecyclePolicyPreviewCommand; -const de_StartLifecyclePolicyPreviewCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "LifecyclePolicyNotFoundException": - case "com.amazonaws.ecr#LifecyclePolicyNotFoundException": - throw await de_LifecyclePolicyNotFoundExceptionRes(parsedOutput, context); - case "LifecyclePolicyPreviewInProgressException": - case "com.amazonaws.ecr#LifecyclePolicyPreviewInProgressException": - throw await de_LifecyclePolicyPreviewInProgressExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + serialize(input, context) { + return (0, Aws_json1_1_1.se_ListTagsForResourceCommand)(input, context); } -}; -const de_TagResourceCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_TagResourceCommandError(output, context); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_ListTagsForResourceCommand)(output, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_TagResourceCommand = de_TagResourceCommand; -const de_TagResourceCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "InvalidTagParameterException": - case "com.amazonaws.ecr#InvalidTagParameterException": - throw await de_InvalidTagParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "TooManyTagsException": - case "com.amazonaws.ecr#TooManyTagsException": - throw await de_TooManyTagsExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); +} +exports.ListTagsForResourceCommand = ListTagsForResourceCommand; + + +/***/ }), + +/***/ 66844: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.PutImageCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class PutImageCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; } -}; -const de_UntagResourceCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_UntagResourceCommandError(output, context); + constructor(input) { + super(); + this.input = input; } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_UntagResourceCommand = de_UntagResourceCommand; -const de_UntagResourceCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "InvalidTagParameterException": - case "com.amazonaws.ecr#InvalidTagParameterException": - throw await de_InvalidTagParameterExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "TooManyTagsException": - case "com.amazonaws.ecr#TooManyTagsException": - throw await de_TooManyTagsExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutImageCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "PutImageCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "PutImage", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } -}; -const de_UploadLayerPartCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_UploadLayerPartCommandError(output, context); + serialize(input, context) { + return (0, Aws_json1_1_1.se_PutImageCommand)(input, context); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = (0, smithy_client_1._json)(data); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_UploadLayerPartCommand = de_UploadLayerPartCommand; -const de_UploadLayerPartCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidLayerPartException": - case "com.amazonaws.ecr#InvalidLayerPartException": - throw await de_InvalidLayerPartExceptionRes(parsedOutput, context); - case "InvalidParameterException": - case "com.amazonaws.ecr#InvalidParameterException": - throw await de_InvalidParameterExceptionRes(parsedOutput, context); - case "KmsException": - case "com.amazonaws.ecr#KmsException": - throw await de_KmsExceptionRes(parsedOutput, context); - case "LimitExceededException": - case "com.amazonaws.ecr#LimitExceededException": - throw await de_LimitExceededExceptionRes(parsedOutput, context); - case "RepositoryNotFoundException": - case "com.amazonaws.ecr#RepositoryNotFoundException": - throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); - case "ServerException": - case "com.amazonaws.ecr#ServerException": - throw await de_ServerExceptionRes(parsedOutput, context); - case "UploadNotFoundException": - case "com.amazonaws.ecr#UploadNotFoundException": - throw await de_UploadNotFoundExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); + deserialize(output, context) { + return (0, Aws_json1_1_1.de_PutImageCommand)(output, context); } -}; -const de_EmptyUploadExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.EmptyUploadException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_ImageAlreadyExistsExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.ImageAlreadyExistsException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_ImageDigestDoesNotMatchExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.ImageDigestDoesNotMatchException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_ImageNotFoundExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.ImageNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_ImageTagAlreadyExistsExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.ImageTagAlreadyExistsException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_InvalidLayerExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.InvalidLayerException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_InvalidLayerPartExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.InvalidLayerPartException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_InvalidParameterExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.InvalidParameterException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_InvalidTagParameterExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.InvalidTagParameterException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_KmsExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.KmsException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_LayerAlreadyExistsExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.LayerAlreadyExistsException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_LayerInaccessibleExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.LayerInaccessibleException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_LayerPartTooSmallExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.LayerPartTooSmallException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_LayersNotFoundExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.LayersNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_LifecyclePolicyNotFoundExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.LifecyclePolicyNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_LifecyclePolicyPreviewInProgressExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.LifecyclePolicyPreviewInProgressException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_LifecyclePolicyPreviewNotFoundExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.LifecyclePolicyPreviewNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_LimitExceededExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.LimitExceededException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_PullThroughCacheRuleAlreadyExistsExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.PullThroughCacheRuleAlreadyExistsException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_PullThroughCacheRuleNotFoundExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.PullThroughCacheRuleNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_ReferencedImagesNotFoundExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.ReferencedImagesNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_RegistryPolicyNotFoundExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.RegistryPolicyNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_RepositoryAlreadyExistsExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.RepositoryAlreadyExistsException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_RepositoryNotEmptyExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.RepositoryNotEmptyException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_RepositoryNotFoundExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.RepositoryNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_RepositoryPolicyNotFoundExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.RepositoryPolicyNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_ScanNotFoundExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.ScanNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_ServerExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.ServerException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; +} +exports.PutImageCommand = PutImageCommand; + + +/***/ }), + +/***/ 87935: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.PutImageScanningConfigurationCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class PutImageScanningConfigurationCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutImageScanningConfigurationCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "PutImageScanningConfigurationCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "PutImageScanningConfiguration", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_PutImageScanningConfigurationCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_PutImageScanningConfigurationCommand)(output, context); + } +} +exports.PutImageScanningConfigurationCommand = PutImageScanningConfigurationCommand; + + +/***/ }), + +/***/ 66495: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.PutImageTagMutabilityCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class PutImageTagMutabilityCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutImageTagMutabilityCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "PutImageTagMutabilityCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "PutImageTagMutability", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_PutImageTagMutabilityCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_PutImageTagMutabilityCommand)(output, context); + } +} +exports.PutImageTagMutabilityCommand = PutImageTagMutabilityCommand; + + +/***/ }), + +/***/ 33854: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.PutLifecyclePolicyCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class PutLifecyclePolicyCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutLifecyclePolicyCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "PutLifecyclePolicyCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "PutLifecyclePolicy", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_PutLifecyclePolicyCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_PutLifecyclePolicyCommand)(output, context); + } +} +exports.PutLifecyclePolicyCommand = PutLifecyclePolicyCommand; + + +/***/ }), + +/***/ 97928: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.PutRegistryPolicyCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class PutRegistryPolicyCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutRegistryPolicyCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "PutRegistryPolicyCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "PutRegistryPolicy", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_PutRegistryPolicyCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_PutRegistryPolicyCommand)(output, context); + } +} +exports.PutRegistryPolicyCommand = PutRegistryPolicyCommand; + + +/***/ }), + +/***/ 29529: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.PutRegistryScanningConfigurationCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class PutRegistryScanningConfigurationCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutRegistryScanningConfigurationCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "PutRegistryScanningConfigurationCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "PutRegistryScanningConfiguration", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_PutRegistryScanningConfigurationCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_PutRegistryScanningConfigurationCommand)(output, context); + } +} +exports.PutRegistryScanningConfigurationCommand = PutRegistryScanningConfigurationCommand; + + +/***/ }), + +/***/ 14030: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.PutReplicationConfigurationCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class PutReplicationConfigurationCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, PutReplicationConfigurationCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "PutReplicationConfigurationCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "PutReplicationConfiguration", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_PutReplicationConfigurationCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_PutReplicationConfigurationCommand)(output, context); + } +} +exports.PutReplicationConfigurationCommand = PutReplicationConfigurationCommand; + + +/***/ }), + +/***/ 78300: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SetRepositoryPolicyCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class SetRepositoryPolicyCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, SetRepositoryPolicyCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "SetRepositoryPolicyCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "SetRepositoryPolicy", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_SetRepositoryPolicyCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_SetRepositoryPolicyCommand)(output, context); + } +} +exports.SetRepositoryPolicyCommand = SetRepositoryPolicyCommand; + + +/***/ }), + +/***/ 47984: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.StartImageScanCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class StartImageScanCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, StartImageScanCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "StartImageScanCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "StartImageScan", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_StartImageScanCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_StartImageScanCommand)(output, context); + } +} +exports.StartImageScanCommand = StartImageScanCommand; + + +/***/ }), + +/***/ 35905: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.StartLifecyclePolicyPreviewCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class StartLifecyclePolicyPreviewCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, StartLifecyclePolicyPreviewCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "StartLifecyclePolicyPreviewCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "StartLifecyclePolicyPreview", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_StartLifecyclePolicyPreviewCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_StartLifecyclePolicyPreviewCommand)(output, context); + } +} +exports.StartLifecyclePolicyPreviewCommand = StartLifecyclePolicyPreviewCommand; + + +/***/ }), + +/***/ 82665: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.TagResourceCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class TagResourceCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, TagResourceCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "TagResourceCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "TagResource", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_TagResourceCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_TagResourceCommand)(output, context); + } +} +exports.TagResourceCommand = TagResourceCommand; + + +/***/ }), + +/***/ 37225: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.UntagResourceCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class UntagResourceCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, UntagResourceCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "UntagResourceCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "UntagResource", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_UntagResourceCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_UntagResourceCommand)(output, context); + } +} +exports.UntagResourceCommand = UntagResourceCommand; + + +/***/ }), + +/***/ 55825: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.UploadLayerPartCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(5417); +const Aws_json1_1_1 = __nccwpck_require__(56704); +class UploadLayerPartCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, UploadLayerPartCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "ECRClient"; + const commandName = "UploadLayerPartCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AmazonEC2ContainerRegistry_V20150921", + operation: "UploadLayerPart", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_json1_1_1.se_UploadLayerPartCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_json1_1_1.de_UploadLayerPartCommand)(output, context); + } +} +exports.UploadLayerPartCommand = UploadLayerPartCommand; + + +/***/ }), + +/***/ 67407: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(63804), exports); +tslib_1.__exportStar(__nccwpck_require__(15511), exports); +tslib_1.__exportStar(__nccwpck_require__(78859), exports); +tslib_1.__exportStar(__nccwpck_require__(79728), exports); +tslib_1.__exportStar(__nccwpck_require__(49003), exports); +tslib_1.__exportStar(__nccwpck_require__(71454), exports); +tslib_1.__exportStar(__nccwpck_require__(5074), exports); +tslib_1.__exportStar(__nccwpck_require__(48981), exports); +tslib_1.__exportStar(__nccwpck_require__(83793), exports); +tslib_1.__exportStar(__nccwpck_require__(31424), exports); +tslib_1.__exportStar(__nccwpck_require__(88651), exports); +tslib_1.__exportStar(__nccwpck_require__(36828), exports); +tslib_1.__exportStar(__nccwpck_require__(39694), exports); +tslib_1.__exportStar(__nccwpck_require__(72987), exports); +tslib_1.__exportStar(__nccwpck_require__(95353), exports); +tslib_1.__exportStar(__nccwpck_require__(31484), exports); +tslib_1.__exportStar(__nccwpck_require__(26166), exports); +tslib_1.__exportStar(__nccwpck_require__(21200), exports); +tslib_1.__exportStar(__nccwpck_require__(35828), exports); +tslib_1.__exportStar(__nccwpck_require__(51401), exports); +tslib_1.__exportStar(__nccwpck_require__(48469), exports); +tslib_1.__exportStar(__nccwpck_require__(17006), exports); +tslib_1.__exportStar(__nccwpck_require__(33685), exports); +tslib_1.__exportStar(__nccwpck_require__(82741), exports); +tslib_1.__exportStar(__nccwpck_require__(46330), exports); +tslib_1.__exportStar(__nccwpck_require__(6936), exports); +tslib_1.__exportStar(__nccwpck_require__(3854), exports); +tslib_1.__exportStar(__nccwpck_require__(97403), exports); +tslib_1.__exportStar(__nccwpck_require__(66844), exports); +tslib_1.__exportStar(__nccwpck_require__(87935), exports); +tslib_1.__exportStar(__nccwpck_require__(66495), exports); +tslib_1.__exportStar(__nccwpck_require__(33854), exports); +tslib_1.__exportStar(__nccwpck_require__(97928), exports); +tslib_1.__exportStar(__nccwpck_require__(29529), exports); +tslib_1.__exportStar(__nccwpck_require__(14030), exports); +tslib_1.__exportStar(__nccwpck_require__(78300), exports); +tslib_1.__exportStar(__nccwpck_require__(47984), exports); +tslib_1.__exportStar(__nccwpck_require__(35905), exports); +tslib_1.__exportStar(__nccwpck_require__(82665), exports); +tslib_1.__exportStar(__nccwpck_require__(37225), exports); +tslib_1.__exportStar(__nccwpck_require__(55825), exports); + + +/***/ }), + +/***/ 49729: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveClientEndpointParameters = void 0; +const resolveClientEndpointParameters = (options) => { + return { + ...options, + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + defaultSigningName: "ecr", + }; +}; +exports.resolveClientEndpointParameters = resolveClientEndpointParameters; + + +/***/ }), + +/***/ 61610: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultEndpointResolver = void 0; +const util_endpoints_1 = __nccwpck_require__(13350); +const ruleset_1 = __nccwpck_require__(64053); +const defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_1.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams: endpointParams, + logger: context.logger, + }); +}; +exports.defaultEndpointResolver = defaultEndpointResolver; + + +/***/ }), + +/***/ 64053: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ruleSet = void 0; +const t = "required", u = "fn", v = "argv", w = "ref"; +const a = "isSet", b = "tree", c = "error", d = "endpoint", e = "PartitionResult", f = "stringEquals", g = { [t]: false, "type": "String" }, h = { [t]: true, "default": false, "type": "Boolean" }, i = { [w]: "Endpoint" }, j = { [u]: "booleanEquals", [v]: [{ [w]: "UseFIPS" }, true] }, k = { [u]: "booleanEquals", [v]: [{ [w]: "UseDualStack" }, true] }, l = {}, m = { [u]: "booleanEquals", [v]: [true, { [u]: "getAttr", [v]: [{ [w]: e }, "supportsFIPS"] }] }, n = { [u]: "booleanEquals", [v]: [true, { [u]: "getAttr", [v]: [{ [w]: e }, "supportsDualStack"] }] }, o = { [u]: "getAttr", [v]: [{ [w]: e }, "name"] }, p = { "url": "https://ecr-fips.{Region}.amazonaws.com", "properties": {}, "headers": {} }, q = [j], r = [k], s = [{ [w]: "Region" }]; +const _data = { version: "1.0", parameters: { Region: g, UseDualStack: h, UseFIPS: h, Endpoint: g }, rules: [{ conditions: [{ [u]: a, [v]: [i] }], type: b, rules: [{ conditions: q, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: c }, { conditions: r, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: c }, { endpoint: { url: i, properties: l, headers: l }, type: d }] }, { conditions: [{ [u]: a, [v]: s }], type: b, rules: [{ conditions: [{ [u]: "aws.partition", [v]: s, assign: e }], type: b, rules: [{ conditions: [j, k], type: b, rules: [{ conditions: [m, n], type: b, rules: [{ endpoint: { url: "https://api.ecr-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: l, headers: l }, type: d }] }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: c }] }, { conditions: q, type: b, rules: [{ conditions: [m], type: b, rules: [{ conditions: [{ [u]: f, [v]: ["aws", o] }], endpoint: p, type: d }, { conditions: [{ [u]: f, [v]: ["aws-us-gov", o] }], endpoint: p, type: d }, { endpoint: { url: "https://api.ecr-fips.{Region}.{PartitionResult#dnsSuffix}", properties: l, headers: l }, type: d }] }, { error: "FIPS is enabled but this partition does not support FIPS", type: c }] }, { conditions: r, type: b, rules: [{ conditions: [n], type: b, rules: [{ endpoint: { url: "https://api.ecr.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: l, headers: l }, type: d }] }, { error: "DualStack is enabled but this partition does not support DualStack", type: c }] }, { endpoint: { url: "https://api.ecr.{Region}.{PartitionResult#dnsSuffix}", properties: l, headers: l }, type: d }] }] }, { error: "Invalid Configuration: Missing Region", type: c }] }; +exports.ruleSet = _data; + + +/***/ }), + +/***/ 8923: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ECRServiceException = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(83391), exports); +tslib_1.__exportStar(__nccwpck_require__(59167), exports); +tslib_1.__exportStar(__nccwpck_require__(67407), exports); +tslib_1.__exportStar(__nccwpck_require__(35356), exports); +tslib_1.__exportStar(__nccwpck_require__(28406), exports); +tslib_1.__exportStar(__nccwpck_require__(57451), exports); +var ECRServiceException_1 = __nccwpck_require__(11610); +Object.defineProperty(exports, "ECRServiceException", ({ enumerable: true, get: function () { return ECRServiceException_1.ECRServiceException; } })); + + +/***/ }), + +/***/ 11610: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ECRServiceException = exports.__ServiceException = void 0; +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "__ServiceException", ({ enumerable: true, get: function () { return smithy_client_1.ServiceException; } })); +class ECRServiceException extends smithy_client_1.ServiceException { + constructor(options) { + super(options); + Object.setPrototypeOf(this, ECRServiceException.prototype); + } +} +exports.ECRServiceException = ECRServiceException; + + +/***/ }), + +/***/ 57451: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(79088), exports); + + +/***/ }), + +/***/ 79088: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.InvalidLayerPartException = exports.LifecyclePolicyPreviewInProgressException = exports.UnsupportedImageTypeException = exports.ReferencedImagesNotFoundException = exports.ImageTagAlreadyExistsException = exports.ImageDigestDoesNotMatchException = exports.ImageAlreadyExistsException = exports.ScanType = exports.LifecyclePolicyPreviewNotFoundException = exports.LifecyclePolicyPreviewStatus = exports.ImageActionType = exports.LayersNotFoundException = exports.LayerInaccessibleException = exports.RepositoryFilterType = exports.ScanNotFoundException = exports.ScanStatus = exports.FindingSeverity = exports.TagStatus = exports.ImageNotFoundException = exports.ReplicationStatus = exports.RepositoryPolicyNotFoundException = exports.RepositoryNotEmptyException = exports.RegistryPolicyNotFoundException = exports.PullThroughCacheRuleNotFoundException = exports.LifecyclePolicyNotFoundException = exports.TooManyTagsException = exports.RepositoryAlreadyExistsException = exports.InvalidTagParameterException = exports.ImageTagMutability = exports.EncryptionType = exports.UnsupportedUpstreamRegistryException = exports.PullThroughCacheRuleAlreadyExistsException = exports.LimitExceededException = exports.UploadNotFoundException = exports.LayerPartTooSmallException = exports.LayerAlreadyExistsException = exports.KmsException = exports.InvalidLayerException = exports.EmptyUploadException = exports.ValidationException = exports.ScanFrequency = exports.ScanningRepositoryFilterType = exports.ScanningConfigurationFailureCode = exports.ImageFailureCode = exports.ServerException = exports.RepositoryNotFoundException = exports.InvalidParameterException = exports.LayerAvailability = exports.LayerFailureCode = void 0; +const ECRServiceException_1 = __nccwpck_require__(11610); +exports.LayerFailureCode = { + InvalidLayerDigest: "InvalidLayerDigest", + MissingLayerDigest: "MissingLayerDigest", +}; +exports.LayerAvailability = { + AVAILABLE: "AVAILABLE", + UNAVAILABLE: "UNAVAILABLE", +}; +class InvalidParameterException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "InvalidParameterException", + $fault: "client", + ...opts, + }); + this.name = "InvalidParameterException"; + this.$fault = "client"; + Object.setPrototypeOf(this, InvalidParameterException.prototype); + } +} +exports.InvalidParameterException = InvalidParameterException; +class RepositoryNotFoundException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "RepositoryNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "RepositoryNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, RepositoryNotFoundException.prototype); + } +} +exports.RepositoryNotFoundException = RepositoryNotFoundException; +class ServerException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "ServerException", + $fault: "server", + ...opts, + }); + this.name = "ServerException"; + this.$fault = "server"; + Object.setPrototypeOf(this, ServerException.prototype); + } +} +exports.ServerException = ServerException; +exports.ImageFailureCode = { + ImageNotFound: "ImageNotFound", + ImageReferencedByManifestList: "ImageReferencedByManifestList", + ImageTagDoesNotMatchDigest: "ImageTagDoesNotMatchDigest", + InvalidImageDigest: "InvalidImageDigest", + InvalidImageTag: "InvalidImageTag", + KmsError: "KmsError", + MissingDigestAndTag: "MissingDigestAndTag", +}; +exports.ScanningConfigurationFailureCode = { + REPOSITORY_NOT_FOUND: "REPOSITORY_NOT_FOUND", +}; +exports.ScanningRepositoryFilterType = { + WILDCARD: "WILDCARD", +}; +exports.ScanFrequency = { + CONTINUOUS_SCAN: "CONTINUOUS_SCAN", + MANUAL: "MANUAL", + SCAN_ON_PUSH: "SCAN_ON_PUSH", +}; +class ValidationException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "ValidationException", + $fault: "client", + ...opts, + }); + this.name = "ValidationException"; + this.$fault = "client"; + Object.setPrototypeOf(this, ValidationException.prototype); + } +} +exports.ValidationException = ValidationException; +class EmptyUploadException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "EmptyUploadException", + $fault: "client", + ...opts, + }); + this.name = "EmptyUploadException"; + this.$fault = "client"; + Object.setPrototypeOf(this, EmptyUploadException.prototype); + } +} +exports.EmptyUploadException = EmptyUploadException; +class InvalidLayerException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "InvalidLayerException", + $fault: "client", + ...opts, + }); + this.name = "InvalidLayerException"; + this.$fault = "client"; + Object.setPrototypeOf(this, InvalidLayerException.prototype); + } +} +exports.InvalidLayerException = InvalidLayerException; +class KmsException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "KmsException", + $fault: "client", + ...opts, + }); + this.name = "KmsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, KmsException.prototype); + this.kmsError = opts.kmsError; + } +} +exports.KmsException = KmsException; +class LayerAlreadyExistsException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "LayerAlreadyExistsException", + $fault: "client", + ...opts, + }); + this.name = "LayerAlreadyExistsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, LayerAlreadyExistsException.prototype); + } +} +exports.LayerAlreadyExistsException = LayerAlreadyExistsException; +class LayerPartTooSmallException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "LayerPartTooSmallException", + $fault: "client", + ...opts, + }); + this.name = "LayerPartTooSmallException"; + this.$fault = "client"; + Object.setPrototypeOf(this, LayerPartTooSmallException.prototype); + } +} +exports.LayerPartTooSmallException = LayerPartTooSmallException; +class UploadNotFoundException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "UploadNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "UploadNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, UploadNotFoundException.prototype); + } +} +exports.UploadNotFoundException = UploadNotFoundException; +class LimitExceededException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "LimitExceededException", + $fault: "client", + ...opts, + }); + this.name = "LimitExceededException"; + this.$fault = "client"; + Object.setPrototypeOf(this, LimitExceededException.prototype); + } +} +exports.LimitExceededException = LimitExceededException; +class PullThroughCacheRuleAlreadyExistsException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "PullThroughCacheRuleAlreadyExistsException", + $fault: "client", + ...opts, + }); + this.name = "PullThroughCacheRuleAlreadyExistsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, PullThroughCacheRuleAlreadyExistsException.prototype); + } +} +exports.PullThroughCacheRuleAlreadyExistsException = PullThroughCacheRuleAlreadyExistsException; +class UnsupportedUpstreamRegistryException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "UnsupportedUpstreamRegistryException", + $fault: "client", + ...opts, + }); + this.name = "UnsupportedUpstreamRegistryException"; + this.$fault = "client"; + Object.setPrototypeOf(this, UnsupportedUpstreamRegistryException.prototype); + } +} +exports.UnsupportedUpstreamRegistryException = UnsupportedUpstreamRegistryException; +exports.EncryptionType = { + AES256: "AES256", + KMS: "KMS", +}; +exports.ImageTagMutability = { + IMMUTABLE: "IMMUTABLE", + MUTABLE: "MUTABLE", +}; +class InvalidTagParameterException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "InvalidTagParameterException", + $fault: "client", + ...opts, + }); + this.name = "InvalidTagParameterException"; + this.$fault = "client"; + Object.setPrototypeOf(this, InvalidTagParameterException.prototype); + } +} +exports.InvalidTagParameterException = InvalidTagParameterException; +class RepositoryAlreadyExistsException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "RepositoryAlreadyExistsException", + $fault: "client", + ...opts, + }); + this.name = "RepositoryAlreadyExistsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, RepositoryAlreadyExistsException.prototype); + } +} +exports.RepositoryAlreadyExistsException = RepositoryAlreadyExistsException; +class TooManyTagsException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "TooManyTagsException", + $fault: "client", + ...opts, + }); + this.name = "TooManyTagsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, TooManyTagsException.prototype); + } +} +exports.TooManyTagsException = TooManyTagsException; +class LifecyclePolicyNotFoundException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "LifecyclePolicyNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "LifecyclePolicyNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, LifecyclePolicyNotFoundException.prototype); + } +} +exports.LifecyclePolicyNotFoundException = LifecyclePolicyNotFoundException; +class PullThroughCacheRuleNotFoundException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "PullThroughCacheRuleNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "PullThroughCacheRuleNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, PullThroughCacheRuleNotFoundException.prototype); + } +} +exports.PullThroughCacheRuleNotFoundException = PullThroughCacheRuleNotFoundException; +class RegistryPolicyNotFoundException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "RegistryPolicyNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "RegistryPolicyNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, RegistryPolicyNotFoundException.prototype); + } +} +exports.RegistryPolicyNotFoundException = RegistryPolicyNotFoundException; +class RepositoryNotEmptyException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "RepositoryNotEmptyException", + $fault: "client", + ...opts, + }); + this.name = "RepositoryNotEmptyException"; + this.$fault = "client"; + Object.setPrototypeOf(this, RepositoryNotEmptyException.prototype); + } +} +exports.RepositoryNotEmptyException = RepositoryNotEmptyException; +class RepositoryPolicyNotFoundException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "RepositoryPolicyNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "RepositoryPolicyNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, RepositoryPolicyNotFoundException.prototype); + } +} +exports.RepositoryPolicyNotFoundException = RepositoryPolicyNotFoundException; +exports.ReplicationStatus = { + COMPLETE: "COMPLETE", + FAILED: "FAILED", + IN_PROGRESS: "IN_PROGRESS", +}; +class ImageNotFoundException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "ImageNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "ImageNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, ImageNotFoundException.prototype); + } +} +exports.ImageNotFoundException = ImageNotFoundException; +exports.TagStatus = { + ANY: "ANY", + TAGGED: "TAGGED", + UNTAGGED: "UNTAGGED", +}; +exports.FindingSeverity = { + CRITICAL: "CRITICAL", + HIGH: "HIGH", + INFORMATIONAL: "INFORMATIONAL", + LOW: "LOW", + MEDIUM: "MEDIUM", + UNDEFINED: "UNDEFINED", +}; +exports.ScanStatus = { + ACTIVE: "ACTIVE", + COMPLETE: "COMPLETE", + FAILED: "FAILED", + FINDINGS_UNAVAILABLE: "FINDINGS_UNAVAILABLE", + IN_PROGRESS: "IN_PROGRESS", + PENDING: "PENDING", + SCAN_ELIGIBILITY_EXPIRED: "SCAN_ELIGIBILITY_EXPIRED", + UNSUPPORTED_IMAGE: "UNSUPPORTED_IMAGE", +}; +class ScanNotFoundException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "ScanNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "ScanNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, ScanNotFoundException.prototype); + } +} +exports.ScanNotFoundException = ScanNotFoundException; +exports.RepositoryFilterType = { + PREFIX_MATCH: "PREFIX_MATCH", +}; +class LayerInaccessibleException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "LayerInaccessibleException", + $fault: "client", + ...opts, + }); + this.name = "LayerInaccessibleException"; + this.$fault = "client"; + Object.setPrototypeOf(this, LayerInaccessibleException.prototype); + } +} +exports.LayerInaccessibleException = LayerInaccessibleException; +class LayersNotFoundException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "LayersNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "LayersNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, LayersNotFoundException.prototype); + } +} +exports.LayersNotFoundException = LayersNotFoundException; +exports.ImageActionType = { + EXPIRE: "EXPIRE", +}; +exports.LifecyclePolicyPreviewStatus = { + COMPLETE: "COMPLETE", + EXPIRED: "EXPIRED", + FAILED: "FAILED", + IN_PROGRESS: "IN_PROGRESS", +}; +class LifecyclePolicyPreviewNotFoundException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "LifecyclePolicyPreviewNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "LifecyclePolicyPreviewNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, LifecyclePolicyPreviewNotFoundException.prototype); + } +} +exports.LifecyclePolicyPreviewNotFoundException = LifecyclePolicyPreviewNotFoundException; +exports.ScanType = { + BASIC: "BASIC", + ENHANCED: "ENHANCED", +}; +class ImageAlreadyExistsException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "ImageAlreadyExistsException", + $fault: "client", + ...opts, + }); + this.name = "ImageAlreadyExistsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, ImageAlreadyExistsException.prototype); + } +} +exports.ImageAlreadyExistsException = ImageAlreadyExistsException; +class ImageDigestDoesNotMatchException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "ImageDigestDoesNotMatchException", + $fault: "client", + ...opts, + }); + this.name = "ImageDigestDoesNotMatchException"; + this.$fault = "client"; + Object.setPrototypeOf(this, ImageDigestDoesNotMatchException.prototype); + } +} +exports.ImageDigestDoesNotMatchException = ImageDigestDoesNotMatchException; +class ImageTagAlreadyExistsException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "ImageTagAlreadyExistsException", + $fault: "client", + ...opts, + }); + this.name = "ImageTagAlreadyExistsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, ImageTagAlreadyExistsException.prototype); + } +} +exports.ImageTagAlreadyExistsException = ImageTagAlreadyExistsException; +class ReferencedImagesNotFoundException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "ReferencedImagesNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "ReferencedImagesNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, ReferencedImagesNotFoundException.prototype); + } +} +exports.ReferencedImagesNotFoundException = ReferencedImagesNotFoundException; +class UnsupportedImageTypeException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "UnsupportedImageTypeException", + $fault: "client", + ...opts, + }); + this.name = "UnsupportedImageTypeException"; + this.$fault = "client"; + Object.setPrototypeOf(this, UnsupportedImageTypeException.prototype); + } +} +exports.UnsupportedImageTypeException = UnsupportedImageTypeException; +class LifecyclePolicyPreviewInProgressException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "LifecyclePolicyPreviewInProgressException", + $fault: "client", + ...opts, + }); + this.name = "LifecyclePolicyPreviewInProgressException"; + this.$fault = "client"; + Object.setPrototypeOf(this, LifecyclePolicyPreviewInProgressException.prototype); + } +} +exports.LifecyclePolicyPreviewInProgressException = LifecyclePolicyPreviewInProgressException; +class InvalidLayerPartException extends ECRServiceException_1.ECRServiceException { + constructor(opts) { + super({ + name: "InvalidLayerPartException", + $fault: "client", + ...opts, + }); + this.name = "InvalidLayerPartException"; + this.$fault = "client"; + Object.setPrototypeOf(this, InvalidLayerPartException.prototype); + this.registryId = opts.registryId; + this.repositoryName = opts.repositoryName; + this.uploadId = opts.uploadId; + this.lastValidByteReceived = opts.lastValidByteReceived; + } +} +exports.InvalidLayerPartException = InvalidLayerPartException; + + +/***/ }), + +/***/ 58624: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.paginateDescribeImageScanFindings = void 0; +const DescribeImageScanFindingsCommand_1 = __nccwpck_require__(72987); +const ECRClient_1 = __nccwpck_require__(83391); +const makePagedClientRequest = async (client, input, ...args) => { + return await client.send(new DescribeImageScanFindingsCommand_1.DescribeImageScanFindingsCommand(input), ...args); +}; +async function* paginateDescribeImageScanFindings(config, input, ...additionalArguments) { + let token = config.startingToken || undefined; + let hasNext = true; + let page; + while (hasNext) { + input.nextToken = token; + input["maxResults"] = config.pageSize; + if (config.client instanceof ECRClient_1.ECRClient) { + page = await makePagedClientRequest(config.client, input, ...additionalArguments); + } + else { + throw new Error("Invalid client, expected ECR | ECRClient"); + } + yield page; + const prevToken = token; + token = page.nextToken; + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return undefined; +} +exports.paginateDescribeImageScanFindings = paginateDescribeImageScanFindings; + + +/***/ }), + +/***/ 51351: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.paginateDescribeImages = void 0; +const DescribeImagesCommand_1 = __nccwpck_require__(95353); +const ECRClient_1 = __nccwpck_require__(83391); +const makePagedClientRequest = async (client, input, ...args) => { + return await client.send(new DescribeImagesCommand_1.DescribeImagesCommand(input), ...args); +}; +async function* paginateDescribeImages(config, input, ...additionalArguments) { + let token = config.startingToken || undefined; + let hasNext = true; + let page; + while (hasNext) { + input.nextToken = token; + input["maxResults"] = config.pageSize; + if (config.client instanceof ECRClient_1.ECRClient) { + page = await makePagedClientRequest(config.client, input, ...additionalArguments); + } + else { + throw new Error("Invalid client, expected ECR | ECRClient"); + } + yield page; + const prevToken = token; + token = page.nextToken; + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return undefined; +} +exports.paginateDescribeImages = paginateDescribeImages; + + +/***/ }), + +/***/ 59589: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.paginateDescribePullThroughCacheRules = void 0; +const DescribePullThroughCacheRulesCommand_1 = __nccwpck_require__(31484); +const ECRClient_1 = __nccwpck_require__(83391); +const makePagedClientRequest = async (client, input, ...args) => { + return await client.send(new DescribePullThroughCacheRulesCommand_1.DescribePullThroughCacheRulesCommand(input), ...args); +}; +async function* paginateDescribePullThroughCacheRules(config, input, ...additionalArguments) { + let token = config.startingToken || undefined; + let hasNext = true; + let page; + while (hasNext) { + input.nextToken = token; + input["maxResults"] = config.pageSize; + if (config.client instanceof ECRClient_1.ECRClient) { + page = await makePagedClientRequest(config.client, input, ...additionalArguments); + } + else { + throw new Error("Invalid client, expected ECR | ECRClient"); + } + yield page; + const prevToken = token; + token = page.nextToken; + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return undefined; +} +exports.paginateDescribePullThroughCacheRules = paginateDescribePullThroughCacheRules; + + +/***/ }), + +/***/ 16404: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.paginateDescribeRepositories = void 0; +const DescribeRepositoriesCommand_1 = __nccwpck_require__(21200); +const ECRClient_1 = __nccwpck_require__(83391); +const makePagedClientRequest = async (client, input, ...args) => { + return await client.send(new DescribeRepositoriesCommand_1.DescribeRepositoriesCommand(input), ...args); +}; +async function* paginateDescribeRepositories(config, input, ...additionalArguments) { + let token = config.startingToken || undefined; + let hasNext = true; + let page; + while (hasNext) { + input.nextToken = token; + input["maxResults"] = config.pageSize; + if (config.client instanceof ECRClient_1.ECRClient) { + page = await makePagedClientRequest(config.client, input, ...additionalArguments); + } + else { + throw new Error("Invalid client, expected ECR | ECRClient"); + } + yield page; + const prevToken = token; + token = page.nextToken; + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return undefined; +} +exports.paginateDescribeRepositories = paginateDescribeRepositories; + + +/***/ }), + +/***/ 50987: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.paginateGetLifecyclePolicyPreview = void 0; +const GetLifecyclePolicyPreviewCommand_1 = __nccwpck_require__(17006); +const ECRClient_1 = __nccwpck_require__(83391); +const makePagedClientRequest = async (client, input, ...args) => { + return await client.send(new GetLifecyclePolicyPreviewCommand_1.GetLifecyclePolicyPreviewCommand(input), ...args); +}; +async function* paginateGetLifecyclePolicyPreview(config, input, ...additionalArguments) { + let token = config.startingToken || undefined; + let hasNext = true; + let page; + while (hasNext) { + input.nextToken = token; + input["maxResults"] = config.pageSize; + if (config.client instanceof ECRClient_1.ECRClient) { + page = await makePagedClientRequest(config.client, input, ...additionalArguments); + } + else { + throw new Error("Invalid client, expected ECR | ECRClient"); + } + yield page; + const prevToken = token; + token = page.nextToken; + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return undefined; +} +exports.paginateGetLifecyclePolicyPreview = paginateGetLifecyclePolicyPreview; + + +/***/ }), + +/***/ 9010: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 1066: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.paginateListImages = void 0; +const ListImagesCommand_1 = __nccwpck_require__(3854); +const ECRClient_1 = __nccwpck_require__(83391); +const makePagedClientRequest = async (client, input, ...args) => { + return await client.send(new ListImagesCommand_1.ListImagesCommand(input), ...args); +}; +async function* paginateListImages(config, input, ...additionalArguments) { + let token = config.startingToken || undefined; + let hasNext = true; + let page; + while (hasNext) { + input.nextToken = token; + input["maxResults"] = config.pageSize; + if (config.client instanceof ECRClient_1.ECRClient) { + page = await makePagedClientRequest(config.client, input, ...additionalArguments); + } + else { + throw new Error("Invalid client, expected ECR | ECRClient"); + } + yield page; + const prevToken = token; + token = page.nextToken; + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return undefined; +} +exports.paginateListImages = paginateListImages; + + +/***/ }), + +/***/ 35356: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(58624), exports); +tslib_1.__exportStar(__nccwpck_require__(51351), exports); +tslib_1.__exportStar(__nccwpck_require__(59589), exports); +tslib_1.__exportStar(__nccwpck_require__(16404), exports); +tslib_1.__exportStar(__nccwpck_require__(50987), exports); +tslib_1.__exportStar(__nccwpck_require__(9010), exports); +tslib_1.__exportStar(__nccwpck_require__(1066), exports); + + +/***/ }), + +/***/ 56704: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.de_DeletePullThroughCacheRuleCommand = exports.de_DeleteLifecyclePolicyCommand = exports.de_CreateRepositoryCommand = exports.de_CreatePullThroughCacheRuleCommand = exports.de_CompleteLayerUploadCommand = exports.de_BatchGetRepositoryScanningConfigurationCommand = exports.de_BatchGetImageCommand = exports.de_BatchDeleteImageCommand = exports.de_BatchCheckLayerAvailabilityCommand = exports.se_UploadLayerPartCommand = exports.se_UntagResourceCommand = exports.se_TagResourceCommand = exports.se_StartLifecyclePolicyPreviewCommand = exports.se_StartImageScanCommand = exports.se_SetRepositoryPolicyCommand = exports.se_PutReplicationConfigurationCommand = exports.se_PutRegistryScanningConfigurationCommand = exports.se_PutRegistryPolicyCommand = exports.se_PutLifecyclePolicyCommand = exports.se_PutImageTagMutabilityCommand = exports.se_PutImageScanningConfigurationCommand = exports.se_PutImageCommand = exports.se_ListTagsForResourceCommand = exports.se_ListImagesCommand = exports.se_InitiateLayerUploadCommand = exports.se_GetRepositoryPolicyCommand = exports.se_GetRegistryScanningConfigurationCommand = exports.se_GetRegistryPolicyCommand = exports.se_GetLifecyclePolicyPreviewCommand = exports.se_GetLifecyclePolicyCommand = exports.se_GetDownloadUrlForLayerCommand = exports.se_GetAuthorizationTokenCommand = exports.se_DescribeRepositoriesCommand = exports.se_DescribeRegistryCommand = exports.se_DescribePullThroughCacheRulesCommand = exports.se_DescribeImageScanFindingsCommand = exports.se_DescribeImagesCommand = exports.se_DescribeImageReplicationStatusCommand = exports.se_DeleteRepositoryPolicyCommand = exports.se_DeleteRepositoryCommand = exports.se_DeleteRegistryPolicyCommand = exports.se_DeletePullThroughCacheRuleCommand = exports.se_DeleteLifecyclePolicyCommand = exports.se_CreateRepositoryCommand = exports.se_CreatePullThroughCacheRuleCommand = exports.se_CompleteLayerUploadCommand = exports.se_BatchGetRepositoryScanningConfigurationCommand = exports.se_BatchGetImageCommand = exports.se_BatchDeleteImageCommand = exports.se_BatchCheckLayerAvailabilityCommand = void 0; +exports.de_UploadLayerPartCommand = exports.de_UntagResourceCommand = exports.de_TagResourceCommand = exports.de_StartLifecyclePolicyPreviewCommand = exports.de_StartImageScanCommand = exports.de_SetRepositoryPolicyCommand = exports.de_PutReplicationConfigurationCommand = exports.de_PutRegistryScanningConfigurationCommand = exports.de_PutRegistryPolicyCommand = exports.de_PutLifecyclePolicyCommand = exports.de_PutImageTagMutabilityCommand = exports.de_PutImageScanningConfigurationCommand = exports.de_PutImageCommand = exports.de_ListTagsForResourceCommand = exports.de_ListImagesCommand = exports.de_InitiateLayerUploadCommand = exports.de_GetRepositoryPolicyCommand = exports.de_GetRegistryScanningConfigurationCommand = exports.de_GetRegistryPolicyCommand = exports.de_GetLifecyclePolicyPreviewCommand = exports.de_GetLifecyclePolicyCommand = exports.de_GetDownloadUrlForLayerCommand = exports.de_GetAuthorizationTokenCommand = exports.de_DescribeRepositoriesCommand = exports.de_DescribeRegistryCommand = exports.de_DescribePullThroughCacheRulesCommand = exports.de_DescribeImageScanFindingsCommand = exports.de_DescribeImagesCommand = exports.de_DescribeImageReplicationStatusCommand = exports.de_DeleteRepositoryPolicyCommand = exports.de_DeleteRepositoryCommand = exports.de_DeleteRegistryPolicyCommand = void 0; +const protocol_http_1 = __nccwpck_require__(82473); +const smithy_client_1 = __nccwpck_require__(63570); +const ECRServiceException_1 = __nccwpck_require__(11610); +const models_0_1 = __nccwpck_require__(79088); +const se_BatchCheckLayerAvailabilityCommand = async (input, context) => { + const headers = sharedHeaders("BatchCheckLayerAvailability"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_BatchCheckLayerAvailabilityCommand = se_BatchCheckLayerAvailabilityCommand; +const se_BatchDeleteImageCommand = async (input, context) => { + const headers = sharedHeaders("BatchDeleteImage"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_BatchDeleteImageCommand = se_BatchDeleteImageCommand; +const se_BatchGetImageCommand = async (input, context) => { + const headers = sharedHeaders("BatchGetImage"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_BatchGetImageCommand = se_BatchGetImageCommand; +const se_BatchGetRepositoryScanningConfigurationCommand = async (input, context) => { + const headers = sharedHeaders("BatchGetRepositoryScanningConfiguration"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_BatchGetRepositoryScanningConfigurationCommand = se_BatchGetRepositoryScanningConfigurationCommand; +const se_CompleteLayerUploadCommand = async (input, context) => { + const headers = sharedHeaders("CompleteLayerUpload"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_CompleteLayerUploadCommand = se_CompleteLayerUploadCommand; +const se_CreatePullThroughCacheRuleCommand = async (input, context) => { + const headers = sharedHeaders("CreatePullThroughCacheRule"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_CreatePullThroughCacheRuleCommand = se_CreatePullThroughCacheRuleCommand; +const se_CreateRepositoryCommand = async (input, context) => { + const headers = sharedHeaders("CreateRepository"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_CreateRepositoryCommand = se_CreateRepositoryCommand; +const se_DeleteLifecyclePolicyCommand = async (input, context) => { + const headers = sharedHeaders("DeleteLifecyclePolicy"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_DeleteLifecyclePolicyCommand = se_DeleteLifecyclePolicyCommand; +const se_DeletePullThroughCacheRuleCommand = async (input, context) => { + const headers = sharedHeaders("DeletePullThroughCacheRule"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_DeletePullThroughCacheRuleCommand = se_DeletePullThroughCacheRuleCommand; +const se_DeleteRegistryPolicyCommand = async (input, context) => { + const headers = sharedHeaders("DeleteRegistryPolicy"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_DeleteRegistryPolicyCommand = se_DeleteRegistryPolicyCommand; +const se_DeleteRepositoryCommand = async (input, context) => { + const headers = sharedHeaders("DeleteRepository"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_DeleteRepositoryCommand = se_DeleteRepositoryCommand; +const se_DeleteRepositoryPolicyCommand = async (input, context) => { + const headers = sharedHeaders("DeleteRepositoryPolicy"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_DeleteRepositoryPolicyCommand = se_DeleteRepositoryPolicyCommand; +const se_DescribeImageReplicationStatusCommand = async (input, context) => { + const headers = sharedHeaders("DescribeImageReplicationStatus"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_DescribeImageReplicationStatusCommand = se_DescribeImageReplicationStatusCommand; +const se_DescribeImagesCommand = async (input, context) => { + const headers = sharedHeaders("DescribeImages"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_DescribeImagesCommand = se_DescribeImagesCommand; +const se_DescribeImageScanFindingsCommand = async (input, context) => { + const headers = sharedHeaders("DescribeImageScanFindings"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_DescribeImageScanFindingsCommand = se_DescribeImageScanFindingsCommand; +const se_DescribePullThroughCacheRulesCommand = async (input, context) => { + const headers = sharedHeaders("DescribePullThroughCacheRules"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_DescribePullThroughCacheRulesCommand = se_DescribePullThroughCacheRulesCommand; +const se_DescribeRegistryCommand = async (input, context) => { + const headers = sharedHeaders("DescribeRegistry"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_DescribeRegistryCommand = se_DescribeRegistryCommand; +const se_DescribeRepositoriesCommand = async (input, context) => { + const headers = sharedHeaders("DescribeRepositories"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_DescribeRepositoriesCommand = se_DescribeRepositoriesCommand; +const se_GetAuthorizationTokenCommand = async (input, context) => { + const headers = sharedHeaders("GetAuthorizationToken"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_GetAuthorizationTokenCommand = se_GetAuthorizationTokenCommand; +const se_GetDownloadUrlForLayerCommand = async (input, context) => { + const headers = sharedHeaders("GetDownloadUrlForLayer"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_GetDownloadUrlForLayerCommand = se_GetDownloadUrlForLayerCommand; +const se_GetLifecyclePolicyCommand = async (input, context) => { + const headers = sharedHeaders("GetLifecyclePolicy"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_GetLifecyclePolicyCommand = se_GetLifecyclePolicyCommand; +const se_GetLifecyclePolicyPreviewCommand = async (input, context) => { + const headers = sharedHeaders("GetLifecyclePolicyPreview"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_GetLifecyclePolicyPreviewCommand = se_GetLifecyclePolicyPreviewCommand; +const se_GetRegistryPolicyCommand = async (input, context) => { + const headers = sharedHeaders("GetRegistryPolicy"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_GetRegistryPolicyCommand = se_GetRegistryPolicyCommand; +const se_GetRegistryScanningConfigurationCommand = async (input, context) => { + const headers = sharedHeaders("GetRegistryScanningConfiguration"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_GetRegistryScanningConfigurationCommand = se_GetRegistryScanningConfigurationCommand; +const se_GetRepositoryPolicyCommand = async (input, context) => { + const headers = sharedHeaders("GetRepositoryPolicy"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_GetRepositoryPolicyCommand = se_GetRepositoryPolicyCommand; +const se_InitiateLayerUploadCommand = async (input, context) => { + const headers = sharedHeaders("InitiateLayerUpload"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_InitiateLayerUploadCommand = se_InitiateLayerUploadCommand; +const se_ListImagesCommand = async (input, context) => { + const headers = sharedHeaders("ListImages"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_ListImagesCommand = se_ListImagesCommand; +const se_ListTagsForResourceCommand = async (input, context) => { + const headers = sharedHeaders("ListTagsForResource"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_ListTagsForResourceCommand = se_ListTagsForResourceCommand; +const se_PutImageCommand = async (input, context) => { + const headers = sharedHeaders("PutImage"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_PutImageCommand = se_PutImageCommand; +const se_PutImageScanningConfigurationCommand = async (input, context) => { + const headers = sharedHeaders("PutImageScanningConfiguration"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_PutImageScanningConfigurationCommand = se_PutImageScanningConfigurationCommand; +const se_PutImageTagMutabilityCommand = async (input, context) => { + const headers = sharedHeaders("PutImageTagMutability"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_PutImageTagMutabilityCommand = se_PutImageTagMutabilityCommand; +const se_PutLifecyclePolicyCommand = async (input, context) => { + const headers = sharedHeaders("PutLifecyclePolicy"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_PutLifecyclePolicyCommand = se_PutLifecyclePolicyCommand; +const se_PutRegistryPolicyCommand = async (input, context) => { + const headers = sharedHeaders("PutRegistryPolicy"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_PutRegistryPolicyCommand = se_PutRegistryPolicyCommand; +const se_PutRegistryScanningConfigurationCommand = async (input, context) => { + const headers = sharedHeaders("PutRegistryScanningConfiguration"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_PutRegistryScanningConfigurationCommand = se_PutRegistryScanningConfigurationCommand; +const se_PutReplicationConfigurationCommand = async (input, context) => { + const headers = sharedHeaders("PutReplicationConfiguration"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_PutReplicationConfigurationCommand = se_PutReplicationConfigurationCommand; +const se_SetRepositoryPolicyCommand = async (input, context) => { + const headers = sharedHeaders("SetRepositoryPolicy"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_SetRepositoryPolicyCommand = se_SetRepositoryPolicyCommand; +const se_StartImageScanCommand = async (input, context) => { + const headers = sharedHeaders("StartImageScan"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_StartImageScanCommand = se_StartImageScanCommand; +const se_StartLifecyclePolicyPreviewCommand = async (input, context) => { + const headers = sharedHeaders("StartLifecyclePolicyPreview"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_StartLifecyclePolicyPreviewCommand = se_StartLifecyclePolicyPreviewCommand; +const se_TagResourceCommand = async (input, context) => { + const headers = sharedHeaders("TagResource"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_TagResourceCommand = se_TagResourceCommand; +const se_UntagResourceCommand = async (input, context) => { + const headers = sharedHeaders("UntagResource"); + let body; + body = JSON.stringify((0, smithy_client_1._json)(input)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_UntagResourceCommand = se_UntagResourceCommand; +const se_UploadLayerPartCommand = async (input, context) => { + const headers = sharedHeaders("UploadLayerPart"); + let body; + body = JSON.stringify(se_UploadLayerPartRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_UploadLayerPartCommand = se_UploadLayerPartCommand; +const de_BatchCheckLayerAvailabilityCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_BatchCheckLayerAvailabilityCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_BatchCheckLayerAvailabilityCommand = de_BatchCheckLayerAvailabilityCommand; +const de_BatchCheckLayerAvailabilityCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_BatchDeleteImageCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_BatchDeleteImageCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_BatchDeleteImageCommand = de_BatchDeleteImageCommand; +const de_BatchDeleteImageCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_BatchGetImageCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_BatchGetImageCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_BatchGetImageCommand = de_BatchGetImageCommand; +const de_BatchGetImageCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_BatchGetRepositoryScanningConfigurationCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_BatchGetRepositoryScanningConfigurationCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_BatchGetRepositoryScanningConfigurationCommand = de_BatchGetRepositoryScanningConfigurationCommand; +const de_BatchGetRepositoryScanningConfigurationCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_CompleteLayerUploadCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CompleteLayerUploadCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_CompleteLayerUploadCommand = de_CompleteLayerUploadCommand; +const de_CompleteLayerUploadCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "EmptyUploadException": + case "com.amazonaws.ecr#EmptyUploadException": + throw await de_EmptyUploadExceptionRes(parsedOutput, context); + case "InvalidLayerException": + case "com.amazonaws.ecr#InvalidLayerException": + throw await de_InvalidLayerExceptionRes(parsedOutput, context); + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "KmsException": + case "com.amazonaws.ecr#KmsException": + throw await de_KmsExceptionRes(parsedOutput, context); + case "LayerAlreadyExistsException": + case "com.amazonaws.ecr#LayerAlreadyExistsException": + throw await de_LayerAlreadyExistsExceptionRes(parsedOutput, context); + case "LayerPartTooSmallException": + case "com.amazonaws.ecr#LayerPartTooSmallException": + throw await de_LayerPartTooSmallExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "UploadNotFoundException": + case "com.amazonaws.ecr#UploadNotFoundException": + throw await de_UploadNotFoundExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_CreatePullThroughCacheRuleCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CreatePullThroughCacheRuleCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_CreatePullThroughCacheRuleResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_CreatePullThroughCacheRuleCommand = de_CreatePullThroughCacheRuleCommand; +const de_CreatePullThroughCacheRuleCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "LimitExceededException": + case "com.amazonaws.ecr#LimitExceededException": + throw await de_LimitExceededExceptionRes(parsedOutput, context); + case "PullThroughCacheRuleAlreadyExistsException": + case "com.amazonaws.ecr#PullThroughCacheRuleAlreadyExistsException": + throw await de_PullThroughCacheRuleAlreadyExistsExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "UnsupportedUpstreamRegistryException": + case "com.amazonaws.ecr#UnsupportedUpstreamRegistryException": + throw await de_UnsupportedUpstreamRegistryExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_CreateRepositoryCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_CreateRepositoryCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_CreateRepositoryResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_CreateRepositoryCommand = de_CreateRepositoryCommand; +const de_CreateRepositoryCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "InvalidTagParameterException": + case "com.amazonaws.ecr#InvalidTagParameterException": + throw await de_InvalidTagParameterExceptionRes(parsedOutput, context); + case "KmsException": + case "com.amazonaws.ecr#KmsException": + throw await de_KmsExceptionRes(parsedOutput, context); + case "LimitExceededException": + case "com.amazonaws.ecr#LimitExceededException": + throw await de_LimitExceededExceptionRes(parsedOutput, context); + case "RepositoryAlreadyExistsException": + case "com.amazonaws.ecr#RepositoryAlreadyExistsException": + throw await de_RepositoryAlreadyExistsExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "TooManyTagsException": + case "com.amazonaws.ecr#TooManyTagsException": + throw await de_TooManyTagsExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_DeleteLifecyclePolicyCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_DeleteLifecyclePolicyCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_DeleteLifecyclePolicyResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_DeleteLifecyclePolicyCommand = de_DeleteLifecyclePolicyCommand; +const de_DeleteLifecyclePolicyCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "LifecyclePolicyNotFoundException": + case "com.amazonaws.ecr#LifecyclePolicyNotFoundException": + throw await de_LifecyclePolicyNotFoundExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_DeletePullThroughCacheRuleCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_DeletePullThroughCacheRuleCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_DeletePullThroughCacheRuleResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_DeletePullThroughCacheRuleCommand = de_DeletePullThroughCacheRuleCommand; +const de_DeletePullThroughCacheRuleCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "PullThroughCacheRuleNotFoundException": + case "com.amazonaws.ecr#PullThroughCacheRuleNotFoundException": + throw await de_PullThroughCacheRuleNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_DeleteRegistryPolicyCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_DeleteRegistryPolicyCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_DeleteRegistryPolicyCommand = de_DeleteRegistryPolicyCommand; +const de_DeleteRegistryPolicyCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RegistryPolicyNotFoundException": + case "com.amazonaws.ecr#RegistryPolicyNotFoundException": + throw await de_RegistryPolicyNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_DeleteRepositoryCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_DeleteRepositoryCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_DeleteRepositoryResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_DeleteRepositoryCommand = de_DeleteRepositoryCommand; +const de_DeleteRepositoryCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "KmsException": + case "com.amazonaws.ecr#KmsException": + throw await de_KmsExceptionRes(parsedOutput, context); + case "RepositoryNotEmptyException": + case "com.amazonaws.ecr#RepositoryNotEmptyException": + throw await de_RepositoryNotEmptyExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_DeleteRepositoryPolicyCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_DeleteRepositoryPolicyCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_DeleteRepositoryPolicyCommand = de_DeleteRepositoryPolicyCommand; +const de_DeleteRepositoryPolicyCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "RepositoryPolicyNotFoundException": + case "com.amazonaws.ecr#RepositoryPolicyNotFoundException": + throw await de_RepositoryPolicyNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_DescribeImageReplicationStatusCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_DescribeImageReplicationStatusCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_DescribeImageReplicationStatusCommand = de_DescribeImageReplicationStatusCommand; +const de_DescribeImageReplicationStatusCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ImageNotFoundException": + case "com.amazonaws.ecr#ImageNotFoundException": + throw await de_ImageNotFoundExceptionRes(parsedOutput, context); + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_DescribeImagesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_DescribeImagesCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_DescribeImagesResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_DescribeImagesCommand = de_DescribeImagesCommand; +const de_DescribeImagesCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ImageNotFoundException": + case "com.amazonaws.ecr#ImageNotFoundException": + throw await de_ImageNotFoundExceptionRes(parsedOutput, context); + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_DescribeImageScanFindingsCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_DescribeImageScanFindingsCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_DescribeImageScanFindingsResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_DescribeImageScanFindingsCommand = de_DescribeImageScanFindingsCommand; +const de_DescribeImageScanFindingsCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ImageNotFoundException": + case "com.amazonaws.ecr#ImageNotFoundException": + throw await de_ImageNotFoundExceptionRes(parsedOutput, context); + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ScanNotFoundException": + case "com.amazonaws.ecr#ScanNotFoundException": + throw await de_ScanNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_DescribePullThroughCacheRulesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_DescribePullThroughCacheRulesCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_DescribePullThroughCacheRulesResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_DescribePullThroughCacheRulesCommand = de_DescribePullThroughCacheRulesCommand; +const de_DescribePullThroughCacheRulesCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "PullThroughCacheRuleNotFoundException": + case "com.amazonaws.ecr#PullThroughCacheRuleNotFoundException": + throw await de_PullThroughCacheRuleNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_DescribeRegistryCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_DescribeRegistryCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_DescribeRegistryCommand = de_DescribeRegistryCommand; +const de_DescribeRegistryCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_DescribeRepositoriesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_DescribeRepositoriesCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_DescribeRepositoriesResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_DescribeRepositoriesCommand = de_DescribeRepositoriesCommand; +const de_DescribeRepositoriesCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_GetAuthorizationTokenCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_GetAuthorizationTokenCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_GetAuthorizationTokenResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_GetAuthorizationTokenCommand = de_GetAuthorizationTokenCommand; +const de_GetAuthorizationTokenCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_GetDownloadUrlForLayerCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_GetDownloadUrlForLayerCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_GetDownloadUrlForLayerCommand = de_GetDownloadUrlForLayerCommand; +const de_GetDownloadUrlForLayerCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "LayerInaccessibleException": + case "com.amazonaws.ecr#LayerInaccessibleException": + throw await de_LayerInaccessibleExceptionRes(parsedOutput, context); + case "LayersNotFoundException": + case "com.amazonaws.ecr#LayersNotFoundException": + throw await de_LayersNotFoundExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_GetLifecyclePolicyCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_GetLifecyclePolicyCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_GetLifecyclePolicyResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_GetLifecyclePolicyCommand = de_GetLifecyclePolicyCommand; +const de_GetLifecyclePolicyCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "LifecyclePolicyNotFoundException": + case "com.amazonaws.ecr#LifecyclePolicyNotFoundException": + throw await de_LifecyclePolicyNotFoundExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_GetLifecyclePolicyPreviewCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_GetLifecyclePolicyPreviewCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_GetLifecyclePolicyPreviewResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_GetLifecyclePolicyPreviewCommand = de_GetLifecyclePolicyPreviewCommand; +const de_GetLifecyclePolicyPreviewCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "LifecyclePolicyPreviewNotFoundException": + case "com.amazonaws.ecr#LifecyclePolicyPreviewNotFoundException": + throw await de_LifecyclePolicyPreviewNotFoundExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_GetRegistryPolicyCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_GetRegistryPolicyCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_GetRegistryPolicyCommand = de_GetRegistryPolicyCommand; +const de_GetRegistryPolicyCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RegistryPolicyNotFoundException": + case "com.amazonaws.ecr#RegistryPolicyNotFoundException": + throw await de_RegistryPolicyNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_GetRegistryScanningConfigurationCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_GetRegistryScanningConfigurationCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_GetRegistryScanningConfigurationCommand = de_GetRegistryScanningConfigurationCommand; +const de_GetRegistryScanningConfigurationCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_GetRepositoryPolicyCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_GetRepositoryPolicyCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_GetRepositoryPolicyCommand = de_GetRepositoryPolicyCommand; +const de_GetRepositoryPolicyCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "RepositoryPolicyNotFoundException": + case "com.amazonaws.ecr#RepositoryPolicyNotFoundException": + throw await de_RepositoryPolicyNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_InitiateLayerUploadCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_InitiateLayerUploadCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_InitiateLayerUploadCommand = de_InitiateLayerUploadCommand; +const de_InitiateLayerUploadCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "KmsException": + case "com.amazonaws.ecr#KmsException": + throw await de_KmsExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_ListImagesCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_ListImagesCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_ListImagesCommand = de_ListImagesCommand; +const de_ListImagesCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_ListTagsForResourceCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_ListTagsForResourceCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_ListTagsForResourceCommand = de_ListTagsForResourceCommand; +const de_ListTagsForResourceCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_PutImageCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_PutImageCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_PutImageCommand = de_PutImageCommand; +const de_PutImageCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ImageAlreadyExistsException": + case "com.amazonaws.ecr#ImageAlreadyExistsException": + throw await de_ImageAlreadyExistsExceptionRes(parsedOutput, context); + case "ImageDigestDoesNotMatchException": + case "com.amazonaws.ecr#ImageDigestDoesNotMatchException": + throw await de_ImageDigestDoesNotMatchExceptionRes(parsedOutput, context); + case "ImageTagAlreadyExistsException": + case "com.amazonaws.ecr#ImageTagAlreadyExistsException": + throw await de_ImageTagAlreadyExistsExceptionRes(parsedOutput, context); + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "KmsException": + case "com.amazonaws.ecr#KmsException": + throw await de_KmsExceptionRes(parsedOutput, context); + case "LayersNotFoundException": + case "com.amazonaws.ecr#LayersNotFoundException": + throw await de_LayersNotFoundExceptionRes(parsedOutput, context); + case "LimitExceededException": + case "com.amazonaws.ecr#LimitExceededException": + throw await de_LimitExceededExceptionRes(parsedOutput, context); + case "ReferencedImagesNotFoundException": + case "com.amazonaws.ecr#ReferencedImagesNotFoundException": + throw await de_ReferencedImagesNotFoundExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_PutImageScanningConfigurationCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_PutImageScanningConfigurationCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_PutImageScanningConfigurationCommand = de_PutImageScanningConfigurationCommand; +const de_PutImageScanningConfigurationCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_PutImageTagMutabilityCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_PutImageTagMutabilityCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_PutImageTagMutabilityCommand = de_PutImageTagMutabilityCommand; +const de_PutImageTagMutabilityCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_PutLifecyclePolicyCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_PutLifecyclePolicyCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_PutLifecyclePolicyCommand = de_PutLifecyclePolicyCommand; +const de_PutLifecyclePolicyCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_PutRegistryPolicyCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_PutRegistryPolicyCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_PutRegistryPolicyCommand = de_PutRegistryPolicyCommand; +const de_PutRegistryPolicyCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_PutRegistryScanningConfigurationCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_PutRegistryScanningConfigurationCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_PutRegistryScanningConfigurationCommand = de_PutRegistryScanningConfigurationCommand; +const de_PutRegistryScanningConfigurationCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_PutReplicationConfigurationCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_PutReplicationConfigurationCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_PutReplicationConfigurationCommand = de_PutReplicationConfigurationCommand; +const de_PutReplicationConfigurationCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_SetRepositoryPolicyCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_SetRepositoryPolicyCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_SetRepositoryPolicyCommand = de_SetRepositoryPolicyCommand; +const de_SetRepositoryPolicyCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_StartImageScanCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_StartImageScanCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_StartImageScanCommand = de_StartImageScanCommand; +const de_StartImageScanCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ImageNotFoundException": + case "com.amazonaws.ecr#ImageNotFoundException": + throw await de_ImageNotFoundExceptionRes(parsedOutput, context); + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "LimitExceededException": + case "com.amazonaws.ecr#LimitExceededException": + throw await de_LimitExceededExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "UnsupportedImageTypeException": + case "com.amazonaws.ecr#UnsupportedImageTypeException": + throw await de_UnsupportedImageTypeExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_StartLifecyclePolicyPreviewCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_StartLifecyclePolicyPreviewCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_StartLifecyclePolicyPreviewCommand = de_StartLifecyclePolicyPreviewCommand; +const de_StartLifecyclePolicyPreviewCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "LifecyclePolicyNotFoundException": + case "com.amazonaws.ecr#LifecyclePolicyNotFoundException": + throw await de_LifecyclePolicyNotFoundExceptionRes(parsedOutput, context); + case "LifecyclePolicyPreviewInProgressException": + case "com.amazonaws.ecr#LifecyclePolicyPreviewInProgressException": + throw await de_LifecyclePolicyPreviewInProgressExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "ValidationException": + case "com.amazonaws.ecr#ValidationException": + throw await de_ValidationExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_TagResourceCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_TagResourceCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_TagResourceCommand = de_TagResourceCommand; +const de_TagResourceCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "InvalidTagParameterException": + case "com.amazonaws.ecr#InvalidTagParameterException": + throw await de_InvalidTagParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "TooManyTagsException": + case "com.amazonaws.ecr#TooManyTagsException": + throw await de_TooManyTagsExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_UntagResourceCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_UntagResourceCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_UntagResourceCommand = de_UntagResourceCommand; +const de_UntagResourceCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "InvalidTagParameterException": + case "com.amazonaws.ecr#InvalidTagParameterException": + throw await de_InvalidTagParameterExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "TooManyTagsException": + case "com.amazonaws.ecr#TooManyTagsException": + throw await de_TooManyTagsExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_UploadLayerPartCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_UploadLayerPartCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = (0, smithy_client_1._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_UploadLayerPartCommand = de_UploadLayerPartCommand; +const de_UploadLayerPartCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidLayerPartException": + case "com.amazonaws.ecr#InvalidLayerPartException": + throw await de_InvalidLayerPartExceptionRes(parsedOutput, context); + case "InvalidParameterException": + case "com.amazonaws.ecr#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "KmsException": + case "com.amazonaws.ecr#KmsException": + throw await de_KmsExceptionRes(parsedOutput, context); + case "LimitExceededException": + case "com.amazonaws.ecr#LimitExceededException": + throw await de_LimitExceededExceptionRes(parsedOutput, context); + case "RepositoryNotFoundException": + case "com.amazonaws.ecr#RepositoryNotFoundException": + throw await de_RepositoryNotFoundExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecr#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "UploadNotFoundException": + case "com.amazonaws.ecr#UploadNotFoundException": + throw await de_UploadNotFoundExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_EmptyUploadExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.EmptyUploadException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_ImageAlreadyExistsExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.ImageAlreadyExistsException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_ImageDigestDoesNotMatchExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.ImageDigestDoesNotMatchException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_ImageNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.ImageNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_ImageTagAlreadyExistsExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.ImageTagAlreadyExistsException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_InvalidLayerExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.InvalidLayerException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_InvalidLayerPartExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.InvalidLayerPartException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_InvalidParameterExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.InvalidParameterException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_InvalidTagParameterExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.InvalidTagParameterException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_KmsExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.KmsException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_LayerAlreadyExistsExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.LayerAlreadyExistsException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_LayerInaccessibleExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.LayerInaccessibleException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_LayerPartTooSmallExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.LayerPartTooSmallException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_LayersNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.LayersNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_LifecyclePolicyNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.LifecyclePolicyNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_LifecyclePolicyPreviewInProgressExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.LifecyclePolicyPreviewInProgressException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_LifecyclePolicyPreviewNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.LifecyclePolicyPreviewNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_LimitExceededExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.LimitExceededException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_PullThroughCacheRuleAlreadyExistsExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.PullThroughCacheRuleAlreadyExistsException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_PullThroughCacheRuleNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.PullThroughCacheRuleNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_ReferencedImagesNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.ReferencedImagesNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_RegistryPolicyNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.RegistryPolicyNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_RepositoryAlreadyExistsExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.RepositoryAlreadyExistsException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_RepositoryNotEmptyExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.RepositoryNotEmptyException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_RepositoryNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.RepositoryNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_RepositoryPolicyNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.RepositoryPolicyNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_ScanNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.ScanNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_ServerExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.ServerException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; const de_TooManyTagsExceptionRes = async (parsedOutput, context) => { const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.TooManyTagsException({ + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.TooManyTagsException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_UnsupportedImageTypeExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.UnsupportedImageTypeException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_UnsupportedUpstreamRegistryExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.UnsupportedUpstreamRegistryException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_UploadNotFoundExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.UploadNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_ValidationExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, smithy_client_1._json)(body); + const exception = new models_0_1.ValidationException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const se_UploadLayerPartRequest = (input, context) => { + return (0, smithy_client_1.take)(input, { + layerPartBlob: context.base64Encoder, + partFirstByte: [], + partLastByte: [], + registryId: [], + repositoryName: [], + uploadId: [], + }); +}; +const de_AuthorizationData = (output, context) => { + return (0, smithy_client_1.take)(output, { + authorizationToken: smithy_client_1.expectString, + expiresAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + proxyEndpoint: smithy_client_1.expectString, + }); +}; +const de_AuthorizationDataList = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_AuthorizationData(entry, context); + }); + return retVal; +}; +const de_AwsEcrContainerImageDetails = (output, context) => { + return (0, smithy_client_1.take)(output, { + architecture: smithy_client_1.expectString, + author: smithy_client_1.expectString, + imageHash: smithy_client_1.expectString, + imageTags: smithy_client_1._json, + platform: smithy_client_1.expectString, + pushedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + registry: smithy_client_1.expectString, + repositoryName: smithy_client_1.expectString, + }); +}; +const de_CreatePullThroughCacheRuleResponse = (output, context) => { + return (0, smithy_client_1.take)(output, { + createdAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + ecrRepositoryPrefix: smithy_client_1.expectString, + registryId: smithy_client_1.expectString, + upstreamRegistryUrl: smithy_client_1.expectString, + }); +}; +const de_CreateRepositoryResponse = (output, context) => { + return (0, smithy_client_1.take)(output, { + repository: (_) => de_Repository(_, context), + }); +}; +const de_CvssScore = (output, context) => { + return (0, smithy_client_1.take)(output, { + baseScore: smithy_client_1.limitedParseDouble, + scoringVector: smithy_client_1.expectString, + source: smithy_client_1.expectString, + version: smithy_client_1.expectString, + }); +}; +const de_CvssScoreDetails = (output, context) => { + return (0, smithy_client_1.take)(output, { + adjustments: smithy_client_1._json, + score: smithy_client_1.limitedParseDouble, + scoreSource: smithy_client_1.expectString, + scoringVector: smithy_client_1.expectString, + version: smithy_client_1.expectString, + }); +}; +const de_CvssScoreList = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_CvssScore(entry, context); + }); + return retVal; +}; +const de_DeleteLifecyclePolicyResponse = (output, context) => { + return (0, smithy_client_1.take)(output, { + lastEvaluatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + lifecyclePolicyText: smithy_client_1.expectString, + registryId: smithy_client_1.expectString, + repositoryName: smithy_client_1.expectString, + }); +}; +const de_DeletePullThroughCacheRuleResponse = (output, context) => { + return (0, smithy_client_1.take)(output, { + createdAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + ecrRepositoryPrefix: smithy_client_1.expectString, + registryId: smithy_client_1.expectString, + upstreamRegistryUrl: smithy_client_1.expectString, + }); +}; +const de_DeleteRepositoryResponse = (output, context) => { + return (0, smithy_client_1.take)(output, { + repository: (_) => de_Repository(_, context), + }); +}; +const de_DescribeImageScanFindingsResponse = (output, context) => { + return (0, smithy_client_1.take)(output, { + imageId: smithy_client_1._json, + imageScanFindings: (_) => de_ImageScanFindings(_, context), + imageScanStatus: smithy_client_1._json, + nextToken: smithy_client_1.expectString, + registryId: smithy_client_1.expectString, + repositoryName: smithy_client_1.expectString, + }); +}; +const de_DescribeImagesResponse = (output, context) => { + return (0, smithy_client_1.take)(output, { + imageDetails: (_) => de_ImageDetailList(_, context), + nextToken: smithy_client_1.expectString, + }); +}; +const de_DescribePullThroughCacheRulesResponse = (output, context) => { + return (0, smithy_client_1.take)(output, { + nextToken: smithy_client_1.expectString, + pullThroughCacheRules: (_) => de_PullThroughCacheRuleList(_, context), + }); +}; +const de_DescribeRepositoriesResponse = (output, context) => { + return (0, smithy_client_1.take)(output, { + nextToken: smithy_client_1.expectString, + repositories: (_) => de_RepositoryList(_, context), + }); +}; +const de_EnhancedImageScanFinding = (output, context) => { + return (0, smithy_client_1.take)(output, { + awsAccountId: smithy_client_1.expectString, + description: smithy_client_1.expectString, + findingArn: smithy_client_1.expectString, + firstObservedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + lastObservedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + packageVulnerabilityDetails: (_) => de_PackageVulnerabilityDetails(_, context), + remediation: smithy_client_1._json, + resources: (_) => de_ResourceList(_, context), + score: smithy_client_1.limitedParseDouble, + scoreDetails: (_) => de_ScoreDetails(_, context), + severity: smithy_client_1.expectString, + status: smithy_client_1.expectString, + title: smithy_client_1.expectString, + type: smithy_client_1.expectString, + updatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + }); +}; +const de_EnhancedImageScanFindingList = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_EnhancedImageScanFinding(entry, context); + }); + return retVal; +}; +const de_GetAuthorizationTokenResponse = (output, context) => { + return (0, smithy_client_1.take)(output, { + authorizationData: (_) => de_AuthorizationDataList(_, context), + }); +}; +const de_GetLifecyclePolicyPreviewResponse = (output, context) => { + return (0, smithy_client_1.take)(output, { + lifecyclePolicyText: smithy_client_1.expectString, + nextToken: smithy_client_1.expectString, + previewResults: (_) => de_LifecyclePolicyPreviewResultList(_, context), + registryId: smithy_client_1.expectString, + repositoryName: smithy_client_1.expectString, + status: smithy_client_1.expectString, + summary: smithy_client_1._json, + }); +}; +const de_GetLifecyclePolicyResponse = (output, context) => { + return (0, smithy_client_1.take)(output, { + lastEvaluatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + lifecyclePolicyText: smithy_client_1.expectString, + registryId: smithy_client_1.expectString, + repositoryName: smithy_client_1.expectString, + }); +}; +const de_ImageDetail = (output, context) => { + return (0, smithy_client_1.take)(output, { + artifactMediaType: smithy_client_1.expectString, + imageDigest: smithy_client_1.expectString, + imageManifestMediaType: smithy_client_1.expectString, + imagePushedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + imageScanFindingsSummary: (_) => de_ImageScanFindingsSummary(_, context), + imageScanStatus: smithy_client_1._json, + imageSizeInBytes: smithy_client_1.expectLong, + imageTags: smithy_client_1._json, + lastRecordedPullTime: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + registryId: smithy_client_1.expectString, + repositoryName: smithy_client_1.expectString, + }); +}; +const de_ImageDetailList = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_ImageDetail(entry, context); + }); + return retVal; +}; +const de_ImageScanFindings = (output, context) => { + return (0, smithy_client_1.take)(output, { + enhancedFindings: (_) => de_EnhancedImageScanFindingList(_, context), + findingSeverityCounts: smithy_client_1._json, + findings: smithy_client_1._json, + imageScanCompletedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + vulnerabilitySourceUpdatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + }); +}; +const de_ImageScanFindingsSummary = (output, context) => { + return (0, smithy_client_1.take)(output, { + findingSeverityCounts: smithy_client_1._json, + imageScanCompletedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + vulnerabilitySourceUpdatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + }); +}; +const de_LifecyclePolicyPreviewResult = (output, context) => { + return (0, smithy_client_1.take)(output, { + action: smithy_client_1._json, + appliedRulePriority: smithy_client_1.expectInt32, + imageDigest: smithy_client_1.expectString, + imagePushedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + imageTags: smithy_client_1._json, + }); +}; +const de_LifecyclePolicyPreviewResultList = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_LifecyclePolicyPreviewResult(entry, context); + }); + return retVal; +}; +const de_PackageVulnerabilityDetails = (output, context) => { + return (0, smithy_client_1.take)(output, { + cvss: (_) => de_CvssScoreList(_, context), + referenceUrls: smithy_client_1._json, + relatedVulnerabilities: smithy_client_1._json, + source: smithy_client_1.expectString, + sourceUrl: smithy_client_1.expectString, + vendorCreatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + vendorSeverity: smithy_client_1.expectString, + vendorUpdatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + vulnerabilityId: smithy_client_1.expectString, + vulnerablePackages: smithy_client_1._json, + }); +}; +const de_PullThroughCacheRule = (output, context) => { + return (0, smithy_client_1.take)(output, { + createdAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + ecrRepositoryPrefix: smithy_client_1.expectString, + registryId: smithy_client_1.expectString, + upstreamRegistryUrl: smithy_client_1.expectString, + }); +}; +const de_PullThroughCacheRuleList = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_PullThroughCacheRule(entry, context); + }); + return retVal; +}; +const de_Repository = (output, context) => { + return (0, smithy_client_1.take)(output, { + createdAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), + encryptionConfiguration: smithy_client_1._json, + imageScanningConfiguration: smithy_client_1._json, + imageTagMutability: smithy_client_1.expectString, + registryId: smithy_client_1.expectString, + repositoryArn: smithy_client_1.expectString, + repositoryName: smithy_client_1.expectString, + repositoryUri: smithy_client_1.expectString, + }); +}; +const de_RepositoryList = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_Repository(entry, context); + }); + return retVal; +}; +const de_Resource = (output, context) => { + return (0, smithy_client_1.take)(output, { + details: (_) => de_ResourceDetails(_, context), + id: smithy_client_1.expectString, + tags: smithy_client_1._json, + type: smithy_client_1.expectString, + }); +}; +const de_ResourceDetails = (output, context) => { + return (0, smithy_client_1.take)(output, { + awsEcrContainerImage: (_) => de_AwsEcrContainerImageDetails(_, context), + }); +}; +const de_ResourceList = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + return de_Resource(entry, context); + }); + return retVal; +}; +const de_ScoreDetails = (output, context) => { + return (0, smithy_client_1.take)(output, { + cvss: (_) => de_CvssScoreDetails(_, context), + }); +}; +const deserializeMetadata = (output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"], +}); +const collectBodyString = (streamBody, context) => (0, smithy_client_1.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)); +const throwDefaultError = (0, smithy_client_1.withBaseException)(ECRServiceException_1.ECRServiceException); +const buildHttpRpcRequest = async (context, headers, path, resolvedHostname, body) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const contents = { + protocol, + hostname, + port, + method: "POST", + path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, + headers, + }; + if (resolvedHostname !== undefined) { + contents.hostname = resolvedHostname; + } + if (body !== undefined) { + contents.body = body; + } + return new protocol_http_1.HttpRequest(contents); +}; +function sharedHeaders(operation) { + return { + "content-type": "application/x-amz-json-1.1", + "x-amz-target": `AmazonEC2ContainerRegistry_V20150921.${operation}`, + }; +} +const parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + return JSON.parse(encoded); + } + return {}; +}); +const parseErrorBody = async (errorBody, context) => { + const value = await parseBody(errorBody, context); + value.message = value.message ?? value.Message; + return value; +}; +const loadRestJsonErrorCode = (output, data) => { + const findKey = (object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()); + const sanitizeErrorCode = (rawValue) => { + let cleanValue = rawValue; + if (typeof cleanValue === "number") { + cleanValue = cleanValue.toString(); + } + if (cleanValue.indexOf(",") >= 0) { + cleanValue = cleanValue.split(",")[0]; + } + if (cleanValue.indexOf(":") >= 0) { + cleanValue = cleanValue.split(":")[0]; + } + if (cleanValue.indexOf("#") >= 0) { + cleanValue = cleanValue.split("#")[1]; + } + return cleanValue; + }; + const headerKey = findKey(output.headers, "x-amzn-errortype"); + if (headerKey !== undefined) { + return sanitizeErrorCode(output.headers[headerKey]); + } + if (data.code !== undefined) { + return sanitizeErrorCode(data.code); + } + if (data["__type"] !== undefined) { + return sanitizeErrorCode(data["__type"]); + } +}; + + +/***/ }), + +/***/ 869: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const tslib_1 = __nccwpck_require__(4351); +const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(4289)); +const client_sts_1 = __nccwpck_require__(52209); +const credential_provider_node_1 = __nccwpck_require__(75531); +const util_user_agent_node_1 = __nccwpck_require__(98095); +const config_resolver_1 = __nccwpck_require__(53098); +const hash_node_1 = __nccwpck_require__(3081); +const middleware_retry_1 = __nccwpck_require__(96039); +const node_config_provider_1 = __nccwpck_require__(33461); +const node_http_handler_1 = __nccwpck_require__(64350); +const util_body_length_node_1 = __nccwpck_require__(68075); +const util_retry_1 = __nccwpck_require__(84902); +const runtimeConfig_shared_1 = __nccwpck_require__(70542); +const smithy_client_1 = __nccwpck_require__(63570); +const util_defaults_mode_node_1 = __nccwpck_require__(72429); +const smithy_client_2 = __nccwpck_require__(63570); +const getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + credentialDefaultProvider: config?.credentialDefaultProvider ?? (0, client_sts_1.decorateDefaultCredentialProvider)(credential_provider_node_1.defaultProvider), + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? + (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: config?.requestHandler ?? new node_http_handler_1.NodeHttpHandler(defaultConfigProvider), + retryMode: config?.retryMode ?? + (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, + }), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 70542: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const smithy_client_1 = __nccwpck_require__(63570); +const url_parser_1 = __nccwpck_require__(14681); +const util_base64_1 = __nccwpck_require__(75600); +const util_utf8_1 = __nccwpck_require__(41895); +const endpointResolver_1 = __nccwpck_require__(61610); +const getRuntimeConfig = (config) => ({ + apiVersion: "2015-09-21", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "ECR", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, +}); +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 86506: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveRuntimeExtensions = void 0; +const region_config_resolver_1 = __nccwpck_require__(18156); +const protocol_http_1 = __nccwpck_require__(82473); +const smithy_client_1 = __nccwpck_require__(63570); +const asPartial = (t) => t; +const resolveRuntimeExtensions = (runtimeConfig, extensions) => { + const extensionConfiguration = { + ...asPartial((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, smithy_client_1.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig)), + }; + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return { + ...runtimeConfig, + ...(0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), + ...(0, smithy_client_1.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), + }; +}; +exports.resolveRuntimeExtensions = resolveRuntimeExtensions; + + +/***/ }), + +/***/ 28406: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(78547), exports); +tslib_1.__exportStar(__nccwpck_require__(45723), exports); + + +/***/ }), + +/***/ 78547: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.waitUntilImageScanComplete = exports.waitForImageScanComplete = void 0; +const util_waiter_1 = __nccwpck_require__(78011); +const DescribeImageScanFindingsCommand_1 = __nccwpck_require__(72987); +const checkState = async (client, input) => { + let reason; + try { + const result = await client.send(new DescribeImageScanFindingsCommand_1.DescribeImageScanFindingsCommand(input)); + reason = result; + try { + const returnComparator = () => { + return result.imageScanStatus.status; + }; + if (returnComparator() === "COMPLETE") { + return { state: util_waiter_1.WaiterState.SUCCESS, reason }; + } + } + catch (e) { } + try { + const returnComparator = () => { + return result.imageScanStatus.status; + }; + if (returnComparator() === "FAILED") { + return { state: util_waiter_1.WaiterState.FAILURE, reason }; + } + } + catch (e) { } + } + catch (exception) { + reason = exception; + } + return { state: util_waiter_1.WaiterState.RETRY, reason }; +}; +const waitForImageScanComplete = async (params, input) => { + const serviceDefaults = { minDelay: 5, maxDelay: 120 }; + return (0, util_waiter_1.createWaiter)({ ...serviceDefaults, ...params }, input, checkState); +}; +exports.waitForImageScanComplete = waitForImageScanComplete; +const waitUntilImageScanComplete = async (params, input) => { + const serviceDefaults = { minDelay: 5, maxDelay: 120 }; + const result = await (0, util_waiter_1.createWaiter)({ ...serviceDefaults, ...params }, input, checkState); + return (0, util_waiter_1.checkExceptions)(result); +}; +exports.waitUntilImageScanComplete = waitUntilImageScanComplete; + + +/***/ }), + +/***/ 45723: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.waitUntilLifecyclePolicyPreviewComplete = exports.waitForLifecyclePolicyPreviewComplete = void 0; +const util_waiter_1 = __nccwpck_require__(78011); +const GetLifecyclePolicyPreviewCommand_1 = __nccwpck_require__(17006); +const checkState = async (client, input) => { + let reason; + try { + const result = await client.send(new GetLifecyclePolicyPreviewCommand_1.GetLifecyclePolicyPreviewCommand(input)); + reason = result; + try { + const returnComparator = () => { + return result.status; + }; + if (returnComparator() === "COMPLETE") { + return { state: util_waiter_1.WaiterState.SUCCESS, reason }; + } + } + catch (e) { } + try { + const returnComparator = () => { + return result.status; + }; + if (returnComparator() === "FAILED") { + return { state: util_waiter_1.WaiterState.FAILURE, reason }; + } + } + catch (e) { } + } + catch (exception) { + reason = exception; + } + return { state: util_waiter_1.WaiterState.RETRY, reason }; +}; +const waitForLifecyclePolicyPreviewComplete = async (params, input) => { + const serviceDefaults = { minDelay: 5, maxDelay: 120 }; + return (0, util_waiter_1.createWaiter)({ ...serviceDefaults, ...params }, input, checkState); +}; +exports.waitForLifecyclePolicyPreviewComplete = waitForLifecyclePolicyPreviewComplete; +const waitUntilLifecyclePolicyPreviewComplete = async (params, input) => { + const serviceDefaults = { minDelay: 5, maxDelay: 120 }; + const result = await (0, util_waiter_1.createWaiter)({ ...serviceDefaults, ...params }, input, checkState); + return (0, util_waiter_1.checkExceptions)(result); +}; +exports.waitUntilLifecyclePolicyPreviewComplete = waitUntilLifecyclePolicyPreviewComplete; + + +/***/ }), + +/***/ 98253: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODEJS_TIMEOUT_ERROR_CODES = void 0; +exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + + +/***/ }), + +/***/ 41680: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getTransformedHeaders = void 0; +const getTransformedHeaders = (headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; + } + return transformedHeaders; +}; +exports.getTransformedHeaders = getTransformedHeaders; + + +/***/ }), + +/***/ 64350: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(52885), exports); +tslib_1.__exportStar(__nccwpck_require__(29415), exports); +tslib_1.__exportStar(__nccwpck_require__(53444), exports); + + +/***/ }), + +/***/ 52885: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttpHandler = exports.DEFAULT_REQUEST_TIMEOUT = void 0; +const protocol_http_1 = __nccwpck_require__(82473); +const querystring_builder_1 = __nccwpck_require__(18021); +const http_1 = __nccwpck_require__(13685); +const https_1 = __nccwpck_require__(95687); +const constants_1 = __nccwpck_require__(98253); +const get_transformed_headers_1 = __nccwpck_require__(41680); +const set_connection_timeout_1 = __nccwpck_require__(79062); +const set_socket_keep_alive_1 = __nccwpck_require__(86268); +const set_socket_timeout_1 = __nccwpck_require__(11700); +const write_request_body_1 = __nccwpck_require__(94310); +exports.DEFAULT_REQUEST_TIMEOUT = 0; +class NodeHttpHandler { + constructor(options) { + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }) + .catch(reject); + } + else { + resolve(this.resolveDefaultConfig(options)); + } + }); + } + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + requestTimeout: requestTimeout !== null && requestTimeout !== void 0 ? requestTimeout : socketTimeout, + httpAgent: httpAgent || new http_1.Agent({ keepAlive, maxSockets }), + httpsAgent: httpsAgent || new https_1.Agent({ keepAlive, maxSockets }), + }; + } + destroy() { + var _a, _b, _c, _d; + (_b = (_a = this.config) === null || _a === void 0 ? void 0 : _a.httpAgent) === null || _b === void 0 ? void 0 : _b.destroy(); + (_d = (_c = this.config) === null || _c === void 0 ? void 0 : _c.httpsAgent) === null || _d === void 0 ? void 0 : _d.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + return new Promise((_resolve, _reject) => { + var _a, _b; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const queryString = (0, querystring_builder_1.buildQueryString)(request.query || {}); + let auth = undefined; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}`; + } + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const nodeHttpsOptions = { + headers: request.headers, + host: request.hostname, + method: request.method, + path, + port: request.port, + agent: isSSL ? this.config.httpsAgent : this.config.httpAgent, + auth, + }; + const requestFunc = isSSL ? https_1.request : http_1.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(res.headers), + body: res, + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } + else { + reject(err); + } + }); + (0, set_connection_timeout_1.setConnectionTimeout)(req, reject, this.config.connectionTimeout); + (0, set_socket_timeout_1.setSocketTimeout)(req, reject, this.config.requestTimeout); + if (abortSignal) { + abortSignal.onabort = () => { + req.abort(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }; + } + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + (0, set_socket_keep_alive_1.setSocketKeepAlive)(req, { + keepAlive: httpAgent.keepAlive, + keepAliveMsecs: httpAgent.keepAliveMsecs, + }); + } + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, this.config.requestTimeout).catch(_reject); + }); + } + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); + } + httpHandlerConfigs() { + var _a; + return (_a = this.config) !== null && _a !== void 0 ? _a : {}; + } +} +exports.NodeHttpHandler = NodeHttpHandler; + + +/***/ }), + +/***/ 22219: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2ConnectionManager = void 0; +const tslib_1 = __nccwpck_require__(4351); +const http2_1 = tslib_1.__importDefault(__nccwpck_require__(85158)); +const node_http2_connection_pool_1 = __nccwpck_require__(94783); +class NodeHttp2ConnectionManager { + constructor(config) { + this.sessionCache = new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); + } + } + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; + } + } + const session = http2_1.default.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error("Fail to set maxConcurrentStreams to " + + this.config.maxConcurrency + + "when creating new session for " + + requestContext.destination.toString()); + } + }); + } + session.unref(); + const destroySessionCb = () => { + session.destroy(); + this.deleteSession(url, session); + }; + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new node_http2_connection_pool_1.NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; + } + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; + } + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); + } + release(requestContext, session) { + var _a; + const cacheKey = this.getUrlString(requestContext); + (_a = this.sessionCache.get(cacheKey)) === null || _a === void 0 ? void 0 : _a.offerLast(session); + } + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); + } + this.sessionCache.delete(key); + } + } + setMaxConcurrentStreams(maxConcurrentStreams) { + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); + } + this.config.maxConcurrency = maxConcurrentStreams; + } + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; + } + getUrlString(request) { + return request.destination.toString(); + } +} +exports.NodeHttp2ConnectionManager = NodeHttp2ConnectionManager; + + +/***/ }), + +/***/ 94783: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2ConnectionPool = void 0; +class NodeHttp2ConnectionPool { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions !== null && sessions !== void 0 ? sessions : []; + } + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); + } + } + offerLast(session) { + this.sessions.push(session); + } + contains(session) { + return this.sessions.includes(session); + } + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); + } + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); + } + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } + } + } + } +} +exports.NodeHttp2ConnectionPool = NodeHttp2ConnectionPool; + + +/***/ }), + +/***/ 29415: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2Handler = void 0; +const protocol_http_1 = __nccwpck_require__(82473); +const querystring_builder_1 = __nccwpck_require__(18021); +const http2_1 = __nccwpck_require__(85158); +const get_transformed_headers_1 = __nccwpck_require__(41680); +const node_http2_connection_manager_1 = __nccwpck_require__(22219); +const write_request_body_1 = __nccwpck_require__(94310); +class NodeHttp2Handler { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new node_http2_connection_manager_1.NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((opts) => { + resolve(opts || {}); + }) + .catch(reject); + } + else { + resolve(options || {}); + } + }); + } + destroy() { + this.connectionManager.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } + } + const { requestTimeout, disableConcurrentStreams } = this.config; + return new Promise((_resolve, _reject) => { + var _a, _b, _c; + let fulfilled = false; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request; + let auth = ""; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: (_c = this.config) === null || _c === void 0 ? void 0 : _c.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false, + }); + const rejectWithDestroy = (err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + reject(err); + }; + const queryString = (0, querystring_builder_1.buildQueryString)(query || {}); + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const req = session.request({ + ...request.headers, + [http2_1.constants.HTTP2_HEADER_PATH]: path, + [http2_1.constants.HTTP2_HEADER_METHOD]: method, + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(headers), + body: req, + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (requestTimeout) { + req.setTimeout(requestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + abortSignal.onabort = () => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }; + } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy(new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`)); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, requestTimeout); + }); + } + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); + } + httpHandlerConfigs() { + var _a; + return (_a = this.config) !== null && _a !== void 0 ? _a : {}; + } + destroySession(session) { + if (!session.destroyed) { + session.destroy(); + } + } +} +exports.NodeHttp2Handler = NodeHttp2Handler; + + +/***/ }), + +/***/ 79062: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setConnectionTimeout = void 0; +const setConnectionTimeout = (request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return; + } + const timeoutId = setTimeout(() => { + request.destroy(); + reject(Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError", + })); + }, timeoutInMs); + request.on("socket", (socket) => { + if (socket.connecting) { + socket.on("connect", () => { + clearTimeout(timeoutId); + }); + } + else { + clearTimeout(timeoutId); + } + }); +}; +exports.setConnectionTimeout = setConnectionTimeout; + + +/***/ }), + +/***/ 86268: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setSocketKeepAlive = void 0; +const setSocketKeepAlive = (request, { keepAlive, keepAliveMsecs }) => { + if (keepAlive !== true) { + return; + } + request.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); +}; +exports.setSocketKeepAlive = setSocketKeepAlive; + + +/***/ }), + +/***/ 11700: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setSocketTimeout = void 0; +const setSocketTimeout = (request, reject, timeoutInMs = 0) => { + request.setTimeout(timeoutInMs, () => { + request.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }); +}; +exports.setSocketTimeout = setSocketTimeout; + + +/***/ }), + +/***/ 13110: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Collector = void 0; +const stream_1 = __nccwpck_require__(12781); +class Collector extends stream_1.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; + } + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); + } +} +exports.Collector = Collector; + + +/***/ }), + +/***/ 53444: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.streamCollector = void 0; +const collector_1 = __nccwpck_require__(13110); +const streamCollector = (stream) => new Promise((resolve, reject) => { + const collector = new collector_1.Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function () { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); +}); +exports.streamCollector = streamCollector; + + +/***/ }), + +/***/ 94310: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.writeRequestBody = void 0; +const stream_1 = __nccwpck_require__(12781); +const MIN_WAIT_TIME = 1000; +async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { + var _a; + const headers = (_a = request.headers) !== null && _a !== void 0 ? _a : {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let hasError = false; + if (expect === "100-continue") { + await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + clearTimeout(timeoutId); + resolve(); + }); + httpRequest.on("error", () => { + hasError = true; + clearTimeout(timeoutId); + resolve(); + }); + }), + ]); + } + if (!hasError) { + writeBody(httpRequest, request.body); + } +} +exports.writeRequestBody = writeRequestBody; +function writeBody(httpRequest, body) { + if (body instanceof stream_1.Readable) { + body.pipe(httpRequest); + } + else if (body) { + httpRequest.end(Buffer.from(body)); + } + else { + httpRequest.end(); + } +} + + +/***/ }), + +/***/ 72435: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Field = void 0; +const types_1 = __nccwpck_require__(5417); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + add(value) { + this.values.push(value); + } + set(values) { + this.values = values; + } + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; + } +} +exports.Field = Field; + + +/***/ }), + +/***/ 50120: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + getField(name) { + return this.entries[name.toLowerCase()]; + } + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +} +exports.Fields = Fields; + + +/***/ }), + +/***/ 75981: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0; +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; + return { + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + }, + }; +}; +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), + }; +}; +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; + + +/***/ }), + +/***/ 10418: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(75981), exports); + + +/***/ }), + +/***/ 91917: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 23343: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); + } + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; + } +} +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} + + +/***/ }), + +/***/ 55192: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} +exports.HttpResponse = HttpResponse; + + +/***/ }), + +/***/ 82473: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(10418), exports); +tslib_1.__exportStar(__nccwpck_require__(72435), exports); +tslib_1.__exportStar(__nccwpck_require__(50120), exports); +tslib_1.__exportStar(__nccwpck_require__(91917), exports); +tslib_1.__exportStar(__nccwpck_require__(23343), exports); +tslib_1.__exportStar(__nccwpck_require__(55192), exports); +tslib_1.__exportStar(__nccwpck_require__(36579), exports); +tslib_1.__exportStar(__nccwpck_require__(36198), exports); + + +/***/ }), + +/***/ 36579: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; + + +/***/ }), + +/***/ 36198: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 18021: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.buildQueryString = void 0; +const util_uri_escape_1 = __nccwpck_require__(92509); +function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, util_uri_escape_1.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, util_uri_escape_1.escapeUri)(value[i])}`); + } + } + else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, util_uri_escape_1.escapeUri)(value)}`; + } + parts.push(qsEntry); + } + } + return parts.join("&"); +} +exports.buildQueryString = buildQueryString; + + +/***/ }), + +/***/ 80352: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 55353: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); + + +/***/ }), + +/***/ 35136: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 69996: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 51485: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 52560: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 23421: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 4695: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(23421), exports); +tslib_1.__exportStar(__nccwpck_require__(92951), exports); +tslib_1.__exportStar(__nccwpck_require__(4706), exports); + + +/***/ }), + +/***/ 92951: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 4706: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 56579: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 27084: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 42184: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 74538: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 42927: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 19395: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 70478: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 79083: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(74538), exports); +tslib_1.__exportStar(__nccwpck_require__(42927), exports); +tslib_1.__exportStar(__nccwpck_require__(19395), exports); +tslib_1.__exportStar(__nccwpck_require__(55084), exports); +tslib_1.__exportStar(__nccwpck_require__(70478), exports); + + +/***/ }), + +/***/ 55084: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 117: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 16184: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); + } + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; +}; +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; + + +/***/ }), + +/***/ 27690: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(16184); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + }; +}; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; +}; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; + + +/***/ }), + +/***/ 11948: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 79775: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(27690), exports); +tslib_1.__exportStar(__nccwpck_require__(11948), exports); +var checksum_1 = __nccwpck_require__(16184); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); + + +/***/ }), + +/***/ 51487: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); + + +/***/ }), + +/***/ 63083: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 60981: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 71249: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(63083), exports); +tslib_1.__exportStar(__nccwpck_require__(60981), exports); + + +/***/ }), + +/***/ 5417: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(80352), exports); +tslib_1.__exportStar(__nccwpck_require__(55353), exports); +tslib_1.__exportStar(__nccwpck_require__(35136), exports); +tslib_1.__exportStar(__nccwpck_require__(69996), exports); +tslib_1.__exportStar(__nccwpck_require__(51485), exports); +tslib_1.__exportStar(__nccwpck_require__(52560), exports); +tslib_1.__exportStar(__nccwpck_require__(4695), exports); +tslib_1.__exportStar(__nccwpck_require__(56579), exports); +tslib_1.__exportStar(__nccwpck_require__(27084), exports); +tslib_1.__exportStar(__nccwpck_require__(42184), exports); +tslib_1.__exportStar(__nccwpck_require__(79083), exports); +tslib_1.__exportStar(__nccwpck_require__(117), exports); +tslib_1.__exportStar(__nccwpck_require__(79775), exports); +tslib_1.__exportStar(__nccwpck_require__(51487), exports); +tslib_1.__exportStar(__nccwpck_require__(71249), exports); +tslib_1.__exportStar(__nccwpck_require__(25966), exports); +tslib_1.__exportStar(__nccwpck_require__(67184), exports); +tslib_1.__exportStar(__nccwpck_require__(7902), exports); +tslib_1.__exportStar(__nccwpck_require__(87206), exports); +tslib_1.__exportStar(__nccwpck_require__(2896), exports); +tslib_1.__exportStar(__nccwpck_require__(90859), exports); +tslib_1.__exportStar(__nccwpck_require__(91990), exports); +tslib_1.__exportStar(__nccwpck_require__(32651), exports); +tslib_1.__exportStar(__nccwpck_require__(23358), exports); +tslib_1.__exportStar(__nccwpck_require__(5786), exports); +tslib_1.__exportStar(__nccwpck_require__(87164), exports); +tslib_1.__exportStar(__nccwpck_require__(22194), exports); +tslib_1.__exportStar(__nccwpck_require__(97137), exports); +tslib_1.__exportStar(__nccwpck_require__(74406), exports); +tslib_1.__exportStar(__nccwpck_require__(5838), exports); +tslib_1.__exportStar(__nccwpck_require__(89072), exports); +tslib_1.__exportStar(__nccwpck_require__(32002), exports); +tslib_1.__exportStar(__nccwpck_require__(43006), exports); +tslib_1.__exportStar(__nccwpck_require__(95528), exports); + + +/***/ }), + +/***/ 25966: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 67184: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; + + +/***/ }), + +/***/ 7902: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 87206: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 2896: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 90859: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 91990: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 32651: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 23358: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 5786: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 87164: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 22194: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 97137: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 74406: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); + + +/***/ }), + +/***/ 5838: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 89072: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 32002: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 43006: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 95528: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 30862: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.escapeUriPath = void 0; +const escape_uri_1 = __nccwpck_require__(39447); +const escapeUriPath = (uri) => uri.split("/").map(escape_uri_1.escapeUri).join("/"); +exports.escapeUriPath = escapeUriPath; + + +/***/ }), + +/***/ 39447: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.escapeUri = void 0; +const escapeUri = (uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode); +exports.escapeUri = escapeUri; +const hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`; + + +/***/ }), + +/***/ 92509: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(39447), exports); +tslib_1.__exportStar(__nccwpck_require__(30862), exports); + + +/***/ }), + +/***/ 69838: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SSO = void 0; +const smithy_client_1 = __nccwpck_require__(63570); +const GetRoleCredentialsCommand_1 = __nccwpck_require__(18972); +const ListAccountRolesCommand_1 = __nccwpck_require__(1513); +const ListAccountsCommand_1 = __nccwpck_require__(64296); +const LogoutCommand_1 = __nccwpck_require__(12586); +const SSOClient_1 = __nccwpck_require__(71057); +const commands = { + GetRoleCredentialsCommand: GetRoleCredentialsCommand_1.GetRoleCredentialsCommand, + ListAccountRolesCommand: ListAccountRolesCommand_1.ListAccountRolesCommand, + ListAccountsCommand: ListAccountsCommand_1.ListAccountsCommand, + LogoutCommand: LogoutCommand_1.LogoutCommand, +}; +class SSO extends SSOClient_1.SSOClient { +} +exports.SSO = SSO; +(0, smithy_client_1.createAggregatedClient)(commands, SSO); + + +/***/ }), + +/***/ 71057: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SSOClient = exports.__Client = void 0; +const middleware_host_header_1 = __nccwpck_require__(22545); +const middleware_logger_1 = __nccwpck_require__(20014); +const middleware_recursion_detection_1 = __nccwpck_require__(85525); +const middleware_user_agent_1 = __nccwpck_require__(64688); +const config_resolver_1 = __nccwpck_require__(53098); +const middleware_content_length_1 = __nccwpck_require__(82800); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_retry_1 = __nccwpck_require__(96039); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } })); +const EndpointParameters_1 = __nccwpck_require__(34214); +const runtimeConfig_1 = __nccwpck_require__(19756); +const runtimeExtensions_1 = __nccwpck_require__(63398); +class SSOClient extends smithy_client_1.Client { + constructor(...[configuration]) { + const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration || {}); + const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); + const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1); + const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2); + const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3); + const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_5); + const _config_7 = (0, runtimeExtensions_1.resolveRuntimeExtensions)(_config_6, configuration?.extensions || []); + super(_config_7); + this.config = _config_7; + this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); + } + destroy() { + super.destroy(); + } +} +exports.SSOClient = SSOClient; + + +/***/ }), + +/***/ 18972: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetRoleCredentialsCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(30917); +const models_0_1 = __nccwpck_require__(66390); +const Aws_restJson1_1 = __nccwpck_require__(98507); +class GetRoleCredentialsCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetRoleCredentialsCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "SSOClient"; + const commandName = "GetRoleCredentialsCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.GetRoleCredentialsRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.GetRoleCredentialsResponseFilterSensitiveLog, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SWBPortalService", + operation: "GetRoleCredentials", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_restJson1_1.se_GetRoleCredentialsCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_restJson1_1.de_GetRoleCredentialsCommand)(output, context); + } +} +exports.GetRoleCredentialsCommand = GetRoleCredentialsCommand; + + +/***/ }), + +/***/ 1513: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ListAccountRolesCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(30917); +const models_0_1 = __nccwpck_require__(66390); +const Aws_restJson1_1 = __nccwpck_require__(98507); +class ListAccountRolesCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, ListAccountRolesCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "SSOClient"; + const commandName = "ListAccountRolesCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.ListAccountRolesRequestFilterSensitiveLog, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SWBPortalService", + operation: "ListAccountRoles", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_restJson1_1.se_ListAccountRolesCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_restJson1_1.de_ListAccountRolesCommand)(output, context); + } +} +exports.ListAccountRolesCommand = ListAccountRolesCommand; + + +/***/ }), + +/***/ 64296: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ListAccountsCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(30917); +const models_0_1 = __nccwpck_require__(66390); +const Aws_restJson1_1 = __nccwpck_require__(98507); +class ListAccountsCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, ListAccountsCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "SSOClient"; + const commandName = "ListAccountsCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.ListAccountsRequestFilterSensitiveLog, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SWBPortalService", + operation: "ListAccounts", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_restJson1_1.se_ListAccountsCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_restJson1_1.de_ListAccountsCommand)(output, context); + } +} +exports.ListAccountsCommand = ListAccountsCommand; + + +/***/ }), + +/***/ 12586: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.LogoutCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(30917); +const models_0_1 = __nccwpck_require__(66390); +const Aws_restJson1_1 = __nccwpck_require__(98507); +class LogoutCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, LogoutCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "SSOClient"; + const commandName = "LogoutCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.LogoutRequestFilterSensitiveLog, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "SWBPortalService", + operation: "Logout", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_restJson1_1.se_LogoutCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_restJson1_1.de_LogoutCommand)(output, context); + } +} +exports.LogoutCommand = LogoutCommand; + + +/***/ }), + +/***/ 65706: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(18972), exports); +tslib_1.__exportStar(__nccwpck_require__(1513), exports); +tslib_1.__exportStar(__nccwpck_require__(64296), exports); +tslib_1.__exportStar(__nccwpck_require__(12586), exports); + + +/***/ }), + +/***/ 34214: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveClientEndpointParameters = void 0; +const resolveClientEndpointParameters = (options) => { + return { + ...options, + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + defaultSigningName: "awsssoportal", + }; +}; +exports.resolveClientEndpointParameters = resolveClientEndpointParameters; + + +/***/ }), + +/***/ 30898: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultEndpointResolver = void 0; +const util_endpoints_1 = __nccwpck_require__(13350); +const ruleset_1 = __nccwpck_require__(13341); +const defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_1.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams: endpointParams, + logger: context.logger, + }); +}; +exports.defaultEndpointResolver = defaultEndpointResolver; + + +/***/ }), + +/***/ 13341: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ruleSet = void 0; +const q = "required", r = "fn", s = "argv", t = "ref"; +const a = "isSet", b = "tree", c = "error", d = "endpoint", e = "PartitionResult", f = { [q]: false, "type": "String" }, g = { [q]: true, "default": false, "type": "Boolean" }, h = { [t]: "Endpoint" }, i = { [r]: "booleanEquals", [s]: [{ [t]: "UseFIPS" }, true] }, j = { [r]: "booleanEquals", [s]: [{ [t]: "UseDualStack" }, true] }, k = {}, l = { [r]: "booleanEquals", [s]: [true, { [r]: "getAttr", [s]: [{ [t]: e }, "supportsFIPS"] }] }, m = { [r]: "booleanEquals", [s]: [true, { [r]: "getAttr", [s]: [{ [t]: e }, "supportsDualStack"] }] }, n = [i], o = [j], p = [{ [t]: "Region" }]; +const _data = { version: "1.0", parameters: { Region: f, UseDualStack: g, UseFIPS: g, Endpoint: f }, rules: [{ conditions: [{ [r]: a, [s]: [h] }], type: b, rules: [{ conditions: n, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: c }, { conditions: o, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: c }, { endpoint: { url: h, properties: k, headers: k }, type: d }] }, { conditions: [{ [r]: a, [s]: p }], type: b, rules: [{ conditions: [{ [r]: "aws.partition", [s]: p, assign: e }], type: b, rules: [{ conditions: [i, j], type: b, rules: [{ conditions: [l, m], type: b, rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: k, headers: k }, type: d }] }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: c }] }, { conditions: n, type: b, rules: [{ conditions: [l], type: b, rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dnsSuffix}", properties: k, headers: k }, type: d }] }, { error: "FIPS is enabled but this partition does not support FIPS", type: c }] }, { conditions: o, type: b, rules: [{ conditions: [m], type: b, rules: [{ endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: k, headers: k }, type: d }] }, { error: "DualStack is enabled but this partition does not support DualStack", type: c }] }, { endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dnsSuffix}", properties: k, headers: k }, type: d }] }] }, { error: "Invalid Configuration: Missing Region", type: c }] }; +exports.ruleSet = _data; + + +/***/ }), + +/***/ 82666: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SSOServiceException = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(71057), exports); +tslib_1.__exportStar(__nccwpck_require__(69838), exports); +tslib_1.__exportStar(__nccwpck_require__(65706), exports); +tslib_1.__exportStar(__nccwpck_require__(36773), exports); +tslib_1.__exportStar(__nccwpck_require__(14952), exports); +var SSOServiceException_1 = __nccwpck_require__(81517); +Object.defineProperty(exports, "SSOServiceException", ({ enumerable: true, get: function () { return SSOServiceException_1.SSOServiceException; } })); + + +/***/ }), + +/***/ 81517: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SSOServiceException = exports.__ServiceException = void 0; +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "__ServiceException", ({ enumerable: true, get: function () { return smithy_client_1.ServiceException; } })); +class SSOServiceException extends smithy_client_1.ServiceException { + constructor(options) { + super(options); + Object.setPrototypeOf(this, SSOServiceException.prototype); + } +} +exports.SSOServiceException = SSOServiceException; + + +/***/ }), + +/***/ 14952: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(66390), exports); + + +/***/ }), + +/***/ 66390: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.LogoutRequestFilterSensitiveLog = exports.ListAccountsRequestFilterSensitiveLog = exports.ListAccountRolesRequestFilterSensitiveLog = exports.GetRoleCredentialsResponseFilterSensitiveLog = exports.RoleCredentialsFilterSensitiveLog = exports.GetRoleCredentialsRequestFilterSensitiveLog = exports.UnauthorizedException = exports.TooManyRequestsException = exports.ResourceNotFoundException = exports.InvalidRequestException = void 0; +const smithy_client_1 = __nccwpck_require__(63570); +const SSOServiceException_1 = __nccwpck_require__(81517); +class InvalidRequestException extends SSOServiceException_1.SSOServiceException { + constructor(opts) { + super({ + name: "InvalidRequestException", + $fault: "client", + ...opts, + }); + this.name = "InvalidRequestException"; + this.$fault = "client"; + Object.setPrototypeOf(this, InvalidRequestException.prototype); + } +} +exports.InvalidRequestException = InvalidRequestException; +class ResourceNotFoundException extends SSOServiceException_1.SSOServiceException { + constructor(opts) { + super({ + name: "ResourceNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "ResourceNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, ResourceNotFoundException.prototype); + } +} +exports.ResourceNotFoundException = ResourceNotFoundException; +class TooManyRequestsException extends SSOServiceException_1.SSOServiceException { + constructor(opts) { + super({ + name: "TooManyRequestsException", + $fault: "client", + ...opts, + }); + this.name = "TooManyRequestsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, TooManyRequestsException.prototype); + } +} +exports.TooManyRequestsException = TooManyRequestsException; +class UnauthorizedException extends SSOServiceException_1.SSOServiceException { + constructor(opts) { + super({ + name: "UnauthorizedException", + $fault: "client", + ...opts, + }); + this.name = "UnauthorizedException"; + this.$fault = "client"; + Object.setPrototypeOf(this, UnauthorizedException.prototype); + } +} +exports.UnauthorizedException = UnauthorizedException; +const GetRoleCredentialsRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }), +}); +exports.GetRoleCredentialsRequestFilterSensitiveLog = GetRoleCredentialsRequestFilterSensitiveLog; +const RoleCredentialsFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.secretAccessKey && { secretAccessKey: smithy_client_1.SENSITIVE_STRING }), + ...(obj.sessionToken && { sessionToken: smithy_client_1.SENSITIVE_STRING }), +}); +exports.RoleCredentialsFilterSensitiveLog = RoleCredentialsFilterSensitiveLog; +const GetRoleCredentialsResponseFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.roleCredentials && { roleCredentials: (0, exports.RoleCredentialsFilterSensitiveLog)(obj.roleCredentials) }), +}); +exports.GetRoleCredentialsResponseFilterSensitiveLog = GetRoleCredentialsResponseFilterSensitiveLog; +const ListAccountRolesRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }), +}); +exports.ListAccountRolesRequestFilterSensitiveLog = ListAccountRolesRequestFilterSensitiveLog; +const ListAccountsRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }), +}); +exports.ListAccountsRequestFilterSensitiveLog = ListAccountsRequestFilterSensitiveLog; +const LogoutRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }), +}); +exports.LogoutRequestFilterSensitiveLog = LogoutRequestFilterSensitiveLog; + + +/***/ }), + +/***/ 80849: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 88460: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.paginateListAccountRoles = void 0; +const ListAccountRolesCommand_1 = __nccwpck_require__(1513); +const SSOClient_1 = __nccwpck_require__(71057); +const makePagedClientRequest = async (client, input, ...args) => { + return await client.send(new ListAccountRolesCommand_1.ListAccountRolesCommand(input), ...args); +}; +async function* paginateListAccountRoles(config, input, ...additionalArguments) { + let token = config.startingToken || undefined; + let hasNext = true; + let page; + while (hasNext) { + input.nextToken = token; + input["maxResults"] = config.pageSize; + if (config.client instanceof SSOClient_1.SSOClient) { + page = await makePagedClientRequest(config.client, input, ...additionalArguments); + } + else { + throw new Error("Invalid client, expected SSO | SSOClient"); + } + yield page; + const prevToken = token; + token = page.nextToken; + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return undefined; +} +exports.paginateListAccountRoles = paginateListAccountRoles; + + +/***/ }), + +/***/ 50938: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.paginateListAccounts = void 0; +const ListAccountsCommand_1 = __nccwpck_require__(64296); +const SSOClient_1 = __nccwpck_require__(71057); +const makePagedClientRequest = async (client, input, ...args) => { + return await client.send(new ListAccountsCommand_1.ListAccountsCommand(input), ...args); +}; +async function* paginateListAccounts(config, input, ...additionalArguments) { + let token = config.startingToken || undefined; + let hasNext = true; + let page; + while (hasNext) { + input.nextToken = token; + input["maxResults"] = config.pageSize; + if (config.client instanceof SSOClient_1.SSOClient) { + page = await makePagedClientRequest(config.client, input, ...additionalArguments); + } + else { + throw new Error("Invalid client, expected SSO | SSOClient"); + } + yield page; + const prevToken = token; + token = page.nextToken; + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return undefined; +} +exports.paginateListAccounts = paginateListAccounts; + + +/***/ }), + +/***/ 36773: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(80849), exports); +tslib_1.__exportStar(__nccwpck_require__(88460), exports); +tslib_1.__exportStar(__nccwpck_require__(50938), exports); + + +/***/ }), + +/***/ 98507: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.de_LogoutCommand = exports.de_ListAccountsCommand = exports.de_ListAccountRolesCommand = exports.de_GetRoleCredentialsCommand = exports.se_LogoutCommand = exports.se_ListAccountsCommand = exports.se_ListAccountRolesCommand = exports.se_GetRoleCredentialsCommand = void 0; +const protocol_http_1 = __nccwpck_require__(23555); +const smithy_client_1 = __nccwpck_require__(63570); +const models_0_1 = __nccwpck_require__(66390); +const SSOServiceException_1 = __nccwpck_require__(81517); +const se_GetRoleCredentialsCommand = async (input, context) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const headers = (0, smithy_client_1.map)({}, isSerializableHeaderValue, { + "x-amz-sso_bearer_token": input.accessToken, + }); + const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/federation/credentials"; + const query = (0, smithy_client_1.map)({ + role_name: [, (0, smithy_client_1.expectNonNull)(input.roleName, `roleName`)], + account_id: [, (0, smithy_client_1.expectNonNull)(input.accountId, `accountId`)], + }); + let body; + return new protocol_http_1.HttpRequest({ + protocol, + hostname, + port, + method: "GET", + headers, + path: resolvedPath, + query, + body, + }); +}; +exports.se_GetRoleCredentialsCommand = se_GetRoleCredentialsCommand; +const se_ListAccountRolesCommand = async (input, context) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const headers = (0, smithy_client_1.map)({}, isSerializableHeaderValue, { + "x-amz-sso_bearer_token": input.accessToken, + }); + const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/assignment/roles"; + const query = (0, smithy_client_1.map)({ + next_token: [, input.nextToken], + max_result: [() => input.maxResults !== void 0, () => input.maxResults.toString()], + account_id: [, (0, smithy_client_1.expectNonNull)(input.accountId, `accountId`)], + }); + let body; + return new protocol_http_1.HttpRequest({ + protocol, + hostname, + port, + method: "GET", + headers, + path: resolvedPath, + query, + body, + }); +}; +exports.se_ListAccountRolesCommand = se_ListAccountRolesCommand; +const se_ListAccountsCommand = async (input, context) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const headers = (0, smithy_client_1.map)({}, isSerializableHeaderValue, { + "x-amz-sso_bearer_token": input.accessToken, + }); + const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/assignment/accounts"; + const query = (0, smithy_client_1.map)({ + next_token: [, input.nextToken], + max_result: [() => input.maxResults !== void 0, () => input.maxResults.toString()], + }); + let body; + return new protocol_http_1.HttpRequest({ + protocol, + hostname, + port, + method: "GET", + headers, + path: resolvedPath, + query, + body, + }); +}; +exports.se_ListAccountsCommand = se_ListAccountsCommand; +const se_LogoutCommand = async (input, context) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const headers = (0, smithy_client_1.map)({}, isSerializableHeaderValue, { + "x-amz-sso_bearer_token": input.accessToken, + }); + const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/logout"; + let body; + return new protocol_http_1.HttpRequest({ + protocol, + hostname, + port, + method: "POST", + headers, + path: resolvedPath, + body, + }); +}; +exports.se_LogoutCommand = se_LogoutCommand; +const de_GetRoleCredentialsCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_GetRoleCredentialsCommandError(output, context); + } + const contents = (0, smithy_client_1.map)({ + $metadata: deserializeMetadata(output), + }); + const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body"); + const doc = (0, smithy_client_1.take)(data, { + roleCredentials: smithy_client_1._json, + }); + Object.assign(contents, doc); + return contents; +}; +exports.de_GetRoleCredentialsCommand = de_GetRoleCredentialsCommand; +const de_GetRoleCredentialsCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidRequestException": + case "com.amazonaws.sso#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput, context); + case "ResourceNotFoundException": + case "com.amazonaws.sso#ResourceNotFoundException": + throw await de_ResourceNotFoundExceptionRes(parsedOutput, context); + case "TooManyRequestsException": + case "com.amazonaws.sso#TooManyRequestsException": + throw await de_TooManyRequestsExceptionRes(parsedOutput, context); + case "UnauthorizedException": + case "com.amazonaws.sso#UnauthorizedException": + throw await de_UnauthorizedExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_ListAccountRolesCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_ListAccountRolesCommandError(output, context); + } + const contents = (0, smithy_client_1.map)({ + $metadata: deserializeMetadata(output), + }); + const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body"); + const doc = (0, smithy_client_1.take)(data, { + nextToken: smithy_client_1.expectString, + roleList: smithy_client_1._json, + }); + Object.assign(contents, doc); + return contents; +}; +exports.de_ListAccountRolesCommand = de_ListAccountRolesCommand; +const de_ListAccountRolesCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidRequestException": + case "com.amazonaws.sso#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput, context); + case "ResourceNotFoundException": + case "com.amazonaws.sso#ResourceNotFoundException": + throw await de_ResourceNotFoundExceptionRes(parsedOutput, context); + case "TooManyRequestsException": + case "com.amazonaws.sso#TooManyRequestsException": + throw await de_TooManyRequestsExceptionRes(parsedOutput, context); + case "UnauthorizedException": + case "com.amazonaws.sso#UnauthorizedException": + throw await de_UnauthorizedExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_ListAccountsCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_ListAccountsCommandError(output, context); + } + const contents = (0, smithy_client_1.map)({ + $metadata: deserializeMetadata(output), + }); + const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body"); + const doc = (0, smithy_client_1.take)(data, { + accountList: smithy_client_1._json, + nextToken: smithy_client_1.expectString, + }); + Object.assign(contents, doc); + return contents; +}; +exports.de_ListAccountsCommand = de_ListAccountsCommand; +const de_ListAccountsCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidRequestException": + case "com.amazonaws.sso#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput, context); + case "ResourceNotFoundException": + case "com.amazonaws.sso#ResourceNotFoundException": + throw await de_ResourceNotFoundExceptionRes(parsedOutput, context); + case "TooManyRequestsException": + case "com.amazonaws.sso#TooManyRequestsException": + throw await de_TooManyRequestsExceptionRes(parsedOutput, context); + case "UnauthorizedException": + case "com.amazonaws.sso#UnauthorizedException": + throw await de_UnauthorizedExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const de_LogoutCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_LogoutCommandError(output, context); + } + const contents = (0, smithy_client_1.map)({ + $metadata: deserializeMetadata(output), + }); + await (0, smithy_client_1.collectBody)(output.body, context); + return contents; +}; +exports.de_LogoutCommand = de_LogoutCommand; +const de_LogoutCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidRequestException": + case "com.amazonaws.sso#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput, context); + case "TooManyRequestsException": + case "com.amazonaws.sso#TooManyRequestsException": + throw await de_TooManyRequestsExceptionRes(parsedOutput, context); + case "UnauthorizedException": + case "com.amazonaws.sso#UnauthorizedException": + throw await de_UnauthorizedExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode, + }); + } +}; +const throwDefaultError = (0, smithy_client_1.withBaseException)(SSOServiceException_1.SSOServiceException); +const de_InvalidRequestExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_1.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_1.take)(data, { + message: smithy_client_1.expectString, + }); + Object.assign(contents, doc); + const exception = new models_0_1.InvalidRequestException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); +}; +const de_ResourceNotFoundExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_1.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_1.take)(data, { + message: smithy_client_1.expectString, + }); + Object.assign(contents, doc); + const exception = new models_0_1.ResourceNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); +}; +const de_TooManyRequestsExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_1.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_1.take)(data, { + message: smithy_client_1.expectString, + }); + Object.assign(contents, doc); + const exception = new models_0_1.TooManyRequestsException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); +}; +const de_UnauthorizedExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_1.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_1.take)(data, { + message: smithy_client_1.expectString, + }); + Object.assign(contents, doc); + const exception = new models_0_1.UnauthorizedException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); +}; +const deserializeMetadata = (output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"], +}); +const collectBodyString = (streamBody, context) => (0, smithy_client_1.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)); +const isSerializableHeaderValue = (value) => value !== undefined && + value !== null && + value !== "" && + (!Object.getOwnPropertyNames(value).includes("length") || value.length != 0) && + (!Object.getOwnPropertyNames(value).includes("size") || value.size != 0); +const parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + return JSON.parse(encoded); + } + return {}; +}); +const parseErrorBody = async (errorBody, context) => { + const value = await parseBody(errorBody, context); + value.message = value.message ?? value.Message; + return value; +}; +const loadRestJsonErrorCode = (output, data) => { + const findKey = (object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()); + const sanitizeErrorCode = (rawValue) => { + let cleanValue = rawValue; + if (typeof cleanValue === "number") { + cleanValue = cleanValue.toString(); + } + if (cleanValue.indexOf(",") >= 0) { + cleanValue = cleanValue.split(",")[0]; + } + if (cleanValue.indexOf(":") >= 0) { + cleanValue = cleanValue.split(":")[0]; + } + if (cleanValue.indexOf("#") >= 0) { + cleanValue = cleanValue.split("#")[1]; + } + return cleanValue; + }; + const headerKey = findKey(output.headers, "x-amzn-errortype"); + if (headerKey !== undefined) { + return sanitizeErrorCode(output.headers[headerKey]); + } + if (data.code !== undefined) { + return sanitizeErrorCode(data.code); + } + if (data["__type"] !== undefined) { + return sanitizeErrorCode(data["__type"]); + } +}; + + +/***/ }), + +/***/ 19756: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const tslib_1 = __nccwpck_require__(4351); +const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(91092)); +const util_user_agent_node_1 = __nccwpck_require__(98095); +const config_resolver_1 = __nccwpck_require__(53098); +const hash_node_1 = __nccwpck_require__(3081); +const middleware_retry_1 = __nccwpck_require__(96039); +const node_config_provider_1 = __nccwpck_require__(33461); +const node_http_handler_1 = __nccwpck_require__(67028); +const util_body_length_node_1 = __nccwpck_require__(68075); +const util_retry_1 = __nccwpck_require__(84902); +const runtimeConfig_shared_1 = __nccwpck_require__(4355); +const smithy_client_1 = __nccwpck_require__(63570); +const util_defaults_mode_node_1 = __nccwpck_require__(72429); +const smithy_client_2 = __nccwpck_require__(63570); +const getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? + (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: config?.requestHandler ?? new node_http_handler_1.NodeHttpHandler(defaultConfigProvider), + retryMode: config?.retryMode ?? + (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, + }), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 4355: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const smithy_client_1 = __nccwpck_require__(63570); +const url_parser_1 = __nccwpck_require__(14681); +const util_base64_1 = __nccwpck_require__(75600); +const util_utf8_1 = __nccwpck_require__(41895); +const endpointResolver_1 = __nccwpck_require__(30898); +const getRuntimeConfig = (config) => ({ + apiVersion: "2019-06-10", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "SSO", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, +}); +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 63398: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveRuntimeExtensions = void 0; +const region_config_resolver_1 = __nccwpck_require__(18156); +const protocol_http_1 = __nccwpck_require__(23555); +const smithy_client_1 = __nccwpck_require__(63570); +const asPartial = (t) => t; +const resolveRuntimeExtensions = (runtimeConfig, extensions) => { + const extensionConfiguration = { + ...asPartial((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, smithy_client_1.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig)), + }; + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return { + ...runtimeConfig, + ...(0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), + ...(0, smithy_client_1.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), + }; +}; +exports.resolveRuntimeExtensions = resolveRuntimeExtensions; + + +/***/ }), + +/***/ 70579: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODEJS_TIMEOUT_ERROR_CODES = void 0; +exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + + +/***/ }), + +/***/ 64434: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getTransformedHeaders = void 0; +const getTransformedHeaders = (headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; + } + return transformedHeaders; +}; +exports.getTransformedHeaders = getTransformedHeaders; + + +/***/ }), + +/***/ 67028: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(11081), exports); +tslib_1.__exportStar(__nccwpck_require__(75770), exports); +tslib_1.__exportStar(__nccwpck_require__(22775), exports); + + +/***/ }), + +/***/ 11081: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttpHandler = exports.DEFAULT_REQUEST_TIMEOUT = void 0; +const protocol_http_1 = __nccwpck_require__(23555); +const querystring_builder_1 = __nccwpck_require__(77090); +const http_1 = __nccwpck_require__(13685); +const https_1 = __nccwpck_require__(95687); +const constants_1 = __nccwpck_require__(70579); +const get_transformed_headers_1 = __nccwpck_require__(64434); +const set_connection_timeout_1 = __nccwpck_require__(99643); +const set_socket_keep_alive_1 = __nccwpck_require__(90354); +const set_socket_timeout_1 = __nccwpck_require__(65050); +const write_request_body_1 = __nccwpck_require__(25185); +exports.DEFAULT_REQUEST_TIMEOUT = 0; +class NodeHttpHandler { + constructor(options) { + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }) + .catch(reject); + } + else { + resolve(this.resolveDefaultConfig(options)); + } + }); + } + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + requestTimeout: requestTimeout !== null && requestTimeout !== void 0 ? requestTimeout : socketTimeout, + httpAgent: httpAgent || new http_1.Agent({ keepAlive, maxSockets }), + httpsAgent: httpsAgent || new https_1.Agent({ keepAlive, maxSockets }), + }; + } + destroy() { + var _a, _b, _c, _d; + (_b = (_a = this.config) === null || _a === void 0 ? void 0 : _a.httpAgent) === null || _b === void 0 ? void 0 : _b.destroy(); + (_d = (_c = this.config) === null || _c === void 0 ? void 0 : _c.httpsAgent) === null || _d === void 0 ? void 0 : _d.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + return new Promise((_resolve, _reject) => { + var _a, _b; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const queryString = (0, querystring_builder_1.buildQueryString)(request.query || {}); + let auth = undefined; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}`; + } + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const nodeHttpsOptions = { + headers: request.headers, + host: request.hostname, + method: request.method, + path, + port: request.port, + agent: isSSL ? this.config.httpsAgent : this.config.httpAgent, + auth, + }; + const requestFunc = isSSL ? https_1.request : http_1.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(res.headers), + body: res, + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } + else { + reject(err); + } + }); + (0, set_connection_timeout_1.setConnectionTimeout)(req, reject, this.config.connectionTimeout); + (0, set_socket_timeout_1.setSocketTimeout)(req, reject, this.config.requestTimeout); + if (abortSignal) { + abortSignal.onabort = () => { + req.abort(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }; + } + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + (0, set_socket_keep_alive_1.setSocketKeepAlive)(req, { + keepAlive: httpAgent.keepAlive, + keepAliveMsecs: httpAgent.keepAliveMsecs, + }); + } + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, this.config.requestTimeout).catch(_reject); + }); + } + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); + } + httpHandlerConfigs() { + var _a; + return (_a = this.config) !== null && _a !== void 0 ? _a : {}; + } +} +exports.NodeHttpHandler = NodeHttpHandler; + + +/***/ }), + +/***/ 15569: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2ConnectionManager = void 0; +const tslib_1 = __nccwpck_require__(4351); +const http2_1 = tslib_1.__importDefault(__nccwpck_require__(85158)); +const node_http2_connection_pool_1 = __nccwpck_require__(33739); +class NodeHttp2ConnectionManager { + constructor(config) { + this.sessionCache = new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); + } + } + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; + } + } + const session = http2_1.default.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error("Fail to set maxConcurrentStreams to " + + this.config.maxConcurrency + + "when creating new session for " + + requestContext.destination.toString()); + } + }); + } + session.unref(); + const destroySessionCb = () => { + session.destroy(); + this.deleteSession(url, session); + }; + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new node_http2_connection_pool_1.NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; + } + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; + } + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); + } + release(requestContext, session) { + var _a; + const cacheKey = this.getUrlString(requestContext); + (_a = this.sessionCache.get(cacheKey)) === null || _a === void 0 ? void 0 : _a.offerLast(session); + } + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); + } + this.sessionCache.delete(key); + } + } + setMaxConcurrentStreams(maxConcurrentStreams) { + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); + } + this.config.maxConcurrency = maxConcurrentStreams; + } + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; + } + getUrlString(request) { + return request.destination.toString(); + } +} +exports.NodeHttp2ConnectionManager = NodeHttp2ConnectionManager; + + +/***/ }), + +/***/ 33739: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2ConnectionPool = void 0; +class NodeHttp2ConnectionPool { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions !== null && sessions !== void 0 ? sessions : []; + } + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); + } + } + offerLast(session) { + this.sessions.push(session); + } + contains(session) { + return this.sessions.includes(session); + } + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); + } + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); + } + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } + } + } + } +} +exports.NodeHttp2ConnectionPool = NodeHttp2ConnectionPool; + + +/***/ }), + +/***/ 75770: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2Handler = void 0; +const protocol_http_1 = __nccwpck_require__(23555); +const querystring_builder_1 = __nccwpck_require__(77090); +const http2_1 = __nccwpck_require__(85158); +const get_transformed_headers_1 = __nccwpck_require__(64434); +const node_http2_connection_manager_1 = __nccwpck_require__(15569); +const write_request_body_1 = __nccwpck_require__(25185); +class NodeHttp2Handler { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new node_http2_connection_manager_1.NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((opts) => { + resolve(opts || {}); + }) + .catch(reject); + } + else { + resolve(options || {}); + } + }); + } + destroy() { + this.connectionManager.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } + } + const { requestTimeout, disableConcurrentStreams } = this.config; + return new Promise((_resolve, _reject) => { + var _a, _b, _c; + let fulfilled = false; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request; + let auth = ""; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: (_c = this.config) === null || _c === void 0 ? void 0 : _c.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false, + }); + const rejectWithDestroy = (err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + reject(err); + }; + const queryString = (0, querystring_builder_1.buildQueryString)(query || {}); + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const req = session.request({ + ...request.headers, + [http2_1.constants.HTTP2_HEADER_PATH]: path, + [http2_1.constants.HTTP2_HEADER_METHOD]: method, + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(headers), + body: req, + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (requestTimeout) { + req.setTimeout(requestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + abortSignal.onabort = () => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }; + } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy(new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`)); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, requestTimeout); + }); + } + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); + } + httpHandlerConfigs() { + var _a; + return (_a = this.config) !== null && _a !== void 0 ? _a : {}; + } + destroySession(session) { + if (!session.destroyed) { + session.destroy(); + } + } +} +exports.NodeHttp2Handler = NodeHttp2Handler; + + +/***/ }), + +/***/ 99643: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setConnectionTimeout = void 0; +const setConnectionTimeout = (request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return; + } + const timeoutId = setTimeout(() => { + request.destroy(); + reject(Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError", + })); + }, timeoutInMs); + request.on("socket", (socket) => { + if (socket.connecting) { + socket.on("connect", () => { + clearTimeout(timeoutId); + }); + } + else { + clearTimeout(timeoutId); + } + }); +}; +exports.setConnectionTimeout = setConnectionTimeout; + + +/***/ }), + +/***/ 90354: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setSocketKeepAlive = void 0; +const setSocketKeepAlive = (request, { keepAlive, keepAliveMsecs }) => { + if (keepAlive !== true) { + return; + } + request.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); +}; +exports.setSocketKeepAlive = setSocketKeepAlive; + + +/***/ }), + +/***/ 65050: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setSocketTimeout = void 0; +const setSocketTimeout = (request, reject, timeoutInMs = 0) => { + request.setTimeout(timeoutInMs, () => { + request.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }); +}; +exports.setSocketTimeout = setSocketTimeout; + + +/***/ }), + +/***/ 41986: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Collector = void 0; +const stream_1 = __nccwpck_require__(12781); +class Collector extends stream_1.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; + } + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); + } +} +exports.Collector = Collector; + + +/***/ }), + +/***/ 22775: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.streamCollector = void 0; +const collector_1 = __nccwpck_require__(41986); +const streamCollector = (stream) => new Promise((resolve, reject) => { + const collector = new collector_1.Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function () { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); +}); +exports.streamCollector = streamCollector; + + +/***/ }), + +/***/ 25185: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.writeRequestBody = void 0; +const stream_1 = __nccwpck_require__(12781); +const MIN_WAIT_TIME = 1000; +async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { + var _a; + const headers = (_a = request.headers) !== null && _a !== void 0 ? _a : {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let hasError = false; + if (expect === "100-continue") { + await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + clearTimeout(timeoutId); + resolve(); + }); + httpRequest.on("error", () => { + hasError = true; + clearTimeout(timeoutId); + resolve(); + }); + }), + ]); + } + if (!hasError) { + writeBody(httpRequest, request.body); + } +} +exports.writeRequestBody = writeRequestBody; +function writeBody(httpRequest, body) { + if (body instanceof stream_1.Readable) { + body.pipe(httpRequest); + } + else if (body) { + httpRequest.end(Buffer.from(body)); + } + else { + httpRequest.end(); + } +} + + +/***/ }), + +/***/ 23504: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Field = void 0; +const types_1 = __nccwpck_require__(30917); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + add(value) { + this.values.push(value); + } + set(values) { + this.values = values; + } + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; + } +} +exports.Field = Field; + + +/***/ }), + +/***/ 10633: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + getField(name) { + return this.entries[name.toLowerCase()]; + } + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +} +exports.Fields = Fields; + + +/***/ }), + +/***/ 88255: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0; +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; + return { + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + }, + }; +}; +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), + }; +}; +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; + + +/***/ }), + +/***/ 30613: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(88255), exports); + + +/***/ }), + +/***/ 81888: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 61324: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); + } + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; + } +} +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} + + +/***/ }), + +/***/ 93879: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} +exports.HttpResponse = HttpResponse; + + +/***/ }), + +/***/ 23555: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(30613), exports); +tslib_1.__exportStar(__nccwpck_require__(23504), exports); +tslib_1.__exportStar(__nccwpck_require__(10633), exports); +tslib_1.__exportStar(__nccwpck_require__(81888), exports); +tslib_1.__exportStar(__nccwpck_require__(61324), exports); +tslib_1.__exportStar(__nccwpck_require__(93879), exports); +tslib_1.__exportStar(__nccwpck_require__(994), exports); +tslib_1.__exportStar(__nccwpck_require__(74390), exports); + + +/***/ }), + +/***/ 994: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; + + +/***/ }), + +/***/ 74390: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 77090: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.buildQueryString = void 0; +const util_uri_escape_1 = __nccwpck_require__(54067); +function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, util_uri_escape_1.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, util_uri_escape_1.escapeUri)(value[i])}`); + } + } + else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, util_uri_escape_1.escapeUri)(value)}`; + } + parts.push(qsEntry); + } + } + return parts.join("&"); +} +exports.buildQueryString = buildQueryString; + + +/***/ }), + +/***/ 64329: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 24798: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); + + +/***/ }), + +/***/ 28760: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 95531: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 79936: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 21170: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 58143: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 93150: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(58143), exports); +tslib_1.__exportStar(__nccwpck_require__(63368), exports); +tslib_1.__exportStar(__nccwpck_require__(13704), exports); + + +/***/ }), + +/***/ 63368: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 13704: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 3992: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 59813: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 53088: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 22067: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 12370: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 99168: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 50491: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 71531: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(22067), exports); +tslib_1.__exportStar(__nccwpck_require__(12370), exports); +tslib_1.__exportStar(__nccwpck_require__(99168), exports); +tslib_1.__exportStar(__nccwpck_require__(20902), exports); +tslib_1.__exportStar(__nccwpck_require__(50491), exports); + + +/***/ }), + +/***/ 20902: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 1335: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 49180: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); + } + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; +}; +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; + + +/***/ }), + +/***/ 11533: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(49180); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + }; +}; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; +}; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; + + +/***/ }), + +/***/ 29493: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 87140: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(11533), exports); +tslib_1.__exportStar(__nccwpck_require__(29493), exports); +var checksum_1 = __nccwpck_require__(49180); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); + + +/***/ }), + +/***/ 75603: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); + + +/***/ }), + +/***/ 51779: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 71038: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 61816: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(51779), exports); +tslib_1.__exportStar(__nccwpck_require__(71038), exports); + + +/***/ }), + +/***/ 30917: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(64329), exports); +tslib_1.__exportStar(__nccwpck_require__(24798), exports); +tslib_1.__exportStar(__nccwpck_require__(28760), exports); +tslib_1.__exportStar(__nccwpck_require__(95531), exports); +tslib_1.__exportStar(__nccwpck_require__(79936), exports); +tslib_1.__exportStar(__nccwpck_require__(21170), exports); +tslib_1.__exportStar(__nccwpck_require__(93150), exports); +tslib_1.__exportStar(__nccwpck_require__(3992), exports); +tslib_1.__exportStar(__nccwpck_require__(59813), exports); +tslib_1.__exportStar(__nccwpck_require__(53088), exports); +tslib_1.__exportStar(__nccwpck_require__(71531), exports); +tslib_1.__exportStar(__nccwpck_require__(1335), exports); +tslib_1.__exportStar(__nccwpck_require__(87140), exports); +tslib_1.__exportStar(__nccwpck_require__(75603), exports); +tslib_1.__exportStar(__nccwpck_require__(61816), exports); +tslib_1.__exportStar(__nccwpck_require__(22568), exports); +tslib_1.__exportStar(__nccwpck_require__(43236), exports); +tslib_1.__exportStar(__nccwpck_require__(88434), exports); +tslib_1.__exportStar(__nccwpck_require__(42986), exports); +tslib_1.__exportStar(__nccwpck_require__(35010), exports); +tslib_1.__exportStar(__nccwpck_require__(75383), exports); +tslib_1.__exportStar(__nccwpck_require__(72347), exports); +tslib_1.__exportStar(__nccwpck_require__(5009), exports); +tslib_1.__exportStar(__nccwpck_require__(45921), exports); +tslib_1.__exportStar(__nccwpck_require__(79748), exports); +tslib_1.__exportStar(__nccwpck_require__(76176), exports); +tslib_1.__exportStar(__nccwpck_require__(54284), exports); +tslib_1.__exportStar(__nccwpck_require__(98532), exports); +tslib_1.__exportStar(__nccwpck_require__(87522), exports); +tslib_1.__exportStar(__nccwpck_require__(26578), exports); +tslib_1.__exportStar(__nccwpck_require__(75330), exports); +tslib_1.__exportStar(__nccwpck_require__(5988), exports); +tslib_1.__exportStar(__nccwpck_require__(52121), exports); +tslib_1.__exportStar(__nccwpck_require__(91006), exports); + + +/***/ }), + +/***/ 22568: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 43236: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; + + +/***/ }), + +/***/ 88434: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 42986: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 35010: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 75383: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 72347: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 5009: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 45921: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 79748: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 76176: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 54284: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 98532: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 87522: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); + + +/***/ }), + +/***/ 26578: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 75330: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 5988: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 52121: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 91006: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 33240: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.escapeUriPath = void 0; +const escape_uri_1 = __nccwpck_require__(56009); +const escapeUriPath = (uri) => uri.split("/").map(escape_uri_1.escapeUri).join("/"); +exports.escapeUriPath = escapeUriPath; + + +/***/ }), + +/***/ 56009: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.escapeUri = void 0; +const escapeUri = (uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode); +exports.escapeUri = escapeUri; +const hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`; + + +/***/ }), + +/***/ 54067: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(56009), exports); +tslib_1.__exportStar(__nccwpck_require__(33240), exports); + + +/***/ }), + +/***/ 32605: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.STS = void 0; +const smithy_client_1 = __nccwpck_require__(63570); +const AssumeRoleCommand_1 = __nccwpck_require__(59802); +const AssumeRoleWithSAMLCommand_1 = __nccwpck_require__(72865); +const AssumeRoleWithWebIdentityCommand_1 = __nccwpck_require__(37451); +const DecodeAuthorizationMessageCommand_1 = __nccwpck_require__(74150); +const GetAccessKeyInfoCommand_1 = __nccwpck_require__(49804); +const GetCallerIdentityCommand_1 = __nccwpck_require__(24278); +const GetFederationTokenCommand_1 = __nccwpck_require__(57552); +const GetSessionTokenCommand_1 = __nccwpck_require__(43285); +const STSClient_1 = __nccwpck_require__(64195); +const commands = { + AssumeRoleCommand: AssumeRoleCommand_1.AssumeRoleCommand, + AssumeRoleWithSAMLCommand: AssumeRoleWithSAMLCommand_1.AssumeRoleWithSAMLCommand, + AssumeRoleWithWebIdentityCommand: AssumeRoleWithWebIdentityCommand_1.AssumeRoleWithWebIdentityCommand, + DecodeAuthorizationMessageCommand: DecodeAuthorizationMessageCommand_1.DecodeAuthorizationMessageCommand, + GetAccessKeyInfoCommand: GetAccessKeyInfoCommand_1.GetAccessKeyInfoCommand, + GetCallerIdentityCommand: GetCallerIdentityCommand_1.GetCallerIdentityCommand, + GetFederationTokenCommand: GetFederationTokenCommand_1.GetFederationTokenCommand, + GetSessionTokenCommand: GetSessionTokenCommand_1.GetSessionTokenCommand, +}; +class STS extends STSClient_1.STSClient { +} +exports.STS = STS; +(0, smithy_client_1.createAggregatedClient)(commands, STS); + + +/***/ }), + +/***/ 64195: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.STSClient = exports.__Client = void 0; +const middleware_host_header_1 = __nccwpck_require__(22545); +const middleware_logger_1 = __nccwpck_require__(20014); +const middleware_recursion_detection_1 = __nccwpck_require__(85525); +const middleware_sdk_sts_1 = __nccwpck_require__(55959); +const middleware_user_agent_1 = __nccwpck_require__(64688); +const config_resolver_1 = __nccwpck_require__(53098); +const middleware_content_length_1 = __nccwpck_require__(82800); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_retry_1 = __nccwpck_require__(96039); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } })); +const EndpointParameters_1 = __nccwpck_require__(20510); +const runtimeConfig_1 = __nccwpck_require__(83405); +const runtimeExtensions_1 = __nccwpck_require__(32053); +class STSClient extends smithy_client_1.Client { + constructor(...[configuration]) { + const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration || {}); + const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); + const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1); + const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2); + const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3); + const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, middleware_sdk_sts_1.resolveStsAuthConfig)(_config_5, { stsClientCtor: STSClient }); + const _config_7 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_6); + const _config_8 = (0, runtimeExtensions_1.resolveRuntimeExtensions)(_config_7, configuration?.extensions || []); + super(_config_8); + this.config = _config_8; + this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); + } + destroy() { + super.destroy(); + } +} +exports.STSClient = STSClient; + + +/***/ }), + +/***/ 59802: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AssumeRoleCommand = exports.$Command = void 0; +const middleware_signing_1 = __nccwpck_require__(14935); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(71551); +const models_0_1 = __nccwpck_require__(21780); +const Aws_query_1 = __nccwpck_require__(10740); +class AssumeRoleCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, AssumeRoleCommand.getEndpointParameterInstructions())); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "AssumeRoleCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: models_0_1.AssumeRoleResponseFilterSensitiveLog, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AWSSecurityTokenServiceV20110615", + operation: "AssumeRole", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.se_AssumeRoleCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.de_AssumeRoleCommand)(output, context); + } +} +exports.AssumeRoleCommand = AssumeRoleCommand; + + +/***/ }), + +/***/ 72865: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AssumeRoleWithSAMLCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(71551); +const models_0_1 = __nccwpck_require__(21780); +const Aws_query_1 = __nccwpck_require__(10740); +class AssumeRoleWithSAMLCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, AssumeRoleWithSAMLCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "AssumeRoleWithSAMLCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.AssumeRoleWithSAMLRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.AssumeRoleWithSAMLResponseFilterSensitiveLog, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AWSSecurityTokenServiceV20110615", + operation: "AssumeRoleWithSAML", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.se_AssumeRoleWithSAMLCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.de_AssumeRoleWithSAMLCommand)(output, context); + } +} +exports.AssumeRoleWithSAMLCommand = AssumeRoleWithSAMLCommand; + + +/***/ }), + +/***/ 37451: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AssumeRoleWithWebIdentityCommand = exports.$Command = void 0; +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(71551); +const models_0_1 = __nccwpck_require__(21780); +const Aws_query_1 = __nccwpck_require__(10740); +class AssumeRoleWithWebIdentityCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, AssumeRoleWithWebIdentityCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "AssumeRoleWithWebIdentityCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.AssumeRoleWithWebIdentityRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.AssumeRoleWithWebIdentityResponseFilterSensitiveLog, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AWSSecurityTokenServiceV20110615", + operation: "AssumeRoleWithWebIdentity", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.se_AssumeRoleWithWebIdentityCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.de_AssumeRoleWithWebIdentityCommand)(output, context); + } +} +exports.AssumeRoleWithWebIdentityCommand = AssumeRoleWithWebIdentityCommand; + + +/***/ }), + +/***/ 74150: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.DecodeAuthorizationMessageCommand = exports.$Command = void 0; +const middleware_signing_1 = __nccwpck_require__(14935); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(71551); +const Aws_query_1 = __nccwpck_require__(10740); +class DecodeAuthorizationMessageCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DecodeAuthorizationMessageCommand.getEndpointParameterInstructions())); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "DecodeAuthorizationMessageCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AWSSecurityTokenServiceV20110615", + operation: "DecodeAuthorizationMessage", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.se_DecodeAuthorizationMessageCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.de_DecodeAuthorizationMessageCommand)(output, context); + } +} +exports.DecodeAuthorizationMessageCommand = DecodeAuthorizationMessageCommand; + + +/***/ }), + +/***/ 49804: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetAccessKeyInfoCommand = exports.$Command = void 0; +const middleware_signing_1 = __nccwpck_require__(14935); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(71551); +const Aws_query_1 = __nccwpck_require__(10740); +class GetAccessKeyInfoCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetAccessKeyInfoCommand.getEndpointParameterInstructions())); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "GetAccessKeyInfoCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AWSSecurityTokenServiceV20110615", + operation: "GetAccessKeyInfo", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.se_GetAccessKeyInfoCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.de_GetAccessKeyInfoCommand)(output, context); + } +} +exports.GetAccessKeyInfoCommand = GetAccessKeyInfoCommand; + + +/***/ }), + +/***/ 24278: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetCallerIdentityCommand = exports.$Command = void 0; +const middleware_signing_1 = __nccwpck_require__(14935); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(71551); +const Aws_query_1 = __nccwpck_require__(10740); +class GetCallerIdentityCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetCallerIdentityCommand.getEndpointParameterInstructions())); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "GetCallerIdentityCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AWSSecurityTokenServiceV20110615", + operation: "GetCallerIdentity", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.se_GetCallerIdentityCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.de_GetCallerIdentityCommand)(output, context); + } +} +exports.GetCallerIdentityCommand = GetCallerIdentityCommand; + + +/***/ }), + +/***/ 57552: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetFederationTokenCommand = exports.$Command = void 0; +const middleware_signing_1 = __nccwpck_require__(14935); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(71551); +const models_0_1 = __nccwpck_require__(21780); +const Aws_query_1 = __nccwpck_require__(10740); +class GetFederationTokenCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetFederationTokenCommand.getEndpointParameterInstructions())); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "GetFederationTokenCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: models_0_1.GetFederationTokenResponseFilterSensitiveLog, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AWSSecurityTokenServiceV20110615", + operation: "GetFederationToken", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.se_GetFederationTokenCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.de_GetFederationTokenCommand)(output, context); + } +} +exports.GetFederationTokenCommand = GetFederationTokenCommand; + + +/***/ }), + +/***/ 43285: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetSessionTokenCommand = exports.$Command = void 0; +const middleware_signing_1 = __nccwpck_require__(14935); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); +const types_1 = __nccwpck_require__(71551); +const models_0_1 = __nccwpck_require__(21780); +const Aws_query_1 = __nccwpck_require__(10740); +class GetSessionTokenCommand extends smithy_client_1.Command { + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + constructor(input) { + super(); + this.input = input; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetSessionTokenCommand.getEndpointParameterInstructions())); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "GetSessionTokenCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: models_0_1.GetSessionTokenResponseFilterSensitiveLog, + [types_1.SMITHY_CONTEXT_KEY]: { + service: "AWSSecurityTokenServiceV20110615", + operation: "GetSessionToken", + }, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.se_GetSessionTokenCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.de_GetSessionTokenCommand)(output, context); + } +} +exports.GetSessionTokenCommand = GetSessionTokenCommand; + + +/***/ }), + +/***/ 55716: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(59802), exports); +tslib_1.__exportStar(__nccwpck_require__(72865), exports); +tslib_1.__exportStar(__nccwpck_require__(37451), exports); +tslib_1.__exportStar(__nccwpck_require__(74150), exports); +tslib_1.__exportStar(__nccwpck_require__(49804), exports); +tslib_1.__exportStar(__nccwpck_require__(24278), exports); +tslib_1.__exportStar(__nccwpck_require__(57552), exports); +tslib_1.__exportStar(__nccwpck_require__(43285), exports); + + +/***/ }), + +/***/ 88028: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.decorateDefaultCredentialProvider = exports.getDefaultRoleAssumerWithWebIdentity = exports.getDefaultRoleAssumer = void 0; +const defaultStsRoleAssumers_1 = __nccwpck_require__(90048); +const STSClient_1 = __nccwpck_require__(64195); +const getCustomizableStsClientCtor = (baseCtor, customizations) => { + if (!customizations) + return baseCtor; + else + return class CustomizableSTSClient extends baseCtor { + constructor(config) { + super(config); + for (const customization of customizations) { + this.middlewareStack.use(customization); + } + } + }; +}; +const getDefaultRoleAssumer = (stsOptions = {}, stsPlugins) => (0, defaultStsRoleAssumers_1.getDefaultRoleAssumer)(stsOptions, getCustomizableStsClientCtor(STSClient_1.STSClient, stsPlugins)); +exports.getDefaultRoleAssumer = getDefaultRoleAssumer; +const getDefaultRoleAssumerWithWebIdentity = (stsOptions = {}, stsPlugins) => (0, defaultStsRoleAssumers_1.getDefaultRoleAssumerWithWebIdentity)(stsOptions, getCustomizableStsClientCtor(STSClient_1.STSClient, stsPlugins)); +exports.getDefaultRoleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity; +const decorateDefaultCredentialProvider = (provider) => (input) => provider({ + roleAssumer: (0, exports.getDefaultRoleAssumer)(input), + roleAssumerWithWebIdentity: (0, exports.getDefaultRoleAssumerWithWebIdentity)(input), + ...input, +}); +exports.decorateDefaultCredentialProvider = decorateDefaultCredentialProvider; + + +/***/ }), + +/***/ 90048: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.decorateDefaultCredentialProvider = exports.getDefaultRoleAssumerWithWebIdentity = exports.getDefaultRoleAssumer = void 0; +const AssumeRoleCommand_1 = __nccwpck_require__(59802); +const AssumeRoleWithWebIdentityCommand_1 = __nccwpck_require__(37451); +const ASSUME_ROLE_DEFAULT_REGION = "us-east-1"; +const decorateDefaultRegion = (region) => { + if (typeof region !== "function") { + return region === undefined ? ASSUME_ROLE_DEFAULT_REGION : region; + } + return async () => { + try { + return await region(); + } + catch (e) { + return ASSUME_ROLE_DEFAULT_REGION; + } + }; +}; +const getDefaultRoleAssumer = (stsOptions, stsClientCtor) => { + let stsClient; + let closureSourceCreds; + return async (sourceCreds, params) => { + closureSourceCreds = sourceCreds; + if (!stsClient) { + const { logger, region, requestHandler } = stsOptions; + stsClient = new stsClientCtor({ + logger, + credentialDefaultProvider: () => async () => closureSourceCreds, + region: decorateDefaultRegion(region || stsOptions.region), + ...(requestHandler ? { requestHandler } : {}), + }); + } + const { Credentials } = await stsClient.send(new AssumeRoleCommand_1.AssumeRoleCommand(params)); + if (!Credentials || !Credentials.AccessKeyId || !Credentials.SecretAccessKey) { + throw new Error(`Invalid response from STS.assumeRole call with role ${params.RoleArn}`); + } + return { + accessKeyId: Credentials.AccessKeyId, + secretAccessKey: Credentials.SecretAccessKey, + sessionToken: Credentials.SessionToken, + expiration: Credentials.Expiration, + }; + }; +}; +exports.getDefaultRoleAssumer = getDefaultRoleAssumer; +const getDefaultRoleAssumerWithWebIdentity = (stsOptions, stsClientCtor) => { + let stsClient; + return async (params) => { + if (!stsClient) { + const { logger, region, requestHandler } = stsOptions; + stsClient = new stsClientCtor({ + logger, + region: decorateDefaultRegion(region || stsOptions.region), + ...(requestHandler ? { requestHandler } : {}), + }); + } + const { Credentials } = await stsClient.send(new AssumeRoleWithWebIdentityCommand_1.AssumeRoleWithWebIdentityCommand(params)); + if (!Credentials || !Credentials.AccessKeyId || !Credentials.SecretAccessKey) { + throw new Error(`Invalid response from STS.assumeRoleWithWebIdentity call with role ${params.RoleArn}`); + } + return { + accessKeyId: Credentials.AccessKeyId, + secretAccessKey: Credentials.SecretAccessKey, + sessionToken: Credentials.SessionToken, + expiration: Credentials.Expiration, + }; + }; +}; +exports.getDefaultRoleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity; +const decorateDefaultCredentialProvider = (provider) => (input) => provider({ + roleAssumer: (0, exports.getDefaultRoleAssumer)(input, input.stsClientCtor), + roleAssumerWithWebIdentity: (0, exports.getDefaultRoleAssumerWithWebIdentity)(input, input.stsClientCtor), + ...input, +}); +exports.decorateDefaultCredentialProvider = decorateDefaultCredentialProvider; + + +/***/ }), + +/***/ 20510: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveClientEndpointParameters = void 0; +const resolveClientEndpointParameters = (options) => { + return { + ...options, + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + useGlobalEndpoint: options.useGlobalEndpoint ?? false, + defaultSigningName: "sts", + }; +}; +exports.resolveClientEndpointParameters = resolveClientEndpointParameters; + + +/***/ }), + +/***/ 41203: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultEndpointResolver = void 0; +const util_endpoints_1 = __nccwpck_require__(13350); +const ruleset_1 = __nccwpck_require__(86882); +const defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_1.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams: endpointParams, + logger: context.logger, + }); +}; +exports.defaultEndpointResolver = defaultEndpointResolver; + + +/***/ }), + +/***/ 86882: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ruleSet = void 0; +const F = "required", G = "type", H = "fn", I = "argv", J = "ref"; +const a = false, b = true, c = "booleanEquals", d = "tree", e = "stringEquals", f = "sigv4", g = "sts", h = "us-east-1", i = "endpoint", j = "https://sts.{Region}.{PartitionResult#dnsSuffix}", k = "error", l = "getAttr", m = { [F]: false, [G]: "String" }, n = { [F]: true, "default": false, [G]: "Boolean" }, o = { [J]: "Endpoint" }, p = { [H]: "isSet", [I]: [{ [J]: "Region" }] }, q = { [J]: "Region" }, r = { [H]: "aws.partition", [I]: [q], "assign": "PartitionResult" }, s = { [J]: "UseFIPS" }, t = { [J]: "UseDualStack" }, u = { "url": "https://sts.amazonaws.com", "properties": { "authSchemes": [{ "name": f, "signingName": g, "signingRegion": h }] }, "headers": {} }, v = {}, w = { "conditions": [{ [H]: e, [I]: [q, "aws-global"] }], [i]: u, [G]: i }, x = { [H]: c, [I]: [s, true] }, y = { [H]: c, [I]: [t, true] }, z = { [H]: c, [I]: [true, { [H]: l, [I]: [{ [J]: "PartitionResult" }, "supportsFIPS"] }] }, A = { [J]: "PartitionResult" }, B = { [H]: c, [I]: [true, { [H]: l, [I]: [A, "supportsDualStack"] }] }, C = [{ [H]: "isSet", [I]: [o] }], D = [x], E = [y]; +const _data = { version: "1.0", parameters: { Region: m, UseDualStack: n, UseFIPS: n, Endpoint: m, UseGlobalEndpoint: n }, rules: [{ conditions: [{ [H]: c, [I]: [{ [J]: "UseGlobalEndpoint" }, b] }, { [H]: "not", [I]: C }, p, r, { [H]: c, [I]: [s, a] }, { [H]: c, [I]: [t, a] }], [G]: d, rules: [{ conditions: [{ [H]: e, [I]: [q, "ap-northeast-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "ap-south-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "ap-southeast-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "ap-southeast-2"] }], endpoint: u, [G]: i }, w, { conditions: [{ [H]: e, [I]: [q, "ca-central-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "eu-central-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "eu-north-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "eu-west-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "eu-west-2"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "eu-west-3"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "sa-east-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, h] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "us-east-2"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "us-west-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "us-west-2"] }], endpoint: u, [G]: i }, { endpoint: { url: j, properties: { authSchemes: [{ name: f, signingName: g, signingRegion: "{Region}" }] }, headers: v }, [G]: i }] }, { conditions: C, [G]: d, rules: [{ conditions: D, error: "Invalid Configuration: FIPS and custom endpoint are not supported", [G]: k }, { conditions: E, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", [G]: k }, { endpoint: { url: o, properties: v, headers: v }, [G]: i }] }, { conditions: [p], [G]: d, rules: [{ conditions: [r], [G]: d, rules: [{ conditions: [x, y], [G]: d, rules: [{ conditions: [z, B], [G]: d, rules: [{ endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: i }] }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", [G]: k }] }, { conditions: D, [G]: d, rules: [{ conditions: [z], [G]: d, rules: [{ conditions: [{ [H]: e, [I]: ["aws-us-gov", { [H]: l, [I]: [A, "name"] }] }], endpoint: { url: "https://sts.{Region}.amazonaws.com", properties: v, headers: v }, [G]: i }, { endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dnsSuffix}", properties: v, headers: v }, [G]: i }] }, { error: "FIPS is enabled but this partition does not support FIPS", [G]: k }] }, { conditions: E, [G]: d, rules: [{ conditions: [B], [G]: d, rules: [{ endpoint: { url: "https://sts.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: i }] }, { error: "DualStack is enabled but this partition does not support DualStack", [G]: k }] }, w, { endpoint: { url: j, properties: v, headers: v }, [G]: i }] }] }, { error: "Invalid Configuration: Missing Region", [G]: k }] }; +exports.ruleSet = _data; + + +/***/ }), + +/***/ 52209: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.STSServiceException = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(64195), exports); +tslib_1.__exportStar(__nccwpck_require__(32605), exports); +tslib_1.__exportStar(__nccwpck_require__(55716), exports); +tslib_1.__exportStar(__nccwpck_require__(20106), exports); +tslib_1.__exportStar(__nccwpck_require__(88028), exports); +var STSServiceException_1 = __nccwpck_require__(15770); +Object.defineProperty(exports, "STSServiceException", ({ enumerable: true, get: function () { return STSServiceException_1.STSServiceException; } })); + + +/***/ }), + +/***/ 15770: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.STSServiceException = exports.__ServiceException = void 0; +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "__ServiceException", ({ enumerable: true, get: function () { return smithy_client_1.ServiceException; } })); +class STSServiceException extends smithy_client_1.ServiceException { + constructor(options) { + super(options); + Object.setPrototypeOf(this, STSServiceException.prototype); + } +} +exports.STSServiceException = STSServiceException; + + +/***/ }), + +/***/ 20106: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(21780), exports); + + +/***/ }), + +/***/ 21780: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetSessionTokenResponseFilterSensitiveLog = exports.GetFederationTokenResponseFilterSensitiveLog = exports.AssumeRoleWithWebIdentityResponseFilterSensitiveLog = exports.AssumeRoleWithWebIdentityRequestFilterSensitiveLog = exports.AssumeRoleWithSAMLResponseFilterSensitiveLog = exports.AssumeRoleWithSAMLRequestFilterSensitiveLog = exports.AssumeRoleResponseFilterSensitiveLog = exports.CredentialsFilterSensitiveLog = exports.InvalidAuthorizationMessageException = exports.IDPCommunicationErrorException = exports.InvalidIdentityTokenException = exports.IDPRejectedClaimException = exports.RegionDisabledException = exports.PackedPolicyTooLargeException = exports.MalformedPolicyDocumentException = exports.ExpiredTokenException = void 0; +const smithy_client_1 = __nccwpck_require__(63570); +const STSServiceException_1 = __nccwpck_require__(15770); +class ExpiredTokenException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "ExpiredTokenException", + $fault: "client", + ...opts, + }); + this.name = "ExpiredTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, ExpiredTokenException.prototype); + } +} +exports.ExpiredTokenException = ExpiredTokenException; +class MalformedPolicyDocumentException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "MalformedPolicyDocumentException", + $fault: "client", + ...opts, + }); + this.name = "MalformedPolicyDocumentException"; + this.$fault = "client"; + Object.setPrototypeOf(this, MalformedPolicyDocumentException.prototype); + } +} +exports.MalformedPolicyDocumentException = MalformedPolicyDocumentException; +class PackedPolicyTooLargeException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "PackedPolicyTooLargeException", + $fault: "client", + ...opts, + }); + this.name = "PackedPolicyTooLargeException"; + this.$fault = "client"; + Object.setPrototypeOf(this, PackedPolicyTooLargeException.prototype); + } +} +exports.PackedPolicyTooLargeException = PackedPolicyTooLargeException; +class RegionDisabledException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "RegionDisabledException", + $fault: "client", + ...opts, + }); + this.name = "RegionDisabledException"; + this.$fault = "client"; + Object.setPrototypeOf(this, RegionDisabledException.prototype); + } +} +exports.RegionDisabledException = RegionDisabledException; +class IDPRejectedClaimException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "IDPRejectedClaimException", + $fault: "client", + ...opts, + }); + this.name = "IDPRejectedClaimException"; + this.$fault = "client"; + Object.setPrototypeOf(this, IDPRejectedClaimException.prototype); + } +} +exports.IDPRejectedClaimException = IDPRejectedClaimException; +class InvalidIdentityTokenException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "InvalidIdentityTokenException", + $fault: "client", + ...opts, + }); + this.name = "InvalidIdentityTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, InvalidIdentityTokenException.prototype); + } +} +exports.InvalidIdentityTokenException = InvalidIdentityTokenException; +class IDPCommunicationErrorException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "IDPCommunicationErrorException", + $fault: "client", + ...opts, + }); + this.name = "IDPCommunicationErrorException"; + this.$fault = "client"; + Object.setPrototypeOf(this, IDPCommunicationErrorException.prototype); + } +} +exports.IDPCommunicationErrorException = IDPCommunicationErrorException; +class InvalidAuthorizationMessageException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "InvalidAuthorizationMessageException", + $fault: "client", + ...opts, + }); + this.name = "InvalidAuthorizationMessageException"; + this.$fault = "client"; + Object.setPrototypeOf(this, InvalidAuthorizationMessageException.prototype); + } +} +exports.InvalidAuthorizationMessageException = InvalidAuthorizationMessageException; +const CredentialsFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.SecretAccessKey && { SecretAccessKey: smithy_client_1.SENSITIVE_STRING }), +}); +exports.CredentialsFilterSensitiveLog = CredentialsFilterSensitiveLog; +const AssumeRoleResponseFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }), +}); +exports.AssumeRoleResponseFilterSensitiveLog = AssumeRoleResponseFilterSensitiveLog; +const AssumeRoleWithSAMLRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.SAMLAssertion && { SAMLAssertion: smithy_client_1.SENSITIVE_STRING }), +}); +exports.AssumeRoleWithSAMLRequestFilterSensitiveLog = AssumeRoleWithSAMLRequestFilterSensitiveLog; +const AssumeRoleWithSAMLResponseFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }), +}); +exports.AssumeRoleWithSAMLResponseFilterSensitiveLog = AssumeRoleWithSAMLResponseFilterSensitiveLog; +const AssumeRoleWithWebIdentityRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.WebIdentityToken && { WebIdentityToken: smithy_client_1.SENSITIVE_STRING }), +}); +exports.AssumeRoleWithWebIdentityRequestFilterSensitiveLog = AssumeRoleWithWebIdentityRequestFilterSensitiveLog; +const AssumeRoleWithWebIdentityResponseFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }), +}); +exports.AssumeRoleWithWebIdentityResponseFilterSensitiveLog = AssumeRoleWithWebIdentityResponseFilterSensitiveLog; +const GetFederationTokenResponseFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }), +}); +exports.GetFederationTokenResponseFilterSensitiveLog = GetFederationTokenResponseFilterSensitiveLog; +const GetSessionTokenResponseFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }), +}); +exports.GetSessionTokenResponseFilterSensitiveLog = GetSessionTokenResponseFilterSensitiveLog; + + +/***/ }), + +/***/ 10740: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.de_GetSessionTokenCommand = exports.de_GetFederationTokenCommand = exports.de_GetCallerIdentityCommand = exports.de_GetAccessKeyInfoCommand = exports.de_DecodeAuthorizationMessageCommand = exports.de_AssumeRoleWithWebIdentityCommand = exports.de_AssumeRoleWithSAMLCommand = exports.de_AssumeRoleCommand = exports.se_GetSessionTokenCommand = exports.se_GetFederationTokenCommand = exports.se_GetCallerIdentityCommand = exports.se_GetAccessKeyInfoCommand = exports.se_DecodeAuthorizationMessageCommand = exports.se_AssumeRoleWithWebIdentityCommand = exports.se_AssumeRoleWithSAMLCommand = exports.se_AssumeRoleCommand = void 0; +const protocol_http_1 = __nccwpck_require__(12223); +const smithy_client_1 = __nccwpck_require__(63570); +const fast_xml_parser_1 = __nccwpck_require__(12603); +const models_0_1 = __nccwpck_require__(21780); +const STSServiceException_1 = __nccwpck_require__(15770); +const se_AssumeRoleCommand = async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_AssumeRoleRequest(input, context), + Action: "AssumeRole", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_AssumeRoleCommand = se_AssumeRoleCommand; +const se_AssumeRoleWithSAMLCommand = async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_AssumeRoleWithSAMLRequest(input, context), + Action: "AssumeRoleWithSAML", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_AssumeRoleWithSAMLCommand = se_AssumeRoleWithSAMLCommand; +const se_AssumeRoleWithWebIdentityCommand = async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_AssumeRoleWithWebIdentityRequest(input, context), + Action: "AssumeRoleWithWebIdentity", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_AssumeRoleWithWebIdentityCommand = se_AssumeRoleWithWebIdentityCommand; +const se_DecodeAuthorizationMessageCommand = async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_DecodeAuthorizationMessageRequest(input, context), + Action: "DecodeAuthorizationMessage", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_DecodeAuthorizationMessageCommand = se_DecodeAuthorizationMessageCommand; +const se_GetAccessKeyInfoCommand = async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_GetAccessKeyInfoRequest(input, context), + Action: "GetAccessKeyInfo", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_GetAccessKeyInfoCommand = se_GetAccessKeyInfoCommand; +const se_GetCallerIdentityCommand = async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_GetCallerIdentityRequest(input, context), + Action: "GetCallerIdentity", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_GetCallerIdentityCommand = se_GetCallerIdentityCommand; +const se_GetFederationTokenCommand = async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_GetFederationTokenRequest(input, context), + Action: "GetFederationToken", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_GetFederationTokenCommand = se_GetFederationTokenCommand; +const se_GetSessionTokenCommand = async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_GetSessionTokenRequest(input, context), + Action: "GetSessionToken", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.se_GetSessionTokenCommand = se_GetSessionTokenCommand; +const de_AssumeRoleCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_AssumeRoleCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_AssumeRoleResponse(data.AssumeRoleResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_AssumeRoleCommand = de_AssumeRoleCommand; +const de_AssumeRoleCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ExpiredTokenException": + case "com.amazonaws.sts#ExpiredTokenException": + throw await de_ExpiredTokenExceptionRes(parsedOutput, context); + case "MalformedPolicyDocument": + case "com.amazonaws.sts#MalformedPolicyDocumentException": + throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); + case "PackedPolicyTooLarge": + case "com.amazonaws.sts#PackedPolicyTooLargeException": + throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context); + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await de_RegionDisabledExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody: parsedBody.Error, + errorCode, + }); + } +}; +const de_AssumeRoleWithSAMLCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_AssumeRoleWithSAMLCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_AssumeRoleWithSAMLResponse(data.AssumeRoleWithSAMLResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_AssumeRoleWithSAMLCommand = de_AssumeRoleWithSAMLCommand; +const de_AssumeRoleWithSAMLCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ExpiredTokenException": + case "com.amazonaws.sts#ExpiredTokenException": + throw await de_ExpiredTokenExceptionRes(parsedOutput, context); + case "IDPRejectedClaim": + case "com.amazonaws.sts#IDPRejectedClaimException": + throw await de_IDPRejectedClaimExceptionRes(parsedOutput, context); + case "InvalidIdentityToken": + case "com.amazonaws.sts#InvalidIdentityTokenException": + throw await de_InvalidIdentityTokenExceptionRes(parsedOutput, context); + case "MalformedPolicyDocument": + case "com.amazonaws.sts#MalformedPolicyDocumentException": + throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); + case "PackedPolicyTooLarge": + case "com.amazonaws.sts#PackedPolicyTooLargeException": + throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context); + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await de_RegionDisabledExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody: parsedBody.Error, + errorCode, + }); + } +}; +const de_AssumeRoleWithWebIdentityCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_AssumeRoleWithWebIdentityCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_AssumeRoleWithWebIdentityResponse(data.AssumeRoleWithWebIdentityResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_AssumeRoleWithWebIdentityCommand = de_AssumeRoleWithWebIdentityCommand; +const de_AssumeRoleWithWebIdentityCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ExpiredTokenException": + case "com.amazonaws.sts#ExpiredTokenException": + throw await de_ExpiredTokenExceptionRes(parsedOutput, context); + case "IDPCommunicationError": + case "com.amazonaws.sts#IDPCommunicationErrorException": + throw await de_IDPCommunicationErrorExceptionRes(parsedOutput, context); + case "IDPRejectedClaim": + case "com.amazonaws.sts#IDPRejectedClaimException": + throw await de_IDPRejectedClaimExceptionRes(parsedOutput, context); + case "InvalidIdentityToken": + case "com.amazonaws.sts#InvalidIdentityTokenException": + throw await de_InvalidIdentityTokenExceptionRes(parsedOutput, context); + case "MalformedPolicyDocument": + case "com.amazonaws.sts#MalformedPolicyDocumentException": + throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); + case "PackedPolicyTooLarge": + case "com.amazonaws.sts#PackedPolicyTooLargeException": + throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context); + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await de_RegionDisabledExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody: parsedBody.Error, + errorCode, + }); + } +}; +const de_DecodeAuthorizationMessageCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_DecodeAuthorizationMessageCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_DecodeAuthorizationMessageResponse(data.DecodeAuthorizationMessageResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_DecodeAuthorizationMessageCommand = de_DecodeAuthorizationMessageCommand; +const de_DecodeAuthorizationMessageCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidAuthorizationMessageException": + case "com.amazonaws.sts#InvalidAuthorizationMessageException": + throw await de_InvalidAuthorizationMessageExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody: parsedBody.Error, + errorCode, + }); + } +}; +const de_GetAccessKeyInfoCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_GetAccessKeyInfoCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_GetAccessKeyInfoResponse(data.GetAccessKeyInfoResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_GetAccessKeyInfoCommand = de_GetAccessKeyInfoCommand; +const de_GetAccessKeyInfoCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody: parsedBody.Error, + errorCode, + }); +}; +const de_GetCallerIdentityCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_GetCallerIdentityCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_GetCallerIdentityResponse(data.GetCallerIdentityResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_GetCallerIdentityCommand = de_GetCallerIdentityCommand; +const de_GetCallerIdentityCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody: parsedBody.Error, + errorCode, + }); +}; +const de_GetFederationTokenCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_GetFederationTokenCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_GetFederationTokenResponse(data.GetFederationTokenResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_GetFederationTokenCommand = de_GetFederationTokenCommand; +const de_GetFederationTokenCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "MalformedPolicyDocument": + case "com.amazonaws.sts#MalformedPolicyDocumentException": + throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); + case "PackedPolicyTooLarge": + case "com.amazonaws.sts#PackedPolicyTooLargeException": + throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context); + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await de_RegionDisabledExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody: parsedBody.Error, + errorCode, + }); + } +}; +const de_GetSessionTokenCommand = async (output, context) => { + if (output.statusCode >= 300) { + return de_GetSessionTokenCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = de_GetSessionTokenResponse(data.GetSessionTokenResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return response; +}; +exports.de_GetSessionTokenCommand = de_GetSessionTokenCommand; +const de_GetSessionTokenCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await de_RegionDisabledExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody: parsedBody.Error, + errorCode, + }); + } +}; +const de_ExpiredTokenExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_ExpiredTokenException(body.Error, context); + const exception = new models_0_1.ExpiredTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_IDPCommunicationErrorExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_IDPCommunicationErrorException(body.Error, context); + const exception = new models_0_1.IDPCommunicationErrorException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_IDPRejectedClaimExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_IDPRejectedClaimException(body.Error, context); + const exception = new models_0_1.IDPRejectedClaimException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_InvalidAuthorizationMessageExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_InvalidAuthorizationMessageException(body.Error, context); + const exception = new models_0_1.InvalidAuthorizationMessageException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_InvalidIdentityTokenExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_InvalidIdentityTokenException(body.Error, context); + const exception = new models_0_1.InvalidIdentityTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_MalformedPolicyDocumentExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_MalformedPolicyDocumentException(body.Error, context); + const exception = new models_0_1.MalformedPolicyDocumentException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_PackedPolicyTooLargeExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_PackedPolicyTooLargeException(body.Error, context); + const exception = new models_0_1.PackedPolicyTooLargeException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const de_RegionDisabledExceptionRes = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_RegionDisabledException(body.Error, context); + const exception = new models_0_1.RegionDisabledException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const se_AssumeRoleRequest = (input, context) => { + const entries = {}; + if (input.RoleArn != null) { + entries["RoleArn"] = input.RoleArn; + } + if (input.RoleSessionName != null) { + entries["RoleSessionName"] = input.RoleSessionName; + } + if (input.PolicyArns != null) { + const memberEntries = se_policyDescriptorListType(input.PolicyArns, context); + if (input.PolicyArns?.length === 0) { + entries.PolicyArns = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input.Policy != null) { + entries["Policy"] = input.Policy; + } + if (input.DurationSeconds != null) { + entries["DurationSeconds"] = input.DurationSeconds; + } + if (input.Tags != null) { + const memberEntries = se_tagListType(input.Tags, context); + if (input.Tags?.length === 0) { + entries.Tags = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `Tags.${key}`; + entries[loc] = value; + }); + } + if (input.TransitiveTagKeys != null) { + const memberEntries = se_tagKeyListType(input.TransitiveTagKeys, context); + if (input.TransitiveTagKeys?.length === 0) { + entries.TransitiveTagKeys = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `TransitiveTagKeys.${key}`; + entries[loc] = value; + }); + } + if (input.ExternalId != null) { + entries["ExternalId"] = input.ExternalId; + } + if (input.SerialNumber != null) { + entries["SerialNumber"] = input.SerialNumber; + } + if (input.TokenCode != null) { + entries["TokenCode"] = input.TokenCode; + } + if (input.SourceIdentity != null) { + entries["SourceIdentity"] = input.SourceIdentity; + } + if (input.ProvidedContexts != null) { + const memberEntries = se_ProvidedContextsListType(input.ProvidedContexts, context); + if (input.ProvidedContexts?.length === 0) { + entries.ProvidedContexts = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `ProvidedContexts.${key}`; + entries[loc] = value; + }); + } + return entries; +}; +const se_AssumeRoleWithSAMLRequest = (input, context) => { + const entries = {}; + if (input.RoleArn != null) { + entries["RoleArn"] = input.RoleArn; + } + if (input.PrincipalArn != null) { + entries["PrincipalArn"] = input.PrincipalArn; + } + if (input.SAMLAssertion != null) { + entries["SAMLAssertion"] = input.SAMLAssertion; + } + if (input.PolicyArns != null) { + const memberEntries = se_policyDescriptorListType(input.PolicyArns, context); + if (input.PolicyArns?.length === 0) { + entries.PolicyArns = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input.Policy != null) { + entries["Policy"] = input.Policy; + } + if (input.DurationSeconds != null) { + entries["DurationSeconds"] = input.DurationSeconds; + } + return entries; +}; +const se_AssumeRoleWithWebIdentityRequest = (input, context) => { + const entries = {}; + if (input.RoleArn != null) { + entries["RoleArn"] = input.RoleArn; + } + if (input.RoleSessionName != null) { + entries["RoleSessionName"] = input.RoleSessionName; + } + if (input.WebIdentityToken != null) { + entries["WebIdentityToken"] = input.WebIdentityToken; + } + if (input.ProviderId != null) { + entries["ProviderId"] = input.ProviderId; + } + if (input.PolicyArns != null) { + const memberEntries = se_policyDescriptorListType(input.PolicyArns, context); + if (input.PolicyArns?.length === 0) { + entries.PolicyArns = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input.Policy != null) { + entries["Policy"] = input.Policy; + } + if (input.DurationSeconds != null) { + entries["DurationSeconds"] = input.DurationSeconds; + } + return entries; +}; +const se_DecodeAuthorizationMessageRequest = (input, context) => { + const entries = {}; + if (input.EncodedMessage != null) { + entries["EncodedMessage"] = input.EncodedMessage; + } + return entries; +}; +const se_GetAccessKeyInfoRequest = (input, context) => { + const entries = {}; + if (input.AccessKeyId != null) { + entries["AccessKeyId"] = input.AccessKeyId; + } + return entries; +}; +const se_GetCallerIdentityRequest = (input, context) => { + const entries = {}; + return entries; +}; +const se_GetFederationTokenRequest = (input, context) => { + const entries = {}; + if (input.Name != null) { + entries["Name"] = input.Name; + } + if (input.Policy != null) { + entries["Policy"] = input.Policy; + } + if (input.PolicyArns != null) { + const memberEntries = se_policyDescriptorListType(input.PolicyArns, context); + if (input.PolicyArns?.length === 0) { + entries.PolicyArns = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input.DurationSeconds != null) { + entries["DurationSeconds"] = input.DurationSeconds; + } + if (input.Tags != null) { + const memberEntries = se_tagListType(input.Tags, context); + if (input.Tags?.length === 0) { + entries.Tags = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `Tags.${key}`; + entries[loc] = value; + }); + } + return entries; +}; +const se_GetSessionTokenRequest = (input, context) => { + const entries = {}; + if (input.DurationSeconds != null) { + entries["DurationSeconds"] = input.DurationSeconds; + } + if (input.SerialNumber != null) { + entries["SerialNumber"] = input.SerialNumber; + } + if (input.TokenCode != null) { + entries["TokenCode"] = input.TokenCode; + } + return entries; +}; +const se_policyDescriptorListType = (input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + const memberEntries = se_PolicyDescriptorType(entry, context); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; +}; +const se_PolicyDescriptorType = (input, context) => { + const entries = {}; + if (input.arn != null) { + entries["arn"] = input.arn; + } + return entries; +}; +const se_ProvidedContext = (input, context) => { + const entries = {}; + if (input.ProviderArn != null) { + entries["ProviderArn"] = input.ProviderArn; + } + if (input.ContextAssertion != null) { + entries["ContextAssertion"] = input.ContextAssertion; + } + return entries; +}; +const se_ProvidedContextsListType = (input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + const memberEntries = se_ProvidedContext(entry, context); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; +}; +const se_Tag = (input, context) => { + const entries = {}; + if (input.Key != null) { + entries["Key"] = input.Key; + } + if (input.Value != null) { + entries["Value"] = input.Value; + } + return entries; +}; +const se_tagKeyListType = (input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + entries[`member.${counter}`] = entry; + counter++; + } + return entries; +}; +const se_tagListType = (input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + const memberEntries = se_Tag(entry, context); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; +}; +const de_AssumedRoleUser = (output, context) => { + const contents = {}; + if (output["AssumedRoleId"] !== undefined) { + contents.AssumedRoleId = (0, smithy_client_1.expectString)(output["AssumedRoleId"]); + } + if (output["Arn"] !== undefined) { + contents.Arn = (0, smithy_client_1.expectString)(output["Arn"]); + } + return contents; +}; +const de_AssumeRoleResponse = (output, context) => { + const contents = {}; + if (output["Credentials"] !== undefined) { + contents.Credentials = de_Credentials(output["Credentials"], context); + } + if (output["AssumedRoleUser"] !== undefined) { + contents.AssumedRoleUser = de_AssumedRoleUser(output["AssumedRoleUser"], context); + } + if (output["PackedPolicySize"] !== undefined) { + contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]); + } + if (output["SourceIdentity"] !== undefined) { + contents.SourceIdentity = (0, smithy_client_1.expectString)(output["SourceIdentity"]); + } + return contents; +}; +const de_AssumeRoleWithSAMLResponse = (output, context) => { + const contents = {}; + if (output["Credentials"] !== undefined) { + contents.Credentials = de_Credentials(output["Credentials"], context); + } + if (output["AssumedRoleUser"] !== undefined) { + contents.AssumedRoleUser = de_AssumedRoleUser(output["AssumedRoleUser"], context); + } + if (output["PackedPolicySize"] !== undefined) { + contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]); + } + if (output["Subject"] !== undefined) { + contents.Subject = (0, smithy_client_1.expectString)(output["Subject"]); + } + if (output["SubjectType"] !== undefined) { + contents.SubjectType = (0, smithy_client_1.expectString)(output["SubjectType"]); + } + if (output["Issuer"] !== undefined) { + contents.Issuer = (0, smithy_client_1.expectString)(output["Issuer"]); + } + if (output["Audience"] !== undefined) { + contents.Audience = (0, smithy_client_1.expectString)(output["Audience"]); + } + if (output["NameQualifier"] !== undefined) { + contents.NameQualifier = (0, smithy_client_1.expectString)(output["NameQualifier"]); + } + if (output["SourceIdentity"] !== undefined) { + contents.SourceIdentity = (0, smithy_client_1.expectString)(output["SourceIdentity"]); + } + return contents; +}; +const de_AssumeRoleWithWebIdentityResponse = (output, context) => { + const contents = {}; + if (output["Credentials"] !== undefined) { + contents.Credentials = de_Credentials(output["Credentials"], context); + } + if (output["SubjectFromWebIdentityToken"] !== undefined) { + contents.SubjectFromWebIdentityToken = (0, smithy_client_1.expectString)(output["SubjectFromWebIdentityToken"]); + } + if (output["AssumedRoleUser"] !== undefined) { + contents.AssumedRoleUser = de_AssumedRoleUser(output["AssumedRoleUser"], context); + } + if (output["PackedPolicySize"] !== undefined) { + contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]); + } + if (output["Provider"] !== undefined) { + contents.Provider = (0, smithy_client_1.expectString)(output["Provider"]); + } + if (output["Audience"] !== undefined) { + contents.Audience = (0, smithy_client_1.expectString)(output["Audience"]); + } + if (output["SourceIdentity"] !== undefined) { + contents.SourceIdentity = (0, smithy_client_1.expectString)(output["SourceIdentity"]); + } + return contents; +}; +const de_Credentials = (output, context) => { + const contents = {}; + if (output["AccessKeyId"] !== undefined) { + contents.AccessKeyId = (0, smithy_client_1.expectString)(output["AccessKeyId"]); + } + if (output["SecretAccessKey"] !== undefined) { + contents.SecretAccessKey = (0, smithy_client_1.expectString)(output["SecretAccessKey"]); + } + if (output["SessionToken"] !== undefined) { + contents.SessionToken = (0, smithy_client_1.expectString)(output["SessionToken"]); + } + if (output["Expiration"] !== undefined) { + contents.Expiration = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseRfc3339DateTimeWithOffset)(output["Expiration"])); + } + return contents; +}; +const de_DecodeAuthorizationMessageResponse = (output, context) => { + const contents = {}; + if (output["DecodedMessage"] !== undefined) { + contents.DecodedMessage = (0, smithy_client_1.expectString)(output["DecodedMessage"]); + } + return contents; +}; +const de_ExpiredTokenException = (output, context) => { + const contents = {}; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const de_FederatedUser = (output, context) => { + const contents = {}; + if (output["FederatedUserId"] !== undefined) { + contents.FederatedUserId = (0, smithy_client_1.expectString)(output["FederatedUserId"]); + } + if (output["Arn"] !== undefined) { + contents.Arn = (0, smithy_client_1.expectString)(output["Arn"]); + } + return contents; +}; +const de_GetAccessKeyInfoResponse = (output, context) => { + const contents = {}; + if (output["Account"] !== undefined) { + contents.Account = (0, smithy_client_1.expectString)(output["Account"]); + } + return contents; +}; +const de_GetCallerIdentityResponse = (output, context) => { + const contents = {}; + if (output["UserId"] !== undefined) { + contents.UserId = (0, smithy_client_1.expectString)(output["UserId"]); + } + if (output["Account"] !== undefined) { + contents.Account = (0, smithy_client_1.expectString)(output["Account"]); + } + if (output["Arn"] !== undefined) { + contents.Arn = (0, smithy_client_1.expectString)(output["Arn"]); + } + return contents; +}; +const de_GetFederationTokenResponse = (output, context) => { + const contents = {}; + if (output["Credentials"] !== undefined) { + contents.Credentials = de_Credentials(output["Credentials"], context); + } + if (output["FederatedUser"] !== undefined) { + contents.FederatedUser = de_FederatedUser(output["FederatedUser"], context); + } + if (output["PackedPolicySize"] !== undefined) { + contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]); + } + return contents; +}; +const de_GetSessionTokenResponse = (output, context) => { + const contents = {}; + if (output["Credentials"] !== undefined) { + contents.Credentials = de_Credentials(output["Credentials"], context); + } + return contents; +}; +const de_IDPCommunicationErrorException = (output, context) => { + const contents = {}; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const de_IDPRejectedClaimException = (output, context) => { + const contents = {}; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const de_InvalidAuthorizationMessageException = (output, context) => { + const contents = {}; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const de_InvalidIdentityTokenException = (output, context) => { + const contents = {}; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const de_MalformedPolicyDocumentException = (output, context) => { + const contents = {}; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const de_PackedPolicyTooLargeException = (output, context) => { + const contents = {}; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const de_RegionDisabledException = (output, context) => { + const contents = {}; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const deserializeMetadata = (output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"], +}); +const collectBodyString = (streamBody, context) => (0, smithy_client_1.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)); +const throwDefaultError = (0, smithy_client_1.withBaseException)(STSServiceException_1.STSServiceException); +const buildHttpRpcRequest = async (context, headers, path, resolvedHostname, body) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const contents = { + protocol, + hostname, + port, + method: "POST", + path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, + headers, + }; + if (resolvedHostname !== undefined) { + contents.hostname = resolvedHostname; + } + if (body !== undefined) { + contents.body = body; + } + return new protocol_http_1.HttpRequest(contents); +}; +const SHARED_HEADERS = { + "content-type": "application/x-www-form-urlencoded", +}; +const parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + const parser = new fast_xml_parser_1.XMLParser({ + attributeNamePrefix: "", + htmlEntities: true, + ignoreAttributes: false, + ignoreDeclaration: true, + parseTagValue: false, + trimValues: false, + tagValueProcessor: (_, val) => (val.trim() === "" && val.includes("\n") ? "" : undefined), + }); + parser.addEntity("#xD", "\r"); + parser.addEntity("#10", "\n"); + const parsedObj = parser.parse(encoded); + const textNodeName = "#text"; + const key = Object.keys(parsedObj)[0]; + const parsedObjToReturn = parsedObj[key]; + if (parsedObjToReturn[textNodeName]) { + parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; + delete parsedObjToReturn[textNodeName]; + } + return (0, smithy_client_1.getValueFromTextNode)(parsedObjToReturn); + } + return {}; +}); +const parseErrorBody = async (errorBody, context) => { + const value = await parseBody(errorBody, context); + if (value.Error) { + value.Error.message = value.Error.message ?? value.Error.Message; + } + return value; +}; +const buildFormUrlencodedString = (formEntries) => Object.entries(formEntries) + .map(([key, value]) => (0, smithy_client_1.extendedEncodeURIComponent)(key) + "=" + (0, smithy_client_1.extendedEncodeURIComponent)(value)) + .join("&"); +const loadQueryErrorCode = (output, data) => { + if (data.Error?.Code !== undefined) { + return data.Error.Code; + } + if (output.statusCode == 404) { + return "NotFound"; + } +}; + + +/***/ }), + +/***/ 83405: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const tslib_1 = __nccwpck_require__(4351); +const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(7947)); +const defaultStsRoleAssumers_1 = __nccwpck_require__(90048); +const credential_provider_node_1 = __nccwpck_require__(75531); +const util_user_agent_node_1 = __nccwpck_require__(98095); +const config_resolver_1 = __nccwpck_require__(53098); +const hash_node_1 = __nccwpck_require__(3081); +const middleware_retry_1 = __nccwpck_require__(96039); +const node_config_provider_1 = __nccwpck_require__(33461); +const node_http_handler_1 = __nccwpck_require__(58303); +const util_body_length_node_1 = __nccwpck_require__(68075); +const util_retry_1 = __nccwpck_require__(84902); +const runtimeConfig_shared_1 = __nccwpck_require__(52642); +const smithy_client_1 = __nccwpck_require__(63570); +const util_defaults_mode_node_1 = __nccwpck_require__(72429); +const smithy_client_2 = __nccwpck_require__(63570); +const getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + credentialDefaultProvider: config?.credentialDefaultProvider ?? (0, defaultStsRoleAssumers_1.decorateDefaultCredentialProvider)(credential_provider_node_1.defaultProvider), + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? + (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: config?.requestHandler ?? new node_http_handler_1.NodeHttpHandler(defaultConfigProvider), + retryMode: config?.retryMode ?? + (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, + }), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 52642: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const smithy_client_1 = __nccwpck_require__(63570); +const url_parser_1 = __nccwpck_require__(14681); +const util_base64_1 = __nccwpck_require__(75600); +const util_utf8_1 = __nccwpck_require__(41895); +const endpointResolver_1 = __nccwpck_require__(41203); +const getRuntimeConfig = (config) => ({ + apiVersion: "2011-06-15", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "STS", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, +}); +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 32053: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveRuntimeExtensions = void 0; +const region_config_resolver_1 = __nccwpck_require__(18156); +const protocol_http_1 = __nccwpck_require__(12223); +const smithy_client_1 = __nccwpck_require__(63570); +const asPartial = (t) => t; +const resolveRuntimeExtensions = (runtimeConfig, extensions) => { + const extensionConfiguration = { + ...asPartial((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, smithy_client_1.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig)), + }; + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return { + ...runtimeConfig, + ...(0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), + ...(0, smithy_client_1.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), + }; +}; +exports.resolveRuntimeExtensions = resolveRuntimeExtensions; + + +/***/ }), + +/***/ 48922: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODEJS_TIMEOUT_ERROR_CODES = void 0; +exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + + +/***/ }), + +/***/ 73546: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getTransformedHeaders = void 0; +const getTransformedHeaders = (headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; + } + return transformedHeaders; +}; +exports.getTransformedHeaders = getTransformedHeaders; + + +/***/ }), + +/***/ 58303: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(72740), exports); +tslib_1.__exportStar(__nccwpck_require__(94175), exports); +tslib_1.__exportStar(__nccwpck_require__(47097), exports); + + +/***/ }), + +/***/ 72740: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttpHandler = exports.DEFAULT_REQUEST_TIMEOUT = void 0; +const protocol_http_1 = __nccwpck_require__(12223); +const querystring_builder_1 = __nccwpck_require__(38815); +const http_1 = __nccwpck_require__(13685); +const https_1 = __nccwpck_require__(95687); +const constants_1 = __nccwpck_require__(48922); +const get_transformed_headers_1 = __nccwpck_require__(73546); +const set_connection_timeout_1 = __nccwpck_require__(2976); +const set_socket_keep_alive_1 = __nccwpck_require__(40131); +const set_socket_timeout_1 = __nccwpck_require__(31978); +const write_request_body_1 = __nccwpck_require__(41422); +exports.DEFAULT_REQUEST_TIMEOUT = 0; +class NodeHttpHandler { + constructor(options) { + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }) + .catch(reject); + } + else { + resolve(this.resolveDefaultConfig(options)); + } + }); + } + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + requestTimeout: requestTimeout !== null && requestTimeout !== void 0 ? requestTimeout : socketTimeout, + httpAgent: httpAgent || new http_1.Agent({ keepAlive, maxSockets }), + httpsAgent: httpsAgent || new https_1.Agent({ keepAlive, maxSockets }), + }; + } + destroy() { + var _a, _b, _c, _d; + (_b = (_a = this.config) === null || _a === void 0 ? void 0 : _a.httpAgent) === null || _b === void 0 ? void 0 : _b.destroy(); + (_d = (_c = this.config) === null || _c === void 0 ? void 0 : _c.httpsAgent) === null || _d === void 0 ? void 0 : _d.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + return new Promise((_resolve, _reject) => { + var _a, _b; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const queryString = (0, querystring_builder_1.buildQueryString)(request.query || {}); + let auth = undefined; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}`; + } + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const nodeHttpsOptions = { + headers: request.headers, + host: request.hostname, + method: request.method, + path, + port: request.port, + agent: isSSL ? this.config.httpsAgent : this.config.httpAgent, + auth, + }; + const requestFunc = isSSL ? https_1.request : http_1.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(res.headers), + body: res, + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } + else { + reject(err); + } + }); + (0, set_connection_timeout_1.setConnectionTimeout)(req, reject, this.config.connectionTimeout); + (0, set_socket_timeout_1.setSocketTimeout)(req, reject, this.config.requestTimeout); + if (abortSignal) { + abortSignal.onabort = () => { + req.abort(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }; + } + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + (0, set_socket_keep_alive_1.setSocketKeepAlive)(req, { + keepAlive: httpAgent.keepAlive, + keepAliveMsecs: httpAgent.keepAliveMsecs, + }); + } + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, this.config.requestTimeout).catch(_reject); + }); + } + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); + } + httpHandlerConfigs() { + var _a; + return (_a = this.config) !== null && _a !== void 0 ? _a : {}; + } +} +exports.NodeHttpHandler = NodeHttpHandler; + + +/***/ }), + +/***/ 70066: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2ConnectionManager = void 0; +const tslib_1 = __nccwpck_require__(4351); +const http2_1 = tslib_1.__importDefault(__nccwpck_require__(85158)); +const node_http2_connection_pool_1 = __nccwpck_require__(81737); +class NodeHttp2ConnectionManager { + constructor(config) { + this.sessionCache = new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); + } + } + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; + } + } + const session = http2_1.default.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error("Fail to set maxConcurrentStreams to " + + this.config.maxConcurrency + + "when creating new session for " + + requestContext.destination.toString()); + } + }); + } + session.unref(); + const destroySessionCb = () => { + session.destroy(); + this.deleteSession(url, session); + }; + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new node_http2_connection_pool_1.NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; + } + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; + } + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); + } + release(requestContext, session) { + var _a; + const cacheKey = this.getUrlString(requestContext); + (_a = this.sessionCache.get(cacheKey)) === null || _a === void 0 ? void 0 : _a.offerLast(session); + } + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); + } + this.sessionCache.delete(key); + } + } + setMaxConcurrentStreams(maxConcurrentStreams) { + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); + } + this.config.maxConcurrency = maxConcurrentStreams; + } + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; + } + getUrlString(request) { + return request.destination.toString(); + } +} +exports.NodeHttp2ConnectionManager = NodeHttp2ConnectionManager; + + +/***/ }), + +/***/ 81737: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2ConnectionPool = void 0; +class NodeHttp2ConnectionPool { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions !== null && sessions !== void 0 ? sessions : []; + } + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); + } + } + offerLast(session) { + this.sessions.push(session); + } + contains(session) { + return this.sessions.includes(session); + } + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); + } + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); + } + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } + } + } + } +} +exports.NodeHttp2ConnectionPool = NodeHttp2ConnectionPool; + + +/***/ }), + +/***/ 94175: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2Handler = void 0; +const protocol_http_1 = __nccwpck_require__(12223); +const querystring_builder_1 = __nccwpck_require__(38815); +const http2_1 = __nccwpck_require__(85158); +const get_transformed_headers_1 = __nccwpck_require__(73546); +const node_http2_connection_manager_1 = __nccwpck_require__(70066); +const write_request_body_1 = __nccwpck_require__(41422); +class NodeHttp2Handler { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new node_http2_connection_manager_1.NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((opts) => { + resolve(opts || {}); + }) + .catch(reject); + } + else { + resolve(options || {}); + } + }); + } + destroy() { + this.connectionManager.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } + } + const { requestTimeout, disableConcurrentStreams } = this.config; + return new Promise((_resolve, _reject) => { + var _a, _b, _c; + let fulfilled = false; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request; + let auth = ""; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: (_c = this.config) === null || _c === void 0 ? void 0 : _c.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false, + }); + const rejectWithDestroy = (err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + reject(err); + }; + const queryString = (0, querystring_builder_1.buildQueryString)(query || {}); + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const req = session.request({ + ...request.headers, + [http2_1.constants.HTTP2_HEADER_PATH]: path, + [http2_1.constants.HTTP2_HEADER_METHOD]: method, + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(headers), + body: req, + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (requestTimeout) { + req.setTimeout(requestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + abortSignal.onabort = () => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }; + } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy(new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`)); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, requestTimeout); + }); + } + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); + } + httpHandlerConfigs() { + var _a; + return (_a = this.config) !== null && _a !== void 0 ? _a : {}; + } + destroySession(session) { + if (!session.destroyed) { + session.destroy(); + } + } +} +exports.NodeHttp2Handler = NodeHttp2Handler; + + +/***/ }), + +/***/ 2976: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setConnectionTimeout = void 0; +const setConnectionTimeout = (request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return; + } + const timeoutId = setTimeout(() => { + request.destroy(); + reject(Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError", + })); + }, timeoutInMs); + request.on("socket", (socket) => { + if (socket.connecting) { + socket.on("connect", () => { + clearTimeout(timeoutId); + }); + } + else { + clearTimeout(timeoutId); + } + }); +}; +exports.setConnectionTimeout = setConnectionTimeout; + + +/***/ }), + +/***/ 40131: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setSocketKeepAlive = void 0; +const setSocketKeepAlive = (request, { keepAlive, keepAliveMsecs }) => { + if (keepAlive !== true) { + return; + } + request.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); +}; +exports.setSocketKeepAlive = setSocketKeepAlive; + + +/***/ }), + +/***/ 31978: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setSocketTimeout = void 0; +const setSocketTimeout = (request, reject, timeoutInMs = 0) => { + request.setTimeout(timeoutInMs, () => { + request.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }); +}; +exports.setSocketTimeout = setSocketTimeout; + + +/***/ }), + +/***/ 95854: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Collector = void 0; +const stream_1 = __nccwpck_require__(12781); +class Collector extends stream_1.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; + } + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); + } +} +exports.Collector = Collector; + + +/***/ }), + +/***/ 47097: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.streamCollector = void 0; +const collector_1 = __nccwpck_require__(95854); +const streamCollector = (stream) => new Promise((resolve, reject) => { + const collector = new collector_1.Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function () { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); +}); +exports.streamCollector = streamCollector; + + +/***/ }), + +/***/ 41422: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.writeRequestBody = void 0; +const stream_1 = __nccwpck_require__(12781); +const MIN_WAIT_TIME = 1000; +async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { + var _a; + const headers = (_a = request.headers) !== null && _a !== void 0 ? _a : {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let hasError = false; + if (expect === "100-continue") { + await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + clearTimeout(timeoutId); + resolve(); + }); + httpRequest.on("error", () => { + hasError = true; + clearTimeout(timeoutId); + resolve(); + }); + }), + ]); + } + if (!hasError) { + writeBody(httpRequest, request.body); + } +} +exports.writeRequestBody = writeRequestBody; +function writeBody(httpRequest, body) { + if (body instanceof stream_1.Readable) { + body.pipe(httpRequest); + } + else if (body) { + httpRequest.end(Buffer.from(body)); + } + else { + httpRequest.end(); + } +} + + +/***/ }), + +/***/ 8452: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Field = void 0; +const types_1 = __nccwpck_require__(71551); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + add(value) { + this.values.push(value); + } + set(values) { + this.values = values; + } + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; + } +} +exports.Field = Field; + + +/***/ }), + +/***/ 13374: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + getField(name) { + return this.entries[name.toLowerCase()]; + } + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +} +exports.Fields = Fields; + + +/***/ }), + +/***/ 10944: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0; +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; + return { + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + }, + }; +}; +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), + }; +}; +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; + + +/***/ }), + +/***/ 75612: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(10944), exports); + + +/***/ }), + +/***/ 86749: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 61204: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); + } + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; + } +} +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} + + +/***/ }), + +/***/ 5193: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} +exports.HttpResponse = HttpResponse; + + +/***/ }), + +/***/ 12223: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(75612), exports); +tslib_1.__exportStar(__nccwpck_require__(8452), exports); +tslib_1.__exportStar(__nccwpck_require__(13374), exports); +tslib_1.__exportStar(__nccwpck_require__(86749), exports); +tslib_1.__exportStar(__nccwpck_require__(61204), exports); +tslib_1.__exportStar(__nccwpck_require__(5193), exports); +tslib_1.__exportStar(__nccwpck_require__(85583), exports); +tslib_1.__exportStar(__nccwpck_require__(28066), exports); + + +/***/ }), + +/***/ 85583: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; + + +/***/ }), + +/***/ 28066: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 38815: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.buildQueryString = void 0; +const util_uri_escape_1 = __nccwpck_require__(2996); +function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, util_uri_escape_1.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, util_uri_escape_1.escapeUri)(value[i])}`); + } + } + else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, util_uri_escape_1.escapeUri)(value)}`; + } + parts.push(qsEntry); + } + } + return parts.join("&"); +} +exports.buildQueryString = buildQueryString; + + +/***/ }), + +/***/ 88152: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 92514: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); + + +/***/ }), + +/***/ 41913: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 61632: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 48313: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 22840: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 14859: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 51530: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(14859), exports); +tslib_1.__exportStar(__nccwpck_require__(96439), exports); +tslib_1.__exportStar(__nccwpck_require__(58865), exports); + + +/***/ }), + +/***/ 96439: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 58865: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 33558: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 17043: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 54550: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 79044: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 21391: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 34697: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 77706: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 50616: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(79044), exports); +tslib_1.__exportStar(__nccwpck_require__(21391), exports); +tslib_1.__exportStar(__nccwpck_require__(34697), exports); +tslib_1.__exportStar(__nccwpck_require__(25250), exports); +tslib_1.__exportStar(__nccwpck_require__(77706), exports); + + +/***/ }), + +/***/ 25250: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 440: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 34493: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); + } + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; +}; +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; + + +/***/ }), + +/***/ 52685: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(34493); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + }; +}; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; +}; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; + + +/***/ }), + +/***/ 90339: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 17390: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(52685), exports); +tslib_1.__exportStar(__nccwpck_require__(90339), exports); +var checksum_1 = __nccwpck_require__(34493); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); + + +/***/ }), + +/***/ 73720: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); + + +/***/ }), + +/***/ 13908: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 31023: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 25340: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(13908), exports); +tslib_1.__exportStar(__nccwpck_require__(31023), exports); + + +/***/ }), + +/***/ 71551: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(88152), exports); +tslib_1.__exportStar(__nccwpck_require__(92514), exports); +tslib_1.__exportStar(__nccwpck_require__(41913), exports); +tslib_1.__exportStar(__nccwpck_require__(61632), exports); +tslib_1.__exportStar(__nccwpck_require__(48313), exports); +tslib_1.__exportStar(__nccwpck_require__(22840), exports); +tslib_1.__exportStar(__nccwpck_require__(51530), exports); +tslib_1.__exportStar(__nccwpck_require__(33558), exports); +tslib_1.__exportStar(__nccwpck_require__(17043), exports); +tslib_1.__exportStar(__nccwpck_require__(54550), exports); +tslib_1.__exportStar(__nccwpck_require__(50616), exports); +tslib_1.__exportStar(__nccwpck_require__(440), exports); +tslib_1.__exportStar(__nccwpck_require__(17390), exports); +tslib_1.__exportStar(__nccwpck_require__(73720), exports); +tslib_1.__exportStar(__nccwpck_require__(25340), exports); +tslib_1.__exportStar(__nccwpck_require__(23519), exports); +tslib_1.__exportStar(__nccwpck_require__(43347), exports); +tslib_1.__exportStar(__nccwpck_require__(27319), exports); +tslib_1.__exportStar(__nccwpck_require__(90229), exports); +tslib_1.__exportStar(__nccwpck_require__(95994), exports); +tslib_1.__exportStar(__nccwpck_require__(29703), exports); +tslib_1.__exportStar(__nccwpck_require__(62540), exports); +tslib_1.__exportStar(__nccwpck_require__(36267), exports); +tslib_1.__exportStar(__nccwpck_require__(75233), exports); +tslib_1.__exportStar(__nccwpck_require__(49620), exports); +tslib_1.__exportStar(__nccwpck_require__(29683), exports); +tslib_1.__exportStar(__nccwpck_require__(99324), exports); +tslib_1.__exportStar(__nccwpck_require__(82771), exports); +tslib_1.__exportStar(__nccwpck_require__(19222), exports); +tslib_1.__exportStar(__nccwpck_require__(72155), exports); +tslib_1.__exportStar(__nccwpck_require__(20346), exports); +tslib_1.__exportStar(__nccwpck_require__(57671), exports); +tslib_1.__exportStar(__nccwpck_require__(62165), exports); +tslib_1.__exportStar(__nccwpck_require__(6688), exports); + + +/***/ }), + +/***/ 23519: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 43347: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; + + +/***/ }), + +/***/ 27319: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 90229: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 95994: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 29703: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 62540: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 36267: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 75233: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 49620: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 29683: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 99324: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 82771: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 19222: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); + + +/***/ }), + +/***/ 72155: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 20346: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 57671: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 62165: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 6688: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 3400: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.escapeUriPath = void 0; +const escape_uri_1 = __nccwpck_require__(84025); +const escapeUriPath = (uri) => uri.split("/").map(escape_uri_1.escapeUri).join("/"); +exports.escapeUriPath = escapeUriPath; + + +/***/ }), + +/***/ 84025: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.escapeUri = void 0; +const escapeUri = (uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode); +exports.escapeUri = escapeUri; +const hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`; + + +/***/ }), + +/***/ 2996: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(84025), exports); +tslib_1.__exportStar(__nccwpck_require__(3400), exports); + + +/***/ }), + +/***/ 80255: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromEnv = exports.ENV_EXPIRATION = exports.ENV_SESSION = exports.ENV_SECRET = exports.ENV_KEY = void 0; +const property_provider_1 = __nccwpck_require__(79721); +exports.ENV_KEY = "AWS_ACCESS_KEY_ID"; +exports.ENV_SECRET = "AWS_SECRET_ACCESS_KEY"; +exports.ENV_SESSION = "AWS_SESSION_TOKEN"; +exports.ENV_EXPIRATION = "AWS_CREDENTIAL_EXPIRATION"; +const fromEnv = () => async () => { + const accessKeyId = process.env[exports.ENV_KEY]; + const secretAccessKey = process.env[exports.ENV_SECRET]; + const sessionToken = process.env[exports.ENV_SESSION]; + const expiry = process.env[exports.ENV_EXPIRATION]; + if (accessKeyId && secretAccessKey) { + return { + accessKeyId, + secretAccessKey, + ...(sessionToken && { sessionToken }), + ...(expiry && { expiration: new Date(expiry) }), + }; + } + throw new property_provider_1.CredentialsProviderError("Unable to find environment variable credentials."); +}; +exports.fromEnv = fromEnv; + + +/***/ }), + +/***/ 15972: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(80255), exports); + + +/***/ }), + +/***/ 55442: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromIni = void 0; +const shared_ini_file_loader_1 = __nccwpck_require__(43507); +const resolveProfileData_1 = __nccwpck_require__(95653); +const fromIni = (init = {}) => async () => { + const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init); + return (0, resolveProfileData_1.resolveProfileData)((0, shared_ini_file_loader_1.getProfileName)(init), profiles, init); +}; +exports.fromIni = fromIni; + + +/***/ }), + +/***/ 74203: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(55442), exports); + + +/***/ }), + +/***/ 60853: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveAssumeRoleCredentials = exports.isAssumeRoleProfile = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const shared_ini_file_loader_1 = __nccwpck_require__(43507); +const resolveCredentialSource_1 = __nccwpck_require__(82458); +const resolveProfileData_1 = __nccwpck_require__(95653); +const isAssumeRoleProfile = (arg) => Boolean(arg) && + typeof arg === "object" && + typeof arg.role_arn === "string" && + ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1 && + ["undefined", "string"].indexOf(typeof arg.external_id) > -1 && + ["undefined", "string"].indexOf(typeof arg.mfa_serial) > -1 && + (isAssumeRoleWithSourceProfile(arg) || isAssumeRoleWithProviderProfile(arg)); +exports.isAssumeRoleProfile = isAssumeRoleProfile; +const isAssumeRoleWithSourceProfile = (arg) => typeof arg.source_profile === "string" && typeof arg.credential_source === "undefined"; +const isAssumeRoleWithProviderProfile = (arg) => typeof arg.credential_source === "string" && typeof arg.source_profile === "undefined"; +const resolveAssumeRoleCredentials = async (profileName, profiles, options, visitedProfiles = {}) => { + const data = profiles[profileName]; + if (!options.roleAssumer) { + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} requires a role to be assumed, but no role assumption callback was provided.`, false); + } + const { source_profile } = data; + if (source_profile && source_profile in visitedProfiles) { + throw new property_provider_1.CredentialsProviderError(`Detected a cycle attempting to resolve credentials for profile` + + ` ${(0, shared_ini_file_loader_1.getProfileName)(options)}. Profiles visited: ` + + Object.keys(visitedProfiles).join(", "), false); + } + const sourceCredsProvider = source_profile + ? (0, resolveProfileData_1.resolveProfileData)(source_profile, profiles, options, { + ...visitedProfiles, + [source_profile]: true, + }) + : (0, resolveCredentialSource_1.resolveCredentialSource)(data.credential_source, profileName)(); + const params = { + RoleArn: data.role_arn, + RoleSessionName: data.role_session_name || `aws-sdk-js-${Date.now()}`, + ExternalId: data.external_id, + DurationSeconds: parseInt(data.duration_seconds || "3600", 10), + }; + const { mfa_serial } = data; + if (mfa_serial) { + if (!options.mfaCodeProvider) { + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} requires multi-factor authentication, but no MFA code callback was provided.`, false); + } + params.SerialNumber = mfa_serial; + params.TokenCode = await options.mfaCodeProvider(mfa_serial); + } + const sourceCreds = await sourceCredsProvider; + return options.roleAssumer(sourceCreds, params); +}; +exports.resolveAssumeRoleCredentials = resolveAssumeRoleCredentials; + + +/***/ }), + +/***/ 82458: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveCredentialSource = void 0; +const credential_provider_env_1 = __nccwpck_require__(15972); +const credential_provider_imds_1 = __nccwpck_require__(7477); +const property_provider_1 = __nccwpck_require__(79721); +const resolveCredentialSource = (credentialSource, profileName) => { + const sourceProvidersMap = { + EcsContainer: credential_provider_imds_1.fromContainerMetadata, + Ec2InstanceMetadata: credential_provider_imds_1.fromInstanceMetadata, + Environment: credential_provider_env_1.fromEnv, + }; + if (credentialSource in sourceProvidersMap) { + return sourceProvidersMap[credentialSource](); + } + else { + throw new property_provider_1.CredentialsProviderError(`Unsupported credential source in profile ${profileName}. Got ${credentialSource}, ` + + `expected EcsContainer or Ec2InstanceMetadata or Environment.`); + } +}; +exports.resolveCredentialSource = resolveCredentialSource; + + +/***/ }), + +/***/ 69993: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveProcessCredentials = exports.isProcessProfile = void 0; +const credential_provider_process_1 = __nccwpck_require__(89969); +const isProcessProfile = (arg) => Boolean(arg) && typeof arg === "object" && typeof arg.credential_process === "string"; +exports.isProcessProfile = isProcessProfile; +const resolveProcessCredentials = async (options, profile) => (0, credential_provider_process_1.fromProcess)({ + ...options, + profile, +})(); +exports.resolveProcessCredentials = resolveProcessCredentials; + + +/***/ }), + +/***/ 95653: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveProfileData = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const resolveAssumeRoleCredentials_1 = __nccwpck_require__(60853); +const resolveProcessCredentials_1 = __nccwpck_require__(69993); +const resolveSsoCredentials_1 = __nccwpck_require__(59867); +const resolveStaticCredentials_1 = __nccwpck_require__(33071); +const resolveWebIdentityCredentials_1 = __nccwpck_require__(58342); +const resolveProfileData = async (profileName, profiles, options, visitedProfiles = {}) => { + const data = profiles[profileName]; + if (Object.keys(visitedProfiles).length > 0 && (0, resolveStaticCredentials_1.isStaticCredsProfile)(data)) { + return (0, resolveStaticCredentials_1.resolveStaticCredentials)(data); + } + if ((0, resolveAssumeRoleCredentials_1.isAssumeRoleProfile)(data)) { + return (0, resolveAssumeRoleCredentials_1.resolveAssumeRoleCredentials)(profileName, profiles, options, visitedProfiles); + } + if ((0, resolveStaticCredentials_1.isStaticCredsProfile)(data)) { + return (0, resolveStaticCredentials_1.resolveStaticCredentials)(data); + } + if ((0, resolveWebIdentityCredentials_1.isWebIdentityProfile)(data)) { + return (0, resolveWebIdentityCredentials_1.resolveWebIdentityCredentials)(data, options); + } + if ((0, resolveProcessCredentials_1.isProcessProfile)(data)) { + return (0, resolveProcessCredentials_1.resolveProcessCredentials)(options, profileName); + } + if ((0, resolveSsoCredentials_1.isSsoProfile)(data)) { + return (0, resolveSsoCredentials_1.resolveSsoCredentials)(data); + } + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} could not be found or parsed in shared credentials file.`); +}; +exports.resolveProfileData = resolveProfileData; + + +/***/ }), + +/***/ 59867: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveSsoCredentials = exports.isSsoProfile = void 0; +const credential_provider_sso_1 = __nccwpck_require__(26414); +var credential_provider_sso_2 = __nccwpck_require__(26414); +Object.defineProperty(exports, "isSsoProfile", ({ enumerable: true, get: function () { return credential_provider_sso_2.isSsoProfile; } })); +const resolveSsoCredentials = (data) => { + const { sso_start_url, sso_account_id, sso_session, sso_region, sso_role_name } = (0, credential_provider_sso_1.validateSsoProfile)(data); + return (0, credential_provider_sso_1.fromSSO)({ + ssoStartUrl: sso_start_url, + ssoAccountId: sso_account_id, + ssoSession: sso_session, + ssoRegion: sso_region, + ssoRoleName: sso_role_name, + })(); +}; +exports.resolveSsoCredentials = resolveSsoCredentials; + + +/***/ }), + +/***/ 33071: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveStaticCredentials = exports.isStaticCredsProfile = void 0; +const isStaticCredsProfile = (arg) => Boolean(arg) && + typeof arg === "object" && + typeof arg.aws_access_key_id === "string" && + typeof arg.aws_secret_access_key === "string" && + ["undefined", "string"].indexOf(typeof arg.aws_session_token) > -1; +exports.isStaticCredsProfile = isStaticCredsProfile; +const resolveStaticCredentials = (profile) => Promise.resolve({ + accessKeyId: profile.aws_access_key_id, + secretAccessKey: profile.aws_secret_access_key, + sessionToken: profile.aws_session_token, +}); +exports.resolveStaticCredentials = resolveStaticCredentials; + + +/***/ }), + +/***/ 58342: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveWebIdentityCredentials = exports.isWebIdentityProfile = void 0; +const credential_provider_web_identity_1 = __nccwpck_require__(15646); +const isWebIdentityProfile = (arg) => Boolean(arg) && + typeof arg === "object" && + typeof arg.web_identity_token_file === "string" && + typeof arg.role_arn === "string" && + ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1; +exports.isWebIdentityProfile = isWebIdentityProfile; +const resolveWebIdentityCredentials = async (profile, options) => (0, credential_provider_web_identity_1.fromTokenFile)({ + webIdentityTokenFile: profile.web_identity_token_file, + roleArn: profile.role_arn, + roleSessionName: profile.role_session_name, + roleAssumerWithWebIdentity: options.roleAssumerWithWebIdentity, +})(); +exports.resolveWebIdentityCredentials = resolveWebIdentityCredentials; + + +/***/ }), + +/***/ 15560: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultProvider = void 0; +const credential_provider_env_1 = __nccwpck_require__(15972); +const credential_provider_ini_1 = __nccwpck_require__(74203); +const credential_provider_process_1 = __nccwpck_require__(89969); +const credential_provider_sso_1 = __nccwpck_require__(26414); +const credential_provider_web_identity_1 = __nccwpck_require__(15646); +const property_provider_1 = __nccwpck_require__(79721); +const shared_ini_file_loader_1 = __nccwpck_require__(43507); +const remoteProvider_1 = __nccwpck_require__(50626); +const defaultProvider = (init = {}) => (0, property_provider_1.memoize)((0, property_provider_1.chain)(...(init.profile || process.env[shared_ini_file_loader_1.ENV_PROFILE] ? [] : [(0, credential_provider_env_1.fromEnv)()]), (0, credential_provider_sso_1.fromSSO)(init), (0, credential_provider_ini_1.fromIni)(init), (0, credential_provider_process_1.fromProcess)(init), (0, credential_provider_web_identity_1.fromTokenFile)(init), (0, remoteProvider_1.remoteProvider)(init), async () => { + throw new property_provider_1.CredentialsProviderError("Could not load credentials from any providers", false); +}), (credentials) => credentials.expiration !== undefined && credentials.expiration.getTime() - Date.now() < 300000, (credentials) => credentials.expiration !== undefined); +exports.defaultProvider = defaultProvider; + + +/***/ }), + +/***/ 75531: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(15560), exports); + + +/***/ }), + +/***/ 50626: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.remoteProvider = exports.ENV_IMDS_DISABLED = void 0; +const credential_provider_imds_1 = __nccwpck_require__(7477); +const property_provider_1 = __nccwpck_require__(79721); +exports.ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; +const remoteProvider = (init) => { + if (process.env[credential_provider_imds_1.ENV_CMDS_RELATIVE_URI] || process.env[credential_provider_imds_1.ENV_CMDS_FULL_URI]) { + return (0, credential_provider_imds_1.fromContainerMetadata)(init); + } + if (process.env[exports.ENV_IMDS_DISABLED]) { + return async () => { + throw new property_provider_1.CredentialsProviderError("EC2 Instance Metadata Service access disabled"); + }; + } + return (0, credential_provider_imds_1.fromInstanceMetadata)(init); +}; +exports.remoteProvider = remoteProvider; + + +/***/ }), + +/***/ 72650: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromProcess = void 0; +const shared_ini_file_loader_1 = __nccwpck_require__(43507); +const resolveProcessCredentials_1 = __nccwpck_require__(74926); +const fromProcess = (init = {}) => async () => { + const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init); + return (0, resolveProcessCredentials_1.resolveProcessCredentials)((0, shared_ini_file_loader_1.getProfileName)(init), profiles); +}; +exports.fromProcess = fromProcess; + + +/***/ }), + +/***/ 41104: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getValidatedProcessCredentials = void 0; +const getValidatedProcessCredentials = (profileName, data) => { + if (data.Version !== 1) { + throw Error(`Profile ${profileName} credential_process did not return Version 1.`); + } + if (data.AccessKeyId === undefined || data.SecretAccessKey === undefined) { + throw Error(`Profile ${profileName} credential_process returned invalid credentials.`); + } + if (data.Expiration) { + const currentTime = new Date(); + const expireTime = new Date(data.Expiration); + if (expireTime < currentTime) { + throw Error(`Profile ${profileName} credential_process returned expired credentials.`); + } + } + return { + accessKeyId: data.AccessKeyId, + secretAccessKey: data.SecretAccessKey, + ...(data.SessionToken && { sessionToken: data.SessionToken }), + ...(data.Expiration && { expiration: new Date(data.Expiration) }), + }; +}; +exports.getValidatedProcessCredentials = getValidatedProcessCredentials; + + +/***/ }), + +/***/ 89969: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(72650), exports); + + +/***/ }), + +/***/ 74926: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveProcessCredentials = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const child_process_1 = __nccwpck_require__(32081); +const util_1 = __nccwpck_require__(73837); +const getValidatedProcessCredentials_1 = __nccwpck_require__(41104); +const resolveProcessCredentials = async (profileName, profiles) => { + const profile = profiles[profileName]; + if (profiles[profileName]) { + const credentialProcess = profile["credential_process"]; + if (credentialProcess !== undefined) { + const execPromise = (0, util_1.promisify)(child_process_1.exec); + try { + const { stdout } = await execPromise(credentialProcess); + let data; + try { + data = JSON.parse(stdout.trim()); + } + catch (_a) { + throw Error(`Profile ${profileName} credential_process returned invalid JSON.`); + } + return (0, getValidatedProcessCredentials_1.getValidatedProcessCredentials)(profileName, data); + } + catch (error) { + throw new property_provider_1.CredentialsProviderError(error.message); + } + } + else { + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} did not contain credential_process.`); + } + } + else { + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} could not be found in shared credentials file.`); + } +}; +exports.resolveProcessCredentials = resolveProcessCredentials; + + +/***/ }), + +/***/ 35959: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromSSO = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const shared_ini_file_loader_1 = __nccwpck_require__(43507); +const isSsoProfile_1 = __nccwpck_require__(32572); +const resolveSSOCredentials_1 = __nccwpck_require__(94729); +const validateSsoProfile_1 = __nccwpck_require__(48098); +const fromSSO = (init = {}) => async () => { + const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoClient, ssoSession } = init; + const profileName = (0, shared_ini_file_loader_1.getProfileName)(init); + if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) { + const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init); + const profile = profiles[profileName]; + if (!profile) { + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} was not found.`); + } + if (!(0, isSsoProfile_1.isSsoProfile)(profile)) { + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} is not configured with SSO credentials.`); + } + if (profile === null || profile === void 0 ? void 0 : profile.sso_session) { + const ssoSessions = await (0, shared_ini_file_loader_1.loadSsoSessionData)(init); + const session = ssoSessions[profile.sso_session]; + const conflictMsg = ` configurations in profile ${profileName} and sso-session ${profile.sso_session}`; + if (ssoRegion && ssoRegion !== session.sso_region) { + throw new property_provider_1.CredentialsProviderError(`Conflicting SSO region` + conflictMsg, false); + } + if (ssoStartUrl && ssoStartUrl !== session.sso_start_url) { + throw new property_provider_1.CredentialsProviderError(`Conflicting SSO start_url` + conflictMsg, false); + } + profile.sso_region = session.sso_region; + profile.sso_start_url = session.sso_start_url; + } + const { sso_start_url, sso_account_id, sso_region, sso_role_name, sso_session } = (0, validateSsoProfile_1.validateSsoProfile)(profile); + return (0, resolveSSOCredentials_1.resolveSSOCredentials)({ + ssoStartUrl: sso_start_url, + ssoSession: sso_session, + ssoAccountId: sso_account_id, + ssoRegion: sso_region, + ssoRoleName: sso_role_name, + ssoClient: ssoClient, + profile: profileName, + }); + } + else if (!ssoStartUrl || !ssoAccountId || !ssoRegion || !ssoRoleName) { + throw new property_provider_1.CredentialsProviderError("Incomplete configuration. The fromSSO() argument hash must include " + + '"ssoStartUrl", "ssoAccountId", "ssoRegion", "ssoRoleName"'); + } + else { + return (0, resolveSSOCredentials_1.resolveSSOCredentials)({ + ssoStartUrl, + ssoSession, + ssoAccountId, + ssoRegion, + ssoRoleName, + ssoClient, + profile: profileName, + }); + } +}; +exports.fromSSO = fromSSO; + + +/***/ }), + +/***/ 26414: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(35959), exports); +tslib_1.__exportStar(__nccwpck_require__(32572), exports); +tslib_1.__exportStar(__nccwpck_require__(86623), exports); +tslib_1.__exportStar(__nccwpck_require__(48098), exports); + + +/***/ }), + +/***/ 32572: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isSsoProfile = void 0; +const isSsoProfile = (arg) => arg && + (typeof arg.sso_start_url === "string" || + typeof arg.sso_account_id === "string" || + typeof arg.sso_session === "string" || + typeof arg.sso_region === "string" || + typeof arg.sso_role_name === "string"); +exports.isSsoProfile = isSsoProfile; + + +/***/ }), + +/***/ 94729: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveSSOCredentials = void 0; +const client_sso_1 = __nccwpck_require__(82666); +const token_providers_1 = __nccwpck_require__(52843); +const property_provider_1 = __nccwpck_require__(79721); +const shared_ini_file_loader_1 = __nccwpck_require__(43507); +const SHOULD_FAIL_CREDENTIAL_CHAIN = false; +const resolveSSOCredentials = async ({ ssoStartUrl, ssoSession, ssoAccountId, ssoRegion, ssoRoleName, ssoClient, profile, }) => { + let token; + const refreshMessage = `To refresh this SSO session run aws sso login with the corresponding profile.`; + if (ssoSession) { + try { + const _token = await (0, token_providers_1.fromSso)({ profile })(); + token = { + accessToken: _token.token, + expiresAt: new Date(_token.expiration).toISOString(), + }; + } + catch (e) { + throw new property_provider_1.CredentialsProviderError(e.message, SHOULD_FAIL_CREDENTIAL_CHAIN); + } + } + else { + try { + token = await (0, shared_ini_file_loader_1.getSSOTokenFromFile)(ssoStartUrl); + } + catch (e) { + throw new property_provider_1.CredentialsProviderError(`The SSO session associated with this profile is invalid. ${refreshMessage}`, SHOULD_FAIL_CREDENTIAL_CHAIN); + } + } + if (new Date(token.expiresAt).getTime() - Date.now() <= 0) { + throw new property_provider_1.CredentialsProviderError(`The SSO session associated with this profile has expired. ${refreshMessage}`, SHOULD_FAIL_CREDENTIAL_CHAIN); + } + const { accessToken } = token; + const sso = ssoClient || new client_sso_1.SSOClient({ region: ssoRegion }); + let ssoResp; + try { + ssoResp = await sso.send(new client_sso_1.GetRoleCredentialsCommand({ + accountId: ssoAccountId, + roleName: ssoRoleName, + accessToken, + })); + } + catch (e) { + throw property_provider_1.CredentialsProviderError.from(e, SHOULD_FAIL_CREDENTIAL_CHAIN); + } + const { roleCredentials: { accessKeyId, secretAccessKey, sessionToken, expiration } = {} } = ssoResp; + if (!accessKeyId || !secretAccessKey || !sessionToken || !expiration) { + throw new property_provider_1.CredentialsProviderError("SSO returns an invalid temporary credential.", SHOULD_FAIL_CREDENTIAL_CHAIN); + } + return { accessKeyId, secretAccessKey, sessionToken, expiration: new Date(expiration) }; +}; +exports.resolveSSOCredentials = resolveSSOCredentials; + + +/***/ }), + +/***/ 86623: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 48098: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.validateSsoProfile = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const validateSsoProfile = (profile) => { + const { sso_start_url, sso_account_id, sso_region, sso_role_name } = profile; + if (!sso_start_url || !sso_account_id || !sso_region || !sso_role_name) { + throw new property_provider_1.CredentialsProviderError(`Profile is configured with invalid SSO credentials. Required parameters "sso_account_id", ` + + `"sso_region", "sso_role_name", "sso_start_url". Got ${Object.keys(profile).join(", ")}\nReference: https://docs.aws.amazon.com/cli/latest/userguide/cli-configure-sso.html`, false); + } + return profile; +}; +exports.validateSsoProfile = validateSsoProfile; + + +/***/ }), + +/***/ 35614: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromTokenFile = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const fs_1 = __nccwpck_require__(57147); +const fromWebToken_1 = __nccwpck_require__(47905); +const ENV_TOKEN_FILE = "AWS_WEB_IDENTITY_TOKEN_FILE"; +const ENV_ROLE_ARN = "AWS_ROLE_ARN"; +const ENV_ROLE_SESSION_NAME = "AWS_ROLE_SESSION_NAME"; +const fromTokenFile = (init = {}) => async () => { + var _a, _b, _c; + const webIdentityTokenFile = (_a = init === null || init === void 0 ? void 0 : init.webIdentityTokenFile) !== null && _a !== void 0 ? _a : process.env[ENV_TOKEN_FILE]; + const roleArn = (_b = init === null || init === void 0 ? void 0 : init.roleArn) !== null && _b !== void 0 ? _b : process.env[ENV_ROLE_ARN]; + const roleSessionName = (_c = init === null || init === void 0 ? void 0 : init.roleSessionName) !== null && _c !== void 0 ? _c : process.env[ENV_ROLE_SESSION_NAME]; + if (!webIdentityTokenFile || !roleArn) { + throw new property_provider_1.CredentialsProviderError("Web identity configuration not specified"); + } + return (0, fromWebToken_1.fromWebToken)({ + ...init, + webIdentityToken: (0, fs_1.readFileSync)(webIdentityTokenFile, { encoding: "ascii" }), + roleArn, + roleSessionName, + })(); +}; +exports.fromTokenFile = fromTokenFile; + + +/***/ }), + +/***/ 47905: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromWebToken = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const fromWebToken = (init) => () => { + const { roleArn, roleSessionName, webIdentityToken, providerId, policyArns, policy, durationSeconds, roleAssumerWithWebIdentity, } = init; + if (!roleAssumerWithWebIdentity) { + throw new property_provider_1.CredentialsProviderError(`Role Arn '${roleArn}' needs to be assumed with web identity,` + + ` but no role assumption callback was provided.`, false); + } + return roleAssumerWithWebIdentity({ + RoleArn: roleArn, + RoleSessionName: roleSessionName !== null && roleSessionName !== void 0 ? roleSessionName : `aws-sdk-js-session-${Date.now()}`, + WebIdentityToken: webIdentityToken, + ProviderId: providerId, + PolicyArns: policyArns, + Policy: policy, + DurationSeconds: durationSeconds, + }); +}; +exports.fromWebToken = fromWebToken; + + +/***/ }), + +/***/ 15646: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(35614), exports); +tslib_1.__exportStar(__nccwpck_require__(47905), exports); + + +/***/ }), + +/***/ 22545: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getHostHeaderPlugin = exports.hostHeaderMiddlewareOptions = exports.hostHeaderMiddleware = exports.resolveHostHeaderConfig = void 0; +const protocol_http_1 = __nccwpck_require__(40517); +function resolveHostHeaderConfig(input) { + return input; +} +exports.resolveHostHeaderConfig = resolveHostHeaderConfig; +const hostHeaderMiddleware = (options) => (next) => async (args) => { + if (!protocol_http_1.HttpRequest.isInstance(args.request)) + return next(args); + const { request } = args; + const { handlerProtocol = "" } = options.requestHandler.metadata || {}; + if (handlerProtocol.indexOf("h2") >= 0 && !request.headers[":authority"]) { + delete request.headers["host"]; + request.headers[":authority"] = ""; + } + else if (!request.headers["host"]) { + let host = request.hostname; + if (request.port != null) + host += `:${request.port}`; + request.headers["host"] = host; + } + return next(args); +}; +exports.hostHeaderMiddleware = hostHeaderMiddleware; +exports.hostHeaderMiddlewareOptions = { + name: "hostHeaderMiddleware", + step: "build", + priority: "low", + tags: ["HOST"], + override: true, +}; +const getHostHeaderPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add((0, exports.hostHeaderMiddleware)(options), exports.hostHeaderMiddlewareOptions); + }, +}); +exports.getHostHeaderPlugin = getHostHeaderPlugin; + + +/***/ }), + +/***/ 60942: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Field = void 0; +const types_1 = __nccwpck_require__(58968); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + add(value) { + this.values.push(value); + } + set(values) { + this.values = values; + } + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; + } +} +exports.Field = Field; + + +/***/ }), + +/***/ 11201: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + getField(name) { + return this.entries[name.toLowerCase()]; + } + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +} +exports.Fields = Fields; + + +/***/ }), + +/***/ 98066: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0; +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; + return { + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + }, + }; +}; +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), + }; +}; +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; + + +/***/ }), + +/***/ 8302: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(98066), exports); + + +/***/ }), + +/***/ 48043: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 15839: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); + } + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; + } +} +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} + + +/***/ }), + +/***/ 30288: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} +exports.HttpResponse = HttpResponse; + + +/***/ }), + +/***/ 40517: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(8302), exports); +tslib_1.__exportStar(__nccwpck_require__(60942), exports); +tslib_1.__exportStar(__nccwpck_require__(11201), exports); +tslib_1.__exportStar(__nccwpck_require__(48043), exports); +tslib_1.__exportStar(__nccwpck_require__(15839), exports); +tslib_1.__exportStar(__nccwpck_require__(30288), exports); +tslib_1.__exportStar(__nccwpck_require__(46607), exports); +tslib_1.__exportStar(__nccwpck_require__(73526), exports); + + +/***/ }), + +/***/ 46607: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; + + +/***/ }), + +/***/ 73526: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 93144: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 74878: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); + + +/***/ }), + +/***/ 88072: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 60045: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 62489: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 23457: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 51525: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 13843: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(51525), exports); +tslib_1.__exportStar(__nccwpck_require__(98296), exports); +tslib_1.__exportStar(__nccwpck_require__(88810), exports); + + +/***/ }), + +/***/ 98296: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 88810: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 76780: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 34348: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 23233: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 91012: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 69336: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 86264: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 87526: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 84688: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(91012), exports); +tslib_1.__exportStar(__nccwpck_require__(69336), exports); +tslib_1.__exportStar(__nccwpck_require__(86264), exports); +tslib_1.__exportStar(__nccwpck_require__(64320), exports); +tslib_1.__exportStar(__nccwpck_require__(87526), exports); + + +/***/ }), + +/***/ 64320: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 84017: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 81112: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); + } + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; +}; +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; + + +/***/ }), + +/***/ 41054: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(81112); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + }; +}; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; +}; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; + + +/***/ }), + +/***/ 34130: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 14547: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(41054), exports); +tslib_1.__exportStar(__nccwpck_require__(34130), exports); +var checksum_1 = __nccwpck_require__(81112); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); + + +/***/ }), + +/***/ 21016: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); + + +/***/ }), + +/***/ 65323: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 40196: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 13258: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(65323), exports); +tslib_1.__exportStar(__nccwpck_require__(40196), exports); + + +/***/ }), + +/***/ 58968: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(93144), exports); +tslib_1.__exportStar(__nccwpck_require__(74878), exports); +tslib_1.__exportStar(__nccwpck_require__(88072), exports); +tslib_1.__exportStar(__nccwpck_require__(60045), exports); +tslib_1.__exportStar(__nccwpck_require__(62489), exports); +tslib_1.__exportStar(__nccwpck_require__(23457), exports); +tslib_1.__exportStar(__nccwpck_require__(13843), exports); +tslib_1.__exportStar(__nccwpck_require__(76780), exports); +tslib_1.__exportStar(__nccwpck_require__(34348), exports); +tslib_1.__exportStar(__nccwpck_require__(23233), exports); +tslib_1.__exportStar(__nccwpck_require__(84688), exports); +tslib_1.__exportStar(__nccwpck_require__(84017), exports); +tslib_1.__exportStar(__nccwpck_require__(14547), exports); +tslib_1.__exportStar(__nccwpck_require__(21016), exports); +tslib_1.__exportStar(__nccwpck_require__(13258), exports); +tslib_1.__exportStar(__nccwpck_require__(15385), exports); +tslib_1.__exportStar(__nccwpck_require__(63366), exports); +tslib_1.__exportStar(__nccwpck_require__(62763), exports); +tslib_1.__exportStar(__nccwpck_require__(81399), exports); +tslib_1.__exportStar(__nccwpck_require__(9067), exports); +tslib_1.__exportStar(__nccwpck_require__(27792), exports); +tslib_1.__exportStar(__nccwpck_require__(31995), exports); +tslib_1.__exportStar(__nccwpck_require__(31778), exports); +tslib_1.__exportStar(__nccwpck_require__(70266), exports); +tslib_1.__exportStar(__nccwpck_require__(38281), exports); +tslib_1.__exportStar(__nccwpck_require__(1620), exports); +tslib_1.__exportStar(__nccwpck_require__(83151), exports); +tslib_1.__exportStar(__nccwpck_require__(64988), exports); +tslib_1.__exportStar(__nccwpck_require__(2045), exports); +tslib_1.__exportStar(__nccwpck_require__(67984), exports); +tslib_1.__exportStar(__nccwpck_require__(65784), exports); +tslib_1.__exportStar(__nccwpck_require__(83116), exports); +tslib_1.__exportStar(__nccwpck_require__(22726), exports); +tslib_1.__exportStar(__nccwpck_require__(61623), exports); + + +/***/ }), + +/***/ 15385: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 63366: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; + + +/***/ }), + +/***/ 62763: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 81399: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 9067: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 27792: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 31995: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 31778: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 70266: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 38281: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 1620: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 83151: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 64988: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 2045: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); + + +/***/ }), + +/***/ 67984: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 65784: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 83116: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 22726: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 61623: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 20014: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(9754), exports); + + +/***/ }), + +/***/ 9754: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getLoggerPlugin = exports.loggerMiddlewareOptions = exports.loggerMiddleware = void 0; +const loggerMiddleware = () => (next, context) => async (args) => { + var _a, _b; + try { + const response = await next(args); + const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; + const { overrideInputFilterSensitiveLog, overrideOutputFilterSensitiveLog } = dynamoDbDocumentClientOptions; + const inputFilterSensitiveLog = overrideInputFilterSensitiveLog !== null && overrideInputFilterSensitiveLog !== void 0 ? overrideInputFilterSensitiveLog : context.inputFilterSensitiveLog; + const outputFilterSensitiveLog = overrideOutputFilterSensitiveLog !== null && overrideOutputFilterSensitiveLog !== void 0 ? overrideOutputFilterSensitiveLog : context.outputFilterSensitiveLog; + const { $metadata, ...outputWithoutMetadata } = response.output; + (_a = logger === null || logger === void 0 ? void 0 : logger.info) === null || _a === void 0 ? void 0 : _a.call(logger, { + clientName, + commandName, + input: inputFilterSensitiveLog(args.input), + output: outputFilterSensitiveLog(outputWithoutMetadata), + metadata: $metadata, + }); + return response; + } + catch (error) { + const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; + const { overrideInputFilterSensitiveLog } = dynamoDbDocumentClientOptions; + const inputFilterSensitiveLog = overrideInputFilterSensitiveLog !== null && overrideInputFilterSensitiveLog !== void 0 ? overrideInputFilterSensitiveLog : context.inputFilterSensitiveLog; + (_b = logger === null || logger === void 0 ? void 0 : logger.error) === null || _b === void 0 ? void 0 : _b.call(logger, { + clientName, + commandName, + input: inputFilterSensitiveLog(args.input), + error, + metadata: error.$metadata, + }); + throw error; + } +}; +exports.loggerMiddleware = loggerMiddleware; +exports.loggerMiddlewareOptions = { + name: "loggerMiddleware", + tags: ["LOGGER"], + step: "initialize", + override: true, +}; +const getLoggerPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add((0, exports.loggerMiddleware)(), exports.loggerMiddlewareOptions); + }, +}); +exports.getLoggerPlugin = getLoggerPlugin; + + +/***/ }), + +/***/ 85525: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRecursionDetectionPlugin = exports.addRecursionDetectionMiddlewareOptions = exports.recursionDetectionMiddleware = void 0; +const protocol_http_1 = __nccwpck_require__(22877); +const TRACE_ID_HEADER_NAME = "X-Amzn-Trace-Id"; +const ENV_LAMBDA_FUNCTION_NAME = "AWS_LAMBDA_FUNCTION_NAME"; +const ENV_TRACE_ID = "_X_AMZN_TRACE_ID"; +const recursionDetectionMiddleware = (options) => (next) => async (args) => { + const { request } = args; + if (!protocol_http_1.HttpRequest.isInstance(request) || + options.runtime !== "node" || + request.headers.hasOwnProperty(TRACE_ID_HEADER_NAME)) { + return next(args); + } + const functionName = process.env[ENV_LAMBDA_FUNCTION_NAME]; + const traceId = process.env[ENV_TRACE_ID]; + const nonEmptyString = (str) => typeof str === "string" && str.length > 0; + if (nonEmptyString(functionName) && nonEmptyString(traceId)) { + request.headers[TRACE_ID_HEADER_NAME] = traceId; + } + return next({ + ...args, + request, + }); +}; +exports.recursionDetectionMiddleware = recursionDetectionMiddleware; +exports.addRecursionDetectionMiddlewareOptions = { + step: "build", + tags: ["RECURSION_DETECTION"], + name: "recursionDetectionMiddleware", + override: true, + priority: "low", +}; +const getRecursionDetectionPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add((0, exports.recursionDetectionMiddleware)(options), exports.addRecursionDetectionMiddlewareOptions); + }, +}); +exports.getRecursionDetectionPlugin = getRecursionDetectionPlugin; + + +/***/ }), + +/***/ 27232: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Field = void 0; +const types_1 = __nccwpck_require__(29360); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + add(value) { + this.values.push(value); + } + set(values) { + this.values = values; + } + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; + } +} +exports.Field = Field; + + +/***/ }), + +/***/ 94727: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + getField(name) { + return this.entries[name.toLowerCase()]; + } + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +} +exports.Fields = Fields; + + +/***/ }), + +/***/ 98392: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0; +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; + return { + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + }, + }; +}; +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), + }; +}; +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; + + +/***/ }), + +/***/ 26750: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(98392), exports); + + +/***/ }), + +/***/ 54967: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 58400: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); + } + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; + } +} +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} + + +/***/ }), + +/***/ 98882: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} +exports.HttpResponse = HttpResponse; + + +/***/ }), + +/***/ 22877: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(26750), exports); +tslib_1.__exportStar(__nccwpck_require__(27232), exports); +tslib_1.__exportStar(__nccwpck_require__(94727), exports); +tslib_1.__exportStar(__nccwpck_require__(54967), exports); +tslib_1.__exportStar(__nccwpck_require__(58400), exports); +tslib_1.__exportStar(__nccwpck_require__(98882), exports); +tslib_1.__exportStar(__nccwpck_require__(95224), exports); +tslib_1.__exportStar(__nccwpck_require__(65201), exports); + + +/***/ }), + +/***/ 95224: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; + + +/***/ }), + +/***/ 65201: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 29058: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 59582: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); + + +/***/ }), + +/***/ 80912: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 4285: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 20600: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 35103: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 18495: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 96084: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(18495), exports); +tslib_1.__exportStar(__nccwpck_require__(54112), exports); +tslib_1.__exportStar(__nccwpck_require__(30629), exports); + + +/***/ }), + +/***/ 54112: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 30629: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 8172: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 98003: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 43438: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 49248: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 91826: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 74843: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 38942: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 87873: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(49248), exports); +tslib_1.__exportStar(__nccwpck_require__(91826), exports); +tslib_1.__exportStar(__nccwpck_require__(74843), exports); +tslib_1.__exportStar(__nccwpck_require__(44730), exports); +tslib_1.__exportStar(__nccwpck_require__(38942), exports); + + +/***/ }), + +/***/ 44730: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 2689: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 20632: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); + } + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; +}; +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; + + +/***/ }), + +/***/ 65598: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(20632); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + }; +}; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; +}; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; + + +/***/ }), + +/***/ 2248: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 54648: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(65598), exports); +tslib_1.__exportStar(__nccwpck_require__(2248), exports); +var checksum_1 = __nccwpck_require__(20632); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); + + +/***/ }), + +/***/ 30165: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); + + +/***/ }), + +/***/ 91291: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 4300: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 90320: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(91291), exports); +tslib_1.__exportStar(__nccwpck_require__(4300), exports); + + +/***/ }), + +/***/ 29360: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(29058), exports); +tslib_1.__exportStar(__nccwpck_require__(59582), exports); +tslib_1.__exportStar(__nccwpck_require__(80912), exports); +tslib_1.__exportStar(__nccwpck_require__(4285), exports); +tslib_1.__exportStar(__nccwpck_require__(20600), exports); +tslib_1.__exportStar(__nccwpck_require__(35103), exports); +tslib_1.__exportStar(__nccwpck_require__(96084), exports); +tslib_1.__exportStar(__nccwpck_require__(8172), exports); +tslib_1.__exportStar(__nccwpck_require__(98003), exports); +tslib_1.__exportStar(__nccwpck_require__(43438), exports); +tslib_1.__exportStar(__nccwpck_require__(87873), exports); +tslib_1.__exportStar(__nccwpck_require__(2689), exports); +tslib_1.__exportStar(__nccwpck_require__(54648), exports); +tslib_1.__exportStar(__nccwpck_require__(30165), exports); +tslib_1.__exportStar(__nccwpck_require__(90320), exports); +tslib_1.__exportStar(__nccwpck_require__(2081), exports); +tslib_1.__exportStar(__nccwpck_require__(76978), exports); +tslib_1.__exportStar(__nccwpck_require__(11017), exports); +tslib_1.__exportStar(__nccwpck_require__(48052), exports); +tslib_1.__exportStar(__nccwpck_require__(3060), exports); +tslib_1.__exportStar(__nccwpck_require__(64233), exports); +tslib_1.__exportStar(__nccwpck_require__(35562), exports); +tslib_1.__exportStar(__nccwpck_require__(52586), exports); +tslib_1.__exportStar(__nccwpck_require__(28133), exports); +tslib_1.__exportStar(__nccwpck_require__(47773), exports); +tslib_1.__exportStar(__nccwpck_require__(14661), exports); +tslib_1.__exportStar(__nccwpck_require__(25357), exports); +tslib_1.__exportStar(__nccwpck_require__(15064), exports); +tslib_1.__exportStar(__nccwpck_require__(63462), exports); +tslib_1.__exportStar(__nccwpck_require__(56241), exports); +tslib_1.__exportStar(__nccwpck_require__(46524), exports); +tslib_1.__exportStar(__nccwpck_require__(89855), exports); +tslib_1.__exportStar(__nccwpck_require__(7109), exports); +tslib_1.__exportStar(__nccwpck_require__(60855), exports); + + +/***/ }), + +/***/ 2081: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 76978: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; + + +/***/ }), + +/***/ 11017: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 48052: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 3060: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 64233: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 35562: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 52586: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 28133: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 47773: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 14661: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 25357: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 15064: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 63462: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); + + +/***/ }), + +/***/ 56241: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 46524: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 89855: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 7109: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 60855: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 55959: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveStsAuthConfig = void 0; +const middleware_signing_1 = __nccwpck_require__(14935); +const resolveStsAuthConfig = (input, { stsClientCtor }) => (0, middleware_signing_1.resolveAwsAuthConfig)({ + ...input, + stsClientCtor, +}); +exports.resolveStsAuthConfig = resolveStsAuthConfig; + + +/***/ }), + +/***/ 84193: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveSigV4AuthConfig = exports.resolveAwsAuthConfig = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const signature_v4_1 = __nccwpck_require__(11528); +const util_middleware_1 = __nccwpck_require__(2390); +const CREDENTIAL_EXPIRE_WINDOW = 300000; +const resolveAwsAuthConfig = (input) => { + const normalizedCreds = input.credentials + ? normalizeCredentialProvider(input.credentials) + : input.credentialDefaultProvider(input); + const { signingEscapePath = true, systemClockOffset = input.systemClockOffset || 0, sha256 } = input; + let signer; + if (input.signer) { + signer = (0, util_middleware_1.normalizeProvider)(input.signer); + } + else if (input.regionInfoProvider) { + signer = () => (0, util_middleware_1.normalizeProvider)(input.region)() + .then(async (region) => [ + (await input.regionInfoProvider(region, { + useFipsEndpoint: await input.useFipsEndpoint(), + useDualstackEndpoint: await input.useDualstackEndpoint(), + })) || {}, + region, + ]) + .then(([regionInfo, region]) => { + const { signingRegion, signingService } = regionInfo; + input.signingRegion = input.signingRegion || signingRegion || region; + input.signingName = input.signingName || signingService || input.serviceId; + const params = { + ...input, + credentials: normalizedCreds, + region: input.signingRegion, + service: input.signingName, + sha256, + uriEscapePath: signingEscapePath, + }; + const SignerCtor = input.signerConstructor || signature_v4_1.SignatureV4; + return new SignerCtor(params); + }); + } + else { + signer = async (authScheme) => { + authScheme = Object.assign({}, { + name: "sigv4", + signingName: input.signingName || input.defaultSigningName, + signingRegion: await (0, util_middleware_1.normalizeProvider)(input.region)(), + properties: {}, + }, authScheme); + const signingRegion = authScheme.signingRegion; + const signingService = authScheme.signingName; + input.signingRegion = input.signingRegion || signingRegion; + input.signingName = input.signingName || signingService || input.serviceId; + const params = { + ...input, + credentials: normalizedCreds, + region: input.signingRegion, + service: input.signingName, + sha256, + uriEscapePath: signingEscapePath, + }; + const SignerCtor = input.signerConstructor || signature_v4_1.SignatureV4; + return new SignerCtor(params); + }; + } + return { + ...input, + systemClockOffset, + signingEscapePath, + credentials: normalizedCreds, + signer, + }; +}; +exports.resolveAwsAuthConfig = resolveAwsAuthConfig; +const resolveSigV4AuthConfig = (input) => { + const normalizedCreds = input.credentials + ? normalizeCredentialProvider(input.credentials) + : input.credentialDefaultProvider(input); + const { signingEscapePath = true, systemClockOffset = input.systemClockOffset || 0, sha256 } = input; + let signer; + if (input.signer) { + signer = (0, util_middleware_1.normalizeProvider)(input.signer); + } + else { + signer = (0, util_middleware_1.normalizeProvider)(new signature_v4_1.SignatureV4({ + credentials: normalizedCreds, + region: input.region, + service: input.signingName, + sha256, + uriEscapePath: signingEscapePath, + })); + } + return { + ...input, + systemClockOffset, + signingEscapePath, + credentials: normalizedCreds, + signer, + }; +}; +exports.resolveSigV4AuthConfig = resolveSigV4AuthConfig; +const normalizeCredentialProvider = (credentials) => { + if (typeof credentials === "function") { + return (0, property_provider_1.memoize)(credentials, (credentials) => credentials.expiration !== undefined && + credentials.expiration.getTime() - Date.now() < CREDENTIAL_EXPIRE_WINDOW, (credentials) => credentials.expiration !== undefined); + } + return (0, util_middleware_1.normalizeProvider)(credentials); +}; + + +/***/ }), + +/***/ 88053: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSigV4AuthPlugin = exports.getAwsAuthPlugin = exports.awsAuthMiddlewareOptions = exports.awsAuthMiddleware = void 0; +const protocol_http_1 = __nccwpck_require__(98467); +const getSkewCorrectedDate_1 = __nccwpck_require__(68253); +const getUpdatedSystemClockOffset_1 = __nccwpck_require__(35863); +const awsAuthMiddleware = (options) => (next, context) => async function (args) { + var _a, _b, _c, _d; + if (!protocol_http_1.HttpRequest.isInstance(args.request)) + return next(args); + const authScheme = (_c = (_b = (_a = context.endpointV2) === null || _a === void 0 ? void 0 : _a.properties) === null || _b === void 0 ? void 0 : _b.authSchemes) === null || _c === void 0 ? void 0 : _c[0]; + const multiRegionOverride = (authScheme === null || authScheme === void 0 ? void 0 : authScheme.name) === "sigv4a" ? (_d = authScheme === null || authScheme === void 0 ? void 0 : authScheme.signingRegionSet) === null || _d === void 0 ? void 0 : _d.join(",") : undefined; + const signer = await options.signer(authScheme); + const output = await next({ + ...args, + request: await signer.sign(args.request, { + signingDate: (0, getSkewCorrectedDate_1.getSkewCorrectedDate)(options.systemClockOffset), + signingRegion: multiRegionOverride || context["signing_region"], + signingService: context["signing_service"], + }), + }).catch((error) => { + var _a; + const serverTime = (_a = error.ServerTime) !== null && _a !== void 0 ? _a : getDateHeader(error.$response); + if (serverTime) { + options.systemClockOffset = (0, getUpdatedSystemClockOffset_1.getUpdatedSystemClockOffset)(serverTime, options.systemClockOffset); + } + throw error; + }); + const dateHeader = getDateHeader(output.response); + if (dateHeader) { + options.systemClockOffset = (0, getUpdatedSystemClockOffset_1.getUpdatedSystemClockOffset)(dateHeader, options.systemClockOffset); + } + return output; +}; +exports.awsAuthMiddleware = awsAuthMiddleware; +const getDateHeader = (response) => { var _a, _b, _c; return protocol_http_1.HttpResponse.isInstance(response) ? (_b = (_a = response.headers) === null || _a === void 0 ? void 0 : _a.date) !== null && _b !== void 0 ? _b : (_c = response.headers) === null || _c === void 0 ? void 0 : _c.Date : undefined; }; +exports.awsAuthMiddlewareOptions = { + name: "awsAuthMiddleware", + tags: ["SIGNATURE", "AWSAUTH"], + relation: "after", + toMiddleware: "retryMiddleware", + override: true, +}; +const getAwsAuthPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo((0, exports.awsAuthMiddleware)(options), exports.awsAuthMiddlewareOptions); + }, +}); +exports.getAwsAuthPlugin = getAwsAuthPlugin; +exports.getSigV4AuthPlugin = exports.getAwsAuthPlugin; + + +/***/ }), + +/***/ 14935: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(84193), exports); +tslib_1.__exportStar(__nccwpck_require__(88053), exports); + + +/***/ }), + +/***/ 68253: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSkewCorrectedDate = void 0; +const getSkewCorrectedDate = (systemClockOffset) => new Date(Date.now() + systemClockOffset); +exports.getSkewCorrectedDate = getSkewCorrectedDate; + + +/***/ }), + +/***/ 35863: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getUpdatedSystemClockOffset = void 0; +const isClockSkewed_1 = __nccwpck_require__(85301); +const getUpdatedSystemClockOffset = (clockTime, currentSystemClockOffset) => { + const clockTimeInMs = Date.parse(clockTime); + if ((0, isClockSkewed_1.isClockSkewed)(clockTimeInMs, currentSystemClockOffset)) { + return clockTimeInMs - Date.now(); + } + return currentSystemClockOffset; +}; +exports.getUpdatedSystemClockOffset = getUpdatedSystemClockOffset; + + +/***/ }), + +/***/ 85301: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isClockSkewed = void 0; +const getSkewCorrectedDate_1 = __nccwpck_require__(68253); +const isClockSkewed = (clockTime, systemClockOffset) => Math.abs((0, getSkewCorrectedDate_1.getSkewCorrectedDate)(systemClockOffset).getTime() - clockTime) >= 300000; +exports.isClockSkewed = isClockSkewed; + + +/***/ }), + +/***/ 86101: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Field = void 0; +const types_1 = __nccwpck_require__(2430); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + add(value) { + this.values.push(value); + } + set(values) { + this.values = values; + } + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; + } +} +exports.Field = Field; + + +/***/ }), + +/***/ 40418: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + getField(name) { + return this.entries[name.toLowerCase()]; + } + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +} +exports.Fields = Fields; + + +/***/ }), + +/***/ 49377: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0; +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; + return { + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + }, + }; +}; +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), + }; +}; +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; + + +/***/ }), + +/***/ 58888: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(49377), exports); + + +/***/ }), + +/***/ 45667: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 37242: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); + } + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; + } +} +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} + + +/***/ }), + +/***/ 95032: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} +exports.HttpResponse = HttpResponse; + + +/***/ }), + +/***/ 98467: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(58888), exports); +tslib_1.__exportStar(__nccwpck_require__(86101), exports); +tslib_1.__exportStar(__nccwpck_require__(40418), exports); +tslib_1.__exportStar(__nccwpck_require__(45667), exports); +tslib_1.__exportStar(__nccwpck_require__(37242), exports); +tslib_1.__exportStar(__nccwpck_require__(95032), exports); +tslib_1.__exportStar(__nccwpck_require__(87689), exports); +tslib_1.__exportStar(__nccwpck_require__(82323), exports); + + +/***/ }), + +/***/ 87689: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; + + +/***/ }), + +/***/ 82323: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 63140: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 68961: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); + + +/***/ }), + +/***/ 27498: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 75793: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 55035: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 50635: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 92803: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 93677: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(92803), exports); +tslib_1.__exportStar(__nccwpck_require__(67454), exports); +tslib_1.__exportStar(__nccwpck_require__(65364), exports); + + +/***/ }), + +/***/ 67454: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 65364: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 49352: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 99089: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 65659: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 87896: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 73697: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 84494: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 73060: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 2309: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(87896), exports); +tslib_1.__exportStar(__nccwpck_require__(73697), exports); +tslib_1.__exportStar(__nccwpck_require__(84494), exports); +tslib_1.__exportStar(__nccwpck_require__(84285), exports); +tslib_1.__exportStar(__nccwpck_require__(73060), exports); + + +/***/ }), + +/***/ 84285: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 97740: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 60162: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); + } + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; +}; +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; + + +/***/ }), + +/***/ 87320: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(60162); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + }; +}; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; +}; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; + + +/***/ }), + +/***/ 9066: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 65509: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(87320), exports); +tslib_1.__exportStar(__nccwpck_require__(9066), exports); +var checksum_1 = __nccwpck_require__(60162); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); + + +/***/ }), + +/***/ 95393: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); + + +/***/ }), + +/***/ 49754: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 62572: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 86902: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(49754), exports); +tslib_1.__exportStar(__nccwpck_require__(62572), exports); + + +/***/ }), + +/***/ 2430: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(63140), exports); +tslib_1.__exportStar(__nccwpck_require__(68961), exports); +tslib_1.__exportStar(__nccwpck_require__(27498), exports); +tslib_1.__exportStar(__nccwpck_require__(75793), exports); +tslib_1.__exportStar(__nccwpck_require__(55035), exports); +tslib_1.__exportStar(__nccwpck_require__(50635), exports); +tslib_1.__exportStar(__nccwpck_require__(93677), exports); +tslib_1.__exportStar(__nccwpck_require__(49352), exports); +tslib_1.__exportStar(__nccwpck_require__(99089), exports); +tslib_1.__exportStar(__nccwpck_require__(65659), exports); +tslib_1.__exportStar(__nccwpck_require__(2309), exports); +tslib_1.__exportStar(__nccwpck_require__(97740), exports); +tslib_1.__exportStar(__nccwpck_require__(65509), exports); +tslib_1.__exportStar(__nccwpck_require__(95393), exports); +tslib_1.__exportStar(__nccwpck_require__(86902), exports); +tslib_1.__exportStar(__nccwpck_require__(30116), exports); +tslib_1.__exportStar(__nccwpck_require__(92627), exports); +tslib_1.__exportStar(__nccwpck_require__(48461), exports); +tslib_1.__exportStar(__nccwpck_require__(78249), exports); +tslib_1.__exportStar(__nccwpck_require__(9616), exports); +tslib_1.__exportStar(__nccwpck_require__(18107), exports); +tslib_1.__exportStar(__nccwpck_require__(22744), exports); +tslib_1.__exportStar(__nccwpck_require__(43865), exports); +tslib_1.__exportStar(__nccwpck_require__(10038), exports); +tslib_1.__exportStar(__nccwpck_require__(68353), exports); +tslib_1.__exportStar(__nccwpck_require__(64337), exports); +tslib_1.__exportStar(__nccwpck_require__(45123), exports); +tslib_1.__exportStar(__nccwpck_require__(13829), exports); +tslib_1.__exportStar(__nccwpck_require__(16274), exports); +tslib_1.__exportStar(__nccwpck_require__(52027), exports); +tslib_1.__exportStar(__nccwpck_require__(73946), exports); +tslib_1.__exportStar(__nccwpck_require__(48366), exports); +tslib_1.__exportStar(__nccwpck_require__(67879), exports); +tslib_1.__exportStar(__nccwpck_require__(20949), exports); + + +/***/ }), + +/***/ 30116: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 92627: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; + + +/***/ }), + +/***/ 48461: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 78249: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 9616: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 18107: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 22744: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 43865: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 10038: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 68353: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 64337: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 45123: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 13829: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 16274: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); + + +/***/ }), + +/***/ 52027: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 73946: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 48366: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 67879: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 20949: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 36546: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveUserAgentConfig = void 0; +function resolveUserAgentConfig(input) { + return { + ...input, + customUserAgent: typeof input.customUserAgent === "string" ? [[input.customUserAgent]] : input.customUserAgent, + }; +} +exports.resolveUserAgentConfig = resolveUserAgentConfig; + + +/***/ }), + +/***/ 28025: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.UA_ESCAPE_CHAR = exports.UA_VALUE_ESCAPE_REGEX = exports.UA_NAME_ESCAPE_REGEX = exports.UA_NAME_SEPARATOR = exports.SPACE = exports.X_AMZ_USER_AGENT = exports.USER_AGENT = void 0; +exports.USER_AGENT = "user-agent"; +exports.X_AMZ_USER_AGENT = "x-amz-user-agent"; +exports.SPACE = " "; +exports.UA_NAME_SEPARATOR = "/"; +exports.UA_NAME_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w]/g; +exports.UA_VALUE_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w\#]/g; +exports.UA_ESCAPE_CHAR = "-"; + + +/***/ }), + +/***/ 64688: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(36546), exports); +tslib_1.__exportStar(__nccwpck_require__(76236), exports); + + +/***/ }), + +/***/ 76236: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getUserAgentPlugin = exports.getUserAgentMiddlewareOptions = exports.userAgentMiddleware = void 0; +const util_endpoints_1 = __nccwpck_require__(13350); +const protocol_http_1 = __nccwpck_require__(7992); +const constants_1 = __nccwpck_require__(28025); +const userAgentMiddleware = (options) => (next, context) => async (args) => { + var _a, _b; + const { request } = args; + if (!protocol_http_1.HttpRequest.isInstance(request)) + return next(args); + const { headers } = request; + const userAgent = ((_a = context === null || context === void 0 ? void 0 : context.userAgent) === null || _a === void 0 ? void 0 : _a.map(escapeUserAgent)) || []; + const defaultUserAgent = (await options.defaultUserAgentProvider()).map(escapeUserAgent); + const customUserAgent = ((_b = options === null || options === void 0 ? void 0 : options.customUserAgent) === null || _b === void 0 ? void 0 : _b.map(escapeUserAgent)) || []; + const prefix = (0, util_endpoints_1.getUserAgentPrefix)(); + const sdkUserAgentValue = (prefix ? [prefix] : []) + .concat([...defaultUserAgent, ...userAgent, ...customUserAgent]) + .join(constants_1.SPACE); + const normalUAValue = [ + ...defaultUserAgent.filter((section) => section.startsWith("aws-sdk-")), + ...customUserAgent, + ].join(constants_1.SPACE); + if (options.runtime !== "browser") { + if (normalUAValue) { + headers[constants_1.X_AMZ_USER_AGENT] = headers[constants_1.X_AMZ_USER_AGENT] + ? `${headers[constants_1.USER_AGENT]} ${normalUAValue}` + : normalUAValue; + } + headers[constants_1.USER_AGENT] = sdkUserAgentValue; + } + else { + headers[constants_1.X_AMZ_USER_AGENT] = sdkUserAgentValue; + } + return next({ + ...args, + request, + }); +}; +exports.userAgentMiddleware = userAgentMiddleware; +const escapeUserAgent = (userAgentPair) => { + var _a; + const name = userAgentPair[0] + .split(constants_1.UA_NAME_SEPARATOR) + .map((part) => part.replace(constants_1.UA_NAME_ESCAPE_REGEX, constants_1.UA_ESCAPE_CHAR)) + .join(constants_1.UA_NAME_SEPARATOR); + const version = (_a = userAgentPair[1]) === null || _a === void 0 ? void 0 : _a.replace(constants_1.UA_VALUE_ESCAPE_REGEX, constants_1.UA_ESCAPE_CHAR); + const prefixSeparatorIndex = name.indexOf(constants_1.UA_NAME_SEPARATOR); + const prefix = name.substring(0, prefixSeparatorIndex); + let uaName = name.substring(prefixSeparatorIndex + 1); + if (prefix === "api") { + uaName = uaName.toLowerCase(); + } + return [prefix, uaName, version] + .filter((item) => item && item.length > 0) + .reduce((acc, item, index) => { + switch (index) { + case 0: + return item; + case 1: + return `${acc}/${item}`; + default: + return `${acc}#${item}`; + } + }, ""); +}; +exports.getUserAgentMiddlewareOptions = { + name: "getUserAgentMiddleware", + step: "build", + priority: "low", + tags: ["SET_USER_AGENT", "USER_AGENT"], + override: true, +}; +const getUserAgentPlugin = (config) => ({ + applyToStack: (clientStack) => { + clientStack.add((0, exports.userAgentMiddleware)(config), exports.getUserAgentMiddlewareOptions); + }, +}); +exports.getUserAgentPlugin = getUserAgentPlugin; + + +/***/ }), + +/***/ 56874: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Field = void 0; +const types_1 = __nccwpck_require__(47866); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + add(value) { + this.values.push(value); + } + set(values) { + this.values = values; + } + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; + } +} +exports.Field = Field; + + +/***/ }), + +/***/ 95723: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + getField(name) { + return this.entries[name.toLowerCase()]; + } + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +} +exports.Fields = Fields; + + +/***/ }), + +/***/ 41127: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0; +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; + return { + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + }, + }; +}; +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), + }; +}; +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; + + +/***/ }), + +/***/ 49088: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(41127), exports); + + +/***/ }), + +/***/ 26998: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 72718: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); + } + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; + } +} +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} + + +/***/ }), + +/***/ 94110: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} +exports.HttpResponse = HttpResponse; + + +/***/ }), + +/***/ 7992: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(49088), exports); +tslib_1.__exportStar(__nccwpck_require__(56874), exports); +tslib_1.__exportStar(__nccwpck_require__(95723), exports); +tslib_1.__exportStar(__nccwpck_require__(26998), exports); +tslib_1.__exportStar(__nccwpck_require__(72718), exports); +tslib_1.__exportStar(__nccwpck_require__(94110), exports); +tslib_1.__exportStar(__nccwpck_require__(21082), exports); +tslib_1.__exportStar(__nccwpck_require__(75922), exports); + + +/***/ }), + +/***/ 21082: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; + + +/***/ }), + +/***/ 75922: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 59172: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 29271: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); + + +/***/ }), + +/***/ 53689: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 51199: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 24838: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 76179: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 55846: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 75194: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(55846), exports); +tslib_1.__exportStar(__nccwpck_require__(48650), exports); +tslib_1.__exportStar(__nccwpck_require__(18749), exports); + + +/***/ }), + +/***/ 48650: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 18749: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 1703: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 19956: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 27588: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 89740: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 82358: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 43105: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 17402: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 4266: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(89740), exports); +tslib_1.__exportStar(__nccwpck_require__(82358), exports); +tslib_1.__exportStar(__nccwpck_require__(43105), exports); +tslib_1.__exportStar(__nccwpck_require__(10882), exports); +tslib_1.__exportStar(__nccwpck_require__(17402), exports); + + +/***/ }), + +/***/ 10882: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 52725: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 30452: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); + } + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; +}; +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; + + +/***/ }), + +/***/ 96167: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(30452); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + }; +}; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; +}; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; + + +/***/ }), + +/***/ 6257: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 66139: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(96167), exports); +tslib_1.__exportStar(__nccwpck_require__(6257), exports); +var checksum_1 = __nccwpck_require__(30452); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); + + +/***/ }), + +/***/ 12694: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); + + +/***/ }), + +/***/ 26363: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 99614: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 44894: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(26363), exports); +tslib_1.__exportStar(__nccwpck_require__(99614), exports); + + +/***/ }), + +/***/ 47866: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(59172), exports); +tslib_1.__exportStar(__nccwpck_require__(29271), exports); +tslib_1.__exportStar(__nccwpck_require__(53689), exports); +tslib_1.__exportStar(__nccwpck_require__(51199), exports); +tslib_1.__exportStar(__nccwpck_require__(24838), exports); +tslib_1.__exportStar(__nccwpck_require__(76179), exports); +tslib_1.__exportStar(__nccwpck_require__(75194), exports); +tslib_1.__exportStar(__nccwpck_require__(1703), exports); +tslib_1.__exportStar(__nccwpck_require__(19956), exports); +tslib_1.__exportStar(__nccwpck_require__(27588), exports); +tslib_1.__exportStar(__nccwpck_require__(4266), exports); +tslib_1.__exportStar(__nccwpck_require__(52725), exports); +tslib_1.__exportStar(__nccwpck_require__(66139), exports); +tslib_1.__exportStar(__nccwpck_require__(12694), exports); +tslib_1.__exportStar(__nccwpck_require__(44894), exports); +tslib_1.__exportStar(__nccwpck_require__(99257), exports); +tslib_1.__exportStar(__nccwpck_require__(54343), exports); +tslib_1.__exportStar(__nccwpck_require__(83992), exports); +tslib_1.__exportStar(__nccwpck_require__(26539), exports); +tslib_1.__exportStar(__nccwpck_require__(39211), exports); +tslib_1.__exportStar(__nccwpck_require__(53294), exports); +tslib_1.__exportStar(__nccwpck_require__(83731), exports); +tslib_1.__exportStar(__nccwpck_require__(30257), exports); +tslib_1.__exportStar(__nccwpck_require__(98399), exports); +tslib_1.__exportStar(__nccwpck_require__(4498), exports); +tslib_1.__exportStar(__nccwpck_require__(12320), exports); +tslib_1.__exportStar(__nccwpck_require__(94694), exports); +tslib_1.__exportStar(__nccwpck_require__(30124), exports); +tslib_1.__exportStar(__nccwpck_require__(72388), exports); +tslib_1.__exportStar(__nccwpck_require__(35892), exports); +tslib_1.__exportStar(__nccwpck_require__(18356), exports); +tslib_1.__exportStar(__nccwpck_require__(42014), exports); +tslib_1.__exportStar(__nccwpck_require__(1691), exports); +tslib_1.__exportStar(__nccwpck_require__(9402), exports); + + +/***/ }), + +/***/ 99257: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 54343: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; + + +/***/ }), + +/***/ 83992: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 26539: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 39211: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 53294: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 83731: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 30257: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 98399: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 4498: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 12320: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 94694: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 30124: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 72388: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); + + +/***/ }), + +/***/ 35892: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 18356: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 42014: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 1691: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 9402: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 68805: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(20258), exports); + + +/***/ }), + +/***/ 60079: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveAwsRegionExtensionConfiguration = exports.getAwsRegionExtensionConfiguration = void 0; +const getAwsRegionExtensionConfiguration = (runtimeConfig) => { + let runtimeConfigRegion = async () => { + if (runtimeConfig.region === undefined) { + throw new Error("Region is missing from runtimeConfig"); + } + const region = runtimeConfig.region; + if (typeof region === "string") { + return region; + } + return region(); + }; + return { + setRegion(region) { + runtimeConfigRegion = region; + }, + region() { + return runtimeConfigRegion; + }, + }; +}; +exports.getAwsRegionExtensionConfiguration = getAwsRegionExtensionConfiguration; +const resolveAwsRegionExtensionConfiguration = (awsRegionExtensionConfiguration) => { + return { + region: awsRegionExtensionConfiguration.region(), + }; +}; +exports.resolveAwsRegionExtensionConfiguration = resolveAwsRegionExtensionConfiguration; + + +/***/ }), + +/***/ 18156: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(60079), exports); +tslib_1.__exportStar(__nccwpck_require__(17177), exports); + + +/***/ }), + +/***/ 60123: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODE_REGION_CONFIG_FILE_OPTIONS = exports.NODE_REGION_CONFIG_OPTIONS = exports.REGION_INI_NAME = exports.REGION_ENV_NAME = void 0; +exports.REGION_ENV_NAME = "AWS_REGION"; +exports.REGION_INI_NAME = "region"; +exports.NODE_REGION_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[exports.REGION_ENV_NAME], + configFileSelector: (profile) => profile[exports.REGION_INI_NAME], + default: () => { + throw new Error("Region is missing"); + }, +}; +exports.NODE_REGION_CONFIG_FILE_OPTIONS = { + preferredFile: "credentials", +}; + + +/***/ }), + +/***/ 30048: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRealRegion = void 0; +const isFipsRegion_1 = __nccwpck_require__(37257); +const getRealRegion = (region) => (0, isFipsRegion_1.isFipsRegion)(region) + ? ["fips-aws-global", "aws-fips"].includes(region) + ? "us-east-1" + : region.replace(/fips-(dkr-|prod-)?|-fips/, "") + : region; +exports.getRealRegion = getRealRegion; + + +/***/ }), + +/***/ 17177: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(60123), exports); +tslib_1.__exportStar(__nccwpck_require__(46187), exports); + + +/***/ }), + +/***/ 37257: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isFipsRegion = void 0; +const isFipsRegion = (region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")); +exports.isFipsRegion = isFipsRegion; + + +/***/ }), + +/***/ 46187: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveRegionConfig = void 0; +const getRealRegion_1 = __nccwpck_require__(30048); +const isFipsRegion_1 = __nccwpck_require__(37257); +const resolveRegionConfig = (input) => { + const { region, useFipsEndpoint } = input; + if (!region) { + throw new Error("Region is missing"); + } + return { + ...input, + region: async () => { + if (typeof region === "string") { + return (0, getRealRegion_1.getRealRegion)(region); + } + const providedRegion = await region(); + return (0, getRealRegion_1.getRealRegion)(providedRegion); + }, + useFipsEndpoint: async () => { + const providedRegion = typeof region === "string" ? region : await region(); + if ((0, isFipsRegion_1.isFipsRegion)(providedRegion)) { + return true; + } + return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); + }, + }; +}; +exports.resolveRegionConfig = resolveRegionConfig; + + +/***/ }), + +/***/ 52664: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.UnsupportedGrantTypeException = exports.UnauthorizedClientException = exports.SlowDownException = exports.SSOOIDCClient = exports.InvalidScopeException = exports.InvalidRequestException = exports.InvalidClientException = exports.InternalServerException = exports.ExpiredTokenException = exports.CreateTokenCommand = exports.AuthorizationPendingException = exports.AccessDeniedException = void 0; +const middleware_host_header_1 = __nccwpck_require__(22545); +const middleware_logger_1 = __nccwpck_require__(20014); +const middleware_recursion_detection_1 = __nccwpck_require__(85525); +const middleware_user_agent_1 = __nccwpck_require__(64688); +const config_resolver_1 = __nccwpck_require__(53098); +const middleware_content_length_1 = __nccwpck_require__(82800); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_retry_1 = __nccwpck_require__(96039); +const smithy_client_1 = __nccwpck_require__(63570); +var resolveClientEndpointParameters = (options) => { + var _a, _b; + return { + ...options, + useDualstackEndpoint: (_a = options.useDualstackEndpoint) !== null && _a !== void 0 ? _a : false, + useFipsEndpoint: (_b = options.useFipsEndpoint) !== null && _b !== void 0 ? _b : false, + defaultSigningName: "awsssooidc" + }; +}; +var package_default = { version: "3.387.0" }; +const util_user_agent_node_1 = __nccwpck_require__(98095); +const config_resolver_2 = __nccwpck_require__(53098); +const hash_node_1 = __nccwpck_require__(3081); +const middleware_retry_2 = __nccwpck_require__(96039); +const node_config_provider_1 = __nccwpck_require__(33461); +const node_http_handler_1 = __nccwpck_require__(17150); +const util_body_length_node_1 = __nccwpck_require__(68075); +const util_retry_1 = __nccwpck_require__(84902); +const smithy_client_2 = __nccwpck_require__(63570); +const url_parser_1 = __nccwpck_require__(14681); +const util_base64_1 = __nccwpck_require__(75600); +const util_utf8_1 = __nccwpck_require__(41895); +const util_endpoints_1 = __nccwpck_require__(13350); +var p = "required"; +var q = "fn"; +var r = "argv"; +var s = "ref"; +var a = "PartitionResult"; +var b = "tree"; +var c = "error"; +var d = "endpoint"; +var e = { [p]: false, "type": "String" }; +var f = { [p]: true, "default": false, "type": "Boolean" }; +var g = { [s]: "Endpoint" }; +var h = { [q]: "booleanEquals", [r]: [{ [s]: "UseFIPS" }, true] }; +var i = { [q]: "booleanEquals", [r]: [{ [s]: "UseDualStack" }, true] }; +var j = {}; +var k = { [q]: "booleanEquals", [r]: [true, { [q]: "getAttr", [r]: [{ [s]: a }, "supportsFIPS"] }] }; +var l = { [q]: "booleanEquals", [r]: [true, { [q]: "getAttr", [r]: [{ [s]: a }, "supportsDualStack"] }] }; +var m = [g]; +var n = [h]; +var o = [i]; +var _data = { version: "1.0", parameters: { Region: e, UseDualStack: f, UseFIPS: f, Endpoint: e }, rules: [{ conditions: [{ [q]: "aws.partition", [r]: [{ [s]: "Region" }], assign: a }], type: b, rules: [{ conditions: [{ [q]: "isSet", [r]: m }, { [q]: "parseURL", [r]: m, assign: "url" }], type: b, rules: [{ conditions: n, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: c }, { type: b, rules: [{ conditions: o, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: c }, { endpoint: { url: g, properties: j, headers: j }, type: d }] }] }, { conditions: [h, i], type: b, rules: [{ conditions: [k, l], type: b, rules: [{ endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: j, headers: j }, type: d }] }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: c }] }, { conditions: n, type: b, rules: [{ conditions: [k], type: b, rules: [{ type: b, rules: [{ endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dnsSuffix}", properties: j, headers: j }, type: d }] }] }, { error: "FIPS is enabled but this partition does not support FIPS", type: c }] }, { conditions: o, type: b, rules: [{ conditions: [l], type: b, rules: [{ endpoint: { url: "https://oidc.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: j, headers: j }, type: d }] }, { error: "DualStack is enabled but this partition does not support DualStack", type: c }] }, { endpoint: { url: "https://oidc.{Region}.{PartitionResult#dnsSuffix}", properties: j, headers: j }, type: d }] }] }; +var ruleSet = _data; +var defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_1.resolveEndpoint)(ruleSet, { + endpointParams, + logger: context.logger + }); +}; +var getRuntimeConfig = (config) => { + var _a, _b, _c, _d, _e, _f, _g, _h, _j; + return ({ + apiVersion: "2019-06-10", + base64Decoder: (_a = config === null || config === void 0 ? void 0 : config.base64Decoder) !== null && _a !== void 0 ? _a : util_base64_1.fromBase64, + base64Encoder: (_b = config === null || config === void 0 ? void 0 : config.base64Encoder) !== null && _b !== void 0 ? _b : util_base64_1.toBase64, + disableHostPrefix: (_c = config === null || config === void 0 ? void 0 : config.disableHostPrefix) !== null && _c !== void 0 ? _c : false, + endpointProvider: (_d = config === null || config === void 0 ? void 0 : config.endpointProvider) !== null && _d !== void 0 ? _d : defaultEndpointResolver, + logger: (_e = config === null || config === void 0 ? void 0 : config.logger) !== null && _e !== void 0 ? _e : new smithy_client_2.NoOpLogger(), + serviceId: (_f = config === null || config === void 0 ? void 0 : config.serviceId) !== null && _f !== void 0 ? _f : "SSO OIDC", + urlParser: (_g = config === null || config === void 0 ? void 0 : config.urlParser) !== null && _g !== void 0 ? _g : url_parser_1.parseUrl, + utf8Decoder: (_h = config === null || config === void 0 ? void 0 : config.utf8Decoder) !== null && _h !== void 0 ? _h : util_utf8_1.fromUtf8, + utf8Encoder: (_j = config === null || config === void 0 ? void 0 : config.utf8Encoder) !== null && _j !== void 0 ? _j : util_utf8_1.toUtf8 + }); +}; +const smithy_client_3 = __nccwpck_require__(63570); +const util_defaults_mode_node_1 = __nccwpck_require__(72429); +const smithy_client_4 = __nccwpck_require__(63570); +var getRuntimeConfig2 = (config) => { + var _a, _b, _c, _d, _e, _f, _g, _h, _j, _k; + (0, smithy_client_4.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_3.loadConfigsForDefaultMode); + const clientSharedValues = getRuntimeConfig(config); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + bodyLengthChecker: (_a = config === null || config === void 0 ? void 0 : config.bodyLengthChecker) !== null && _a !== void 0 ? _a : util_body_length_node_1.calculateBodyLength, + defaultUserAgentProvider: (_b = config === null || config === void 0 ? void 0 : config.defaultUserAgentProvider) !== null && _b !== void 0 ? _b : (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_default.version }), + maxAttempts: (_c = config === null || config === void 0 ? void 0 : config.maxAttempts) !== null && _c !== void 0 ? _c : (0, node_config_provider_1.loadConfig)(middleware_retry_2.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: (_d = config === null || config === void 0 ? void 0 : config.region) !== null && _d !== void 0 ? _d : (0, node_config_provider_1.loadConfig)(config_resolver_2.NODE_REGION_CONFIG_OPTIONS, config_resolver_2.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: (_e = config === null || config === void 0 ? void 0 : config.requestHandler) !== null && _e !== void 0 ? _e : new node_http_handler_1.NodeHttpHandler(defaultConfigProvider), + retryMode: (_f = config === null || config === void 0 ? void 0 : config.retryMode) !== null && _f !== void 0 ? _f : (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_2.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE + }), + sha256: (_g = config === null || config === void 0 ? void 0 : config.sha256) !== null && _g !== void 0 ? _g : hash_node_1.Hash.bind(null, "sha256"), + streamCollector: (_h = config === null || config === void 0 ? void 0 : config.streamCollector) !== null && _h !== void 0 ? _h : node_http_handler_1.streamCollector, + useDualstackEndpoint: (_j = config === null || config === void 0 ? void 0 : config.useDualstackEndpoint) !== null && _j !== void 0 ? _j : (0, node_config_provider_1.loadConfig)(config_resolver_2.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: (_k = config === null || config === void 0 ? void 0 : config.useFipsEndpoint) !== null && _k !== void 0 ? _k : (0, node_config_provider_1.loadConfig)(config_resolver_2.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS) + }; +}; +var SSOOIDCClient = class extends smithy_client_1.Client { + constructor(...[configuration]) { + const _config_0 = getRuntimeConfig2(configuration || {}); + const _config_1 = resolveClientEndpointParameters(_config_0); + const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1); + const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2); + const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3); + const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_5); + super(_config_6); + this.config = _config_6; + this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); + } + destroy() { + super.destroy(); + } +}; +exports.SSOOIDCClient = SSOOIDCClient; +const smithy_client_5 = __nccwpck_require__(63570); +const middleware_endpoint_2 = __nccwpck_require__(82918); +const middleware_serde_1 = __nccwpck_require__(81238); +const smithy_client_6 = __nccwpck_require__(63570); +const protocol_http_1 = __nccwpck_require__(22916); +const smithy_client_7 = __nccwpck_require__(63570); +const smithy_client_8 = __nccwpck_require__(63570); +var SSOOIDCServiceException = class _SSOOIDCServiceException extends smithy_client_8.ServiceException { + constructor(options) { + super(options); + Object.setPrototypeOf(this, _SSOOIDCServiceException.prototype); + } +}; +var AccessDeniedException = class _AccessDeniedException extends SSOOIDCServiceException { + constructor(opts) { + super({ + name: "AccessDeniedException", + $fault: "client", + ...opts + }); + this.name = "AccessDeniedException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _AccessDeniedException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +exports.AccessDeniedException = AccessDeniedException; +var AuthorizationPendingException = class _AuthorizationPendingException extends SSOOIDCServiceException { + constructor(opts) { + super({ + name: "AuthorizationPendingException", + $fault: "client", + ...opts + }); + this.name = "AuthorizationPendingException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _AuthorizationPendingException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +exports.AuthorizationPendingException = AuthorizationPendingException; +var ExpiredTokenException = class _ExpiredTokenException extends SSOOIDCServiceException { + constructor(opts) { + super({ + name: "ExpiredTokenException", + $fault: "client", + ...opts + }); + this.name = "ExpiredTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ExpiredTokenException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +exports.ExpiredTokenException = ExpiredTokenException; +var InternalServerException = class _InternalServerException extends SSOOIDCServiceException { + constructor(opts) { + super({ + name: "InternalServerException", + $fault: "server", + ...opts + }); + this.name = "InternalServerException"; + this.$fault = "server"; + Object.setPrototypeOf(this, _InternalServerException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +exports.InternalServerException = InternalServerException; +var InvalidClientException = class _InvalidClientException extends SSOOIDCServiceException { + constructor(opts) { + super({ + name: "InvalidClientException", + $fault: "client", + ...opts + }); + this.name = "InvalidClientException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidClientException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +exports.InvalidClientException = InvalidClientException; +var InvalidGrantException = class _InvalidGrantException extends SSOOIDCServiceException { + constructor(opts) { + super({ + name: "InvalidGrantException", + $fault: "client", + ...opts + }); + this.name = "InvalidGrantException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidGrantException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +var InvalidRequestException = class _InvalidRequestException extends SSOOIDCServiceException { + constructor(opts) { + super({ + name: "InvalidRequestException", + $fault: "client", + ...opts + }); + this.name = "InvalidRequestException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidRequestException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +exports.InvalidRequestException = InvalidRequestException; +var InvalidScopeException = class _InvalidScopeException extends SSOOIDCServiceException { + constructor(opts) { + super({ + name: "InvalidScopeException", + $fault: "client", + ...opts + }); + this.name = "InvalidScopeException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidScopeException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +exports.InvalidScopeException = InvalidScopeException; +var SlowDownException = class _SlowDownException extends SSOOIDCServiceException { + constructor(opts) { + super({ + name: "SlowDownException", + $fault: "client", + ...opts + }); + this.name = "SlowDownException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _SlowDownException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +exports.SlowDownException = SlowDownException; +var UnauthorizedClientException = class _UnauthorizedClientException extends SSOOIDCServiceException { + constructor(opts) { + super({ + name: "UnauthorizedClientException", + $fault: "client", + ...opts + }); + this.name = "UnauthorizedClientException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _UnauthorizedClientException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +exports.UnauthorizedClientException = UnauthorizedClientException; +var UnsupportedGrantTypeException = class _UnsupportedGrantTypeException extends SSOOIDCServiceException { + constructor(opts) { + super({ + name: "UnsupportedGrantTypeException", + $fault: "client", + ...opts + }); + this.name = "UnsupportedGrantTypeException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _UnsupportedGrantTypeException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +exports.UnsupportedGrantTypeException = UnsupportedGrantTypeException; +var InvalidClientMetadataException = class _InvalidClientMetadataException extends SSOOIDCServiceException { + constructor(opts) { + super({ + name: "InvalidClientMetadataException", + $fault: "client", + ...opts + }); + this.name = "InvalidClientMetadataException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidClientMetadataException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +var se_CreateTokenCommand = async (input, context) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const headers = { + "content-type": "application/json" + }; + const resolvedPath = `${(basePath === null || basePath === void 0 ? void 0 : basePath.endsWith("/")) ? basePath.slice(0, -1) : basePath || ""}/token`; + let body; + body = JSON.stringify((0, smithy_client_7.take)(input, { + clientId: [], + clientSecret: [], + code: [], + deviceCode: [], + grantType: [], + redirectUri: [], + refreshToken: [], + scope: (_) => (0, smithy_client_7._json)(_) + })); + return new protocol_http_1.HttpRequest({ + protocol, + hostname, + port, + method: "POST", + headers, + path: resolvedPath, + body + }); +}; +var se_RegisterClientCommand = async (input, context) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const headers = { + "content-type": "application/json" + }; + const resolvedPath = `${(basePath === null || basePath === void 0 ? void 0 : basePath.endsWith("/")) ? basePath.slice(0, -1) : basePath || ""}/client/register`; + let body; + body = JSON.stringify((0, smithy_client_7.take)(input, { + clientName: [], + clientType: [], + scopes: (_) => (0, smithy_client_7._json)(_) + })); + return new protocol_http_1.HttpRequest({ + protocol, + hostname, + port, + method: "POST", + headers, + path: resolvedPath, + body + }); +}; +var se_StartDeviceAuthorizationCommand = async (input, context) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const headers = { + "content-type": "application/json" + }; + const resolvedPath = `${(basePath === null || basePath === void 0 ? void 0 : basePath.endsWith("/")) ? basePath.slice(0, -1) : basePath || ""}/device_authorization`; + let body; + body = JSON.stringify((0, smithy_client_7.take)(input, { + clientId: [], + clientSecret: [], + startUrl: [] + })); + return new protocol_http_1.HttpRequest({ + protocol, + hostname, + port, + method: "POST", + headers, + path: resolvedPath, + body + }); +}; +var de_CreateTokenCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CreateTokenCommandError(output, context); + } + const contents = (0, smithy_client_7.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, smithy_client_7.expectNonNull)((0, smithy_client_7.expectObject)(await parseBody(output.body, context)), "body"); + const doc = (0, smithy_client_7.take)(data, { + accessToken: smithy_client_7.expectString, + expiresIn: smithy_client_7.expectInt32, + idToken: smithy_client_7.expectString, + refreshToken: smithy_client_7.expectString, + tokenType: smithy_client_7.expectString + }); + Object.assign(contents, doc); + return contents; +}; +var de_CreateTokenCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context) + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "AccessDeniedException": + case "com.amazonaws.ssooidc#AccessDeniedException": + throw await de_AccessDeniedExceptionRes(parsedOutput, context); + case "AuthorizationPendingException": + case "com.amazonaws.ssooidc#AuthorizationPendingException": + throw await de_AuthorizationPendingExceptionRes(parsedOutput, context); + case "ExpiredTokenException": + case "com.amazonaws.ssooidc#ExpiredTokenException": + throw await de_ExpiredTokenExceptionRes(parsedOutput, context); + case "InternalServerException": + case "com.amazonaws.ssooidc#InternalServerException": + throw await de_InternalServerExceptionRes(parsedOutput, context); + case "InvalidClientException": + case "com.amazonaws.ssooidc#InvalidClientException": + throw await de_InvalidClientExceptionRes(parsedOutput, context); + case "InvalidGrantException": + case "com.amazonaws.ssooidc#InvalidGrantException": + throw await de_InvalidGrantExceptionRes(parsedOutput, context); + case "InvalidRequestException": + case "com.amazonaws.ssooidc#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput, context); + case "InvalidScopeException": + case "com.amazonaws.ssooidc#InvalidScopeException": + throw await de_InvalidScopeExceptionRes(parsedOutput, context); + case "SlowDownException": + case "com.amazonaws.ssooidc#SlowDownException": + throw await de_SlowDownExceptionRes(parsedOutput, context); + case "UnauthorizedClientException": + case "com.amazonaws.ssooidc#UnauthorizedClientException": + throw await de_UnauthorizedClientExceptionRes(parsedOutput, context); + case "UnsupportedGrantTypeException": + case "com.amazonaws.ssooidc#UnsupportedGrantTypeException": + throw await de_UnsupportedGrantTypeExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode + }); + } +}; +var de_RegisterClientCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_RegisterClientCommandError(output, context); + } + const contents = (0, smithy_client_7.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, smithy_client_7.expectNonNull)((0, smithy_client_7.expectObject)(await parseBody(output.body, context)), "body"); + const doc = (0, smithy_client_7.take)(data, { + authorizationEndpoint: smithy_client_7.expectString, + clientId: smithy_client_7.expectString, + clientIdIssuedAt: smithy_client_7.expectLong, + clientSecret: smithy_client_7.expectString, + clientSecretExpiresAt: smithy_client_7.expectLong, + tokenEndpoint: smithy_client_7.expectString + }); + Object.assign(contents, doc); + return contents; +}; +var de_RegisterClientCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context) + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InternalServerException": + case "com.amazonaws.ssooidc#InternalServerException": + throw await de_InternalServerExceptionRes(parsedOutput, context); + case "InvalidClientMetadataException": + case "com.amazonaws.ssooidc#InvalidClientMetadataException": + throw await de_InvalidClientMetadataExceptionRes(parsedOutput, context); + case "InvalidRequestException": + case "com.amazonaws.ssooidc#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput, context); + case "InvalidScopeException": + case "com.amazonaws.ssooidc#InvalidScopeException": + throw await de_InvalidScopeExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode + }); + } +}; +var de_StartDeviceAuthorizationCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_StartDeviceAuthorizationCommandError(output, context); + } + const contents = (0, smithy_client_7.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, smithy_client_7.expectNonNull)((0, smithy_client_7.expectObject)(await parseBody(output.body, context)), "body"); + const doc = (0, smithy_client_7.take)(data, { + deviceCode: smithy_client_7.expectString, + expiresIn: smithy_client_7.expectInt32, + interval: smithy_client_7.expectInt32, + userCode: smithy_client_7.expectString, + verificationUri: smithy_client_7.expectString, + verificationUriComplete: smithy_client_7.expectString + }); + Object.assign(contents, doc); + return contents; +}; +var de_StartDeviceAuthorizationCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context) + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InternalServerException": + case "com.amazonaws.ssooidc#InternalServerException": + throw await de_InternalServerExceptionRes(parsedOutput, context); + case "InvalidClientException": + case "com.amazonaws.ssooidc#InvalidClientException": + throw await de_InvalidClientExceptionRes(parsedOutput, context); + case "InvalidRequestException": + case "com.amazonaws.ssooidc#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput, context); + case "SlowDownException": + case "com.amazonaws.ssooidc#SlowDownException": + throw await de_SlowDownExceptionRes(parsedOutput, context); + case "UnauthorizedClientException": + case "com.amazonaws.ssooidc#UnauthorizedClientException": + throw await de_UnauthorizedClientExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode + }); + } +}; +var throwDefaultError = (0, smithy_client_7.withBaseException)(SSOOIDCServiceException); +var de_AccessDeniedExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_7.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_7.take)(data, { + error: smithy_client_7.expectString, + error_description: smithy_client_7.expectString + }); + Object.assign(contents, doc); + const exception = new AccessDeniedException({ $metadata: deserializeMetadata(parsedOutput), - ...deserialized, + ...contents }); - return (0, smithy_client_1.decorateServiceException)(exception, body); + return (0, smithy_client_7.decorateServiceException)(exception, parsedOutput.body); }; -const de_UnsupportedImageTypeExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.UnsupportedImageTypeException({ +var de_AuthorizationPendingExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_7.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_7.take)(data, { + error: smithy_client_7.expectString, + error_description: smithy_client_7.expectString + }); + Object.assign(contents, doc); + const exception = new AuthorizationPendingException({ $metadata: deserializeMetadata(parsedOutput), - ...deserialized, + ...contents }); - return (0, smithy_client_1.decorateServiceException)(exception, body); + return (0, smithy_client_7.decorateServiceException)(exception, parsedOutput.body); }; -const de_UnsupportedUpstreamRegistryExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.UnsupportedUpstreamRegistryException({ +var de_ExpiredTokenExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_7.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_7.take)(data, { + error: smithy_client_7.expectString, + error_description: smithy_client_7.expectString + }); + Object.assign(contents, doc); + const exception = new ExpiredTokenException({ $metadata: deserializeMetadata(parsedOutput), - ...deserialized, + ...contents }); - return (0, smithy_client_1.decorateServiceException)(exception, body); + return (0, smithy_client_7.decorateServiceException)(exception, parsedOutput.body); }; -const de_UploadNotFoundExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.UploadNotFoundException({ +var de_InternalServerExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_7.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_7.take)(data, { + error: smithy_client_7.expectString, + error_description: smithy_client_7.expectString + }); + Object.assign(contents, doc); + const exception = new InternalServerException({ $metadata: deserializeMetadata(parsedOutput), - ...deserialized, + ...contents }); - return (0, smithy_client_1.decorateServiceException)(exception, body); + return (0, smithy_client_7.decorateServiceException)(exception, parsedOutput.body); }; -const de_ValidationExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = (0, smithy_client_1._json)(body); - const exception = new models_0_1.ValidationException({ +var de_InvalidClientExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_7.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_7.take)(data, { + error: smithy_client_7.expectString, + error_description: smithy_client_7.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidClientException({ $metadata: deserializeMetadata(parsedOutput), - ...deserialized, + ...contents }); - return (0, smithy_client_1.decorateServiceException)(exception, body); + return (0, smithy_client_7.decorateServiceException)(exception, parsedOutput.body); }; -const se_UploadLayerPartRequest = (input, context) => { - return (0, smithy_client_1.take)(input, { - layerPartBlob: context.base64Encoder, - partFirstByte: [], - partLastByte: [], - registryId: [], - repositoryName: [], - uploadId: [], +var de_InvalidClientMetadataExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_7.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_7.take)(data, { + error: smithy_client_7.expectString, + error_description: smithy_client_7.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidClientMetadataException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents }); + return (0, smithy_client_7.decorateServiceException)(exception, parsedOutput.body); }; -const de_AuthorizationData = (output, context) => { - return (0, smithy_client_1.take)(output, { - authorizationToken: smithy_client_1.expectString, - expiresAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - proxyEndpoint: smithy_client_1.expectString, +var de_InvalidGrantExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_7.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_7.take)(data, { + error: smithy_client_7.expectString, + error_description: smithy_client_7.expectString }); + Object.assign(contents, doc); + const exception = new InvalidGrantException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, smithy_client_7.decorateServiceException)(exception, parsedOutput.body); }; -const de_AuthorizationDataList = (output, context) => { - const retVal = (output || []) - .filter((e) => e != null) - .map((entry) => { - return de_AuthorizationData(entry, context); +var de_InvalidRequestExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_7.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_7.take)(data, { + error: smithy_client_7.expectString, + error_description: smithy_client_7.expectString }); - return retVal; + Object.assign(contents, doc); + const exception = new InvalidRequestException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, smithy_client_7.decorateServiceException)(exception, parsedOutput.body); }; -const de_AwsEcrContainerImageDetails = (output, context) => { - return (0, smithy_client_1.take)(output, { - architecture: smithy_client_1.expectString, - author: smithy_client_1.expectString, - imageHash: smithy_client_1.expectString, - imageTags: smithy_client_1._json, - platform: smithy_client_1.expectString, - pushedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - registry: smithy_client_1.expectString, - repositoryName: smithy_client_1.expectString, +var de_InvalidScopeExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_7.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_7.take)(data, { + error: smithy_client_7.expectString, + error_description: smithy_client_7.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidScopeException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, smithy_client_7.decorateServiceException)(exception, parsedOutput.body); +}; +var de_SlowDownExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_7.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_7.take)(data, { + error: smithy_client_7.expectString, + error_description: smithy_client_7.expectString + }); + Object.assign(contents, doc); + const exception = new SlowDownException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, smithy_client_7.decorateServiceException)(exception, parsedOutput.body); +}; +var de_UnauthorizedClientExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_7.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_7.take)(data, { + error: smithy_client_7.expectString, + error_description: smithy_client_7.expectString }); + Object.assign(contents, doc); + const exception = new UnauthorizedClientException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, smithy_client_7.decorateServiceException)(exception, parsedOutput.body); +}; +var de_UnsupportedGrantTypeExceptionRes = async (parsedOutput, context) => { + const contents = (0, smithy_client_7.map)({}); + const data = parsedOutput.body; + const doc = (0, smithy_client_7.take)(data, { + error: smithy_client_7.expectString, + error_description: smithy_client_7.expectString + }); + Object.assign(contents, doc); + const exception = new UnsupportedGrantTypeException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, smithy_client_7.decorateServiceException)(exception, parsedOutput.body); +}; +var deserializeMetadata = (output) => { + var _a, _b; + return ({ + httpStatusCode: output.statusCode, + requestId: (_b = (_a = output.headers["x-amzn-requestid"]) !== null && _a !== void 0 ? _a : output.headers["x-amzn-request-id"]) !== null && _b !== void 0 ? _b : output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] + }); +}; +var collectBodyString = (streamBody, context) => (0, smithy_client_7.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)); +var parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + return JSON.parse(encoded); + } + return {}; +}); +var parseErrorBody = async (errorBody, context) => { + var _a; + const value = await parseBody(errorBody, context); + value.message = (_a = value.message) !== null && _a !== void 0 ? _a : value.Message; + return value; +}; +var loadRestJsonErrorCode = (output, data) => { + const findKey = (object, key) => Object.keys(object).find((k2) => k2.toLowerCase() === key.toLowerCase()); + const sanitizeErrorCode = (rawValue) => { + let cleanValue = rawValue; + if (typeof cleanValue === "number") { + cleanValue = cleanValue.toString(); + } + if (cleanValue.indexOf(",") >= 0) { + cleanValue = cleanValue.split(",")[0]; + } + if (cleanValue.indexOf(":") >= 0) { + cleanValue = cleanValue.split(":")[0]; + } + if (cleanValue.indexOf("#") >= 0) { + cleanValue = cleanValue.split("#")[1]; + } + return cleanValue; + }; + const headerKey = findKey(output.headers, "x-amzn-errortype"); + if (headerKey !== void 0) { + return sanitizeErrorCode(output.headers[headerKey]); + } + if (data.code !== void 0) { + return sanitizeErrorCode(data.code); + } + if (data["__type"] !== void 0) { + return sanitizeErrorCode(data["__type"]); + } +}; +var CreateTokenCommand = class _CreateTokenCommand extends smithy_client_6.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_2.getEndpointPlugin)(configuration, _CreateTokenCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "SSOOIDCClient"; + const commandName = "CreateTokenCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _ + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return se_CreateTokenCommand(input, context); + } + deserialize(output, context) { + return de_CreateTokenCommand(output, context); + } +}; +exports.CreateTokenCommand = CreateTokenCommand; +const middleware_endpoint_3 = __nccwpck_require__(82918); +const middleware_serde_2 = __nccwpck_require__(81238); +const smithy_client_9 = __nccwpck_require__(63570); +var RegisterClientCommand = class _RegisterClientCommand extends smithy_client_9.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_2.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_3.getEndpointPlugin)(configuration, _RegisterClientCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "SSOOIDCClient"; + const commandName = "RegisterClientCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _ + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return se_RegisterClientCommand(input, context); + } + deserialize(output, context) { + return de_RegisterClientCommand(output, context); + } +}; +const middleware_endpoint_4 = __nccwpck_require__(82918); +const middleware_serde_3 = __nccwpck_require__(81238); +const smithy_client_10 = __nccwpck_require__(63570); +var StartDeviceAuthorizationCommand = class _StartDeviceAuthorizationCommand extends smithy_client_10.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_3.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_4.getEndpointPlugin)(configuration, _StartDeviceAuthorizationCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "SSOOIDCClient"; + const commandName = "StartDeviceAuthorizationCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: (_) => _, + outputFilterSensitiveLog: (_) => _ + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return se_StartDeviceAuthorizationCommand(input, context); + } + deserialize(output, context) { + return de_StartDeviceAuthorizationCommand(output, context); + } +}; +var commands = { + CreateTokenCommand, + RegisterClientCommand, + StartDeviceAuthorizationCommand +}; +var SSOOIDC = class extends SSOOIDCClient { +}; +(0, smithy_client_5.createAggregatedClient)(commands, SSOOIDC); + + +/***/ }), + +/***/ 92242: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.REFRESH_MESSAGE = exports.EXPIRE_WINDOW_MS = void 0; +exports.EXPIRE_WINDOW_MS = 5 * 60 * 1000; +exports.REFRESH_MESSAGE = `To refresh this SSO session run 'aws sso login' with the corresponding profile.`; + + +/***/ }), + +/***/ 85125: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromSso = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const shared_ini_file_loader_1 = __nccwpck_require__(43507); +const constants_1 = __nccwpck_require__(92242); +const getNewSsoOidcToken_1 = __nccwpck_require__(93601); +const validateTokenExpiry_1 = __nccwpck_require__(28418); +const validateTokenKey_1 = __nccwpck_require__(2488); +const writeSSOTokenToFile_1 = __nccwpck_require__(48552); +const lastRefreshAttemptTime = new Date(0); +const fromSso = (init = {}) => async () => { + const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init); + const profileName = (0, shared_ini_file_loader_1.getProfileName)(init); + const profile = profiles[profileName]; + if (!profile) { + throw new property_provider_1.TokenProviderError(`Profile '${profileName}' could not be found in shared credentials file.`, false); + } + else if (!profile["sso_session"]) { + throw new property_provider_1.TokenProviderError(`Profile '${profileName}' is missing required property 'sso_session'.`); + } + const ssoSessionName = profile["sso_session"]; + const ssoSessions = await (0, shared_ini_file_loader_1.loadSsoSessionData)(init); + const ssoSession = ssoSessions[ssoSessionName]; + if (!ssoSession) { + throw new property_provider_1.TokenProviderError(`Sso session '${ssoSessionName}' could not be found in shared credentials file.`, false); + } + for (const ssoSessionRequiredKey of ["sso_start_url", "sso_region"]) { + if (!ssoSession[ssoSessionRequiredKey]) { + throw new property_provider_1.TokenProviderError(`Sso session '${ssoSessionName}' is missing required property '${ssoSessionRequiredKey}'.`, false); + } + } + const ssoStartUrl = ssoSession["sso_start_url"]; + const ssoRegion = ssoSession["sso_region"]; + let ssoToken; + try { + ssoToken = await (0, shared_ini_file_loader_1.getSSOTokenFromFile)(ssoSessionName); + } + catch (e) { + throw new property_provider_1.TokenProviderError(`The SSO session token associated with profile=${profileName} was not found or is invalid. ${constants_1.REFRESH_MESSAGE}`, false); + } + (0, validateTokenKey_1.validateTokenKey)("accessToken", ssoToken.accessToken); + (0, validateTokenKey_1.validateTokenKey)("expiresAt", ssoToken.expiresAt); + const { accessToken, expiresAt } = ssoToken; + const existingToken = { token: accessToken, expiration: new Date(expiresAt) }; + if (existingToken.expiration.getTime() - Date.now() > constants_1.EXPIRE_WINDOW_MS) { + return existingToken; + } + if (Date.now() - lastRefreshAttemptTime.getTime() < 30 * 1000) { + (0, validateTokenExpiry_1.validateTokenExpiry)(existingToken); + return existingToken; + } + (0, validateTokenKey_1.validateTokenKey)("clientId", ssoToken.clientId, true); + (0, validateTokenKey_1.validateTokenKey)("clientSecret", ssoToken.clientSecret, true); + (0, validateTokenKey_1.validateTokenKey)("refreshToken", ssoToken.refreshToken, true); + try { + lastRefreshAttemptTime.setTime(Date.now()); + const newSsoOidcToken = await (0, getNewSsoOidcToken_1.getNewSsoOidcToken)(ssoToken, ssoRegion); + (0, validateTokenKey_1.validateTokenKey)("accessToken", newSsoOidcToken.accessToken); + (0, validateTokenKey_1.validateTokenKey)("expiresIn", newSsoOidcToken.expiresIn); + const newTokenExpiration = new Date(Date.now() + newSsoOidcToken.expiresIn * 1000); + try { + await (0, writeSSOTokenToFile_1.writeSSOTokenToFile)(ssoSessionName, { + ...ssoToken, + accessToken: newSsoOidcToken.accessToken, + expiresAt: newTokenExpiration.toISOString(), + refreshToken: newSsoOidcToken.refreshToken, + }); + } + catch (error) { + } + return { + token: newSsoOidcToken.accessToken, + expiration: newTokenExpiration, + }; + } + catch (error) { + (0, validateTokenExpiry_1.validateTokenExpiry)(existingToken); + return existingToken; + } +}; +exports.fromSso = fromSso; + + +/***/ }), + +/***/ 63258: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromStatic = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const fromStatic = ({ token }) => async () => { + if (!token || !token.token) { + throw new property_provider_1.TokenProviderError(`Please pass a valid token to fromStatic`, false); + } + return token; +}; +exports.fromStatic = fromStatic; + + +/***/ }), + +/***/ 93601: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getNewSsoOidcToken = void 0; +const client_sso_oidc_node_1 = __nccwpck_require__(52664); +const getSsoOidcClient_1 = __nccwpck_require__(99775); +const getNewSsoOidcToken = (ssoToken, ssoRegion) => { + const ssoOidcClient = (0, getSsoOidcClient_1.getSsoOidcClient)(ssoRegion); + return ssoOidcClient.send(new client_sso_oidc_node_1.CreateTokenCommand({ + clientId: ssoToken.clientId, + clientSecret: ssoToken.clientSecret, + refreshToken: ssoToken.refreshToken, + grantType: "refresh_token", + })); +}; +exports.getNewSsoOidcToken = getNewSsoOidcToken; + + +/***/ }), + +/***/ 99775: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSsoOidcClient = void 0; +const client_sso_oidc_node_1 = __nccwpck_require__(52664); +const ssoOidcClientsHash = {}; +const getSsoOidcClient = (ssoRegion) => { + if (ssoOidcClientsHash[ssoRegion]) { + return ssoOidcClientsHash[ssoRegion]; + } + const ssoOidcClient = new client_sso_oidc_node_1.SSOOIDCClient({ region: ssoRegion }); + ssoOidcClientsHash[ssoRegion] = ssoOidcClient; + return ssoOidcClient; +}; +exports.getSsoOidcClient = getSsoOidcClient; + + +/***/ }), + +/***/ 52843: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(52664), exports); +tslib_1.__exportStar(__nccwpck_require__(85125), exports); +tslib_1.__exportStar(__nccwpck_require__(63258), exports); +tslib_1.__exportStar(__nccwpck_require__(70195), exports); + + +/***/ }), + +/***/ 70195: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.nodeProvider = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const fromSso_1 = __nccwpck_require__(85125); +const nodeProvider = (init = {}) => (0, property_provider_1.memoize)((0, property_provider_1.chain)((0, fromSso_1.fromSso)(init), async () => { + throw new property_provider_1.TokenProviderError("Could not load token from any providers", false); +}), (token) => token.expiration !== undefined && token.expiration.getTime() - Date.now() < 300000, (token) => token.expiration !== undefined); +exports.nodeProvider = nodeProvider; + + +/***/ }), + +/***/ 28418: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.validateTokenExpiry = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const constants_1 = __nccwpck_require__(92242); +const validateTokenExpiry = (token) => { + if (token.expiration && token.expiration.getTime() < Date.now()) { + throw new property_provider_1.TokenProviderError(`Token is expired. ${constants_1.REFRESH_MESSAGE}`, false); + } +}; +exports.validateTokenExpiry = validateTokenExpiry; + + +/***/ }), + +/***/ 2488: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.validateTokenKey = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const constants_1 = __nccwpck_require__(92242); +const validateTokenKey = (key, value, forRefresh = false) => { + if (typeof value === "undefined") { + throw new property_provider_1.TokenProviderError(`Value not present for '${key}' in SSO Token${forRefresh ? ". Cannot refresh" : ""}. ${constants_1.REFRESH_MESSAGE}`, false); + } }; -const de_CreatePullThroughCacheRuleResponse = (output, context) => { - return (0, smithy_client_1.take)(output, { - createdAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - ecrRepositoryPrefix: smithy_client_1.expectString, - registryId: smithy_client_1.expectString, - upstreamRegistryUrl: smithy_client_1.expectString, - }); +exports.validateTokenKey = validateTokenKey; + + +/***/ }), + +/***/ 48552: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.writeSSOTokenToFile = void 0; +const shared_ini_file_loader_1 = __nccwpck_require__(43507); +const fs_1 = __nccwpck_require__(57147); +const { writeFile } = fs_1.promises; +const writeSSOTokenToFile = (id, ssoToken) => { + const tokenFilepath = (0, shared_ini_file_loader_1.getSSOTokenFilepath)(id); + const tokenString = JSON.stringify(ssoToken, null, 2); + return writeFile(tokenFilepath, tokenString); }; -const de_CreateRepositoryResponse = (output, context) => { - return (0, smithy_client_1.take)(output, { - repository: (_) => de_Repository(_, context), - }); +exports.writeSSOTokenToFile = writeSSOTokenToFile; + + +/***/ }), + +/***/ 10653: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODEJS_TIMEOUT_ERROR_CODES = void 0; +exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + + +/***/ }), + +/***/ 28778: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getTransformedHeaders = void 0; +const getTransformedHeaders = (headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; + } + return transformedHeaders; }; -const de_CvssScore = (output, context) => { - return (0, smithy_client_1.take)(output, { - baseScore: smithy_client_1.limitedParseDouble, - scoringVector: smithy_client_1.expectString, - source: smithy_client_1.expectString, - version: smithy_client_1.expectString, +exports.getTransformedHeaders = getTransformedHeaders; + + +/***/ }), + +/***/ 17150: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(77768), exports); +tslib_1.__exportStar(__nccwpck_require__(22256), exports); +tslib_1.__exportStar(__nccwpck_require__(49481), exports); + + +/***/ }), + +/***/ 77768: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttpHandler = exports.DEFAULT_REQUEST_TIMEOUT = void 0; +const protocol_http_1 = __nccwpck_require__(22916); +const querystring_builder_1 = __nccwpck_require__(87983); +const http_1 = __nccwpck_require__(13685); +const https_1 = __nccwpck_require__(95687); +const constants_1 = __nccwpck_require__(10653); +const get_transformed_headers_1 = __nccwpck_require__(28778); +const set_connection_timeout_1 = __nccwpck_require__(14070); +const set_socket_keep_alive_1 = __nccwpck_require__(79401); +const set_socket_timeout_1 = __nccwpck_require__(56588); +const write_request_body_1 = __nccwpck_require__(60643); +exports.DEFAULT_REQUEST_TIMEOUT = 0; +class NodeHttpHandler { + constructor(options) { + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }) + .catch(reject); + } + else { + resolve(this.resolveDefaultConfig(options)); + } + }); + } + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + requestTimeout: requestTimeout !== null && requestTimeout !== void 0 ? requestTimeout : socketTimeout, + httpAgent: httpAgent || new http_1.Agent({ keepAlive, maxSockets }), + httpsAgent: httpsAgent || new https_1.Agent({ keepAlive, maxSockets }), + }; + } + destroy() { + var _a, _b, _c, _d; + (_b = (_a = this.config) === null || _a === void 0 ? void 0 : _a.httpAgent) === null || _b === void 0 ? void 0 : _b.destroy(); + (_d = (_c = this.config) === null || _c === void 0 ? void 0 : _c.httpsAgent) === null || _d === void 0 ? void 0 : _d.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + return new Promise((_resolve, _reject) => { + var _a, _b; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const queryString = (0, querystring_builder_1.buildQueryString)(request.query || {}); + let auth = undefined; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}`; + } + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const nodeHttpsOptions = { + headers: request.headers, + host: request.hostname, + method: request.method, + path, + port: request.port, + agent: isSSL ? this.config.httpsAgent : this.config.httpAgent, + auth, + }; + const requestFunc = isSSL ? https_1.request : http_1.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(res.headers), + body: res, + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } + else { + reject(err); + } + }); + (0, set_connection_timeout_1.setConnectionTimeout)(req, reject, this.config.connectionTimeout); + (0, set_socket_timeout_1.setSocketTimeout)(req, reject, this.config.requestTimeout); + if (abortSignal) { + abortSignal.onabort = () => { + req.abort(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }; + } + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + (0, set_socket_keep_alive_1.setSocketKeepAlive)(req, { + keepAlive: httpAgent.keepAlive, + keepAliveMsecs: httpAgent.keepAliveMsecs, + }); + } + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, this.config.requestTimeout).catch(_reject); + }); + } + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); + } + httpHandlerConfigs() { + var _a; + return (_a = this.config) !== null && _a !== void 0 ? _a : {}; + } +} +exports.NodeHttpHandler = NodeHttpHandler; + + +/***/ }), + +/***/ 29584: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2ConnectionManager = void 0; +const tslib_1 = __nccwpck_require__(4351); +const http2_1 = tslib_1.__importDefault(__nccwpck_require__(85158)); +const node_http2_connection_pool_1 = __nccwpck_require__(36070); +class NodeHttp2ConnectionManager { + constructor(config) { + this.sessionCache = new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); + } + } + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; + } + } + const session = http2_1.default.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error("Fail to set maxConcurrentStreams to " + + this.config.maxConcurrency + + "when creating new session for " + + requestContext.destination.toString()); + } + }); + } + session.unref(); + const destroySessionCb = () => { + session.destroy(); + this.deleteSession(url, session); + }; + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new node_http2_connection_pool_1.NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; + } + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; + } + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); + } + release(requestContext, session) { + var _a; + const cacheKey = this.getUrlString(requestContext); + (_a = this.sessionCache.get(cacheKey)) === null || _a === void 0 ? void 0 : _a.offerLast(session); + } + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); + } + this.sessionCache.delete(key); + } + } + setMaxConcurrentStreams(maxConcurrentStreams) { + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); + } + this.config.maxConcurrency = maxConcurrentStreams; + } + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; + } + getUrlString(request) { + return request.destination.toString(); + } +} +exports.NodeHttp2ConnectionManager = NodeHttp2ConnectionManager; + + +/***/ }), + +/***/ 36070: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2ConnectionPool = void 0; +class NodeHttp2ConnectionPool { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions !== null && sessions !== void 0 ? sessions : []; + } + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); + } + } + offerLast(session) { + this.sessions.push(session); + } + contains(session) { + return this.sessions.includes(session); + } + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); + } + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); + } + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } + } + } + } +} +exports.NodeHttp2ConnectionPool = NodeHttp2ConnectionPool; + + +/***/ }), + +/***/ 22256: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2Handler = void 0; +const protocol_http_1 = __nccwpck_require__(22916); +const querystring_builder_1 = __nccwpck_require__(87983); +const http2_1 = __nccwpck_require__(85158); +const get_transformed_headers_1 = __nccwpck_require__(28778); +const node_http2_connection_manager_1 = __nccwpck_require__(29584); +const write_request_body_1 = __nccwpck_require__(60643); +class NodeHttp2Handler { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new node_http2_connection_manager_1.NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((opts) => { + resolve(opts || {}); + }) + .catch(reject); + } + else { + resolve(options || {}); + } + }); + } + destroy() { + this.connectionManager.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } + } + const { requestTimeout, disableConcurrentStreams } = this.config; + return new Promise((_resolve, _reject) => { + var _a, _b, _c; + let fulfilled = false; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request; + let auth = ""; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: (_c = this.config) === null || _c === void 0 ? void 0 : _c.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false, + }); + const rejectWithDestroy = (err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + reject(err); + }; + const queryString = (0, querystring_builder_1.buildQueryString)(query || {}); + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const req = session.request({ + ...request.headers, + [http2_1.constants.HTTP2_HEADER_PATH]: path, + [http2_1.constants.HTTP2_HEADER_METHOD]: method, + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(headers), + body: req, + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (requestTimeout) { + req.setTimeout(requestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + abortSignal.onabort = () => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }; + } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy(new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`)); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, requestTimeout); + }); + } + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); + } + httpHandlerConfigs() { + var _a; + return (_a = this.config) !== null && _a !== void 0 ? _a : {}; + } + destroySession(session) { + if (!session.destroyed) { + session.destroy(); + } + } +} +exports.NodeHttp2Handler = NodeHttp2Handler; + + +/***/ }), + +/***/ 14070: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setConnectionTimeout = void 0; +const setConnectionTimeout = (request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return; + } + const timeoutId = setTimeout(() => { + request.destroy(); + reject(Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError", + })); + }, timeoutInMs); + request.on("socket", (socket) => { + if (socket.connecting) { + socket.on("connect", () => { + clearTimeout(timeoutId); + }); + } + else { + clearTimeout(timeoutId); + } }); }; -const de_CvssScoreDetails = (output, context) => { - return (0, smithy_client_1.take)(output, { - adjustments: smithy_client_1._json, - score: smithy_client_1.limitedParseDouble, - scoreSource: smithy_client_1.expectString, - scoringVector: smithy_client_1.expectString, - version: smithy_client_1.expectString, +exports.setConnectionTimeout = setConnectionTimeout; + + +/***/ }), + +/***/ 79401: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setSocketKeepAlive = void 0; +const setSocketKeepAlive = (request, { keepAlive, keepAliveMsecs }) => { + if (keepAlive !== true) { + return; + } + request.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); }); }; -const de_CvssScoreList = (output, context) => { - const retVal = (output || []) - .filter((e) => e != null) - .map((entry) => { - return de_CvssScore(entry, context); +exports.setSocketKeepAlive = setSocketKeepAlive; + + +/***/ }), + +/***/ 56588: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setSocketTimeout = void 0; +const setSocketTimeout = (request, reject, timeoutInMs = 0) => { + request.setTimeout(timeoutInMs, () => { + request.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); }); - return retVal; }; -const de_DeleteLifecyclePolicyResponse = (output, context) => { - return (0, smithy_client_1.take)(output, { - lastEvaluatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - lifecyclePolicyText: smithy_client_1.expectString, - registryId: smithy_client_1.expectString, - repositoryName: smithy_client_1.expectString, +exports.setSocketTimeout = setSocketTimeout; + + +/***/ }), + +/***/ 17745: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Collector = void 0; +const stream_1 = __nccwpck_require__(12781); +class Collector extends stream_1.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; + } + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); + } +} +exports.Collector = Collector; + + +/***/ }), + +/***/ 49481: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.streamCollector = void 0; +const collector_1 = __nccwpck_require__(17745); +const streamCollector = (stream) => new Promise((resolve, reject) => { + const collector = new collector_1.Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); }); -}; -const de_DeletePullThroughCacheRuleResponse = (output, context) => { - return (0, smithy_client_1.take)(output, { - createdAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - ecrRepositoryPrefix: smithy_client_1.expectString, - registryId: smithy_client_1.expectString, - upstreamRegistryUrl: smithy_client_1.expectString, + collector.on("error", reject); + collector.on("finish", function () { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); }); +}); +exports.streamCollector = streamCollector; + + +/***/ }), + +/***/ 60643: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.writeRequestBody = void 0; +const stream_1 = __nccwpck_require__(12781); +const MIN_WAIT_TIME = 1000; +async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { + var _a; + const headers = (_a = request.headers) !== null && _a !== void 0 ? _a : {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let hasError = false; + if (expect === "100-continue") { + await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + clearTimeout(timeoutId); + resolve(); + }); + httpRequest.on("error", () => { + hasError = true; + clearTimeout(timeoutId); + resolve(); + }); + }), + ]); + } + if (!hasError) { + writeBody(httpRequest, request.body); + } +} +exports.writeRequestBody = writeRequestBody; +function writeBody(httpRequest, body) { + if (body instanceof stream_1.Readable) { + body.pipe(httpRequest); + } + else if (body) { + httpRequest.end(Buffer.from(body)); + } + else { + httpRequest.end(); + } +} + + +/***/ }), + +/***/ 97519: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Field = void 0; +const types_1 = __nccwpck_require__(55961); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + add(value) { + this.values.push(value); + } + set(values) { + this.values = values; + } + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; + } +} +exports.Field = Field; + + +/***/ }), + +/***/ 8296: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + getField(name) { + return this.entries[name.toLowerCase()]; + } + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +} +exports.Fields = Fields; + + +/***/ }), + +/***/ 71355: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0; +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; + return { + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + }, + }; }; -const de_DeleteRepositoryResponse = (output, context) => { - return (0, smithy_client_1.take)(output, { - repository: (_) => de_Repository(_, context), - }); +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), + }; }; -const de_DescribeImageScanFindingsResponse = (output, context) => { - return (0, smithy_client_1.take)(output, { - imageId: smithy_client_1._json, - imageScanFindings: (_) => de_ImageScanFindings(_, context), - imageScanStatus: smithy_client_1._json, - nextToken: smithy_client_1.expectString, - registryId: smithy_client_1.expectString, - repositoryName: smithy_client_1.expectString, - }); +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; + + +/***/ }), + +/***/ 62240: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(71355), exports); + + +/***/ }), + +/***/ 71011: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 36744: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); + } + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; + } +} +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} + + +/***/ }), + +/***/ 11128: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} +exports.HttpResponse = HttpResponse; + + +/***/ }), + +/***/ 22916: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(62240), exports); +tslib_1.__exportStar(__nccwpck_require__(97519), exports); +tslib_1.__exportStar(__nccwpck_require__(8296), exports); +tslib_1.__exportStar(__nccwpck_require__(71011), exports); +tslib_1.__exportStar(__nccwpck_require__(36744), exports); +tslib_1.__exportStar(__nccwpck_require__(11128), exports); +tslib_1.__exportStar(__nccwpck_require__(23027), exports); +tslib_1.__exportStar(__nccwpck_require__(80354), exports); + + +/***/ }), + +/***/ 23027: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; + + +/***/ }), + +/***/ 80354: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 87983: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.buildQueryString = void 0; +const util_uri_escape_1 = __nccwpck_require__(18802); +function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, util_uri_escape_1.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, util_uri_escape_1.escapeUri)(value[i])}`); + } + } + else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, util_uri_escape_1.escapeUri)(value)}`; + } + parts.push(qsEntry); + } + } + return parts.join("&"); +} +exports.buildQueryString = buildQueryString; + + +/***/ }), + +/***/ 59993: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 47111: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); + + +/***/ }), + +/***/ 86825: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 47409: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 21795: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 52681: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 86638: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 12274: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(86638), exports); +tslib_1.__exportStar(__nccwpck_require__(39534), exports); +tslib_1.__exportStar(__nccwpck_require__(38832), exports); + + +/***/ }), + +/***/ 39534: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 38832: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 55780: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 43170: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 20502: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 60975: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 44216: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 8671: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 85462: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 92762: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(60975), exports); +tslib_1.__exportStar(__nccwpck_require__(44216), exports); +tslib_1.__exportStar(__nccwpck_require__(8671), exports); +tslib_1.__exportStar(__nccwpck_require__(12130), exports); +tslib_1.__exportStar(__nccwpck_require__(85462), exports); + + +/***/ }), + +/***/ 12130: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 28686: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 43283: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); + } + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; }; -const de_DescribeImagesResponse = (output, context) => { - return (0, smithy_client_1.take)(output, { - imageDetails: (_) => de_ImageDetailList(_, context), - nextToken: smithy_client_1.expectString, +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); }); + return runtimeConfig; }; -const de_DescribePullThroughCacheRulesResponse = (output, context) => { - return (0, smithy_client_1.take)(output, { - nextToken: smithy_client_1.expectString, - pullThroughCacheRules: (_) => de_PullThroughCacheRuleList(_, context), - }); +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; + + +/***/ }), + +/***/ 10838: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(43283); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + }; }; -const de_DescribeRepositoriesResponse = (output, context) => { - return (0, smithy_client_1.take)(output, { - nextToken: smithy_client_1.expectString, - repositories: (_) => de_RepositoryList(_, context), - }); +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; }; -const de_EnhancedImageScanFinding = (output, context) => { - return (0, smithy_client_1.take)(output, { - awsAccountId: smithy_client_1.expectString, - description: smithy_client_1.expectString, - findingArn: smithy_client_1.expectString, - firstObservedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - lastObservedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - packageVulnerabilityDetails: (_) => de_PackageVulnerabilityDetails(_, context), - remediation: smithy_client_1._json, - resources: (_) => de_ResourceList(_, context), - score: smithy_client_1.limitedParseDouble, - scoreDetails: (_) => de_ScoreDetails(_, context), - severity: smithy_client_1.expectString, - status: smithy_client_1.expectString, - title: smithy_client_1.expectString, - type: smithy_client_1.expectString, - updatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - }); +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; + + +/***/ }), + +/***/ 97892: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 94993: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(10838), exports); +tslib_1.__exportStar(__nccwpck_require__(97892), exports); +var checksum_1 = __nccwpck_require__(43283); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); + + +/***/ }), + +/***/ 84089: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); + + +/***/ }), + +/***/ 30843: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 40173: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 21997: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(30843), exports); +tslib_1.__exportStar(__nccwpck_require__(40173), exports); + + +/***/ }), + +/***/ 55961: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(59993), exports); +tslib_1.__exportStar(__nccwpck_require__(47111), exports); +tslib_1.__exportStar(__nccwpck_require__(86825), exports); +tslib_1.__exportStar(__nccwpck_require__(47409), exports); +tslib_1.__exportStar(__nccwpck_require__(21795), exports); +tslib_1.__exportStar(__nccwpck_require__(52681), exports); +tslib_1.__exportStar(__nccwpck_require__(12274), exports); +tslib_1.__exportStar(__nccwpck_require__(55780), exports); +tslib_1.__exportStar(__nccwpck_require__(43170), exports); +tslib_1.__exportStar(__nccwpck_require__(20502), exports); +tslib_1.__exportStar(__nccwpck_require__(92762), exports); +tslib_1.__exportStar(__nccwpck_require__(28686), exports); +tslib_1.__exportStar(__nccwpck_require__(94993), exports); +tslib_1.__exportStar(__nccwpck_require__(84089), exports); +tslib_1.__exportStar(__nccwpck_require__(21997), exports); +tslib_1.__exportStar(__nccwpck_require__(27658), exports); +tslib_1.__exportStar(__nccwpck_require__(29966), exports); +tslib_1.__exportStar(__nccwpck_require__(30878), exports); +tslib_1.__exportStar(__nccwpck_require__(41567), exports); +tslib_1.__exportStar(__nccwpck_require__(77181), exports); +tslib_1.__exportStar(__nccwpck_require__(19900), exports); +tslib_1.__exportStar(__nccwpck_require__(70640), exports); +tslib_1.__exportStar(__nccwpck_require__(13136), exports); +tslib_1.__exportStar(__nccwpck_require__(30294), exports); +tslib_1.__exportStar(__nccwpck_require__(78922), exports); +tslib_1.__exportStar(__nccwpck_require__(61220), exports); +tslib_1.__exportStar(__nccwpck_require__(94269), exports); +tslib_1.__exportStar(__nccwpck_require__(33851), exports); +tslib_1.__exportStar(__nccwpck_require__(69224), exports); +tslib_1.__exportStar(__nccwpck_require__(66991), exports); +tslib_1.__exportStar(__nccwpck_require__(47521), exports); +tslib_1.__exportStar(__nccwpck_require__(46606), exports); +tslib_1.__exportStar(__nccwpck_require__(43741), exports); +tslib_1.__exportStar(__nccwpck_require__(35668), exports); + + +/***/ }), + +/***/ 27658: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 29966: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; + + +/***/ }), + +/***/ 30878: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 41567: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 77181: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 19900: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 70640: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 13136: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 30294: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 78922: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 61220: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 94269: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 33851: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 69224: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); + + +/***/ }), + +/***/ 66991: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 47521: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 46606: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 43741: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 35668: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 13834: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.escapeUriPath = void 0; +const escape_uri_1 = __nccwpck_require__(54978); +const escapeUriPath = (uri) => uri.split("/").map(escape_uri_1.escapeUri).join("/"); +exports.escapeUriPath = escapeUriPath; + + +/***/ }), + +/***/ 54978: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.escapeUri = void 0; +const escapeUri = (uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode); +exports.escapeUri = escapeUri; +const hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`; + + +/***/ }), + +/***/ 18802: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(54978), exports); +tslib_1.__exportStar(__nccwpck_require__(13834), exports); + + +/***/ }), + +/***/ 52562: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 26913: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpAuthLocation = void 0; +var types_1 = __nccwpck_require__(36424); +Object.defineProperty(exports, "HttpAuthLocation", ({ enumerable: true, get: function () { return types_1.HttpAuthLocation; } })); + + +/***/ }), + +/***/ 14994: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 65861: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 76527: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 48470: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 28045: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 67736: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 13268: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 90142: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HostAddressType = void 0; +var HostAddressType; +(function (HostAddressType) { + HostAddressType["AAAA"] = "AAAA"; + HostAddressType["A"] = "A"; +})(HostAddressType = exports.HostAddressType || (exports.HostAddressType = {})); + + +/***/ }), + +/***/ 62338: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 99385: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var types_1 = __nccwpck_require__(36424); +Object.defineProperty(exports, "EndpointURLScheme", ({ enumerable: true, get: function () { return types_1.EndpointURLScheme; } })); + + +/***/ }), + +/***/ 37521: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 76244: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 61393: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 51821: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 92635: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 71301: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 21268: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 7192: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 10640: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(51821), exports); +tslib_1.__exportStar(__nccwpck_require__(92635), exports); +tslib_1.__exportStar(__nccwpck_require__(71301), exports); +tslib_1.__exportStar(__nccwpck_require__(21268), exports); +tslib_1.__exportStar(__nccwpck_require__(7192), exports); + + +/***/ }), + +/***/ 89029: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(52562), exports); +tslib_1.__exportStar(__nccwpck_require__(26913), exports); +tslib_1.__exportStar(__nccwpck_require__(14994), exports); +tslib_1.__exportStar(__nccwpck_require__(65861), exports); +tslib_1.__exportStar(__nccwpck_require__(76527), exports); +tslib_1.__exportStar(__nccwpck_require__(48470), exports); +tslib_1.__exportStar(__nccwpck_require__(28045), exports); +tslib_1.__exportStar(__nccwpck_require__(67736), exports); +tslib_1.__exportStar(__nccwpck_require__(13268), exports); +tslib_1.__exportStar(__nccwpck_require__(90142), exports); +tslib_1.__exportStar(__nccwpck_require__(62338), exports); +tslib_1.__exportStar(__nccwpck_require__(99385), exports); +tslib_1.__exportStar(__nccwpck_require__(37521), exports); +tslib_1.__exportStar(__nccwpck_require__(76244), exports); +tslib_1.__exportStar(__nccwpck_require__(61393), exports); +tslib_1.__exportStar(__nccwpck_require__(10640), exports); +tslib_1.__exportStar(__nccwpck_require__(89910), exports); +tslib_1.__exportStar(__nccwpck_require__(36678), exports); +tslib_1.__exportStar(__nccwpck_require__(39931), exports); +tslib_1.__exportStar(__nccwpck_require__(42620), exports); +tslib_1.__exportStar(__nccwpck_require__(89062), exports); +tslib_1.__exportStar(__nccwpck_require__(89546), exports); +tslib_1.__exportStar(__nccwpck_require__(80316), exports); +tslib_1.__exportStar(__nccwpck_require__(57835), exports); +tslib_1.__exportStar(__nccwpck_require__(91678), exports); +tslib_1.__exportStar(__nccwpck_require__(93818), exports); +tslib_1.__exportStar(__nccwpck_require__(51991), exports); +tslib_1.__exportStar(__nccwpck_require__(24296), exports); +tslib_1.__exportStar(__nccwpck_require__(59416), exports); +tslib_1.__exportStar(__nccwpck_require__(92772), exports); +tslib_1.__exportStar(__nccwpck_require__(20134), exports); +tslib_1.__exportStar(__nccwpck_require__(34465), exports); + + +/***/ }), + +/***/ 89910: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 36678: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 39931: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 42620: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 89062: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 89546: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 80316: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 57835: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 91678: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 93818: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 51991: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 24296: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 59416: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var types_1 = __nccwpck_require__(36424); +Object.defineProperty(exports, "RequestHandlerProtocol", ({ enumerable: true, get: function () { return types_1.RequestHandlerProtocol; } })); + + +/***/ }), + +/***/ 92772: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 20134: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 34465: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 49015: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 42268: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); + + +/***/ }), + +/***/ 87049: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 40109: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 24745: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 86373: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 82962: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 39891: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(82962), exports); +tslib_1.__exportStar(__nccwpck_require__(80847), exports); +tslib_1.__exportStar(__nccwpck_require__(31457), exports); + + +/***/ }), + +/***/ 80847: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 31457: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 26450: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 371: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 82836: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 28633: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 12818: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 98737: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 85468: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 48275: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(28633), exports); +tslib_1.__exportStar(__nccwpck_require__(12818), exports); +tslib_1.__exportStar(__nccwpck_require__(98737), exports); +tslib_1.__exportStar(__nccwpck_require__(44093), exports); +tslib_1.__exportStar(__nccwpck_require__(85468), exports); + + +/***/ }), + +/***/ 44093: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 89946: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 96692: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); + } + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; }; -const de_EnhancedImageScanFindingList = (output, context) => { - const retVal = (output || []) - .filter((e) => e != null) - .map((entry) => { - return de_EnhancedImageScanFinding(entry, context); +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); }); - return retVal; + return runtimeConfig; }; -const de_GetAuthorizationTokenResponse = (output, context) => { - return (0, smithy_client_1.take)(output, { - authorizationData: (_) => de_AuthorizationDataList(_, context), - }); +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; + + +/***/ }), + +/***/ 79438: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(96692); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + }; }; -const de_GetLifecyclePolicyPreviewResponse = (output, context) => { - return (0, smithy_client_1.take)(output, { - lifecyclePolicyText: smithy_client_1.expectString, - nextToken: smithy_client_1.expectString, - previewResults: (_) => de_LifecyclePolicyPreviewResultList(_, context), - registryId: smithy_client_1.expectString, - repositoryName: smithy_client_1.expectString, - status: smithy_client_1.expectString, - summary: smithy_client_1._json, - }); +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; }; -const de_GetLifecyclePolicyResponse = (output, context) => { - return (0, smithy_client_1.take)(output, { - lastEvaluatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - lifecyclePolicyText: smithy_client_1.expectString, - registryId: smithy_client_1.expectString, - repositoryName: smithy_client_1.expectString, - }); +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; + + +/***/ }), + +/***/ 79454: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 50617: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(79438), exports); +tslib_1.__exportStar(__nccwpck_require__(79454), exports); +var checksum_1 = __nccwpck_require__(96692); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); + + +/***/ }), + +/***/ 16618: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); + + +/***/ }), + +/***/ 42886: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 21861: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 62426: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(42886), exports); +tslib_1.__exportStar(__nccwpck_require__(21861), exports); + + +/***/ }), + +/***/ 36424: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(49015), exports); +tslib_1.__exportStar(__nccwpck_require__(42268), exports); +tslib_1.__exportStar(__nccwpck_require__(87049), exports); +tslib_1.__exportStar(__nccwpck_require__(40109), exports); +tslib_1.__exportStar(__nccwpck_require__(24745), exports); +tslib_1.__exportStar(__nccwpck_require__(86373), exports); +tslib_1.__exportStar(__nccwpck_require__(39891), exports); +tslib_1.__exportStar(__nccwpck_require__(26450), exports); +tslib_1.__exportStar(__nccwpck_require__(371), exports); +tslib_1.__exportStar(__nccwpck_require__(82836), exports); +tslib_1.__exportStar(__nccwpck_require__(48275), exports); +tslib_1.__exportStar(__nccwpck_require__(89946), exports); +tslib_1.__exportStar(__nccwpck_require__(50617), exports); +tslib_1.__exportStar(__nccwpck_require__(16618), exports); +tslib_1.__exportStar(__nccwpck_require__(62426), exports); +tslib_1.__exportStar(__nccwpck_require__(76543), exports); +tslib_1.__exportStar(__nccwpck_require__(46236), exports); +tslib_1.__exportStar(__nccwpck_require__(16464), exports); +tslib_1.__exportStar(__nccwpck_require__(89055), exports); +tslib_1.__exportStar(__nccwpck_require__(15474), exports); +tslib_1.__exportStar(__nccwpck_require__(44715), exports); +tslib_1.__exportStar(__nccwpck_require__(92701), exports); +tslib_1.__exportStar(__nccwpck_require__(39602), exports); +tslib_1.__exportStar(__nccwpck_require__(59674), exports); +tslib_1.__exportStar(__nccwpck_require__(16546), exports); +tslib_1.__exportStar(__nccwpck_require__(41903), exports); +tslib_1.__exportStar(__nccwpck_require__(25929), exports); +tslib_1.__exportStar(__nccwpck_require__(44744), exports); +tslib_1.__exportStar(__nccwpck_require__(57898), exports); +tslib_1.__exportStar(__nccwpck_require__(26016), exports); +tslib_1.__exportStar(__nccwpck_require__(99459), exports); +tslib_1.__exportStar(__nccwpck_require__(48559), exports); +tslib_1.__exportStar(__nccwpck_require__(65436), exports); +tslib_1.__exportStar(__nccwpck_require__(34231), exports); + + +/***/ }), + +/***/ 76543: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 46236: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; + + +/***/ }), + +/***/ 16464: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 89055: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 15474: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 44715: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 92701: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 39602: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 59674: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 16546: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 41903: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 25929: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 44744: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 57898: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); + + +/***/ }), + +/***/ 26016: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 99459: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 48559: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 65436: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 34231: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 81809: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.debugId = void 0; +exports.debugId = "endpoints"; + + +/***/ }), + +/***/ 27617: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(81809), exports); +tslib_1.__exportStar(__nccwpck_require__(46833), exports); + + +/***/ }), + +/***/ 46833: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toDebugString = void 0; +function toDebugString(input) { + if (typeof input !== "object" || input == null) { + return input; + } + if ("ref" in input) { + return `$${toDebugString(input.ref)}`; + } + if ("fn" in input) { + return `${input.fn}(${(input.argv || []).map(toDebugString).join(", ")})`; + } + return JSON.stringify(input, null, 2); +} +exports.toDebugString = toDebugString; + + +/***/ }), + +/***/ 13350: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(37482), exports); +tslib_1.__exportStar(__nccwpck_require__(73442), exports); +tslib_1.__exportStar(__nccwpck_require__(36563), exports); +tslib_1.__exportStar(__nccwpck_require__(57433), exports); + + +/***/ }), + +/***/ 46835: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(48079), exports); +tslib_1.__exportStar(__nccwpck_require__(34711), exports); +tslib_1.__exportStar(__nccwpck_require__(37482), exports); + + +/***/ }), + +/***/ 48079: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isVirtualHostableS3Bucket = void 0; +const isIpAddress_1 = __nccwpck_require__(73442); +const isValidHostLabel_1 = __nccwpck_require__(57373); +const isVirtualHostableS3Bucket = (value, allowSubDomains = false) => { + if (allowSubDomains) { + for (const label of value.split(".")) { + if (!(0, exports.isVirtualHostableS3Bucket)(label)) { + return false; + } + } + return true; + } + if (!(0, isValidHostLabel_1.isValidHostLabel)(value)) { + return false; + } + if (value.length < 3 || value.length > 63) { + return false; + } + if (value !== value.toLowerCase()) { + return false; + } + if ((0, isIpAddress_1.isIpAddress)(value)) { + return false; + } + return true; }; -const de_ImageDetail = (output, context) => { - return (0, smithy_client_1.take)(output, { - artifactMediaType: smithy_client_1.expectString, - imageDigest: smithy_client_1.expectString, - imageManifestMediaType: smithy_client_1.expectString, - imagePushedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - imageScanFindingsSummary: (_) => de_ImageScanFindingsSummary(_, context), - imageScanStatus: smithy_client_1._json, - imageSizeInBytes: smithy_client_1.expectLong, - imageTags: smithy_client_1._json, - lastRecordedPullTime: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - registryId: smithy_client_1.expectString, - repositoryName: smithy_client_1.expectString, - }); +exports.isVirtualHostableS3Bucket = isVirtualHostableS3Bucket; + + +/***/ }), + +/***/ 34711: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.parseArn = void 0; +const parseArn = (value) => { + const segments = value.split(":"); + if (segments.length < 6) + return null; + const [arn, partition, service, region, accountId, ...resourceId] = segments; + if (arn !== "arn" || partition === "" || service === "" || resourceId[0] === "") + return null; + return { + partition, + service, + region, + accountId, + resourceId: resourceId[0].includes("/") ? resourceId[0].split("/") : resourceId, + }; }; -const de_ImageDetailList = (output, context) => { - const retVal = (output || []) - .filter((e) => e != null) - .map((entry) => { - return de_ImageDetail(entry, context); - }); - return retVal; +exports.parseArn = parseArn; + + +/***/ }), + +/***/ 37482: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getUserAgentPrefix = exports.useDefaultPartitionInfo = exports.setPartitionInfo = exports.partition = void 0; +const tslib_1 = __nccwpck_require__(4351); +const partitions_json_1 = tslib_1.__importDefault(__nccwpck_require__(95367)); +let selectedPartitionsInfo = partitions_json_1.default; +let selectedUserAgentPrefix = ""; +const partition = (value) => { + const { partitions } = selectedPartitionsInfo; + for (const partition of partitions) { + const { regions, outputs } = partition; + for (const [region, regionData] of Object.entries(regions)) { + if (region === value) { + return { + ...outputs, + ...regionData, + }; + } + } + } + for (const partition of partitions) { + const { regionRegex, outputs } = partition; + if (new RegExp(regionRegex).test(value)) { + return { + ...outputs, + }; + } + } + const DEFAULT_PARTITION = partitions.find((partition) => partition.id === "aws"); + if (!DEFAULT_PARTITION) { + throw new Error("Provided region was not found in the partition array or regex," + + " and default partition with id 'aws' doesn't exist."); + } + return { + ...DEFAULT_PARTITION.outputs, + }; }; -const de_ImageScanFindings = (output, context) => { - return (0, smithy_client_1.take)(output, { - enhancedFindings: (_) => de_EnhancedImageScanFindingList(_, context), - findingSeverityCounts: smithy_client_1._json, - findings: smithy_client_1._json, - imageScanCompletedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - vulnerabilitySourceUpdatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - }); +exports.partition = partition; +const setPartitionInfo = (partitionsInfo, userAgentPrefix = "") => { + selectedPartitionsInfo = partitionsInfo; + selectedUserAgentPrefix = userAgentPrefix; }; -const de_ImageScanFindingsSummary = (output, context) => { - return (0, smithy_client_1.take)(output, { - findingSeverityCounts: smithy_client_1._json, - imageScanCompletedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - vulnerabilitySourceUpdatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - }); +exports.setPartitionInfo = setPartitionInfo; +const useDefaultPartitionInfo = () => { + (0, exports.setPartitionInfo)(partitions_json_1.default, ""); }; -const de_LifecyclePolicyPreviewResult = (output, context) => { - return (0, smithy_client_1.take)(output, { - action: smithy_client_1._json, - appliedRulePriority: smithy_client_1.expectInt32, - imageDigest: smithy_client_1.expectString, - imagePushedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - imageTags: smithy_client_1._json, - }); +exports.useDefaultPartitionInfo = useDefaultPartitionInfo; +const getUserAgentPrefix = () => selectedUserAgentPrefix; +exports.getUserAgentPrefix = getUserAgentPrefix; + + +/***/ }), + +/***/ 55370: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.booleanEquals = void 0; +const booleanEquals = (value1, value2) => value1 === value2; +exports.booleanEquals = booleanEquals; + + +/***/ }), + +/***/ 20767: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getAttr = void 0; +const types_1 = __nccwpck_require__(57433); +const getAttrPathList_1 = __nccwpck_require__(81844); +const getAttr = (value, path) => (0, getAttrPathList_1.getAttrPathList)(path).reduce((acc, index) => { + if (typeof acc !== "object") { + throw new types_1.EndpointError(`Index '${index}' in '${path}' not found in '${JSON.stringify(value)}'`); + } + else if (Array.isArray(acc)) { + return acc[parseInt(index)]; + } + return acc[index]; +}, value); +exports.getAttr = getAttr; + + +/***/ }), + +/***/ 81844: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getAttrPathList = void 0; +const types_1 = __nccwpck_require__(57433); +const getAttrPathList = (path) => { + const parts = path.split("."); + const pathList = []; + for (const part of parts) { + const squareBracketIndex = part.indexOf("["); + if (squareBracketIndex !== -1) { + if (part.indexOf("]") !== part.length - 1) { + throw new types_1.EndpointError(`Path: '${path}' does not end with ']'`); + } + const arrayIndex = part.slice(squareBracketIndex + 1, -1); + if (Number.isNaN(parseInt(arrayIndex))) { + throw new types_1.EndpointError(`Invalid array index: '${arrayIndex}' in path: '${path}'`); + } + if (squareBracketIndex !== 0) { + pathList.push(part.slice(0, squareBracketIndex)); + } + pathList.push(arrayIndex); + } + else { + pathList.push(part); + } + } + return pathList; }; -const de_LifecyclePolicyPreviewResultList = (output, context) => { - const retVal = (output || []) - .filter((e) => e != null) - .map((entry) => { - return de_LifecyclePolicyPreviewResult(entry, context); - }); - return retVal; +exports.getAttrPathList = getAttrPathList; + + +/***/ }), + +/***/ 83188: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.aws = void 0; +const tslib_1 = __nccwpck_require__(4351); +exports.aws = tslib_1.__importStar(__nccwpck_require__(46835)); +tslib_1.__exportStar(__nccwpck_require__(55370), exports); +tslib_1.__exportStar(__nccwpck_require__(20767), exports); +tslib_1.__exportStar(__nccwpck_require__(78816), exports); +tslib_1.__exportStar(__nccwpck_require__(57373), exports); +tslib_1.__exportStar(__nccwpck_require__(29692), exports); +tslib_1.__exportStar(__nccwpck_require__(22780), exports); +tslib_1.__exportStar(__nccwpck_require__(55182), exports); +tslib_1.__exportStar(__nccwpck_require__(48305), exports); +tslib_1.__exportStar(__nccwpck_require__(6535), exports); + + +/***/ }), + +/***/ 73442: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isIpAddress = void 0; +const IP_V4_REGEX = new RegExp(`^(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)(?:\\.(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)){3}$`); +const isIpAddress = (value) => IP_V4_REGEX.test(value) || (value.startsWith("[") && value.endsWith("]")); +exports.isIpAddress = isIpAddress; + + +/***/ }), + +/***/ 78816: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isSet = void 0; +const isSet = (value) => value != null; +exports.isSet = isSet; + + +/***/ }), + +/***/ 57373: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostLabel = void 0; +const VALID_HOST_LABEL_REGEX = new RegExp(`^(?!.*-$)(?!-)[a-zA-Z0-9-]{1,63}$`); +const isValidHostLabel = (value, allowSubDomains = false) => { + if (!allowSubDomains) { + return VALID_HOST_LABEL_REGEX.test(value); + } + const labels = value.split("."); + for (const label of labels) { + if (!(0, exports.isValidHostLabel)(label)) { + return false; + } + } + return true; }; -const de_PackageVulnerabilityDetails = (output, context) => { - return (0, smithy_client_1.take)(output, { - cvss: (_) => de_CvssScoreList(_, context), - referenceUrls: smithy_client_1._json, - relatedVulnerabilities: smithy_client_1._json, - source: smithy_client_1.expectString, - sourceUrl: smithy_client_1.expectString, - vendorCreatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - vendorSeverity: smithy_client_1.expectString, - vendorUpdatedAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - vulnerabilityId: smithy_client_1.expectString, - vulnerablePackages: smithy_client_1._json, - }); +exports.isValidHostLabel = isValidHostLabel; + + +/***/ }), + +/***/ 29692: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.not = void 0; +const not = (value) => !value; +exports.not = not; + + +/***/ }), + +/***/ 22780: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.parseURL = void 0; +const types_1 = __nccwpck_require__(89029); +const isIpAddress_1 = __nccwpck_require__(73442); +const DEFAULT_PORTS = { + [types_1.EndpointURLScheme.HTTP]: 80, + [types_1.EndpointURLScheme.HTTPS]: 443, }; -const de_PullThroughCacheRule = (output, context) => { - return (0, smithy_client_1.take)(output, { - createdAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - ecrRepositoryPrefix: smithy_client_1.expectString, - registryId: smithy_client_1.expectString, - upstreamRegistryUrl: smithy_client_1.expectString, - }); +const parseURL = (value) => { + const whatwgURL = (() => { + try { + if (value instanceof URL) { + return value; + } + if (typeof value === "object" && "hostname" in value) { + const { hostname, port, protocol = "", path = "", query = {} } = value; + const url = new URL(`${protocol}//${hostname}${port ? `:${port}` : ""}${path}`); + url.search = Object.entries(query) + .map(([k, v]) => `${k}=${v}`) + .join("&"); + return url; + } + return new URL(value); + } + catch (error) { + return null; + } + })(); + if (!whatwgURL) { + console.error(`Unable to parse ${JSON.stringify(value)} as a whatwg URL.`); + return null; + } + const urlString = whatwgURL.href; + const { host, hostname, pathname, protocol, search } = whatwgURL; + if (search) { + return null; + } + const scheme = protocol.slice(0, -1); + if (!Object.values(types_1.EndpointURLScheme).includes(scheme)) { + return null; + } + const isIp = (0, isIpAddress_1.isIpAddress)(hostname); + const inputContainsDefaultPort = urlString.includes(`${host}:${DEFAULT_PORTS[scheme]}`) || + (typeof value === "string" && value.includes(`${host}:${DEFAULT_PORTS[scheme]}`)); + const authority = `${host}${inputContainsDefaultPort ? `:${DEFAULT_PORTS[scheme]}` : ``}`; + return { + scheme, + authority, + path: pathname, + normalizedPath: pathname.endsWith("/") ? pathname : `${pathname}/`, + isIp, + }; }; -const de_PullThroughCacheRuleList = (output, context) => { - const retVal = (output || []) - .filter((e) => e != null) - .map((entry) => { - return de_PullThroughCacheRule(entry, context); - }); - return retVal; +exports.parseURL = parseURL; + + +/***/ }), + +/***/ 55182: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.stringEquals = void 0; +const stringEquals = (value1, value2) => value1 === value2; +exports.stringEquals = stringEquals; + + +/***/ }), + +/***/ 48305: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.substring = void 0; +const substring = (input, start, stop, reverse) => { + if (start >= stop || input.length < stop) { + return null; + } + if (!reverse) { + return input.substring(start, stop); + } + return input.substring(input.length - stop, input.length - start); }; -const de_Repository = (output, context) => { - return (0, smithy_client_1.take)(output, { - createdAt: (_) => (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseEpochTimestamp)((0, smithy_client_1.expectNumber)(_))), - encryptionConfiguration: smithy_client_1._json, - imageScanningConfiguration: smithy_client_1._json, - imageTagMutability: smithy_client_1.expectString, - registryId: smithy_client_1.expectString, - repositoryArn: smithy_client_1.expectString, - repositoryName: smithy_client_1.expectString, - repositoryUri: smithy_client_1.expectString, - }); +exports.substring = substring; + + +/***/ }), + +/***/ 6535: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.uriEncode = void 0; +const uriEncode = (value) => encodeURIComponent(value).replace(/[!*'()]/g, (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`); +exports.uriEncode = uriEncode; + + +/***/ }), + +/***/ 36563: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveEndpoint = void 0; +const debug_1 = __nccwpck_require__(27617); +const types_1 = __nccwpck_require__(57433); +const utils_1 = __nccwpck_require__(81114); +const resolveEndpoint = (ruleSetObject, options) => { + var _a, _b, _c, _d, _e, _f; + const { endpointParams, logger } = options; + const { parameters, rules } = ruleSetObject; + (_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, `${debug_1.debugId} Initial EndpointParams: ${(0, debug_1.toDebugString)(endpointParams)}`); + const paramsWithDefault = Object.entries(parameters) + .filter(([, v]) => v.default != null) + .map(([k, v]) => [k, v.default]); + if (paramsWithDefault.length > 0) { + for (const [paramKey, paramDefaultValue] of paramsWithDefault) { + endpointParams[paramKey] = (_c = endpointParams[paramKey]) !== null && _c !== void 0 ? _c : paramDefaultValue; + } + } + const requiredParams = Object.entries(parameters) + .filter(([, v]) => v.required) + .map(([k]) => k); + for (const requiredParam of requiredParams) { + if (endpointParams[requiredParam] == null) { + throw new types_1.EndpointError(`Missing required parameter: '${requiredParam}'`); + } + } + const endpoint = (0, utils_1.evaluateRules)(rules, { endpointParams, logger, referenceRecord: {} }); + if ((_d = options.endpointParams) === null || _d === void 0 ? void 0 : _d.Endpoint) { + try { + const givenEndpoint = new URL(options.endpointParams.Endpoint); + const { protocol, port } = givenEndpoint; + endpoint.url.protocol = protocol; + endpoint.url.port = port; + } + catch (e) { + } + } + (_f = (_e = options.logger) === null || _e === void 0 ? void 0 : _e.debug) === null || _f === void 0 ? void 0 : _f.call(_e, `${debug_1.debugId} Resolved endpoint: ${(0, debug_1.toDebugString)(endpoint)}`); + return endpoint; }; -const de_RepositoryList = (output, context) => { - const retVal = (output || []) - .filter((e) => e != null) - .map((entry) => { - return de_Repository(entry, context); - }); - return retVal; +exports.resolveEndpoint = resolveEndpoint; + + +/***/ }), + +/***/ 82605: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointError = void 0; +class EndpointError extends Error { + constructor(message) { + super(message); + this.name = "EndpointError"; + } +} +exports.EndpointError = EndpointError; + + +/***/ }), + +/***/ 21261: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 20312: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 56083: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 21767: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 57433: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(82605), exports); +tslib_1.__exportStar(__nccwpck_require__(21261), exports); +tslib_1.__exportStar(__nccwpck_require__(20312), exports); +tslib_1.__exportStar(__nccwpck_require__(56083), exports); +tslib_1.__exportStar(__nccwpck_require__(21767), exports); +tslib_1.__exportStar(__nccwpck_require__(41811), exports); + + +/***/ }), + +/***/ 41811: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 65075: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.callFunction = void 0; +const tslib_1 = __nccwpck_require__(4351); +const lib = tslib_1.__importStar(__nccwpck_require__(83188)); +const evaluateExpression_1 = __nccwpck_require__(82980); +const callFunction = ({ fn, argv }, options) => { + const evaluatedArgs = argv.map((arg) => ["boolean", "number"].includes(typeof arg) ? arg : (0, evaluateExpression_1.evaluateExpression)(arg, "arg", options)); + return fn.split(".").reduce((acc, key) => acc[key], lib)(...evaluatedArgs); }; -const de_Resource = (output, context) => { - return (0, smithy_client_1.take)(output, { - details: (_) => de_ResourceDetails(_, context), - id: smithy_client_1.expectString, - tags: smithy_client_1._json, - type: smithy_client_1.expectString, - }); +exports.callFunction = callFunction; + + +/***/ }), + +/***/ 77851: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateCondition = void 0; +const debug_1 = __nccwpck_require__(27617); +const types_1 = __nccwpck_require__(57433); +const callFunction_1 = __nccwpck_require__(65075); +const evaluateCondition = ({ assign, ...fnArgs }, options) => { + var _a, _b; + if (assign && assign in options.referenceRecord) { + throw new types_1.EndpointError(`'${assign}' is already defined in Reference Record.`); + } + const value = (0, callFunction_1.callFunction)(fnArgs, options); + (_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `evaluateCondition: ${(0, debug_1.toDebugString)(fnArgs)} = ${(0, debug_1.toDebugString)(value)}`); + return { + result: value === "" ? true : !!value, + ...(assign != null && { toAssign: { name: assign, value } }), + }; }; -const de_ResourceDetails = (output, context) => { - return (0, smithy_client_1.take)(output, { - awsEcrContainerImage: (_) => de_AwsEcrContainerImageDetails(_, context), - }); +exports.evaluateCondition = evaluateCondition; + + +/***/ }), + +/***/ 59169: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateConditions = void 0; +const debug_1 = __nccwpck_require__(27617); +const evaluateCondition_1 = __nccwpck_require__(77851); +const evaluateConditions = (conditions = [], options) => { + var _a, _b; + const conditionsReferenceRecord = {}; + for (const condition of conditions) { + const { result, toAssign } = (0, evaluateCondition_1.evaluateCondition)(condition, { + ...options, + referenceRecord: { + ...options.referenceRecord, + ...conditionsReferenceRecord, + }, + }); + if (!result) { + return { result }; + } + if (toAssign) { + conditionsReferenceRecord[toAssign.name] = toAssign.value; + (_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `assign: ${toAssign.name} := ${(0, debug_1.toDebugString)(toAssign.value)}`); + } + } + return { result: true, referenceRecord: conditionsReferenceRecord }; }; -const de_ResourceList = (output, context) => { - const retVal = (output || []) - .filter((e) => e != null) - .map((entry) => { - return de_Resource(entry, context); - }); - return retVal; +exports.evaluateConditions = evaluateConditions; + + +/***/ }), + +/***/ 35324: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateEndpointRule = void 0; +const debug_1 = __nccwpck_require__(27617); +const evaluateConditions_1 = __nccwpck_require__(59169); +const getEndpointHeaders_1 = __nccwpck_require__(88268); +const getEndpointProperties_1 = __nccwpck_require__(34973); +const getEndpointUrl_1 = __nccwpck_require__(23602); +const evaluateEndpointRule = (endpointRule, options) => { + var _a, _b; + const { conditions, endpoint } = endpointRule; + const { result, referenceRecord } = (0, evaluateConditions_1.evaluateConditions)(conditions, options); + if (!result) { + return; + } + const endpointRuleOptions = { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord }, + }; + const { url, properties, headers } = endpoint; + (_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `Resolving endpoint from template: ${(0, debug_1.toDebugString)(endpoint)}`); + return { + ...(headers != undefined && { + headers: (0, getEndpointHeaders_1.getEndpointHeaders)(headers, endpointRuleOptions), + }), + ...(properties != undefined && { + properties: (0, getEndpointProperties_1.getEndpointProperties)(properties, endpointRuleOptions), + }), + url: (0, getEndpointUrl_1.getEndpointUrl)(url, endpointRuleOptions), + }; }; -const de_ScoreDetails = (output, context) => { - return (0, smithy_client_1.take)(output, { - cvss: (_) => de_CvssScoreDetails(_, context), - }); +exports.evaluateEndpointRule = evaluateEndpointRule; + + +/***/ }), + +/***/ 12110: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateErrorRule = void 0; +const types_1 = __nccwpck_require__(57433); +const evaluateConditions_1 = __nccwpck_require__(59169); +const evaluateExpression_1 = __nccwpck_require__(82980); +const evaluateErrorRule = (errorRule, options) => { + const { conditions, error } = errorRule; + const { result, referenceRecord } = (0, evaluateConditions_1.evaluateConditions)(conditions, options); + if (!result) { + return; + } + throw new types_1.EndpointError((0, evaluateExpression_1.evaluateExpression)(error, "Error", { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord }, + })); }; -const deserializeMetadata = (output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"], -}); -const collectBodyString = (streamBody, context) => (0, smithy_client_1.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)); -const throwDefaultError = (0, smithy_client_1.withBaseException)(ECRServiceException_1.ECRServiceException); -const buildHttpRpcRequest = async (context, headers, path, resolvedHostname, body) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const contents = { - protocol, - hostname, - port, - method: "POST", - path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, - headers, - }; - if (resolvedHostname !== undefined) { - contents.hostname = resolvedHostname; +exports.evaluateErrorRule = evaluateErrorRule; + + +/***/ }), + +/***/ 82980: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateExpression = void 0; +const types_1 = __nccwpck_require__(57433); +const callFunction_1 = __nccwpck_require__(65075); +const evaluateTemplate_1 = __nccwpck_require__(57535); +const getReferenceValue_1 = __nccwpck_require__(68810); +const evaluateExpression = (obj, keyName, options) => { + if (typeof obj === "string") { + return (0, evaluateTemplate_1.evaluateTemplate)(obj, options); } - if (body !== undefined) { - contents.body = body; + else if (obj["fn"]) { + return (0, callFunction_1.callFunction)(obj, options); } - return new protocol_http_1.HttpRequest(contents); -}; -function sharedHeaders(operation) { - return { - "content-type": "application/x-amz-json-1.1", - "x-amz-target": `AmazonEC2ContainerRegistry_V20150921.${operation}`, - }; -} -const parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { - if (encoded.length) { - return JSON.parse(encoded); + else if (obj["ref"]) { + return (0, getReferenceValue_1.getReferenceValue)(obj, options); } - return {}; -}); -const parseErrorBody = async (errorBody, context) => { - const value = await parseBody(errorBody, context); - value.message = value.message ?? value.Message; - return value; + throw new types_1.EndpointError(`'${keyName}': ${String(obj)} is not a string, function or reference.`); }; -const loadRestJsonErrorCode = (output, data) => { - const findKey = (object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()); - const sanitizeErrorCode = (rawValue) => { - let cleanValue = rawValue; - if (typeof cleanValue === "number") { - cleanValue = cleanValue.toString(); +exports.evaluateExpression = evaluateExpression; + + +/***/ }), + +/***/ 59738: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateRules = void 0; +const types_1 = __nccwpck_require__(57433); +const evaluateEndpointRule_1 = __nccwpck_require__(35324); +const evaluateErrorRule_1 = __nccwpck_require__(12110); +const evaluateTreeRule_1 = __nccwpck_require__(26587); +const evaluateRules = (rules, options) => { + for (const rule of rules) { + if (rule.type === "endpoint") { + const endpointOrUndefined = (0, evaluateEndpointRule_1.evaluateEndpointRule)(rule, options); + if (endpointOrUndefined) { + return endpointOrUndefined; + } } - if (cleanValue.indexOf(",") >= 0) { - cleanValue = cleanValue.split(",")[0]; + else if (rule.type === "error") { + (0, evaluateErrorRule_1.evaluateErrorRule)(rule, options); } - if (cleanValue.indexOf(":") >= 0) { - cleanValue = cleanValue.split(":")[0]; + else if (rule.type === "tree") { + const endpointOrUndefined = (0, evaluateTreeRule_1.evaluateTreeRule)(rule, options); + if (endpointOrUndefined) { + return endpointOrUndefined; + } } - if (cleanValue.indexOf("#") >= 0) { - cleanValue = cleanValue.split("#")[1]; + else { + throw new types_1.EndpointError(`Unknown endpoint rule: ${rule}`); } - return cleanValue; + } + throw new types_1.EndpointError(`Rules evaluation failed`); +}; +exports.evaluateRules = evaluateRules; + + +/***/ }), + +/***/ 57535: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateTemplate = void 0; +const lib_1 = __nccwpck_require__(83188); +const evaluateTemplate = (template, options) => { + const evaluatedTemplateArr = []; + const templateContext = { + ...options.endpointParams, + ...options.referenceRecord, }; - const headerKey = findKey(output.headers, "x-amzn-errortype"); - if (headerKey !== undefined) { - return sanitizeErrorCode(output.headers[headerKey]); + let currentIndex = 0; + while (currentIndex < template.length) { + const openingBraceIndex = template.indexOf("{", currentIndex); + if (openingBraceIndex === -1) { + evaluatedTemplateArr.push(template.slice(currentIndex)); + break; + } + evaluatedTemplateArr.push(template.slice(currentIndex, openingBraceIndex)); + const closingBraceIndex = template.indexOf("}", openingBraceIndex); + if (closingBraceIndex === -1) { + evaluatedTemplateArr.push(template.slice(openingBraceIndex)); + break; + } + if (template[openingBraceIndex + 1] === "{" && template[closingBraceIndex + 1] === "}") { + evaluatedTemplateArr.push(template.slice(openingBraceIndex + 1, closingBraceIndex)); + currentIndex = closingBraceIndex + 2; + } + const parameterName = template.substring(openingBraceIndex + 1, closingBraceIndex); + if (parameterName.includes("#")) { + const [refName, attrName] = parameterName.split("#"); + evaluatedTemplateArr.push((0, lib_1.getAttr)(templateContext[refName], attrName)); + } + else { + evaluatedTemplateArr.push(templateContext[parameterName]); + } + currentIndex = closingBraceIndex + 1; } - if (data.code !== undefined) { - return sanitizeErrorCode(data.code); + return evaluatedTemplateArr.join(""); +}; +exports.evaluateTemplate = evaluateTemplate; + + +/***/ }), + +/***/ 26587: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateTreeRule = void 0; +const evaluateConditions_1 = __nccwpck_require__(59169); +const evaluateRules_1 = __nccwpck_require__(59738); +const evaluateTreeRule = (treeRule, options) => { + const { conditions, rules } = treeRule; + const { result, referenceRecord } = (0, evaluateConditions_1.evaluateConditions)(conditions, options); + if (!result) { + return; } - if (data["__type"] !== undefined) { - return sanitizeErrorCode(data["__type"]); + return (0, evaluateRules_1.evaluateRules)(rules, { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord }, + }); +}; +exports.evaluateTreeRule = evaluateTreeRule; + + +/***/ }), + +/***/ 88268: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointHeaders = void 0; +const types_1 = __nccwpck_require__(57433); +const evaluateExpression_1 = __nccwpck_require__(82980); +const getEndpointHeaders = (headers, options) => Object.entries(headers).reduce((acc, [headerKey, headerVal]) => ({ + ...acc, + [headerKey]: headerVal.map((headerValEntry) => { + const processedExpr = (0, evaluateExpression_1.evaluateExpression)(headerValEntry, "Header value entry", options); + if (typeof processedExpr !== "string") { + throw new types_1.EndpointError(`Header '${headerKey}' value '${processedExpr}' is not a string`); + } + return processedExpr; + }), +}), {}); +exports.getEndpointHeaders = getEndpointHeaders; + + +/***/ }), + +/***/ 34973: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointProperties = void 0; +const getEndpointProperty_1 = __nccwpck_require__(42978); +const getEndpointProperties = (properties, options) => Object.entries(properties).reduce((acc, [propertyKey, propertyVal]) => ({ + ...acc, + [propertyKey]: (0, getEndpointProperty_1.getEndpointProperty)(propertyVal, options), +}), {}); +exports.getEndpointProperties = getEndpointProperties; + + +/***/ }), + +/***/ 42978: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointProperty = void 0; +const types_1 = __nccwpck_require__(57433); +const evaluateTemplate_1 = __nccwpck_require__(57535); +const getEndpointProperties_1 = __nccwpck_require__(34973); +const getEndpointProperty = (property, options) => { + if (Array.isArray(property)) { + return property.map((propertyEntry) => (0, exports.getEndpointProperty)(propertyEntry, options)); + } + switch (typeof property) { + case "string": + return (0, evaluateTemplate_1.evaluateTemplate)(property, options); + case "object": + if (property === null) { + throw new types_1.EndpointError(`Unexpected endpoint property: ${property}`); + } + return (0, getEndpointProperties_1.getEndpointProperties)(property, options); + case "boolean": + return property; + default: + throw new types_1.EndpointError(`Unexpected endpoint property type: ${typeof property}`); + } +}; +exports.getEndpointProperty = getEndpointProperty; + + +/***/ }), + +/***/ 23602: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointUrl = void 0; +const types_1 = __nccwpck_require__(57433); +const evaluateExpression_1 = __nccwpck_require__(82980); +const getEndpointUrl = (endpointUrl, options) => { + const expression = (0, evaluateExpression_1.evaluateExpression)(endpointUrl, "Endpoint URL", options); + if (typeof expression === "string") { + try { + return new URL(expression); + } + catch (error) { + console.error(`Failed to construct URL with ${expression}`, error); + throw error; + } } + throw new types_1.EndpointError(`Endpoint URL must be a string, got ${typeof expression}`); +}; +exports.getEndpointUrl = getEndpointUrl; + + +/***/ }), + +/***/ 68810: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getReferenceValue = void 0; +const getReferenceValue = ({ ref }, options) => { + const referenceRecord = { + ...options.endpointParams, + ...options.referenceRecord, + }; + return referenceRecord[ref]; }; +exports.getReferenceValue = getReferenceValue; /***/ }), -/***/ 869: +/***/ 81114: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; const tslib_1 = __nccwpck_require__(4351); -const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(4289)); -const client_sts_1 = __nccwpck_require__(52209); -const config_resolver_1 = __nccwpck_require__(56153); -const credential_provider_node_1 = __nccwpck_require__(75531); -const hash_node_1 = __nccwpck_require__(97442); -const middleware_retry_1 = __nccwpck_require__(96064); -const node_config_provider_1 = __nccwpck_require__(87684); -const node_http_handler_1 = __nccwpck_require__(68805); -const util_body_length_node_1 = __nccwpck_require__(74147); -const util_retry_1 = __nccwpck_require__(99395); -const util_user_agent_node_1 = __nccwpck_require__(98095); -const runtimeConfig_shared_1 = __nccwpck_require__(70542); -const smithy_client_1 = __nccwpck_require__(4963); -const util_defaults_mode_node_1 = __nccwpck_require__(74243); -const smithy_client_2 = __nccwpck_require__(4963); -const getRuntimeConfig = (config) => { - (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); - const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); - const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); - const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); - return { - ...clientSharedValues, - ...config, - runtime: "node", - defaultsMode, - bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, - credentialDefaultProvider: config?.credentialDefaultProvider ?? (0, client_sts_1.decorateDefaultCredentialProvider)(credential_provider_node_1.defaultProvider), - defaultUserAgentProvider: config?.defaultUserAgentProvider ?? - (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), - maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), - region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), - requestHandler: config?.requestHandler ?? new node_http_handler_1.NodeHttpHandler(defaultConfigProvider), - retryMode: config?.retryMode ?? - (0, node_config_provider_1.loadConfig)({ - ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, - default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, - }), - sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), - streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, - useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), - useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), +tslib_1.__exportStar(__nccwpck_require__(59738), exports); + + +/***/ }), + +/***/ 98095: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultUserAgent = exports.UA_APP_ID_INI_NAME = exports.UA_APP_ID_ENV_NAME = void 0; +const node_config_provider_1 = __nccwpck_require__(33461); +const os_1 = __nccwpck_require__(22037); +const process_1 = __nccwpck_require__(77282); +const is_crt_available_1 = __nccwpck_require__(68390); +exports.UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID"; +exports.UA_APP_ID_INI_NAME = "sdk-ua-app-id"; +const defaultUserAgent = ({ serviceId, clientVersion }) => { + const sections = [ + ["aws-sdk-js", clientVersion], + ["ua", "2.0"], + [`os/${(0, os_1.platform)()}`, (0, os_1.release)()], + ["lang/js"], + ["md/nodejs", `${process_1.versions.node}`], + ]; + const crtAvailable = (0, is_crt_available_1.isCrtAvailable)(); + if (crtAvailable) { + sections.push(crtAvailable); + } + if (serviceId) { + sections.push([`api/${serviceId}`, clientVersion]); + } + if (process_1.env.AWS_EXECUTION_ENV) { + sections.push([`exec-env/${process_1.env.AWS_EXECUTION_ENV}`]); + } + const appIdPromise = (0, node_config_provider_1.loadConfig)({ + environmentVariableSelector: (env) => env[exports.UA_APP_ID_ENV_NAME], + configFileSelector: (profile) => profile[exports.UA_APP_ID_INI_NAME], + default: undefined, + })(); + let resolvedUserAgent = undefined; + return async () => { + if (!resolvedUserAgent) { + const appId = await appIdPromise; + resolvedUserAgent = appId ? [...sections, [`app/${appId}`]] : [...sections]; + } + return resolvedUserAgent; }; }; -exports.getRuntimeConfig = getRuntimeConfig; +exports.defaultUserAgent = defaultUserAgent; /***/ }), -/***/ 70542: +/***/ 68390: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const url_parser_1 = __nccwpck_require__(2992); -const util_base64_1 = __nccwpck_require__(97727); -const util_utf8_1 = __nccwpck_require__(2855); -const endpointResolver_1 = __nccwpck_require__(61610); -const getRuntimeConfig = (config) => ({ - apiVersion: "2015-09-21", - base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, - base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, - disableHostPrefix: config?.disableHostPrefix ?? false, - endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, - logger: config?.logger ?? new smithy_client_1.NoOpLogger(), - serviceId: config?.serviceId ?? "ECR", - urlParser: config?.urlParser ?? url_parser_1.parseUrl, - utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, - utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, -}); -exports.getRuntimeConfig = getRuntimeConfig; +exports.isCrtAvailable = void 0; +const isCrtAvailable = () => { + try { + if ( true && __nccwpck_require__(87578)) { + return ["md/crt-avail"]; + } + return null; + } + catch (e) { + return null; + } +}; +exports.isCrtAvailable = isCrtAvailable; /***/ }), -/***/ 28406: +/***/ 28172: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(78547), exports); -tslib_1.__exportStar(__nccwpck_require__(45723), exports); +exports.toUtf8 = exports.fromUtf8 = void 0; +const pureJs_1 = __nccwpck_require__(21590); +const whatwgEncodingApi_1 = __nccwpck_require__(89215); +const fromUtf8 = (input) => typeof TextEncoder === "function" ? (0, whatwgEncodingApi_1.fromUtf8)(input) : (0, pureJs_1.fromUtf8)(input); +exports.fromUtf8 = fromUtf8; +const toUtf8 = (input) => typeof TextDecoder === "function" ? (0, whatwgEncodingApi_1.toUtf8)(input) : (0, pureJs_1.toUtf8)(input); +exports.toUtf8 = toUtf8; /***/ }), -/***/ 78547: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 21590: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.waitUntilImageScanComplete = exports.waitForImageScanComplete = void 0; -const util_waiter_1 = __nccwpck_require__(21627); -const DescribeImageScanFindingsCommand_1 = __nccwpck_require__(72987); -const checkState = async (client, input) => { - let reason; - try { - const result = await client.send(new DescribeImageScanFindingsCommand_1.DescribeImageScanFindingsCommand(input)); - reason = result; - try { - const returnComparator = () => { - return result.imageScanStatus.status; - }; - if (returnComparator() === "COMPLETE") { - return { state: util_waiter_1.WaiterState.SUCCESS, reason }; - } +exports.toUtf8 = exports.fromUtf8 = void 0; +const fromUtf8 = (input) => { + const bytes = []; + for (let i = 0, len = input.length; i < len; i++) { + const value = input.charCodeAt(i); + if (value < 0x80) { + bytes.push(value); } - catch (e) { } - try { - const returnComparator = () => { - return result.imageScanStatus.status; - }; - if (returnComparator() === "FAILED") { - return { state: util_waiter_1.WaiterState.FAILURE, reason }; - } + else if (value < 0x800) { + bytes.push((value >> 6) | 0b11000000, (value & 0b111111) | 0b10000000); + } + else if (i + 1 < input.length && (value & 0xfc00) === 0xd800 && (input.charCodeAt(i + 1) & 0xfc00) === 0xdc00) { + const surrogatePair = 0x10000 + ((value & 0b1111111111) << 10) + (input.charCodeAt(++i) & 0b1111111111); + bytes.push((surrogatePair >> 18) | 0b11110000, ((surrogatePair >> 12) & 0b111111) | 0b10000000, ((surrogatePair >> 6) & 0b111111) | 0b10000000, (surrogatePair & 0b111111) | 0b10000000); + } + else { + bytes.push((value >> 12) | 0b11100000, ((value >> 6) & 0b111111) | 0b10000000, (value & 0b111111) | 0b10000000); } - catch (e) { } - } - catch (exception) { - reason = exception; } - return { state: util_waiter_1.WaiterState.RETRY, reason }; -}; -const waitForImageScanComplete = async (params, input) => { - const serviceDefaults = { minDelay: 5, maxDelay: 120 }; - return (0, util_waiter_1.createWaiter)({ ...serviceDefaults, ...params }, input, checkState); + return Uint8Array.from(bytes); }; -exports.waitForImageScanComplete = waitForImageScanComplete; -const waitUntilImageScanComplete = async (params, input) => { - const serviceDefaults = { minDelay: 5, maxDelay: 120 }; - const result = await (0, util_waiter_1.createWaiter)({ ...serviceDefaults, ...params }, input, checkState); - return (0, util_waiter_1.checkExceptions)(result); +exports.fromUtf8 = fromUtf8; +const toUtf8 = (input) => { + let decoded = ""; + for (let i = 0, len = input.length; i < len; i++) { + const byte = input[i]; + if (byte < 0x80) { + decoded += String.fromCharCode(byte); + } + else if (0b11000000 <= byte && byte < 0b11100000) { + const nextByte = input[++i]; + decoded += String.fromCharCode(((byte & 0b11111) << 6) | (nextByte & 0b111111)); + } + else if (0b11110000 <= byte && byte < 0b101101101) { + const surrogatePair = [byte, input[++i], input[++i], input[++i]]; + const encoded = "%" + surrogatePair.map((byteValue) => byteValue.toString(16)).join("%"); + decoded += decodeURIComponent(encoded); + } + else { + decoded += String.fromCharCode(((byte & 0b1111) << 12) | ((input[++i] & 0b111111) << 6) | (input[++i] & 0b111111)); + } + } + return decoded; }; -exports.waitUntilImageScanComplete = waitUntilImageScanComplete; +exports.toUtf8 = toUtf8; /***/ }), -/***/ 45723: +/***/ 89215: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toUtf8 = exports.fromUtf8 = void 0; +function fromUtf8(input) { + return new TextEncoder().encode(input); +} +exports.fromUtf8 = fromUtf8; +function toUtf8(input) { + return new TextDecoder("utf-8").decode(input); +} +exports.toUtf8 = toUtf8; + + +/***/ }), + +/***/ 43779: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.waitUntilLifecyclePolicyPreviewComplete = exports.waitForLifecyclePolicyPreviewComplete = void 0; -const util_waiter_1 = __nccwpck_require__(21627); -const GetLifecyclePolicyPreviewCommand_1 = __nccwpck_require__(17006); -const checkState = async (client, input) => { - let reason; - try { - const result = await client.send(new GetLifecyclePolicyPreviewCommand_1.GetLifecyclePolicyPreviewCommand(input)); - reason = result; - try { - const returnComparator = () => { - return result.status; - }; - if (returnComparator() === "COMPLETE") { - return { state: util_waiter_1.WaiterState.SUCCESS, reason }; - } - } - catch (e) { } - try { - const returnComparator = () => { - return result.status; - }; - if (returnComparator() === "FAILED") { - return { state: util_waiter_1.WaiterState.FAILURE, reason }; - } - } - catch (e) { } - } - catch (exception) { - reason = exception; - } - return { state: util_waiter_1.WaiterState.RETRY, reason }; -}; -const waitForLifecyclePolicyPreviewComplete = async (params, input) => { - const serviceDefaults = { minDelay: 5, maxDelay: 120 }; - return (0, util_waiter_1.createWaiter)({ ...serviceDefaults, ...params }, input, checkState); -}; -exports.waitForLifecyclePolicyPreviewComplete = waitForLifecyclePolicyPreviewComplete; -const waitUntilLifecyclePolicyPreviewComplete = async (params, input) => { - const serviceDefaults = { minDelay: 5, maxDelay: 120 }; - const result = await (0, util_waiter_1.createWaiter)({ ...serviceDefaults, ...params }, input, checkState); - return (0, util_waiter_1.checkExceptions)(result); +exports.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = exports.DEFAULT_USE_DUALSTACK_ENDPOINT = exports.CONFIG_USE_DUALSTACK_ENDPOINT = exports.ENV_USE_DUALSTACK_ENDPOINT = void 0; +const util_config_provider_1 = __nccwpck_require__(83375); +exports.ENV_USE_DUALSTACK_ENDPOINT = "AWS_USE_DUALSTACK_ENDPOINT"; +exports.CONFIG_USE_DUALSTACK_ENDPOINT = "use_dualstack_endpoint"; +exports.DEFAULT_USE_DUALSTACK_ENDPOINT = false; +exports.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => (0, util_config_provider_1.booleanSelector)(env, exports.ENV_USE_DUALSTACK_ENDPOINT, util_config_provider_1.SelectorType.ENV), + configFileSelector: (profile) => (0, util_config_provider_1.booleanSelector)(profile, exports.CONFIG_USE_DUALSTACK_ENDPOINT, util_config_provider_1.SelectorType.CONFIG), + default: false, }; -exports.waitUntilLifecyclePolicyPreviewComplete = waitUntilLifecyclePolicyPreviewComplete; /***/ }), -/***/ 17124: +/***/ 17994: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SSOOIDC = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const CreateTokenCommand_1 = __nccwpck_require__(62853); -const RegisterClientCommand_1 = __nccwpck_require__(36677); -const StartDeviceAuthorizationCommand_1 = __nccwpck_require__(38359); -const SSOOIDCClient_1 = __nccwpck_require__(70139); -const commands = { - CreateTokenCommand: CreateTokenCommand_1.CreateTokenCommand, - RegisterClientCommand: RegisterClientCommand_1.RegisterClientCommand, - StartDeviceAuthorizationCommand: StartDeviceAuthorizationCommand_1.StartDeviceAuthorizationCommand, +exports.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = exports.DEFAULT_USE_FIPS_ENDPOINT = exports.CONFIG_USE_FIPS_ENDPOINT = exports.ENV_USE_FIPS_ENDPOINT = void 0; +const util_config_provider_1 = __nccwpck_require__(83375); +exports.ENV_USE_FIPS_ENDPOINT = "AWS_USE_FIPS_ENDPOINT"; +exports.CONFIG_USE_FIPS_ENDPOINT = "use_fips_endpoint"; +exports.DEFAULT_USE_FIPS_ENDPOINT = false; +exports.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => (0, util_config_provider_1.booleanSelector)(env, exports.ENV_USE_FIPS_ENDPOINT, util_config_provider_1.SelectorType.ENV), + configFileSelector: (profile) => (0, util_config_provider_1.booleanSelector)(profile, exports.CONFIG_USE_FIPS_ENDPOINT, util_config_provider_1.SelectorType.CONFIG), + default: false, }; -class SSOOIDC extends SSOOIDCClient_1.SSOOIDCClient { -} -exports.SSOOIDC = SSOOIDC; -(0, smithy_client_1.createAggregatedClient)(commands, SSOOIDC); /***/ }), -/***/ 70139: +/***/ 18421: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SSOOIDCClient = exports.__Client = void 0; -const config_resolver_1 = __nccwpck_require__(56153); -const middleware_content_length_1 = __nccwpck_require__(42245); -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_host_header_1 = __nccwpck_require__(22545); -const middleware_logger_1 = __nccwpck_require__(20014); -const middleware_recursion_detection_1 = __nccwpck_require__(85525); -const middleware_retry_1 = __nccwpck_require__(96064); -const middleware_user_agent_1 = __nccwpck_require__(64688); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } })); -const EndpointParameters_1 = __nccwpck_require__(61426); -const runtimeConfig_1 = __nccwpck_require__(25524); -class SSOOIDCClient extends smithy_client_1.Client { - constructor(configuration) { - const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration); - const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); - const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1); - const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2); - const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3); - const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_5); - super(_config_6); - this.config = _config_6; - this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); - this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); - this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); - this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); - this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); - this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); - } - destroy() { - super.destroy(); - } -} -exports.SSOOIDCClient = SSOOIDCClient; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(43779), exports); +tslib_1.__exportStar(__nccwpck_require__(17994), exports); +tslib_1.__exportStar(__nccwpck_require__(37432), exports); +tslib_1.__exportStar(__nccwpck_require__(61892), exports); /***/ }), -/***/ 62853: +/***/ 37432: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.CreateTokenCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_restJson1_1 = __nccwpck_require__(21518); -class CreateTokenCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, CreateTokenCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "SSOOIDCClient"; - const commandName = "CreateTokenCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_restJson1_1.se_CreateTokenCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_restJson1_1.de_CreateTokenCommand)(output, context); - } -} -exports.CreateTokenCommand = CreateTokenCommand; +exports.resolveCustomEndpointsConfig = void 0; +const util_middleware_1 = __nccwpck_require__(2390); +const resolveCustomEndpointsConfig = (input) => { + var _a, _b; + const { endpoint, urlParser } = input; + return { + ...input, + tls: (_a = input.tls) !== null && _a !== void 0 ? _a : true, + endpoint: (0, util_middleware_1.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint), + isCustomEndpoint: true, + useDualstackEndpoint: (0, util_middleware_1.normalizeProvider)((_b = input.useDualstackEndpoint) !== null && _b !== void 0 ? _b : false), + }; +}; +exports.resolveCustomEndpointsConfig = resolveCustomEndpointsConfig; /***/ }), -/***/ 36677: +/***/ 61892: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.RegisterClientCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_restJson1_1 = __nccwpck_require__(21518); -class RegisterClientCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, RegisterClientCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "SSOOIDCClient"; - const commandName = "RegisterClientCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_restJson1_1.se_RegisterClientCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_restJson1_1.de_RegisterClientCommand)(output, context); - } -} -exports.RegisterClientCommand = RegisterClientCommand; +exports.resolveEndpointsConfig = void 0; +const util_middleware_1 = __nccwpck_require__(2390); +const getEndpointFromRegion_1 = __nccwpck_require__(48570); +const resolveEndpointsConfig = (input) => { + var _a, _b; + const useDualstackEndpoint = (0, util_middleware_1.normalizeProvider)((_a = input.useDualstackEndpoint) !== null && _a !== void 0 ? _a : false); + const { endpoint, useFipsEndpoint, urlParser } = input; + return { + ...input, + tls: (_b = input.tls) !== null && _b !== void 0 ? _b : true, + endpoint: endpoint + ? (0, util_middleware_1.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint) + : () => (0, getEndpointFromRegion_1.getEndpointFromRegion)({ ...input, useDualstackEndpoint, useFipsEndpoint }), + isCustomEndpoint: !!endpoint, + useDualstackEndpoint, + }; +}; +exports.resolveEndpointsConfig = resolveEndpointsConfig; /***/ }), -/***/ 38359: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 48570: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.StartDeviceAuthorizationCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_restJson1_1 = __nccwpck_require__(21518); -class StartDeviceAuthorizationCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, StartDeviceAuthorizationCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "SSOOIDCClient"; - const commandName = "StartDeviceAuthorizationCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_restJson1_1.se_StartDeviceAuthorizationCommand)(input, context); +exports.getEndpointFromRegion = void 0; +const getEndpointFromRegion = async (input) => { + var _a; + const { tls = true } = input; + const region = await input.region(); + const dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/); + if (!dnsHostRegex.test(region)) { + throw new Error("Invalid region in client config"); } - deserialize(output, context) { - return (0, Aws_restJson1_1.de_StartDeviceAuthorizationCommand)(output, context); + const useDualstackEndpoint = await input.useDualstackEndpoint(); + const useFipsEndpoint = await input.useFipsEndpoint(); + const { hostname } = (_a = (await input.regionInfoProvider(region, { useDualstackEndpoint, useFipsEndpoint }))) !== null && _a !== void 0 ? _a : {}; + if (!hostname) { + throw new Error("Cannot resolve hostname from client config"); } -} -exports.StartDeviceAuthorizationCommand = StartDeviceAuthorizationCommand; + return input.urlParser(`${tls ? "https:" : "http:"}//${hostname}`); +}; +exports.getEndpointFromRegion = getEndpointFromRegion; /***/ }), -/***/ 50447: +/***/ 53098: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(62853), exports); -tslib_1.__exportStar(__nccwpck_require__(36677), exports); -tslib_1.__exportStar(__nccwpck_require__(38359), exports); +tslib_1.__exportStar(__nccwpck_require__(18421), exports); +tslib_1.__exportStar(__nccwpck_require__(221), exports); +tslib_1.__exportStar(__nccwpck_require__(86985), exports); /***/ }), -/***/ 61426: +/***/ 33898: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveClientEndpointParameters = void 0; -const resolveClientEndpointParameters = (options) => { - return { - ...options, - useDualstackEndpoint: options.useDualstackEndpoint ?? false, - useFipsEndpoint: options.useFipsEndpoint ?? false, - defaultSigningName: "awsssooidc", - }; +exports.NODE_REGION_CONFIG_FILE_OPTIONS = exports.NODE_REGION_CONFIG_OPTIONS = exports.REGION_INI_NAME = exports.REGION_ENV_NAME = void 0; +exports.REGION_ENV_NAME = "AWS_REGION"; +exports.REGION_INI_NAME = "region"; +exports.NODE_REGION_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[exports.REGION_ENV_NAME], + configFileSelector: (profile) => profile[exports.REGION_INI_NAME], + default: () => { + throw new Error("Region is missing"); + }, +}; +exports.NODE_REGION_CONFIG_FILE_OPTIONS = { + preferredFile: "credentials", }; -exports.resolveClientEndpointParameters = resolveClientEndpointParameters; /***/ }), -/***/ 97604: +/***/ 49506: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultEndpointResolver = void 0; -const util_endpoints_1 = __nccwpck_require__(13350); -const ruleset_1 = __nccwpck_require__(51756); -const defaultEndpointResolver = (endpointParams, context = {}) => { - return (0, util_endpoints_1.resolveEndpoint)(ruleset_1.ruleSet, { - endpointParams: endpointParams, - logger: context.logger, - }); -}; -exports.defaultEndpointResolver = defaultEndpointResolver; +exports.getRealRegion = void 0; +const isFipsRegion_1 = __nccwpck_require__(43870); +const getRealRegion = (region) => (0, isFipsRegion_1.isFipsRegion)(region) + ? ["fips-aws-global", "aws-fips"].includes(region) + ? "us-east-1" + : region.replace(/fips-(dkr-|prod-)?|-fips/, "") + : region; +exports.getRealRegion = getRealRegion; /***/ }), -/***/ 51756: -/***/ ((__unused_webpack_module, exports) => { +/***/ 221: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ruleSet = void 0; -const p = "required", q = "fn", r = "argv", s = "ref"; -const a = "PartitionResult", b = "tree", c = "error", d = "endpoint", e = { [p]: false, "type": "String" }, f = { [p]: true, "default": false, "type": "Boolean" }, g = { [s]: "Endpoint" }, h = { [q]: "booleanEquals", [r]: [{ [s]: "UseFIPS" }, true] }, i = { [q]: "booleanEquals", [r]: [{ [s]: "UseDualStack" }, true] }, j = {}, k = { [q]: "booleanEquals", [r]: [true, { [q]: "getAttr", [r]: [{ [s]: a }, "supportsFIPS"] }] }, l = { [q]: "booleanEquals", [r]: [true, { [q]: "getAttr", [r]: [{ [s]: a }, "supportsDualStack"] }] }, m = [g], n = [h], o = [i]; -const _data = { version: "1.0", parameters: { Region: e, UseDualStack: f, UseFIPS: f, Endpoint: e }, rules: [{ conditions: [{ [q]: "aws.partition", [r]: [{ [s]: "Region" }], assign: a }], type: b, rules: [{ conditions: [{ [q]: "isSet", [r]: m }, { [q]: "parseURL", [r]: m, assign: "url" }], type: b, rules: [{ conditions: n, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: c }, { type: b, rules: [{ conditions: o, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: c }, { endpoint: { url: g, properties: j, headers: j }, type: d }] }] }, { conditions: [h, i], type: b, rules: [{ conditions: [k, l], type: b, rules: [{ endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: j, headers: j }, type: d }] }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: c }] }, { conditions: n, type: b, rules: [{ conditions: [k], type: b, rules: [{ type: b, rules: [{ endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dnsSuffix}", properties: j, headers: j }, type: d }] }] }, { error: "FIPS is enabled but this partition does not support FIPS", type: c }] }, { conditions: o, type: b, rules: [{ conditions: [l], type: b, rules: [{ endpoint: { url: "https://oidc.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: j, headers: j }, type: d }] }, { error: "DualStack is enabled but this partition does not support DualStack", type: c }] }, { endpoint: { url: "https://oidc.{Region}.{PartitionResult#dnsSuffix}", properties: j, headers: j }, type: d }] }] }; -exports.ruleSet = _data; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(33898), exports); +tslib_1.__exportStar(__nccwpck_require__(87065), exports); /***/ }), -/***/ 54527: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 43870: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SSOOIDCServiceException = void 0; -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(70139), exports); -tslib_1.__exportStar(__nccwpck_require__(17124), exports); -tslib_1.__exportStar(__nccwpck_require__(50447), exports); -tslib_1.__exportStar(__nccwpck_require__(35973), exports); -var SSOOIDCServiceException_1 = __nccwpck_require__(43026); -Object.defineProperty(exports, "SSOOIDCServiceException", ({ enumerable: true, get: function () { return SSOOIDCServiceException_1.SSOOIDCServiceException; } })); +exports.isFipsRegion = void 0; +const isFipsRegion = (region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")); +exports.isFipsRegion = isFipsRegion; /***/ }), -/***/ 43026: +/***/ 87065: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SSOOIDCServiceException = exports.__ServiceException = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "__ServiceException", ({ enumerable: true, get: function () { return smithy_client_1.ServiceException; } })); -class SSOOIDCServiceException extends smithy_client_1.ServiceException { - constructor(options) { - super(options); - Object.setPrototypeOf(this, SSOOIDCServiceException.prototype); +exports.resolveRegionConfig = void 0; +const getRealRegion_1 = __nccwpck_require__(49506); +const isFipsRegion_1 = __nccwpck_require__(43870); +const resolveRegionConfig = (input) => { + const { region, useFipsEndpoint } = input; + if (!region) { + throw new Error("Region is missing"); } -} -exports.SSOOIDCServiceException = SSOOIDCServiceException; + return { + ...input, + region: async () => { + if (typeof region === "string") { + return (0, getRealRegion_1.getRealRegion)(region); + } + const providedRegion = await region(); + return (0, getRealRegion_1.getRealRegion)(providedRegion); + }, + useFipsEndpoint: async () => { + const providedRegion = typeof region === "string" ? region : await region(); + if ((0, isFipsRegion_1.isFipsRegion)(providedRegion)) { + return true; + } + return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); + }, + }; +}; +exports.resolveRegionConfig = resolveRegionConfig; /***/ }), -/***/ 35973: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 19814: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(69374), exports); /***/ }), -/***/ 69374: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 14832: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.InvalidClientMetadataException = exports.UnsupportedGrantTypeException = exports.UnauthorizedClientException = exports.SlowDownException = exports.InvalidScopeException = exports.InvalidRequestException = exports.InvalidGrantException = exports.InvalidClientException = exports.InternalServerException = exports.ExpiredTokenException = exports.AuthorizationPendingException = exports.AccessDeniedException = void 0; -const SSOOIDCServiceException_1 = __nccwpck_require__(43026); -class AccessDeniedException extends SSOOIDCServiceException_1.SSOOIDCServiceException { - constructor(opts) { - super({ - name: "AccessDeniedException", - $fault: "client", - ...opts, - }); - this.name = "AccessDeniedException"; - this.$fault = "client"; - Object.setPrototypeOf(this, AccessDeniedException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -} -exports.AccessDeniedException = AccessDeniedException; -class AuthorizationPendingException extends SSOOIDCServiceException_1.SSOOIDCServiceException { - constructor(opts) { - super({ - name: "AuthorizationPendingException", - $fault: "client", - ...opts, - }); - this.name = "AuthorizationPendingException"; - this.$fault = "client"; - Object.setPrototypeOf(this, AuthorizationPendingException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -} -exports.AuthorizationPendingException = AuthorizationPendingException; -class ExpiredTokenException extends SSOOIDCServiceException_1.SSOOIDCServiceException { - constructor(opts) { - super({ - name: "ExpiredTokenException", - $fault: "client", - ...opts, - }); - this.name = "ExpiredTokenException"; - this.$fault = "client"; - Object.setPrototypeOf(this, ExpiredTokenException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -} -exports.ExpiredTokenException = ExpiredTokenException; -class InternalServerException extends SSOOIDCServiceException_1.SSOOIDCServiceException { - constructor(opts) { - super({ - name: "InternalServerException", - $fault: "server", - ...opts, - }); - this.name = "InternalServerException"; - this.$fault = "server"; - Object.setPrototypeOf(this, InternalServerException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -} -exports.InternalServerException = InternalServerException; -class InvalidClientException extends SSOOIDCServiceException_1.SSOOIDCServiceException { - constructor(opts) { - super({ - name: "InvalidClientException", - $fault: "client", - ...opts, - }); - this.name = "InvalidClientException"; - this.$fault = "client"; - Object.setPrototypeOf(this, InvalidClientException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -} -exports.InvalidClientException = InvalidClientException; -class InvalidGrantException extends SSOOIDCServiceException_1.SSOOIDCServiceException { - constructor(opts) { - super({ - name: "InvalidGrantException", - $fault: "client", - ...opts, - }); - this.name = "InvalidGrantException"; - this.$fault = "client"; - Object.setPrototypeOf(this, InvalidGrantException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -} -exports.InvalidGrantException = InvalidGrantException; -class InvalidRequestException extends SSOOIDCServiceException_1.SSOOIDCServiceException { - constructor(opts) { - super({ - name: "InvalidRequestException", - $fault: "client", - ...opts, - }); - this.name = "InvalidRequestException"; - this.$fault = "client"; - Object.setPrototypeOf(this, InvalidRequestException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -} -exports.InvalidRequestException = InvalidRequestException; -class InvalidScopeException extends SSOOIDCServiceException_1.SSOOIDCServiceException { - constructor(opts) { - super({ - name: "InvalidScopeException", - $fault: "client", - ...opts, - }); - this.name = "InvalidScopeException"; - this.$fault = "client"; - Object.setPrototypeOf(this, InvalidScopeException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -} -exports.InvalidScopeException = InvalidScopeException; -class SlowDownException extends SSOOIDCServiceException_1.SSOOIDCServiceException { - constructor(opts) { - super({ - name: "SlowDownException", - $fault: "client", - ...opts, - }); - this.name = "SlowDownException"; - this.$fault = "client"; - Object.setPrototypeOf(this, SlowDownException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -} -exports.SlowDownException = SlowDownException; -class UnauthorizedClientException extends SSOOIDCServiceException_1.SSOOIDCServiceException { - constructor(opts) { - super({ - name: "UnauthorizedClientException", - $fault: "client", - ...opts, - }); - this.name = "UnauthorizedClientException"; - this.$fault = "client"; - Object.setPrototypeOf(this, UnauthorizedClientException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -} -exports.UnauthorizedClientException = UnauthorizedClientException; -class UnsupportedGrantTypeException extends SSOOIDCServiceException_1.SSOOIDCServiceException { - constructor(opts) { - super({ - name: "UnsupportedGrantTypeException", - $fault: "client", - ...opts, - }); - this.name = "UnsupportedGrantTypeException"; - this.$fault = "client"; - Object.setPrototypeOf(this, UnsupportedGrantTypeException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -} -exports.UnsupportedGrantTypeException = UnsupportedGrantTypeException; -class InvalidClientMetadataException extends SSOOIDCServiceException_1.SSOOIDCServiceException { - constructor(opts) { - super({ - name: "InvalidClientMetadataException", - $fault: "client", - ...opts, - }); - this.name = "InvalidClientMetadataException"; - this.$fault = "client"; - Object.setPrototypeOf(this, InvalidClientMetadataException.prototype); - this.error = opts.error; - this.error_description = opts.error_description; - } -} -exports.InvalidClientMetadataException = InvalidClientMetadataException; /***/ }), -/***/ 21518: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; +/***/ 99760: +/***/ ((__unused_webpack_module, exports) => { -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.de_StartDeviceAuthorizationCommand = exports.de_RegisterClientCommand = exports.de_CreateTokenCommand = exports.se_StartDeviceAuthorizationCommand = exports.se_RegisterClientCommand = exports.se_CreateTokenCommand = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const protocol_http_1 = __nccwpck_require__(64418); -const models_0_1 = __nccwpck_require__(69374); -const SSOOIDCServiceException_1 = __nccwpck_require__(43026); -const se_CreateTokenCommand = async (input, context) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const headers = { - "content-type": "application/json", - }; - const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/token"; - let body; - body = JSON.stringify((0, smithy_client_1.take)(input, { - clientId: [], - clientSecret: [], - code: [], - deviceCode: [], - grantType: [], - redirectUri: [], - refreshToken: [], - scope: (_) => (0, smithy_client_1._json)(_), - })); - return new protocol_http_1.HttpRequest({ - protocol, - hostname, - port, - method: "POST", - headers, - path: resolvedPath, - body, - }); -}; -exports.se_CreateTokenCommand = se_CreateTokenCommand; -const se_RegisterClientCommand = async (input, context) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const headers = { - "content-type": "application/json", - }; - const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/client/register"; - let body; - body = JSON.stringify((0, smithy_client_1.take)(input, { - clientName: [], - clientType: [], - scopes: (_) => (0, smithy_client_1._json)(_), - })); - return new protocol_http_1.HttpRequest({ - protocol, - hostname, - port, - method: "POST", - headers, - path: resolvedPath, - body, - }); -}; -exports.se_RegisterClientCommand = se_RegisterClientCommand; -const se_StartDeviceAuthorizationCommand = async (input, context) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const headers = { - "content-type": "application/json", - }; - const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/device_authorization"; - let body; - body = JSON.stringify((0, smithy_client_1.take)(input, { - clientId: [], - clientSecret: [], - startUrl: [], - })); - return new protocol_http_1.HttpRequest({ - protocol, - hostname, - port, - method: "POST", - headers, - path: resolvedPath, - body, - }); -}; -exports.se_StartDeviceAuthorizationCommand = se_StartDeviceAuthorizationCommand; -const de_CreateTokenCommand = async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_CreateTokenCommandError(output, context); - } - const contents = (0, smithy_client_1.map)({ - $metadata: deserializeMetadata(output), - }); - const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body"); - const doc = (0, smithy_client_1.take)(data, { - accessToken: smithy_client_1.expectString, - expiresIn: smithy_client_1.expectInt32, - idToken: smithy_client_1.expectString, - refreshToken: smithy_client_1.expectString, - tokenType: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - return contents; -}; -exports.de_CreateTokenCommand = de_CreateTokenCommand; -const de_CreateTokenCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "AccessDeniedException": - case "com.amazonaws.ssooidc#AccessDeniedException": - throw await de_AccessDeniedExceptionRes(parsedOutput, context); - case "AuthorizationPendingException": - case "com.amazonaws.ssooidc#AuthorizationPendingException": - throw await de_AuthorizationPendingExceptionRes(parsedOutput, context); - case "ExpiredTokenException": - case "com.amazonaws.ssooidc#ExpiredTokenException": - throw await de_ExpiredTokenExceptionRes(parsedOutput, context); - case "InternalServerException": - case "com.amazonaws.ssooidc#InternalServerException": - throw await de_InternalServerExceptionRes(parsedOutput, context); - case "InvalidClientException": - case "com.amazonaws.ssooidc#InvalidClientException": - throw await de_InvalidClientExceptionRes(parsedOutput, context); - case "InvalidGrantException": - case "com.amazonaws.ssooidc#InvalidGrantException": - throw await de_InvalidGrantExceptionRes(parsedOutput, context); - case "InvalidRequestException": - case "com.amazonaws.ssooidc#InvalidRequestException": - throw await de_InvalidRequestExceptionRes(parsedOutput, context); - case "InvalidScopeException": - case "com.amazonaws.ssooidc#InvalidScopeException": - throw await de_InvalidScopeExceptionRes(parsedOutput, context); - case "SlowDownException": - case "com.amazonaws.ssooidc#SlowDownException": - throw await de_SlowDownExceptionRes(parsedOutput, context); - case "UnauthorizedClientException": - case "com.amazonaws.ssooidc#UnauthorizedClientException": - throw await de_UnauthorizedClientExceptionRes(parsedOutput, context); - case "UnsupportedGrantTypeException": - case "com.amazonaws.ssooidc#UnsupportedGrantTypeException": - throw await de_UnsupportedGrantTypeExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); - } -}; -const de_RegisterClientCommand = async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_RegisterClientCommandError(output, context); - } - const contents = (0, smithy_client_1.map)({ - $metadata: deserializeMetadata(output), - }); - const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body"); - const doc = (0, smithy_client_1.take)(data, { - authorizationEndpoint: smithy_client_1.expectString, - clientId: smithy_client_1.expectString, - clientIdIssuedAt: smithy_client_1.expectLong, - clientSecret: smithy_client_1.expectString, - clientSecretExpiresAt: smithy_client_1.expectLong, - tokenEndpoint: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - return contents; -}; -exports.de_RegisterClientCommand = de_RegisterClientCommand; -const de_RegisterClientCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InternalServerException": - case "com.amazonaws.ssooidc#InternalServerException": - throw await de_InternalServerExceptionRes(parsedOutput, context); - case "InvalidClientMetadataException": - case "com.amazonaws.ssooidc#InvalidClientMetadataException": - throw await de_InvalidClientMetadataExceptionRes(parsedOutput, context); - case "InvalidRequestException": - case "com.amazonaws.ssooidc#InvalidRequestException": - throw await de_InvalidRequestExceptionRes(parsedOutput, context); - case "InvalidScopeException": - case "com.amazonaws.ssooidc#InvalidScopeException": - throw await de_InvalidScopeExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); - } -}; -const de_StartDeviceAuthorizationCommand = async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_StartDeviceAuthorizationCommandError(output, context); - } - const contents = (0, smithy_client_1.map)({ - $metadata: deserializeMetadata(output), - }); - const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body"); - const doc = (0, smithy_client_1.take)(data, { - deviceCode: smithy_client_1.expectString, - expiresIn: smithy_client_1.expectInt32, - interval: smithy_client_1.expectInt32, - userCode: smithy_client_1.expectString, - verificationUri: smithy_client_1.expectString, - verificationUriComplete: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - return contents; -}; -exports.de_StartDeviceAuthorizationCommand = de_StartDeviceAuthorizationCommand; -const de_StartDeviceAuthorizationCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InternalServerException": - case "com.amazonaws.ssooidc#InternalServerException": - throw await de_InternalServerExceptionRes(parsedOutput, context); - case "InvalidClientException": - case "com.amazonaws.ssooidc#InvalidClientException": - throw await de_InvalidClientExceptionRes(parsedOutput, context); - case "InvalidRequestException": - case "com.amazonaws.ssooidc#InvalidRequestException": - throw await de_InvalidRequestExceptionRes(parsedOutput, context); - case "SlowDownException": - case "com.amazonaws.ssooidc#SlowDownException": - throw await de_SlowDownExceptionRes(parsedOutput, context); - case "UnauthorizedClientException": - case "com.amazonaws.ssooidc#UnauthorizedClientException": - throw await de_UnauthorizedClientExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); - } -}; -const throwDefaultError = (0, smithy_client_1.withBaseException)(SSOOIDCServiceException_1.SSOOIDCServiceException); -const de_AccessDeniedExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - error: smithy_client_1.expectString, - error_description: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.AccessDeniedException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_AuthorizationPendingExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - error: smithy_client_1.expectString, - error_description: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.AuthorizationPendingException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_ExpiredTokenExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - error: smithy_client_1.expectString, - error_description: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.ExpiredTokenException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_InternalServerExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - error: smithy_client_1.expectString, - error_description: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.InternalServerException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_InvalidClientExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - error: smithy_client_1.expectString, - error_description: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.InvalidClientException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_InvalidClientMetadataExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - error: smithy_client_1.expectString, - error_description: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.InvalidClientMetadataException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_InvalidGrantExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - error: smithy_client_1.expectString, - error_description: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.InvalidGrantException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_InvalidRequestExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - error: smithy_client_1.expectString, - error_description: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.InvalidRequestException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_InvalidScopeExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - error: smithy_client_1.expectString, - error_description: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.InvalidScopeException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_SlowDownExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - error: smithy_client_1.expectString, - error_description: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.SlowDownException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_UnauthorizedClientExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - error: smithy_client_1.expectString, - error_description: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.UnauthorizedClientException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_UnsupportedGrantTypeExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - error: smithy_client_1.expectString, - error_description: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.UnsupportedGrantTypeException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getHostnameFromVariants = void 0; +const getHostnameFromVariants = (variants = [], { useFipsEndpoint, useDualstackEndpoint }) => { + var _a; + return (_a = variants.find(({ tags }) => useFipsEndpoint === tags.includes("fips") && useDualstackEndpoint === tags.includes("dualstack"))) === null || _a === void 0 ? void 0 : _a.hostname; }; -const deserializeMetadata = (output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"], -}); -const collectBodyString = (streamBody, context) => (0, smithy_client_1.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)); -const isSerializableHeaderValue = (value) => value !== undefined && - value !== null && - value !== "" && - (!Object.getOwnPropertyNames(value).includes("length") || value.length != 0) && - (!Object.getOwnPropertyNames(value).includes("size") || value.size != 0); -const parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { - if (encoded.length) { - return JSON.parse(encoded); +exports.getHostnameFromVariants = getHostnameFromVariants; + + +/***/ }), + +/***/ 77792: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRegionInfo = void 0; +const getHostnameFromVariants_1 = __nccwpck_require__(99760); +const getResolvedHostname_1 = __nccwpck_require__(1487); +const getResolvedPartition_1 = __nccwpck_require__(44441); +const getResolvedSigningRegion_1 = __nccwpck_require__(92281); +const getRegionInfo = (region, { useFipsEndpoint = false, useDualstackEndpoint = false, signingService, regionHash, partitionHash, }) => { + var _a, _b, _c, _d, _e, _f; + const partition = (0, getResolvedPartition_1.getResolvedPartition)(region, { partitionHash }); + const resolvedRegion = region in regionHash ? region : (_b = (_a = partitionHash[partition]) === null || _a === void 0 ? void 0 : _a.endpoint) !== null && _b !== void 0 ? _b : region; + const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint }; + const regionHostname = (0, getHostnameFromVariants_1.getHostnameFromVariants)((_c = regionHash[resolvedRegion]) === null || _c === void 0 ? void 0 : _c.variants, hostnameOptions); + const partitionHostname = (0, getHostnameFromVariants_1.getHostnameFromVariants)((_d = partitionHash[partition]) === null || _d === void 0 ? void 0 : _d.variants, hostnameOptions); + const hostname = (0, getResolvedHostname_1.getResolvedHostname)(resolvedRegion, { regionHostname, partitionHostname }); + if (hostname === undefined) { + throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`); } - return {}; -}); -const parseErrorBody = async (errorBody, context) => { - const value = await parseBody(errorBody, context); - value.message = value.message ?? value.Message; - return value; -}; -const loadRestJsonErrorCode = (output, data) => { - const findKey = (object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()); - const sanitizeErrorCode = (rawValue) => { - let cleanValue = rawValue; - if (typeof cleanValue === "number") { - cleanValue = cleanValue.toString(); - } - if (cleanValue.indexOf(",") >= 0) { - cleanValue = cleanValue.split(",")[0]; - } - if (cleanValue.indexOf(":") >= 0) { - cleanValue = cleanValue.split(":")[0]; - } - if (cleanValue.indexOf("#") >= 0) { - cleanValue = cleanValue.split("#")[1]; - } - return cleanValue; + const signingRegion = (0, getResolvedSigningRegion_1.getResolvedSigningRegion)(hostname, { + signingRegion: (_e = regionHash[resolvedRegion]) === null || _e === void 0 ? void 0 : _e.signingRegion, + regionRegex: partitionHash[partition].regionRegex, + useFipsEndpoint, + }); + return { + partition, + signingService, + hostname, + ...(signingRegion && { signingRegion }), + ...(((_f = regionHash[resolvedRegion]) === null || _f === void 0 ? void 0 : _f.signingService) && { + signingService: regionHash[resolvedRegion].signingService, + }), }; - const headerKey = findKey(output.headers, "x-amzn-errortype"); - if (headerKey !== undefined) { - return sanitizeErrorCode(output.headers[headerKey]); - } - if (data.code !== undefined) { - return sanitizeErrorCode(data.code); +}; +exports.getRegionInfo = getRegionInfo; + + +/***/ }), + +/***/ 1487: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getResolvedHostname = void 0; +const getResolvedHostname = (resolvedRegion, { regionHostname, partitionHostname }) => regionHostname + ? regionHostname + : partitionHostname + ? partitionHostname.replace("{region}", resolvedRegion) + : undefined; +exports.getResolvedHostname = getResolvedHostname; + + +/***/ }), + +/***/ 44441: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getResolvedPartition = void 0; +const getResolvedPartition = (region, { partitionHash }) => { var _a; return (_a = Object.keys(partitionHash || {}).find((key) => partitionHash[key].regions.includes(region))) !== null && _a !== void 0 ? _a : "aws"; }; +exports.getResolvedPartition = getResolvedPartition; + + +/***/ }), + +/***/ 92281: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getResolvedSigningRegion = void 0; +const getResolvedSigningRegion = (hostname, { signingRegion, regionRegex, useFipsEndpoint }) => { + if (signingRegion) { + return signingRegion; } - if (data["__type"] !== undefined) { - return sanitizeErrorCode(data["__type"]); + else if (useFipsEndpoint) { + const regionRegexJs = regionRegex.replace("\\\\", "\\").replace(/^\^/g, "\\.").replace(/\$$/g, "\\."); + const regionRegexmatchArray = hostname.match(regionRegexJs); + if (regionRegexmatchArray) { + return regionRegexmatchArray[0].slice(1, -1); + } } }; +exports.getResolvedSigningRegion = getResolvedSigningRegion; /***/ }), -/***/ 25524: +/***/ 86985: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; const tslib_1 = __nccwpck_require__(4351); -const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(69722)); -const config_resolver_1 = __nccwpck_require__(56153); -const hash_node_1 = __nccwpck_require__(97442); -const middleware_retry_1 = __nccwpck_require__(96064); -const node_config_provider_1 = __nccwpck_require__(87684); -const node_http_handler_1 = __nccwpck_require__(68805); -const util_body_length_node_1 = __nccwpck_require__(74147); -const util_retry_1 = __nccwpck_require__(99395); -const util_user_agent_node_1 = __nccwpck_require__(98095); -const runtimeConfig_shared_1 = __nccwpck_require__(68005); -const smithy_client_1 = __nccwpck_require__(4963); -const util_defaults_mode_node_1 = __nccwpck_require__(74243); -const smithy_client_2 = __nccwpck_require__(4963); -const getRuntimeConfig = (config) => { - (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); - const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); - const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); - const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); - return { - ...clientSharedValues, - ...config, - runtime: "node", - defaultsMode, - bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, - defaultUserAgentProvider: config?.defaultUserAgentProvider ?? - (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), - maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), - region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), - requestHandler: config?.requestHandler ?? new node_http_handler_1.NodeHttpHandler(defaultConfigProvider), - retryMode: config?.retryMode ?? - (0, node_config_provider_1.loadConfig)({ - ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, - default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, - }), - sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), - streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, - useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), - useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), - }; -}; -exports.getRuntimeConfig = getRuntimeConfig; +tslib_1.__exportStar(__nccwpck_require__(19814), exports); +tslib_1.__exportStar(__nccwpck_require__(14832), exports); +tslib_1.__exportStar(__nccwpck_require__(77792), exports); /***/ }), -/***/ 68005: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 18044: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const url_parser_1 = __nccwpck_require__(2992); -const util_base64_1 = __nccwpck_require__(97727); -const util_utf8_1 = __nccwpck_require__(2855); -const endpointResolver_1 = __nccwpck_require__(97604); -const getRuntimeConfig = (config) => ({ - apiVersion: "2019-06-10", - base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, - base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, - disableHostPrefix: config?.disableHostPrefix ?? false, - endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, - logger: config?.logger ?? new smithy_client_1.NoOpLogger(), - serviceId: config?.serviceId ?? "SSO OIDC", - urlParser: config?.urlParser ?? url_parser_1.parseUrl, - utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, - utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, -}); -exports.getRuntimeConfig = getRuntimeConfig; +exports.Endpoint = void 0; +var Endpoint; +(function (Endpoint) { + Endpoint["IPv4"] = "http://169.254.169.254"; + Endpoint["IPv6"] = "http://[fd00:ec2::254]"; +})(Endpoint = exports.Endpoint || (exports.Endpoint = {})); /***/ }), -/***/ 69838: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 57342: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SSO = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const GetRoleCredentialsCommand_1 = __nccwpck_require__(18972); -const ListAccountRolesCommand_1 = __nccwpck_require__(1513); -const ListAccountsCommand_1 = __nccwpck_require__(64296); -const LogoutCommand_1 = __nccwpck_require__(12586); -const SSOClient_1 = __nccwpck_require__(71057); -const commands = { - GetRoleCredentialsCommand: GetRoleCredentialsCommand_1.GetRoleCredentialsCommand, - ListAccountRolesCommand: ListAccountRolesCommand_1.ListAccountRolesCommand, - ListAccountsCommand: ListAccountsCommand_1.ListAccountsCommand, - LogoutCommand: LogoutCommand_1.LogoutCommand, +exports.ENDPOINT_CONFIG_OPTIONS = exports.CONFIG_ENDPOINT_NAME = exports.ENV_ENDPOINT_NAME = void 0; +exports.ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT"; +exports.CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint"; +exports.ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[exports.ENV_ENDPOINT_NAME], + configFileSelector: (profile) => profile[exports.CONFIG_ENDPOINT_NAME], + default: undefined, }; -class SSO extends SSOClient_1.SSOClient { -} -exports.SSO = SSO; -(0, smithy_client_1.createAggregatedClient)(commands, SSO); /***/ }), -/***/ 71057: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 80991: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SSOClient = exports.__Client = void 0; -const config_resolver_1 = __nccwpck_require__(56153); -const middleware_content_length_1 = __nccwpck_require__(42245); -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_host_header_1 = __nccwpck_require__(22545); -const middleware_logger_1 = __nccwpck_require__(20014); -const middleware_recursion_detection_1 = __nccwpck_require__(85525); -const middleware_retry_1 = __nccwpck_require__(96064); -const middleware_user_agent_1 = __nccwpck_require__(64688); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } })); -const EndpointParameters_1 = __nccwpck_require__(34214); -const runtimeConfig_1 = __nccwpck_require__(19756); -class SSOClient extends smithy_client_1.Client { - constructor(configuration) { - const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration); - const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); - const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1); - const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2); - const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3); - const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_5); - super(_config_6); - this.config = _config_6; - this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); - this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); - this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); - this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); - this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); - this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); - } - destroy() { - super.destroy(); - } -} -exports.SSOClient = SSOClient; +exports.EndpointMode = void 0; +var EndpointMode; +(function (EndpointMode) { + EndpointMode["IPv4"] = "IPv4"; + EndpointMode["IPv6"] = "IPv6"; +})(EndpointMode = exports.EndpointMode || (exports.EndpointMode = {})); /***/ }), -/***/ 18972: +/***/ 88337: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetRoleCredentialsCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const models_0_1 = __nccwpck_require__(66390); -const Aws_restJson1_1 = __nccwpck_require__(98507); -class GetRoleCredentialsCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetRoleCredentialsCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "SSOClient"; - const commandName = "GetRoleCredentialsCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: models_0_1.GetRoleCredentialsRequestFilterSensitiveLog, - outputFilterSensitiveLog: models_0_1.GetRoleCredentialsResponseFilterSensitiveLog, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_restJson1_1.se_GetRoleCredentialsCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_restJson1_1.de_GetRoleCredentialsCommand)(output, context); - } -} -exports.GetRoleCredentialsCommand = GetRoleCredentialsCommand; +exports.ENDPOINT_MODE_CONFIG_OPTIONS = exports.CONFIG_ENDPOINT_MODE_NAME = exports.ENV_ENDPOINT_MODE_NAME = void 0; +const EndpointMode_1 = __nccwpck_require__(80991); +exports.ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE"; +exports.CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode"; +exports.ENDPOINT_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[exports.ENV_ENDPOINT_MODE_NAME], + configFileSelector: (profile) => profile[exports.CONFIG_ENDPOINT_MODE_NAME], + default: EndpointMode_1.EndpointMode.IPv4, +}; /***/ }), -/***/ 1513: +/***/ 89227: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ListAccountRolesCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const models_0_1 = __nccwpck_require__(66390); -const Aws_restJson1_1 = __nccwpck_require__(98507); -class ListAccountRolesCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, +exports.fromContainerMetadata = exports.ENV_CMDS_AUTH_TOKEN = exports.ENV_CMDS_RELATIVE_URI = exports.ENV_CMDS_FULL_URI = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const url_1 = __nccwpck_require__(57310); +const httpRequest_1 = __nccwpck_require__(32199); +const ImdsCredentials_1 = __nccwpck_require__(6894); +const RemoteProviderInit_1 = __nccwpck_require__(98533); +const retry_1 = __nccwpck_require__(91351); +exports.ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; +exports.ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; +exports.ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; +const fromContainerMetadata = (init = {}) => { + const { timeout, maxRetries } = (0, RemoteProviderInit_1.providerConfigFromInit)(init); + return () => (0, retry_1.retry)(async () => { + const requestOptions = await getCmdsUri(); + const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions)); + if (!(0, ImdsCredentials_1.isImdsCredentials)(credsResponse)) { + throw new property_provider_1.CredentialsProviderError("Invalid response received from instance metadata service."); + } + return (0, ImdsCredentials_1.fromImdsCredentials)(credsResponse); + }, maxRetries); +}; +exports.fromContainerMetadata = fromContainerMetadata; +const requestFromEcsImds = async (timeout, options) => { + if (process.env[exports.ENV_CMDS_AUTH_TOKEN]) { + options.headers = { + ...options.headers, + Authorization: process.env[exports.ENV_CMDS_AUTH_TOKEN], }; } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, ListAccountRolesCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "SSOClient"; - const commandName = "ListAccountRolesCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: models_0_1.ListAccountRolesRequestFilterSensitiveLog, - outputFilterSensitiveLog: (_) => _, + const buffer = await (0, httpRequest_1.httpRequest)({ + ...options, + timeout, + }); + return buffer.toString(); +}; +const CMDS_IP = "169.254.170.2"; +const GREENGRASS_HOSTS = { + localhost: true, + "127.0.0.1": true, +}; +const GREENGRASS_PROTOCOLS = { + "http:": true, + "https:": true, +}; +const getCmdsUri = async () => { + if (process.env[exports.ENV_CMDS_RELATIVE_URI]) { + return { + hostname: CMDS_IP, + path: process.env[exports.ENV_CMDS_RELATIVE_URI], }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); } - serialize(input, context) { - return (0, Aws_restJson1_1.se_ListAccountRolesCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_restJson1_1.de_ListAccountRolesCommand)(output, context); + if (process.env[exports.ENV_CMDS_FULL_URI]) { + const parsed = (0, url_1.parse)(process.env[exports.ENV_CMDS_FULL_URI]); + if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) { + throw new property_provider_1.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, false); + } + if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) { + throw new property_provider_1.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, false); + } + return { + ...parsed, + port: parsed.port ? parseInt(parsed.port, 10) : undefined, + }; } -} -exports.ListAccountRolesCommand = ListAccountRolesCommand; + throw new property_provider_1.CredentialsProviderError("The container metadata credential provider cannot be used unless" + + ` the ${exports.ENV_CMDS_RELATIVE_URI} or ${exports.ENV_CMDS_FULL_URI} environment` + + " variable is set", false); +}; /***/ }), -/***/ 64296: +/***/ 52207: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ListAccountsCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const models_0_1 = __nccwpck_require__(66390); -const Aws_restJson1_1 = __nccwpck_require__(98507); -class ListAccountsCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, ListAccountsCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "SSOClient"; - const commandName = "ListAccountsCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: models_0_1.ListAccountsRequestFilterSensitiveLog, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_restJson1_1.se_ListAccountsCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_restJson1_1.de_ListAccountsCommand)(output, context); +exports.fromInstanceMetadata = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const httpRequest_1 = __nccwpck_require__(32199); +const ImdsCredentials_1 = __nccwpck_require__(6894); +const RemoteProviderInit_1 = __nccwpck_require__(98533); +const retry_1 = __nccwpck_require__(91351); +const getInstanceMetadataEndpoint_1 = __nccwpck_require__(92460); +const staticStabilityProvider_1 = __nccwpck_require__(74035); +const IMDS_PATH = "/latest/meta-data/iam/security-credentials/"; +const IMDS_TOKEN_PATH = "/latest/api/token"; +const fromInstanceMetadata = (init = {}) => (0, staticStabilityProvider_1.staticStabilityProvider)(getInstanceImdsProvider(init), { logger: init.logger }); +exports.fromInstanceMetadata = fromInstanceMetadata; +const getInstanceImdsProvider = (init) => { + let disableFetchToken = false; + const { timeout, maxRetries } = (0, RemoteProviderInit_1.providerConfigFromInit)(init); + const getCredentials = async (maxRetries, options) => { + const profile = (await (0, retry_1.retry)(async () => { + let profile; + try { + profile = await getProfile(options); + } + catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; + } + throw err; + } + return profile; + }, maxRetries)).trim(); + return (0, retry_1.retry)(async () => { + let creds; + try { + creds = await getCredentialsFromProfile(profile, options); + } + catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; + } + throw err; + } + return creds; + }, maxRetries); + }; + return async () => { + const endpoint = await (0, getInstanceMetadataEndpoint_1.getInstanceMetadataEndpoint)(); + if (disableFetchToken) { + return getCredentials(maxRetries, { ...endpoint, timeout }); + } + else { + let token; + try { + token = (await getMetadataToken({ ...endpoint, timeout })).toString(); + } + catch (error) { + if ((error === null || error === void 0 ? void 0 : error.statusCode) === 400) { + throw Object.assign(error, { + message: "EC2 Metadata token request returned error", + }); + } + else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) { + disableFetchToken = true; + } + return getCredentials(maxRetries, { ...endpoint, timeout }); + } + return getCredentials(maxRetries, { + ...endpoint, + headers: { + "x-aws-ec2-metadata-token": token, + }, + timeout, + }); + } + }; +}; +const getMetadataToken = async (options) => (0, httpRequest_1.httpRequest)({ + ...options, + path: IMDS_TOKEN_PATH, + method: "PUT", + headers: { + "x-aws-ec2-metadata-token-ttl-seconds": "21600", + }, +}); +const getProfile = async (options) => (await (0, httpRequest_1.httpRequest)({ ...options, path: IMDS_PATH })).toString(); +const getCredentialsFromProfile = async (profile, options) => { + const credsResponse = JSON.parse((await (0, httpRequest_1.httpRequest)({ + ...options, + path: IMDS_PATH + profile, + })).toString()); + if (!(0, ImdsCredentials_1.isImdsCredentials)(credsResponse)) { + throw new property_provider_1.CredentialsProviderError("Invalid response received from instance metadata service."); } -} -exports.ListAccountsCommand = ListAccountsCommand; + return (0, ImdsCredentials_1.fromImdsCredentials)(credsResponse); +}; /***/ }), -/***/ 12586: +/***/ 7477: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.LogoutCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const models_0_1 = __nccwpck_require__(66390); -const Aws_restJson1_1 = __nccwpck_require__(98507); -class LogoutCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, LogoutCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "SSOClient"; - const commandName = "LogoutCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: models_0_1.LogoutRequestFilterSensitiveLog, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_restJson1_1.se_LogoutCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_restJson1_1.de_LogoutCommand)(output, context); - } -} -exports.LogoutCommand = LogoutCommand; +exports.getInstanceMetadataEndpoint = exports.httpRequest = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(89227), exports); +tslib_1.__exportStar(__nccwpck_require__(52207), exports); +tslib_1.__exportStar(__nccwpck_require__(98533), exports); +tslib_1.__exportStar(__nccwpck_require__(45036), exports); +var httpRequest_1 = __nccwpck_require__(32199); +Object.defineProperty(exports, "httpRequest", ({ enumerable: true, get: function () { return httpRequest_1.httpRequest; } })); +var getInstanceMetadataEndpoint_1 = __nccwpck_require__(92460); +Object.defineProperty(exports, "getInstanceMetadataEndpoint", ({ enumerable: true, get: function () { return getInstanceMetadataEndpoint_1.getInstanceMetadataEndpoint; } })); /***/ }), -/***/ 65706: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 6894: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(18972), exports); -tslib_1.__exportStar(__nccwpck_require__(1513), exports); -tslib_1.__exportStar(__nccwpck_require__(64296), exports); -tslib_1.__exportStar(__nccwpck_require__(12586), exports); +exports.fromImdsCredentials = exports.isImdsCredentials = void 0; +const isImdsCredentials = (arg) => Boolean(arg) && + typeof arg === "object" && + typeof arg.AccessKeyId === "string" && + typeof arg.SecretAccessKey === "string" && + typeof arg.Token === "string" && + typeof arg.Expiration === "string"; +exports.isImdsCredentials = isImdsCredentials; +const fromImdsCredentials = (creds) => ({ + accessKeyId: creds.AccessKeyId, + secretAccessKey: creds.SecretAccessKey, + sessionToken: creds.Token, + expiration: new Date(creds.Expiration), +}); +exports.fromImdsCredentials = fromImdsCredentials; /***/ }), -/***/ 34214: +/***/ 98533: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveClientEndpointParameters = void 0; -const resolveClientEndpointParameters = (options) => { - return { - ...options, - useDualstackEndpoint: options.useDualstackEndpoint ?? false, - useFipsEndpoint: options.useFipsEndpoint ?? false, - defaultSigningName: "awsssoportal", - }; -}; -exports.resolveClientEndpointParameters = resolveClientEndpointParameters; +exports.providerConfigFromInit = exports.DEFAULT_MAX_RETRIES = exports.DEFAULT_TIMEOUT = void 0; +exports.DEFAULT_TIMEOUT = 1000; +exports.DEFAULT_MAX_RETRIES = 0; +const providerConfigFromInit = ({ maxRetries = exports.DEFAULT_MAX_RETRIES, timeout = exports.DEFAULT_TIMEOUT, }) => ({ maxRetries, timeout }); +exports.providerConfigFromInit = providerConfigFromInit; /***/ }), -/***/ 30898: +/***/ 32199: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultEndpointResolver = void 0; -const util_endpoints_1 = __nccwpck_require__(13350); -const ruleset_1 = __nccwpck_require__(13341); -const defaultEndpointResolver = (endpointParams, context = {}) => { - return (0, util_endpoints_1.resolveEndpoint)(ruleset_1.ruleSet, { - endpointParams: endpointParams, - logger: context.logger, +exports.httpRequest = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const buffer_1 = __nccwpck_require__(14300); +const http_1 = __nccwpck_require__(13685); +function httpRequest(options) { + return new Promise((resolve, reject) => { + var _a; + const req = (0, http_1.request)({ + method: "GET", + ...options, + hostname: (_a = options.hostname) === null || _a === void 0 ? void 0 : _a.replace(/^\[(.+)\]$/, "$1"), + }); + req.on("error", (err) => { + reject(Object.assign(new property_provider_1.ProviderError("Unable to connect to instance metadata service"), err)); + req.destroy(); + }); + req.on("timeout", () => { + reject(new property_provider_1.ProviderError("TimeoutError from instance metadata service")); + req.destroy(); + }); + req.on("response", (res) => { + const { statusCode = 400 } = res; + if (statusCode < 200 || 300 <= statusCode) { + reject(Object.assign(new property_provider_1.ProviderError("Error response received from instance metadata service"), { statusCode })); + req.destroy(); + } + const chunks = []; + res.on("data", (chunk) => { + chunks.push(chunk); + }); + res.on("end", () => { + resolve(buffer_1.Buffer.concat(chunks)); + req.destroy(); + }); + }); + req.end(); }); +} +exports.httpRequest = httpRequest; + + +/***/ }), + +/***/ 91351: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.retry = void 0; +const retry = (toRetry, maxRetries) => { + let promise = toRetry(); + for (let i = 0; i < maxRetries; i++) { + promise = promise.catch(toRetry); + } + return promise; }; -exports.defaultEndpointResolver = defaultEndpointResolver; +exports.retry = retry; /***/ }), -/***/ 13341: +/***/ 45036: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ruleSet = void 0; -const p = "required", q = "fn", r = "argv", s = "ref"; -const a = "PartitionResult", b = "tree", c = "error", d = "endpoint", e = { [p]: false, "type": "String" }, f = { [p]: true, "default": false, "type": "Boolean" }, g = { [s]: "Endpoint" }, h = { [q]: "booleanEquals", [r]: [{ [s]: "UseFIPS" }, true] }, i = { [q]: "booleanEquals", [r]: [{ [s]: "UseDualStack" }, true] }, j = {}, k = { [q]: "booleanEquals", [r]: [true, { [q]: "getAttr", [r]: [{ [s]: a }, "supportsFIPS"] }] }, l = { [q]: "booleanEquals", [r]: [true, { [q]: "getAttr", [r]: [{ [s]: a }, "supportsDualStack"] }] }, m = [g], n = [h], o = [i]; -const _data = { version: "1.0", parameters: { Region: e, UseDualStack: f, UseFIPS: f, Endpoint: e }, rules: [{ conditions: [{ [q]: "aws.partition", [r]: [{ [s]: "Region" }], assign: a }], type: b, rules: [{ conditions: [{ [q]: "isSet", [r]: m }, { [q]: "parseURL", [r]: m, assign: "url" }], type: b, rules: [{ conditions: n, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: c }, { type: b, rules: [{ conditions: o, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: c }, { endpoint: { url: g, properties: j, headers: j }, type: d }] }] }, { conditions: [h, i], type: b, rules: [{ conditions: [k, l], type: b, rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: j, headers: j }, type: d }] }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: c }] }, { conditions: n, type: b, rules: [{ conditions: [k], type: b, rules: [{ type: b, rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dnsSuffix}", properties: j, headers: j }, type: d }] }] }, { error: "FIPS is enabled but this partition does not support FIPS", type: c }] }, { conditions: o, type: b, rules: [{ conditions: [l], type: b, rules: [{ endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: j, headers: j }, type: d }] }, { error: "DualStack is enabled but this partition does not support DualStack", type: c }] }, { endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dnsSuffix}", properties: j, headers: j }, type: d }] }] }; -exports.ruleSet = _data; /***/ }), -/***/ 82666: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 22666: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SSOServiceException = void 0; -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(71057), exports); -tslib_1.__exportStar(__nccwpck_require__(69838), exports); -tslib_1.__exportStar(__nccwpck_require__(65706), exports); -tslib_1.__exportStar(__nccwpck_require__(36773), exports); -tslib_1.__exportStar(__nccwpck_require__(14952), exports); -var SSOServiceException_1 = __nccwpck_require__(81517); -Object.defineProperty(exports, "SSOServiceException", ({ enumerable: true, get: function () { return SSOServiceException_1.SSOServiceException; } })); +exports.getExtendedInstanceMetadataCredentials = void 0; +const STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60; +const STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60; +const STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html"; +const getExtendedInstanceMetadataCredentials = (credentials, logger) => { + var _a; + const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + + Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS); + const newExpiration = new Date(Date.now() + refreshInterval * 1000); + logger.warn("Attempting credential expiration extension due to a credential service availability issue. A refresh of these " + + "credentials will be attempted after ${new Date(newExpiration)}.\nFor more information, please visit: " + + STATIC_STABILITY_DOC_URL); + const originalExpiration = (_a = credentials.originalExpiration) !== null && _a !== void 0 ? _a : credentials.expiration; + return { + ...credentials, + ...(originalExpiration ? { originalExpiration } : {}), + expiration: newExpiration, + }; +}; +exports.getExtendedInstanceMetadataCredentials = getExtendedInstanceMetadataCredentials; /***/ }), -/***/ 81517: +/***/ 92460: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SSOServiceException = exports.__ServiceException = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "__ServiceException", ({ enumerable: true, get: function () { return smithy_client_1.ServiceException; } })); -class SSOServiceException extends smithy_client_1.ServiceException { - constructor(options) { - super(options); - Object.setPrototypeOf(this, SSOServiceException.prototype); +exports.getInstanceMetadataEndpoint = void 0; +const node_config_provider_1 = __nccwpck_require__(33461); +const url_parser_1 = __nccwpck_require__(14681); +const Endpoint_1 = __nccwpck_require__(18044); +const EndpointConfigOptions_1 = __nccwpck_require__(57342); +const EndpointMode_1 = __nccwpck_require__(80991); +const EndpointModeConfigOptions_1 = __nccwpck_require__(88337); +const getInstanceMetadataEndpoint = async () => (0, url_parser_1.parseUrl)((await getFromEndpointConfig()) || (await getFromEndpointModeConfig())); +exports.getInstanceMetadataEndpoint = getInstanceMetadataEndpoint; +const getFromEndpointConfig = async () => (0, node_config_provider_1.loadConfig)(EndpointConfigOptions_1.ENDPOINT_CONFIG_OPTIONS)(); +const getFromEndpointModeConfig = async () => { + const endpointMode = await (0, node_config_provider_1.loadConfig)(EndpointModeConfigOptions_1.ENDPOINT_MODE_CONFIG_OPTIONS)(); + switch (endpointMode) { + case EndpointMode_1.EndpointMode.IPv4: + return Endpoint_1.Endpoint.IPv4; + case EndpointMode_1.EndpointMode.IPv6: + return Endpoint_1.Endpoint.IPv6; + default: + throw new Error(`Unsupported endpoint mode: ${endpointMode}.` + ` Select from ${Object.values(EndpointMode_1.EndpointMode)}`); } -} -exports.SSOServiceException = SSOServiceException; +}; /***/ }), -/***/ 14952: +/***/ 74035: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(66390), exports); +exports.staticStabilityProvider = void 0; +const getExtendedInstanceMetadataCredentials_1 = __nccwpck_require__(22666); +const staticStabilityProvider = (provider, options = {}) => { + const logger = (options === null || options === void 0 ? void 0 : options.logger) || console; + let pastCredentials; + return async () => { + let credentials; + try { + credentials = await provider(); + if (credentials.expiration && credentials.expiration.getTime() < Date.now()) { + credentials = (0, getExtendedInstanceMetadataCredentials_1.getExtendedInstanceMetadataCredentials)(credentials, logger); + } + } + catch (e) { + if (pastCredentials) { + logger.warn("Credential renew failed: ", e); + credentials = (0, getExtendedInstanceMetadataCredentials_1.getExtendedInstanceMetadataCredentials)(pastCredentials, logger); + } + else { + throw e; + } + } + pastCredentials = credentials; + return credentials; + }; +}; +exports.staticStabilityProvider = staticStabilityProvider; /***/ }), -/***/ 66390: +/***/ 11014: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.LogoutRequestFilterSensitiveLog = exports.ListAccountsRequestFilterSensitiveLog = exports.ListAccountRolesRequestFilterSensitiveLog = exports.GetRoleCredentialsResponseFilterSensitiveLog = exports.RoleCredentialsFilterSensitiveLog = exports.GetRoleCredentialsRequestFilterSensitiveLog = exports.UnauthorizedException = exports.TooManyRequestsException = exports.ResourceNotFoundException = exports.InvalidRequestException = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const SSOServiceException_1 = __nccwpck_require__(81517); -class InvalidRequestException extends SSOServiceException_1.SSOServiceException { - constructor(opts) { - super({ - name: "InvalidRequestException", - $fault: "client", - ...opts, - }); - this.name = "InvalidRequestException"; - this.$fault = "client"; - Object.setPrototypeOf(this, InvalidRequestException.prototype); +exports.EventStreamCodec = void 0; +const crc32_1 = __nccwpck_require__(47327); +const HeaderMarshaller_1 = __nccwpck_require__(74712); +const splitMessage_1 = __nccwpck_require__(20597); +class EventStreamCodec { + constructor(toUtf8, fromUtf8) { + this.headerMarshaller = new HeaderMarshaller_1.HeaderMarshaller(toUtf8, fromUtf8); + this.messageBuffer = []; + this.isEndOfStream = false; } -} -exports.InvalidRequestException = InvalidRequestException; -class ResourceNotFoundException extends SSOServiceException_1.SSOServiceException { - constructor(opts) { - super({ - name: "ResourceNotFoundException", - $fault: "client", - ...opts, - }); - this.name = "ResourceNotFoundException"; - this.$fault = "client"; - Object.setPrototypeOf(this, ResourceNotFoundException.prototype); + feed(message) { + this.messageBuffer.push(this.decode(message)); } -} -exports.ResourceNotFoundException = ResourceNotFoundException; -class TooManyRequestsException extends SSOServiceException_1.SSOServiceException { - constructor(opts) { - super({ - name: "TooManyRequestsException", - $fault: "client", - ...opts, - }); - this.name = "TooManyRequestsException"; - this.$fault = "client"; - Object.setPrototypeOf(this, TooManyRequestsException.prototype); + endOfStream() { + this.isEndOfStream = true; } -} -exports.TooManyRequestsException = TooManyRequestsException; -class UnauthorizedException extends SSOServiceException_1.SSOServiceException { - constructor(opts) { - super({ - name: "UnauthorizedException", - $fault: "client", - ...opts, - }); - this.name = "UnauthorizedException"; - this.$fault = "client"; - Object.setPrototypeOf(this, UnauthorizedException.prototype); + getMessage() { + const message = this.messageBuffer.pop(); + const isEndOfStream = this.isEndOfStream; + return { + getMessage() { + return message; + }, + isEndOfStream() { + return isEndOfStream; + }, + }; + } + getAvailableMessages() { + const messages = this.messageBuffer; + this.messageBuffer = []; + const isEndOfStream = this.isEndOfStream; + return { + getMessages() { + return messages; + }, + isEndOfStream() { + return isEndOfStream; + }, + }; + } + encode({ headers: rawHeaders, body }) { + const headers = this.headerMarshaller.format(rawHeaders); + const length = headers.byteLength + body.byteLength + 16; + const out = new Uint8Array(length); + const view = new DataView(out.buffer, out.byteOffset, out.byteLength); + const checksum = new crc32_1.Crc32(); + view.setUint32(0, length, false); + view.setUint32(4, headers.byteLength, false); + view.setUint32(8, checksum.update(out.subarray(0, 8)).digest(), false); + out.set(headers, 12); + out.set(body, headers.byteLength + 12); + view.setUint32(length - 4, checksum.update(out.subarray(8, length - 4)).digest(), false); + return out; + } + decode(message) { + const { headers, body } = (0, splitMessage_1.splitMessage)(message); + return { headers: this.headerMarshaller.parse(headers), body }; + } + formatHeaders(rawHeaders) { + return this.headerMarshaller.format(rawHeaders); } } -exports.UnauthorizedException = UnauthorizedException; -const GetRoleCredentialsRequestFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }), -}); -exports.GetRoleCredentialsRequestFilterSensitiveLog = GetRoleCredentialsRequestFilterSensitiveLog; -const RoleCredentialsFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.secretAccessKey && { secretAccessKey: smithy_client_1.SENSITIVE_STRING }), - ...(obj.sessionToken && { sessionToken: smithy_client_1.SENSITIVE_STRING }), -}); -exports.RoleCredentialsFilterSensitiveLog = RoleCredentialsFilterSensitiveLog; -const GetRoleCredentialsResponseFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.roleCredentials && { roleCredentials: (0, exports.RoleCredentialsFilterSensitiveLog)(obj.roleCredentials) }), -}); -exports.GetRoleCredentialsResponseFilterSensitiveLog = GetRoleCredentialsResponseFilterSensitiveLog; -const ListAccountRolesRequestFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }), -}); -exports.ListAccountRolesRequestFilterSensitiveLog = ListAccountRolesRequestFilterSensitiveLog; -const ListAccountsRequestFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }), -}); -exports.ListAccountsRequestFilterSensitiveLog = ListAccountsRequestFilterSensitiveLog; -const LogoutRequestFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }), -}); -exports.LogoutRequestFilterSensitiveLog = LogoutRequestFilterSensitiveLog; +exports.EventStreamCodec = EventStreamCodec; /***/ }), -/***/ 80849: -/***/ ((__unused_webpack_module, exports) => { +/***/ 74712: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HeaderMarshaller = void 0; +const util_hex_encoding_1 = __nccwpck_require__(45364); +const Int64_1 = __nccwpck_require__(46086); +class HeaderMarshaller { + constructor(toUtf8, fromUtf8) { + this.toUtf8 = toUtf8; + this.fromUtf8 = fromUtf8; + } + format(headers) { + const chunks = []; + for (const headerName of Object.keys(headers)) { + const bytes = this.fromUtf8(headerName); + chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName])); + } + const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0)); + let position = 0; + for (const chunk of chunks) { + out.set(chunk, position); + position += chunk.byteLength; + } + return out; + } + formatHeaderValue(header) { + switch (header.type) { + case "boolean": + return Uint8Array.from([header.value ? 0 : 1]); + case "byte": + return Uint8Array.from([2, header.value]); + case "short": + const shortView = new DataView(new ArrayBuffer(3)); + shortView.setUint8(0, 3); + shortView.setInt16(1, header.value, false); + return new Uint8Array(shortView.buffer); + case "integer": + const intView = new DataView(new ArrayBuffer(5)); + intView.setUint8(0, 4); + intView.setInt32(1, header.value, false); + return new Uint8Array(intView.buffer); + case "long": + const longBytes = new Uint8Array(9); + longBytes[0] = 5; + longBytes.set(header.value.bytes, 1); + return longBytes; + case "binary": + const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength)); + binView.setUint8(0, 6); + binView.setUint16(1, header.value.byteLength, false); + const binBytes = new Uint8Array(binView.buffer); + binBytes.set(header.value, 3); + return binBytes; + case "string": + const utf8Bytes = this.fromUtf8(header.value); + const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength)); + strView.setUint8(0, 7); + strView.setUint16(1, utf8Bytes.byteLength, false); + const strBytes = new Uint8Array(strView.buffer); + strBytes.set(utf8Bytes, 3); + return strBytes; + case "timestamp": + const tsBytes = new Uint8Array(9); + tsBytes[0] = 8; + tsBytes.set(Int64_1.Int64.fromNumber(header.value.valueOf()).bytes, 1); + return tsBytes; + case "uuid": + if (!UUID_PATTERN.test(header.value)) { + throw new Error(`Invalid UUID received: ${header.value}`); + } + const uuidBytes = new Uint8Array(17); + uuidBytes[0] = 9; + uuidBytes.set((0, util_hex_encoding_1.fromHex)(header.value.replace(/\-/g, "")), 1); + return uuidBytes; + } + } + parse(headers) { + const out = {}; + let position = 0; + while (position < headers.byteLength) { + const nameLength = headers.getUint8(position++); + const name = this.toUtf8(new Uint8Array(headers.buffer, headers.byteOffset + position, nameLength)); + position += nameLength; + switch (headers.getUint8(position++)) { + case 0: + out[name] = { + type: BOOLEAN_TAG, + value: true, + }; + break; + case 1: + out[name] = { + type: BOOLEAN_TAG, + value: false, + }; + break; + case 2: + out[name] = { + type: BYTE_TAG, + value: headers.getInt8(position++), + }; + break; + case 3: + out[name] = { + type: SHORT_TAG, + value: headers.getInt16(position, false), + }; + position += 2; + break; + case 4: + out[name] = { + type: INT_TAG, + value: headers.getInt32(position, false), + }; + position += 4; + break; + case 5: + out[name] = { + type: LONG_TAG, + value: new Int64_1.Int64(new Uint8Array(headers.buffer, headers.byteOffset + position, 8)), + }; + position += 8; + break; + case 6: + const binaryLength = headers.getUint16(position, false); + position += 2; + out[name] = { + type: BINARY_TAG, + value: new Uint8Array(headers.buffer, headers.byteOffset + position, binaryLength), + }; + position += binaryLength; + break; + case 7: + const stringLength = headers.getUint16(position, false); + position += 2; + out[name] = { + type: STRING_TAG, + value: this.toUtf8(new Uint8Array(headers.buffer, headers.byteOffset + position, stringLength)), + }; + position += stringLength; + break; + case 8: + out[name] = { + type: TIMESTAMP_TAG, + value: new Date(new Int64_1.Int64(new Uint8Array(headers.buffer, headers.byteOffset + position, 8)).valueOf()), + }; + position += 8; + break; + case 9: + const uuidBytes = new Uint8Array(headers.buffer, headers.byteOffset + position, 16); + position += 16; + out[name] = { + type: UUID_TAG, + value: `${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(0, 4))}-${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(4, 6))}-${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(6, 8))}-${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(8, 10))}-${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(10))}`, + }; + break; + default: + throw new Error(`Unrecognized header type tag`); + } + } + return out; + } +} +exports.HeaderMarshaller = HeaderMarshaller; +var HEADER_VALUE_TYPE; +(function (HEADER_VALUE_TYPE) { + HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["boolTrue"] = 0] = "boolTrue"; + HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["boolFalse"] = 1] = "boolFalse"; + HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["byte"] = 2] = "byte"; + HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["short"] = 3] = "short"; + HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["integer"] = 4] = "integer"; + HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["long"] = 5] = "long"; + HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["byteArray"] = 6] = "byteArray"; + HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["string"] = 7] = "string"; + HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["timestamp"] = 8] = "timestamp"; + HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["uuid"] = 9] = "uuid"; +})(HEADER_VALUE_TYPE || (HEADER_VALUE_TYPE = {})); +const BOOLEAN_TAG = "boolean"; +const BYTE_TAG = "byte"; +const SHORT_TAG = "short"; +const INT_TAG = "integer"; +const LONG_TAG = "long"; +const BINARY_TAG = "binary"; +const STRING_TAG = "string"; +const TIMESTAMP_TAG = "timestamp"; +const UUID_TAG = "uuid"; +const UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/; /***/ }), -/***/ 88460: +/***/ 46086: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.paginateListAccountRoles = void 0; -const ListAccountRolesCommand_1 = __nccwpck_require__(1513); -const SSOClient_1 = __nccwpck_require__(71057); -const makePagedClientRequest = async (client, input, ...args) => { - return await client.send(new ListAccountRolesCommand_1.ListAccountRolesCommand(input), ...args); -}; -async function* paginateListAccountRoles(config, input, ...additionalArguments) { - let token = config.startingToken || undefined; - let hasNext = true; - let page; - while (hasNext) { - input.nextToken = token; - input["maxResults"] = config.pageSize; - if (config.client instanceof SSOClient_1.SSOClient) { - page = await makePagedClientRequest(config.client, input, ...additionalArguments); +exports.Int64 = void 0; +const util_hex_encoding_1 = __nccwpck_require__(45364); +class Int64 { + constructor(bytes) { + this.bytes = bytes; + if (bytes.byteLength !== 8) { + throw new Error("Int64 buffers must be exactly 8 bytes"); } - else { - throw new Error("Invalid client, expected SSO | SSOClient"); + } + static fromNumber(number) { + if (number > 9223372036854776000 || number < -9223372036854776000) { + throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`); } - yield page; - const prevToken = token; - token = page.nextToken; - hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + const bytes = new Uint8Array(8); + for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) { + bytes[i] = remaining; + } + if (number < 0) { + negate(bytes); + } + return new Int64(bytes); + } + valueOf() { + const bytes = this.bytes.slice(0); + const negative = bytes[0] & 0b10000000; + if (negative) { + negate(bytes); + } + return parseInt((0, util_hex_encoding_1.toHex)(bytes), 16) * (negative ? -1 : 1); + } + toString() { + return String(this.valueOf()); + } +} +exports.Int64 = Int64; +function negate(bytes) { + for (let i = 0; i < 8; i++) { + bytes[i] ^= 0xff; + } + for (let i = 7; i > -1; i--) { + bytes[i]++; + if (bytes[i] !== 0) + break; } - return undefined; } -exports.paginateListAccountRoles = paginateListAccountRoles; /***/ }), -/***/ 50938: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 73684: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.paginateListAccounts = void 0; -const ListAccountsCommand_1 = __nccwpck_require__(64296); -const SSOClient_1 = __nccwpck_require__(71057); -const makePagedClientRequest = async (client, input, ...args) => { - return await client.send(new ListAccountsCommand_1.ListAccountsCommand(input), ...args); -}; -async function* paginateListAccounts(config, input, ...additionalArguments) { - let token = config.startingToken || undefined; - let hasNext = true; - let page; - while (hasNext) { - input.nextToken = token; - input["maxResults"] = config.pageSize; - if (config.client instanceof SSOClient_1.SSOClient) { - page = await makePagedClientRequest(config.client, input, ...additionalArguments); - } - else { - throw new Error("Invalid client, expected SSO | SSOClient"); - } - yield page; - const prevToken = token; - token = page.nextToken; - hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); - } - return undefined; -} -exports.paginateListAccounts = paginateListAccounts; /***/ }), -/***/ 36773: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 57255: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(80849), exports); -tslib_1.__exportStar(__nccwpck_require__(88460), exports); -tslib_1.__exportStar(__nccwpck_require__(50938), exports); +exports.MessageDecoderStream = void 0; +class MessageDecoderStream { + constructor(options) { + this.options = options; + } + [Symbol.asyncIterator]() { + return this.asyncIterator(); + } + async *asyncIterator() { + for await (const bytes of this.options.inputStream) { + const decoded = this.options.decoder.decode(bytes); + yield decoded; + } + } +} +exports.MessageDecoderStream = MessageDecoderStream; /***/ }), -/***/ 98507: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 52362: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.de_LogoutCommand = exports.de_ListAccountsCommand = exports.de_ListAccountRolesCommand = exports.de_GetRoleCredentialsCommand = exports.se_LogoutCommand = exports.se_ListAccountsCommand = exports.se_ListAccountRolesCommand = exports.se_GetRoleCredentialsCommand = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const protocol_http_1 = __nccwpck_require__(64418); -const models_0_1 = __nccwpck_require__(66390); -const SSOServiceException_1 = __nccwpck_require__(81517); -const se_GetRoleCredentialsCommand = async (input, context) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const headers = (0, smithy_client_1.map)({}, isSerializableHeaderValue, { - "x-amz-sso_bearer_token": input.accessToken, - }); - const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/federation/credentials"; - const query = (0, smithy_client_1.map)({ - role_name: [, (0, smithy_client_1.expectNonNull)(input.roleName, `roleName`)], - account_id: [, (0, smithy_client_1.expectNonNull)(input.accountId, `accountId`)], - }); - let body; - return new protocol_http_1.HttpRequest({ - protocol, - hostname, - port, - method: "GET", - headers, - path: resolvedPath, - query, - body, - }); -}; -exports.se_GetRoleCredentialsCommand = se_GetRoleCredentialsCommand; -const se_ListAccountRolesCommand = async (input, context) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const headers = (0, smithy_client_1.map)({}, isSerializableHeaderValue, { - "x-amz-sso_bearer_token": input.accessToken, - }); - const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/assignment/roles"; - const query = (0, smithy_client_1.map)({ - next_token: [, input.nextToken], - max_result: [() => input.maxResults !== void 0, () => input.maxResults.toString()], - account_id: [, (0, smithy_client_1.expectNonNull)(input.accountId, `accountId`)], - }); - let body; - return new protocol_http_1.HttpRequest({ - protocol, - hostname, - port, - method: "GET", - headers, - path: resolvedPath, - query, - body, - }); -}; -exports.se_ListAccountRolesCommand = se_ListAccountRolesCommand; -const se_ListAccountsCommand = async (input, context) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const headers = (0, smithy_client_1.map)({}, isSerializableHeaderValue, { - "x-amz-sso_bearer_token": input.accessToken, - }); - const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/assignment/accounts"; - const query = (0, smithy_client_1.map)({ - next_token: [, input.nextToken], - max_result: [() => input.maxResults !== void 0, () => input.maxResults.toString()], - }); - let body; - return new protocol_http_1.HttpRequest({ - protocol, - hostname, - port, - method: "GET", - headers, - path: resolvedPath, - query, - body, - }); -}; -exports.se_ListAccountsCommand = se_ListAccountsCommand; -const se_LogoutCommand = async (input, context) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const headers = (0, smithy_client_1.map)({}, isSerializableHeaderValue, { - "x-amz-sso_bearer_token": input.accessToken, - }); - const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/logout"; - let body; - return new protocol_http_1.HttpRequest({ - protocol, - hostname, - port, - method: "POST", - headers, - path: resolvedPath, - body, - }); -}; -exports.se_LogoutCommand = se_LogoutCommand; -const de_GetRoleCredentialsCommand = async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_GetRoleCredentialsCommandError(output, context); - } - const contents = (0, smithy_client_1.map)({ - $metadata: deserializeMetadata(output), - }); - const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body"); - const doc = (0, smithy_client_1.take)(data, { - roleCredentials: smithy_client_1._json, - }); - Object.assign(contents, doc); - return contents; -}; -exports.de_GetRoleCredentialsCommand = de_GetRoleCredentialsCommand; -const de_GetRoleCredentialsCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidRequestException": - case "com.amazonaws.sso#InvalidRequestException": - throw await de_InvalidRequestExceptionRes(parsedOutput, context); - case "ResourceNotFoundException": - case "com.amazonaws.sso#ResourceNotFoundException": - throw await de_ResourceNotFoundExceptionRes(parsedOutput, context); - case "TooManyRequestsException": - case "com.amazonaws.sso#TooManyRequestsException": - throw await de_TooManyRequestsExceptionRes(parsedOutput, context); - case "UnauthorizedException": - case "com.amazonaws.sso#UnauthorizedException": - throw await de_UnauthorizedExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); - } -}; -const de_ListAccountRolesCommand = async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_ListAccountRolesCommandError(output, context); - } - const contents = (0, smithy_client_1.map)({ - $metadata: deserializeMetadata(output), - }); - const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body"); - const doc = (0, smithy_client_1.take)(data, { - nextToken: smithy_client_1.expectString, - roleList: smithy_client_1._json, - }); - Object.assign(contents, doc); - return contents; -}; -exports.de_ListAccountRolesCommand = de_ListAccountRolesCommand; -const de_ListAccountRolesCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidRequestException": - case "com.amazonaws.sso#InvalidRequestException": - throw await de_InvalidRequestExceptionRes(parsedOutput, context); - case "ResourceNotFoundException": - case "com.amazonaws.sso#ResourceNotFoundException": - throw await de_ResourceNotFoundExceptionRes(parsedOutput, context); - case "TooManyRequestsException": - case "com.amazonaws.sso#TooManyRequestsException": - throw await de_TooManyRequestsExceptionRes(parsedOutput, context); - case "UnauthorizedException": - case "com.amazonaws.sso#UnauthorizedException": - throw await de_UnauthorizedExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); - } -}; -const de_ListAccountsCommand = async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_ListAccountsCommandError(output, context); - } - const contents = (0, smithy_client_1.map)({ - $metadata: deserializeMetadata(output), - }); - const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body"); - const doc = (0, smithy_client_1.take)(data, { - accountList: smithy_client_1._json, - nextToken: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - return contents; -}; -exports.de_ListAccountsCommand = de_ListAccountsCommand; -const de_ListAccountsCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidRequestException": - case "com.amazonaws.sso#InvalidRequestException": - throw await de_InvalidRequestExceptionRes(parsedOutput, context); - case "ResourceNotFoundException": - case "com.amazonaws.sso#ResourceNotFoundException": - throw await de_ResourceNotFoundExceptionRes(parsedOutput, context); - case "TooManyRequestsException": - case "com.amazonaws.sso#TooManyRequestsException": - throw await de_TooManyRequestsExceptionRes(parsedOutput, context); - case "UnauthorizedException": - case "com.amazonaws.sso#UnauthorizedException": - throw await de_UnauthorizedExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); - } -}; -const de_LogoutCommand = async (output, context) => { - if (output.statusCode !== 200 && output.statusCode >= 300) { - return de_LogoutCommandError(output, context); - } - const contents = (0, smithy_client_1.map)({ - $metadata: deserializeMetadata(output), - }); - await (0, smithy_client_1.collectBody)(output.body, context); - return contents; -}; -exports.de_LogoutCommand = de_LogoutCommand; -const de_LogoutCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidRequestException": - case "com.amazonaws.sso#InvalidRequestException": - throw await de_InvalidRequestExceptionRes(parsedOutput, context); - case "TooManyRequestsException": - case "com.amazonaws.sso#TooManyRequestsException": - throw await de_TooManyRequestsExceptionRes(parsedOutput, context); - case "UnauthorizedException": - case "com.amazonaws.sso#UnauthorizedException": - throw await de_UnauthorizedExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody, - errorCode, - }); +exports.MessageEncoderStream = void 0; +class MessageEncoderStream { + constructor(options) { + this.options = options; } -}; -const throwDefaultError = (0, smithy_client_1.withBaseException)(SSOServiceException_1.SSOServiceException); -const de_InvalidRequestExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - message: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.InvalidRequestException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_ResourceNotFoundExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - message: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.ResourceNotFoundException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_TooManyRequestsExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - message: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.TooManyRequestsException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const de_UnauthorizedExceptionRes = async (parsedOutput, context) => { - const contents = (0, smithy_client_1.map)({}); - const data = parsedOutput.body; - const doc = (0, smithy_client_1.take)(data, { - message: smithy_client_1.expectString, - }); - Object.assign(contents, doc); - const exception = new models_0_1.UnauthorizedException({ - $metadata: deserializeMetadata(parsedOutput), - ...contents, - }); - return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); -}; -const deserializeMetadata = (output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"], -}); -const collectBodyString = (streamBody, context) => (0, smithy_client_1.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)); -const isSerializableHeaderValue = (value) => value !== undefined && - value !== null && - value !== "" && - (!Object.getOwnPropertyNames(value).includes("length") || value.length != 0) && - (!Object.getOwnPropertyNames(value).includes("size") || value.size != 0); -const parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { - if (encoded.length) { - return JSON.parse(encoded); + [Symbol.asyncIterator]() { + return this.asyncIterator(); } - return {}; -}); -const parseErrorBody = async (errorBody, context) => { - const value = await parseBody(errorBody, context); - value.message = value.message ?? value.Message; - return value; -}; -const loadRestJsonErrorCode = (output, data) => { - const findKey = (object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()); - const sanitizeErrorCode = (rawValue) => { - let cleanValue = rawValue; - if (typeof cleanValue === "number") { - cleanValue = cleanValue.toString(); - } - if (cleanValue.indexOf(",") >= 0) { - cleanValue = cleanValue.split(",")[0]; + async *asyncIterator() { + for await (const msg of this.options.messageStream) { + const encoded = this.options.encoder.encode(msg); + yield encoded; } - if (cleanValue.indexOf(":") >= 0) { - cleanValue = cleanValue.split(":")[0]; + if (this.options.includeEndFrame) { + yield new Uint8Array(0); } - if (cleanValue.indexOf("#") >= 0) { - cleanValue = cleanValue.split("#")[1]; + } +} +exports.MessageEncoderStream = MessageEncoderStream; + + +/***/ }), + +/***/ 62379: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SmithyMessageDecoderStream = void 0; +class SmithyMessageDecoderStream { + constructor(options) { + this.options = options; + } + [Symbol.asyncIterator]() { + return this.asyncIterator(); + } + async *asyncIterator() { + for await (const message of this.options.messageStream) { + const deserialized = await this.options.deserializer(message); + if (deserialized === undefined) + continue; + yield deserialized; } - return cleanValue; - }; - const headerKey = findKey(output.headers, "x-amzn-errortype"); - if (headerKey !== undefined) { - return sanitizeErrorCode(output.headers[headerKey]); } - if (data.code !== undefined) { - return sanitizeErrorCode(data.code); +} +exports.SmithyMessageDecoderStream = SmithyMessageDecoderStream; + + +/***/ }), + +/***/ 12484: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SmithyMessageEncoderStream = void 0; +class SmithyMessageEncoderStream { + constructor(options) { + this.options = options; } - if (data["__type"] !== undefined) { - return sanitizeErrorCode(data["__type"]); + [Symbol.asyncIterator]() { + return this.asyncIterator(); } -}; + async *asyncIterator() { + for await (const chunk of this.options.inputStream) { + const payloadBuf = this.options.serializer(chunk); + yield payloadBuf; + } + } +} +exports.SmithyMessageEncoderStream = SmithyMessageEncoderStream; /***/ }), -/***/ 19756: +/***/ 56459: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; const tslib_1 = __nccwpck_require__(4351); -const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(91092)); -const config_resolver_1 = __nccwpck_require__(56153); -const hash_node_1 = __nccwpck_require__(97442); -const middleware_retry_1 = __nccwpck_require__(96064); -const node_config_provider_1 = __nccwpck_require__(87684); -const node_http_handler_1 = __nccwpck_require__(68805); -const util_body_length_node_1 = __nccwpck_require__(74147); -const util_retry_1 = __nccwpck_require__(99395); -const util_user_agent_node_1 = __nccwpck_require__(98095); -const runtimeConfig_shared_1 = __nccwpck_require__(44809); -const smithy_client_1 = __nccwpck_require__(4963); -const util_defaults_mode_node_1 = __nccwpck_require__(74243); -const smithy_client_2 = __nccwpck_require__(4963); -const getRuntimeConfig = (config) => { - (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); - const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); - const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); - const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); +tslib_1.__exportStar(__nccwpck_require__(11014), exports); +tslib_1.__exportStar(__nccwpck_require__(74712), exports); +tslib_1.__exportStar(__nccwpck_require__(46086), exports); +tslib_1.__exportStar(__nccwpck_require__(73684), exports); +tslib_1.__exportStar(__nccwpck_require__(57255), exports); +tslib_1.__exportStar(__nccwpck_require__(52362), exports); +tslib_1.__exportStar(__nccwpck_require__(62379), exports); +tslib_1.__exportStar(__nccwpck_require__(12484), exports); + + +/***/ }), + +/***/ 20597: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.splitMessage = void 0; +const crc32_1 = __nccwpck_require__(47327); +const PRELUDE_MEMBER_LENGTH = 4; +const PRELUDE_LENGTH = PRELUDE_MEMBER_LENGTH * 2; +const CHECKSUM_LENGTH = 4; +const MINIMUM_MESSAGE_LENGTH = PRELUDE_LENGTH + CHECKSUM_LENGTH * 2; +function splitMessage({ byteLength, byteOffset, buffer }) { + if (byteLength < MINIMUM_MESSAGE_LENGTH) { + throw new Error("Provided message too short to accommodate event stream message overhead"); + } + const view = new DataView(buffer, byteOffset, byteLength); + const messageLength = view.getUint32(0, false); + if (byteLength !== messageLength) { + throw new Error("Reported message length does not match received message length"); + } + const headerLength = view.getUint32(PRELUDE_MEMBER_LENGTH, false); + const expectedPreludeChecksum = view.getUint32(PRELUDE_LENGTH, false); + const expectedMessageChecksum = view.getUint32(byteLength - CHECKSUM_LENGTH, false); + const checksummer = new crc32_1.Crc32().update(new Uint8Array(buffer, byteOffset, PRELUDE_LENGTH)); + if (expectedPreludeChecksum !== checksummer.digest()) { + throw new Error(`The prelude checksum specified in the message (${expectedPreludeChecksum}) does not match the calculated CRC32 checksum (${checksummer.digest()})`); + } + checksummer.update(new Uint8Array(buffer, byteOffset + PRELUDE_LENGTH, byteLength - (PRELUDE_LENGTH + CHECKSUM_LENGTH))); + if (expectedMessageChecksum !== checksummer.digest()) { + throw new Error(`The message checksum (${checksummer.digest()}) did not match the expected value of ${expectedMessageChecksum}`); + } return { - ...clientSharedValues, - ...config, - runtime: "node", - defaultsMode, - bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, - defaultUserAgentProvider: config?.defaultUserAgentProvider ?? - (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), - maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), - region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), - requestHandler: config?.requestHandler ?? new node_http_handler_1.NodeHttpHandler(defaultConfigProvider), - retryMode: config?.retryMode ?? - (0, node_config_provider_1.loadConfig)({ - ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, - default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, - }), - sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), - streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, - useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), - useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), + headers: new DataView(buffer, byteOffset + PRELUDE_LENGTH + CHECKSUM_LENGTH, headerLength), + body: new Uint8Array(buffer, byteOffset + PRELUDE_LENGTH + CHECKSUM_LENGTH + headerLength, messageLength - headerLength - (PRELUDE_LENGTH + CHECKSUM_LENGTH + CHECKSUM_LENGTH)), }; -}; -exports.getRuntimeConfig = getRuntimeConfig; +} +exports.splitMessage = splitMessage; /***/ }), -/***/ 44809: +/***/ 3081: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const url_parser_1 = __nccwpck_require__(2992); -const util_base64_1 = __nccwpck_require__(97727); -const util_utf8_1 = __nccwpck_require__(2855); -const endpointResolver_1 = __nccwpck_require__(30898); -const getRuntimeConfig = (config) => ({ - apiVersion: "2019-06-10", - base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, - base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, - disableHostPrefix: config?.disableHostPrefix ?? false, - endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, - logger: config?.logger ?? new smithy_client_1.NoOpLogger(), - serviceId: config?.serviceId ?? "SSO", - urlParser: config?.urlParser ?? url_parser_1.parseUrl, - utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, - utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, -}); -exports.getRuntimeConfig = getRuntimeConfig; +exports.Hash = void 0; +const util_buffer_from_1 = __nccwpck_require__(31381); +const util_utf8_1 = __nccwpck_require__(41895); +const buffer_1 = __nccwpck_require__(14300); +const crypto_1 = __nccwpck_require__(6113); +class Hash { + constructor(algorithmIdentifier, secret) { + this.algorithmIdentifier = algorithmIdentifier; + this.secret = secret; + this.reset(); + } + update(toHash, encoding) { + this.hash.update((0, util_utf8_1.toUint8Array)(castSourceData(toHash, encoding))); + } + digest() { + return Promise.resolve(this.hash.digest()); + } + reset() { + this.hash = this.secret + ? (0, crypto_1.createHmac)(this.algorithmIdentifier, castSourceData(this.secret)) + : (0, crypto_1.createHash)(this.algorithmIdentifier); + } +} +exports.Hash = Hash; +function castSourceData(toCast, encoding) { + if (buffer_1.Buffer.isBuffer(toCast)) { + return toCast; + } + if (typeof toCast === "string") { + return (0, util_buffer_from_1.fromString)(toCast, encoding); + } + if (ArrayBuffer.isView(toCast)) { + return (0, util_buffer_from_1.fromArrayBuffer)(toCast.buffer, toCast.byteOffset, toCast.byteLength); + } + return (0, util_buffer_from_1.fromArrayBuffer)(toCast); +} /***/ }), -/***/ 32605: +/***/ 10780: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isArrayBuffer = void 0; +const isArrayBuffer = (arg) => (typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer) || + Object.prototype.toString.call(arg) === "[object ArrayBuffer]"; +exports.isArrayBuffer = isArrayBuffer; + + +/***/ }), + +/***/ 82800: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.STS = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const AssumeRoleCommand_1 = __nccwpck_require__(59802); -const AssumeRoleWithSAMLCommand_1 = __nccwpck_require__(72865); -const AssumeRoleWithWebIdentityCommand_1 = __nccwpck_require__(37451); -const DecodeAuthorizationMessageCommand_1 = __nccwpck_require__(74150); -const GetAccessKeyInfoCommand_1 = __nccwpck_require__(49804); -const GetCallerIdentityCommand_1 = __nccwpck_require__(24278); -const GetFederationTokenCommand_1 = __nccwpck_require__(57552); -const GetSessionTokenCommand_1 = __nccwpck_require__(43285); -const STSClient_1 = __nccwpck_require__(64195); -const commands = { - AssumeRoleCommand: AssumeRoleCommand_1.AssumeRoleCommand, - AssumeRoleWithSAMLCommand: AssumeRoleWithSAMLCommand_1.AssumeRoleWithSAMLCommand, - AssumeRoleWithWebIdentityCommand: AssumeRoleWithWebIdentityCommand_1.AssumeRoleWithWebIdentityCommand, - DecodeAuthorizationMessageCommand: DecodeAuthorizationMessageCommand_1.DecodeAuthorizationMessageCommand, - GetAccessKeyInfoCommand: GetAccessKeyInfoCommand_1.GetAccessKeyInfoCommand, - GetCallerIdentityCommand: GetCallerIdentityCommand_1.GetCallerIdentityCommand, - GetFederationTokenCommand: GetFederationTokenCommand_1.GetFederationTokenCommand, - GetSessionTokenCommand: GetSessionTokenCommand_1.GetSessionTokenCommand, +exports.getContentLengthPlugin = exports.contentLengthMiddlewareOptions = exports.contentLengthMiddleware = void 0; +const protocol_http_1 = __nccwpck_require__(87233); +const CONTENT_LENGTH_HEADER = "content-length"; +function contentLengthMiddleware(bodyLengthChecker) { + return (next) => async (args) => { + const request = args.request; + if (protocol_http_1.HttpRequest.isInstance(request)) { + const { body, headers } = request; + if (body && + Object.keys(headers) + .map((str) => str.toLowerCase()) + .indexOf(CONTENT_LENGTH_HEADER) === -1) { + try { + const length = bodyLengthChecker(body); + request.headers = { + ...request.headers, + [CONTENT_LENGTH_HEADER]: String(length), + }; + } + catch (error) { + } + } + } + return next({ + ...args, + request, + }); + }; +} +exports.contentLengthMiddleware = contentLengthMiddleware; +exports.contentLengthMiddlewareOptions = { + step: "build", + tags: ["SET_CONTENT_LENGTH", "CONTENT_LENGTH"], + name: "contentLengthMiddleware", + override: true, }; -class STS extends STSClient_1.STSClient { +const getContentLengthPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), exports.contentLengthMiddlewareOptions); + }, +}); +exports.getContentLengthPlugin = getContentLengthPlugin; + + +/***/ }), + +/***/ 71051: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Field = void 0; +const types_1 = __nccwpck_require__(78954); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + add(value) { + this.values.push(value); + } + set(values) { + this.values = values; + } + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; + } } -exports.STS = STS; -(0, smithy_client_1.createAggregatedClient)(commands, STS); +exports.Field = Field; /***/ }), -/***/ 64195: +/***/ 61405: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + getField(name) { + return this.entries[name.toLowerCase()]; + } + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +} +exports.Fields = Fields; + + +/***/ }), + +/***/ 81803: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0; +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; + return { + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + }, + }; +}; +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), + }; +}; +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; + + +/***/ }), + +/***/ 89842: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.STSClient = exports.__Client = void 0; -const config_resolver_1 = __nccwpck_require__(56153); -const middleware_content_length_1 = __nccwpck_require__(42245); -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_host_header_1 = __nccwpck_require__(22545); -const middleware_logger_1 = __nccwpck_require__(20014); -const middleware_recursion_detection_1 = __nccwpck_require__(85525); -const middleware_retry_1 = __nccwpck_require__(96064); -const middleware_sdk_sts_1 = __nccwpck_require__(55959); -const middleware_user_agent_1 = __nccwpck_require__(64688); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } })); -const EndpointParameters_1 = __nccwpck_require__(20510); -const runtimeConfig_1 = __nccwpck_require__(83405); -class STSClient extends smithy_client_1.Client { - constructor(configuration) { - const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration); - const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); - const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1); - const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2); - const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3); - const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); - const _config_6 = (0, middleware_sdk_sts_1.resolveStsAuthConfig)(_config_5, { stsClientCtor: STSClient }); - const _config_7 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_6); - super(_config_7); - this.config = _config_7; - this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); - this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); - this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); - this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); - this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); - this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(81803), exports); + + +/***/ }), + +/***/ 67442: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 54339: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; } - destroy() { - super.destroy(); + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); + } + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; } } -exports.STSClient = STSClient; +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} + + +/***/ }), + +/***/ 11723: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} +exports.HttpResponse = HttpResponse; + + +/***/ }), + +/***/ 87233: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(89842), exports); +tslib_1.__exportStar(__nccwpck_require__(71051), exports); +tslib_1.__exportStar(__nccwpck_require__(61405), exports); +tslib_1.__exportStar(__nccwpck_require__(67442), exports); +tslib_1.__exportStar(__nccwpck_require__(54339), exports); +tslib_1.__exportStar(__nccwpck_require__(11723), exports); +tslib_1.__exportStar(__nccwpck_require__(26369), exports); +tslib_1.__exportStar(__nccwpck_require__(41754), exports); + + +/***/ }), + +/***/ 26369: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; + + +/***/ }), + +/***/ 41754: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 59802: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 8637: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.AssumeRoleCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const middleware_signing_1 = __nccwpck_require__(14935); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const models_0_1 = __nccwpck_require__(21780); -const Aws_query_1 = __nccwpck_require__(10740); -class AssumeRoleCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, AssumeRoleCommand.getEndpointParameterInstructions())); - this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "STSClient"; - const commandName = "AssumeRoleCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: models_0_1.AssumeRoleResponseFilterSensitiveLog, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_query_1.se_AssumeRoleCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_query_1.de_AssumeRoleCommand)(output, context); - } -} -exports.AssumeRoleCommand = AssumeRoleCommand; /***/ }), -/***/ 72865: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 795: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.AssumeRoleWithSAMLCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const models_0_1 = __nccwpck_require__(21780); -const Aws_query_1 = __nccwpck_require__(10740); -class AssumeRoleWithSAMLCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, AssumeRoleWithSAMLCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "STSClient"; - const commandName = "AssumeRoleWithSAMLCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: models_0_1.AssumeRoleWithSAMLRequestFilterSensitiveLog, - outputFilterSensitiveLog: models_0_1.AssumeRoleWithSAMLResponseFilterSensitiveLog, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_query_1.se_AssumeRoleWithSAMLCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_query_1.de_AssumeRoleWithSAMLCommand)(output, context); - } -} -exports.AssumeRoleWithSAMLCommand = AssumeRoleWithSAMLCommand; +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); /***/ }), -/***/ 37451: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 15282: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.AssumeRoleWithWebIdentityCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const models_0_1 = __nccwpck_require__(21780); -const Aws_query_1 = __nccwpck_require__(10740); -class AssumeRoleWithWebIdentityCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, AssumeRoleWithWebIdentityCommand.getEndpointParameterInstructions())); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "STSClient"; - const commandName = "AssumeRoleWithWebIdentityCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: models_0_1.AssumeRoleWithWebIdentityRequestFilterSensitiveLog, - outputFilterSensitiveLog: models_0_1.AssumeRoleWithWebIdentityResponseFilterSensitiveLog, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_query_1.se_AssumeRoleWithWebIdentityCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_query_1.de_AssumeRoleWithWebIdentityCommand)(output, context); - } -} -exports.AssumeRoleWithWebIdentityCommand = AssumeRoleWithWebIdentityCommand; /***/ }), -/***/ 74150: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 39085: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DecodeAuthorizationMessageCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const middleware_signing_1 = __nccwpck_require__(14935); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_query_1 = __nccwpck_require__(10740); -class DecodeAuthorizationMessageCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DecodeAuthorizationMessageCommand.getEndpointParameterInstructions())); - this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "STSClient"; - const commandName = "DecodeAuthorizationMessageCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_query_1.se_DecodeAuthorizationMessageCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_query_1.de_DecodeAuthorizationMessageCommand)(output, context); - } -} -exports.DecodeAuthorizationMessageCommand = DecodeAuthorizationMessageCommand; /***/ }), -/***/ 49804: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 60864: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetAccessKeyInfoCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const middleware_signing_1 = __nccwpck_require__(14935); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_query_1 = __nccwpck_require__(10740); -class GetAccessKeyInfoCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetAccessKeyInfoCommand.getEndpointParameterInstructions())); - this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "STSClient"; - const commandName = "GetAccessKeyInfoCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_query_1.se_GetAccessKeyInfoCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_query_1.de_GetAccessKeyInfoCommand)(output, context); - } -} -exports.GetAccessKeyInfoCommand = GetAccessKeyInfoCommand; /***/ }), -/***/ 24278: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 23001: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetCallerIdentityCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const middleware_signing_1 = __nccwpck_require__(14935); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const Aws_query_1 = __nccwpck_require__(10740); -class GetCallerIdentityCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetCallerIdentityCommand.getEndpointParameterInstructions())); - this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "STSClient"; - const commandName = "GetCallerIdentityCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: (_) => _, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_query_1.se_GetCallerIdentityCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_query_1.de_GetCallerIdentityCommand)(output, context); - } -} -exports.GetCallerIdentityCommand = GetCallerIdentityCommand; /***/ }), -/***/ 57552: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 21343: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetFederationTokenCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const middleware_signing_1 = __nccwpck_require__(14935); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const models_0_1 = __nccwpck_require__(21780); -const Aws_query_1 = __nccwpck_require__(10740); -class GetFederationTokenCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetFederationTokenCommand.getEndpointParameterInstructions())); - this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "STSClient"; - const commandName = "GetFederationTokenCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: models_0_1.GetFederationTokenResponseFilterSensitiveLog, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_query_1.se_GetFederationTokenCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_query_1.de_GetFederationTokenCommand)(output, context); - } -} -exports.GetFederationTokenCommand = GetFederationTokenCommand; /***/ }), -/***/ 43285: +/***/ 70664: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetSessionTokenCommand = exports.$Command = void 0; -const middleware_endpoint_1 = __nccwpck_require__(5497); -const middleware_serde_1 = __nccwpck_require__(93631); -const middleware_signing_1 = __nccwpck_require__(14935); -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } })); -const models_0_1 = __nccwpck_require__(21780); -const Aws_query_1 = __nccwpck_require__(10740); -class GetSessionTokenCommand extends smithy_client_1.Command { - static getEndpointParameterInstructions() { - return { - UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, - UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, - Endpoint: { type: "builtInParams", name: "endpoint" }, - Region: { type: "builtInParams", name: "region" }, - UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, - }; - } - constructor(input) { - super(); - this.input = input; - } - resolveMiddleware(clientStack, configuration, options) { - this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); - this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetSessionTokenCommand.getEndpointParameterInstructions())); - this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); - const stack = clientStack.concat(this.middlewareStack); - const { logger } = configuration; - const clientName = "STSClient"; - const commandName = "GetSessionTokenCommand"; - const handlerExecutionContext = { - logger, - clientName, - commandName, - inputFilterSensitiveLog: (_) => _, - outputFilterSensitiveLog: models_0_1.GetSessionTokenResponseFilterSensitiveLog, - }; - const { requestHandler } = configuration; - return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); - } - serialize(input, context) { - return (0, Aws_query_1.se_GetSessionTokenCommand)(input, context); - } - deserialize(output, context) { - return (0, Aws_query_1.de_GetSessionTokenCommand)(output, context); - } -} -exports.GetSessionTokenCommand = GetSessionTokenCommand; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(21343), exports); +tslib_1.__exportStar(__nccwpck_require__(58597), exports); +tslib_1.__exportStar(__nccwpck_require__(19786), exports); /***/ }), -/***/ 55716: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 58597: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(59802), exports); -tslib_1.__exportStar(__nccwpck_require__(72865), exports); -tslib_1.__exportStar(__nccwpck_require__(37451), exports); -tslib_1.__exportStar(__nccwpck_require__(74150), exports); -tslib_1.__exportStar(__nccwpck_require__(49804), exports); -tslib_1.__exportStar(__nccwpck_require__(24278), exports); -tslib_1.__exportStar(__nccwpck_require__(57552), exports); -tslib_1.__exportStar(__nccwpck_require__(43285), exports); /***/ }), -/***/ 88028: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 19786: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.decorateDefaultCredentialProvider = exports.getDefaultRoleAssumerWithWebIdentity = exports.getDefaultRoleAssumer = void 0; -const defaultStsRoleAssumers_1 = __nccwpck_require__(90048); -const STSClient_1 = __nccwpck_require__(64195); -const getCustomizableStsClientCtor = (baseCtor, customizations) => { - if (!customizations) - return baseCtor; - else - return class CustomizableSTSClient extends baseCtor { - constructor(config) { - super(config); - for (const customization of customizations) { - this.middlewareStack.use(customization); - } - } - }; -}; -const getDefaultRoleAssumer = (stsOptions = {}, stsPlugins) => (0, defaultStsRoleAssumers_1.getDefaultRoleAssumer)(stsOptions, getCustomizableStsClientCtor(STSClient_1.STSClient, stsPlugins)); -exports.getDefaultRoleAssumer = getDefaultRoleAssumer; -const getDefaultRoleAssumerWithWebIdentity = (stsOptions = {}, stsPlugins) => (0, defaultStsRoleAssumers_1.getDefaultRoleAssumerWithWebIdentity)(stsOptions, getCustomizableStsClientCtor(STSClient_1.STSClient, stsPlugins)); -exports.getDefaultRoleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity; -const decorateDefaultCredentialProvider = (provider) => (input) => provider({ - roleAssumer: (0, exports.getDefaultRoleAssumer)(input), - roleAssumerWithWebIdentity: (0, exports.getDefaultRoleAssumerWithWebIdentity)(input), - ...input, -}); -exports.decorateDefaultCredentialProvider = decorateDefaultCredentialProvider; /***/ }), -/***/ 90048: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 86979: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 23312: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.decorateDefaultCredentialProvider = exports.getDefaultRoleAssumerWithWebIdentity = exports.getDefaultRoleAssumer = void 0; -const AssumeRoleCommand_1 = __nccwpck_require__(59802); -const AssumeRoleWithWebIdentityCommand_1 = __nccwpck_require__(37451); -const ASSUME_ROLE_DEFAULT_REGION = "us-east-1"; -const decorateDefaultRegion = (region) => { - if (typeof region !== "function") { - return region === undefined ? ASSUME_ROLE_DEFAULT_REGION : region; - } - return async () => { - try { - return await region(); - } - catch (e) { - return ASSUME_ROLE_DEFAULT_REGION; - } - }; -}; -const getDefaultRoleAssumer = (stsOptions, stsClientCtor) => { - let stsClient; - let closureSourceCreds; - return async (sourceCreds, params) => { - closureSourceCreds = sourceCreds; - if (!stsClient) { - const { logger, region, requestHandler } = stsOptions; - stsClient = new stsClientCtor({ - logger, - credentialDefaultProvider: () => async () => closureSourceCreds, - region: decorateDefaultRegion(region || stsOptions.region), - ...(requestHandler ? { requestHandler } : {}), - }); - } - const { Credentials } = await stsClient.send(new AssumeRoleCommand_1.AssumeRoleCommand(params)); - if (!Credentials || !Credentials.AccessKeyId || !Credentials.SecretAccessKey) { - throw new Error(`Invalid response from STS.assumeRole call with role ${params.RoleArn}`); - } - return { - accessKeyId: Credentials.AccessKeyId, - secretAccessKey: Credentials.SecretAccessKey, - sessionToken: Credentials.SessionToken, - expiration: Credentials.Expiration, - }; - }; -}; -exports.getDefaultRoleAssumer = getDefaultRoleAssumer; -const getDefaultRoleAssumerWithWebIdentity = (stsOptions, stsClientCtor) => { - let stsClient; - return async (params) => { - if (!stsClient) { - const { logger, region, requestHandler } = stsOptions; - stsClient = new stsClientCtor({ - logger, - region: decorateDefaultRegion(region || stsOptions.region), - ...(requestHandler ? { requestHandler } : {}), - }); - } - const { Credentials } = await stsClient.send(new AssumeRoleWithWebIdentityCommand_1.AssumeRoleWithWebIdentityCommand(params)); - if (!Credentials || !Credentials.AccessKeyId || !Credentials.SecretAccessKey) { - throw new Error(`Invalid response from STS.assumeRoleWithWebIdentity call with role ${params.RoleArn}`); - } - return { - accessKeyId: Credentials.AccessKeyId, - secretAccessKey: Credentials.SecretAccessKey, - sessionToken: Credentials.SessionToken, - expiration: Credentials.Expiration, - }; - }; -}; -exports.getDefaultRoleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity; -const decorateDefaultCredentialProvider = (provider) => (input) => provider({ - roleAssumer: (0, exports.getDefaultRoleAssumer)(input, input.stsClientCtor), - roleAssumerWithWebIdentity: (0, exports.getDefaultRoleAssumerWithWebIdentity)(input, input.stsClientCtor), - ...input, -}); -exports.decorateDefaultCredentialProvider = decorateDefaultCredentialProvider; /***/ }), -/***/ 20510: +/***/ 26042: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveClientEndpointParameters = void 0; -const resolveClientEndpointParameters = (options) => { - return { - ...options, - useDualstackEndpoint: options.useDualstackEndpoint ?? false, - useFipsEndpoint: options.useFipsEndpoint ?? false, - useGlobalEndpoint: options.useGlobalEndpoint ?? false, - defaultSigningName: "sts", - }; -}; -exports.resolveClientEndpointParameters = resolveClientEndpointParameters; +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); /***/ }), -/***/ 41203: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 88823: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultEndpointResolver = void 0; -const util_endpoints_1 = __nccwpck_require__(13350); -const ruleset_1 = __nccwpck_require__(86882); -const defaultEndpointResolver = (endpointParams, context = {}) => { - return (0, util_endpoints_1.resolveEndpoint)(ruleset_1.ruleSet, { - endpointParams: endpointParams, - logger: context.logger, - }); -}; -exports.defaultEndpointResolver = defaultEndpointResolver; /***/ }), -/***/ 86882: +/***/ 25924: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ruleSet = void 0; -const F = "required", G = "type", H = "fn", I = "argv", J = "ref"; -const a = false, b = true, c = "booleanEquals", d = "tree", e = "stringEquals", f = "sigv4", g = "sts", h = "us-east-1", i = "endpoint", j = "https://sts.{Region}.{PartitionResult#dnsSuffix}", k = "error", l = "getAttr", m = { [F]: false, [G]: "String" }, n = { [F]: true, "default": false, [G]: "Boolean" }, o = { [J]: "Endpoint" }, p = { [H]: "isSet", [I]: [{ [J]: "Region" }] }, q = { [J]: "Region" }, r = { [H]: "aws.partition", [I]: [q], "assign": "PartitionResult" }, s = { [J]: "UseFIPS" }, t = { [J]: "UseDualStack" }, u = { "url": "https://sts.amazonaws.com", "properties": { "authSchemes": [{ "name": f, "signingName": g, "signingRegion": h }] }, "headers": {} }, v = {}, w = { "conditions": [{ [H]: e, [I]: [q, "aws-global"] }], [i]: u, [G]: i }, x = { [H]: c, [I]: [s, true] }, y = { [H]: c, [I]: [t, true] }, z = { [H]: c, [I]: [true, { [H]: l, [I]: [{ [J]: "PartitionResult" }, "supportsFIPS"] }] }, A = { [J]: "PartitionResult" }, B = { [H]: c, [I]: [true, { [H]: l, [I]: [A, "supportsDualStack"] }] }, C = [{ [H]: "isSet", [I]: [o] }], D = [x], E = [y]; -const _data = { version: "1.0", parameters: { Region: m, UseDualStack: n, UseFIPS: n, Endpoint: m, UseGlobalEndpoint: n }, rules: [{ conditions: [{ [H]: c, [I]: [{ [J]: "UseGlobalEndpoint" }, b] }, { [H]: "not", [I]: C }, p, r, { [H]: c, [I]: [s, a] }, { [H]: c, [I]: [t, a] }], [G]: d, rules: [{ conditions: [{ [H]: e, [I]: [q, "ap-northeast-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "ap-south-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "ap-southeast-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "ap-southeast-2"] }], endpoint: u, [G]: i }, w, { conditions: [{ [H]: e, [I]: [q, "ca-central-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "eu-central-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "eu-north-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "eu-west-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "eu-west-2"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "eu-west-3"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "sa-east-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, h] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "us-east-2"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "us-west-1"] }], endpoint: u, [G]: i }, { conditions: [{ [H]: e, [I]: [q, "us-west-2"] }], endpoint: u, [G]: i }, { endpoint: { url: j, properties: { authSchemes: [{ name: f, signingName: g, signingRegion: "{Region}" }] }, headers: v }, [G]: i }] }, { conditions: C, [G]: d, rules: [{ conditions: D, error: "Invalid Configuration: FIPS and custom endpoint are not supported", [G]: k }, { [G]: d, rules: [{ conditions: E, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", [G]: k }, { endpoint: { url: o, properties: v, headers: v }, [G]: i }] }] }, { [G]: d, rules: [{ conditions: [p], [G]: d, rules: [{ conditions: [r], [G]: d, rules: [{ conditions: [x, y], [G]: d, rules: [{ conditions: [z, B], [G]: d, rules: [{ [G]: d, rules: [{ endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: i }] }] }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", [G]: k }] }, { conditions: D, [G]: d, rules: [{ conditions: [z], [G]: d, rules: [{ [G]: d, rules: [{ conditions: [{ [H]: e, [I]: ["aws-us-gov", { [H]: l, [I]: [A, "name"] }] }], endpoint: { url: "https://sts.{Region}.amazonaws.com", properties: v, headers: v }, [G]: i }, { endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dnsSuffix}", properties: v, headers: v }, [G]: i }] }] }, { error: "FIPS is enabled but this partition does not support FIPS", [G]: k }] }, { conditions: E, [G]: d, rules: [{ conditions: [B], [G]: d, rules: [{ [G]: d, rules: [{ endpoint: { url: "https://sts.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: i }] }] }, { error: "DualStack is enabled but this partition does not support DualStack", [G]: k }] }, { [G]: d, rules: [w, { endpoint: { url: j, properties: v, headers: v }, [G]: i }] }] }] }, { error: "Invalid Configuration: Missing Region", [G]: k }] }] }; -exports.ruleSet = _data; /***/ }), -/***/ 52209: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 34761: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.STSServiceException = void 0; -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(64195), exports); -tslib_1.__exportStar(__nccwpck_require__(32605), exports); -tslib_1.__exportStar(__nccwpck_require__(55716), exports); -tslib_1.__exportStar(__nccwpck_require__(20106), exports); -tslib_1.__exportStar(__nccwpck_require__(88028), exports); -var STSServiceException_1 = __nccwpck_require__(26450); -Object.defineProperty(exports, "STSServiceException", ({ enumerable: true, get: function () { return STSServiceException_1.STSServiceException; } })); /***/ }), -/***/ 26450: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 33191: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.STSServiceException = exports.__ServiceException = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -Object.defineProperty(exports, "__ServiceException", ({ enumerable: true, get: function () { return smithy_client_1.ServiceException; } })); -class STSServiceException extends smithy_client_1.ServiceException { - constructor(options) { - super(options); - Object.setPrototypeOf(this, STSServiceException.prototype); - } -} -exports.STSServiceException = STSServiceException; /***/ }), -/***/ 20106: +/***/ 57615: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(21780), exports); +tslib_1.__exportStar(__nccwpck_require__(88823), exports); +tslib_1.__exportStar(__nccwpck_require__(25924), exports); +tslib_1.__exportStar(__nccwpck_require__(34761), exports); +tslib_1.__exportStar(__nccwpck_require__(6374), exports); +tslib_1.__exportStar(__nccwpck_require__(33191), exports); /***/ }), -/***/ 21780: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 6374: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.GetSessionTokenResponseFilterSensitiveLog = exports.GetFederationTokenResponseFilterSensitiveLog = exports.AssumeRoleWithWebIdentityResponseFilterSensitiveLog = exports.AssumeRoleWithWebIdentityRequestFilterSensitiveLog = exports.AssumeRoleWithSAMLResponseFilterSensitiveLog = exports.AssumeRoleWithSAMLRequestFilterSensitiveLog = exports.AssumeRoleResponseFilterSensitiveLog = exports.CredentialsFilterSensitiveLog = exports.InvalidAuthorizationMessageException = exports.IDPCommunicationErrorException = exports.InvalidIdentityTokenException = exports.IDPRejectedClaimException = exports.RegionDisabledException = exports.PackedPolicyTooLargeException = exports.MalformedPolicyDocumentException = exports.ExpiredTokenException = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const STSServiceException_1 = __nccwpck_require__(26450); -class ExpiredTokenException extends STSServiceException_1.STSServiceException { - constructor(opts) { - super({ - name: "ExpiredTokenException", - $fault: "client", - ...opts, - }); - this.name = "ExpiredTokenException"; - this.$fault = "client"; - Object.setPrototypeOf(this, ExpiredTokenException.prototype); - } -} -exports.ExpiredTokenException = ExpiredTokenException; -class MalformedPolicyDocumentException extends STSServiceException_1.STSServiceException { - constructor(opts) { - super({ - name: "MalformedPolicyDocumentException", - $fault: "client", - ...opts, - }); - this.name = "MalformedPolicyDocumentException"; - this.$fault = "client"; - Object.setPrototypeOf(this, MalformedPolicyDocumentException.prototype); - } -} -exports.MalformedPolicyDocumentException = MalformedPolicyDocumentException; -class PackedPolicyTooLargeException extends STSServiceException_1.STSServiceException { - constructor(opts) { - super({ - name: "PackedPolicyTooLargeException", - $fault: "client", - ...opts, - }); - this.name = "PackedPolicyTooLargeException"; - this.$fault = "client"; - Object.setPrototypeOf(this, PackedPolicyTooLargeException.prototype); - } -} -exports.PackedPolicyTooLargeException = PackedPolicyTooLargeException; -class RegionDisabledException extends STSServiceException_1.STSServiceException { - constructor(opts) { - super({ - name: "RegionDisabledException", - $fault: "client", - ...opts, - }); - this.name = "RegionDisabledException"; - this.$fault = "client"; - Object.setPrototypeOf(this, RegionDisabledException.prototype); - } -} -exports.RegionDisabledException = RegionDisabledException; -class IDPRejectedClaimException extends STSServiceException_1.STSServiceException { - constructor(opts) { - super({ - name: "IDPRejectedClaimException", - $fault: "client", - ...opts, - }); - this.name = "IDPRejectedClaimException"; - this.$fault = "client"; - Object.setPrototypeOf(this, IDPRejectedClaimException.prototype); - } -} -exports.IDPRejectedClaimException = IDPRejectedClaimException; -class InvalidIdentityTokenException extends STSServiceException_1.STSServiceException { - constructor(opts) { - super({ - name: "InvalidIdentityTokenException", - $fault: "client", - ...opts, - }); - this.name = "InvalidIdentityTokenException"; - this.$fault = "client"; - Object.setPrototypeOf(this, InvalidIdentityTokenException.prototype); - } -} -exports.InvalidIdentityTokenException = InvalidIdentityTokenException; -class IDPCommunicationErrorException extends STSServiceException_1.STSServiceException { - constructor(opts) { - super({ - name: "IDPCommunicationErrorException", - $fault: "client", - ...opts, - }); - this.name = "IDPCommunicationErrorException"; - this.$fault = "client"; - Object.setPrototypeOf(this, IDPCommunicationErrorException.prototype); - } -} -exports.IDPCommunicationErrorException = IDPCommunicationErrorException; -class InvalidAuthorizationMessageException extends STSServiceException_1.STSServiceException { - constructor(opts) { - super({ - name: "InvalidAuthorizationMessageException", - $fault: "client", - ...opts, - }); - this.name = "InvalidAuthorizationMessageException"; - this.$fault = "client"; - Object.setPrototypeOf(this, InvalidAuthorizationMessageException.prototype); - } -} -exports.InvalidAuthorizationMessageException = InvalidAuthorizationMessageException; -const CredentialsFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.SecretAccessKey && { SecretAccessKey: smithy_client_1.SENSITIVE_STRING }), -}); -exports.CredentialsFilterSensitiveLog = CredentialsFilterSensitiveLog; -const AssumeRoleResponseFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }), -}); -exports.AssumeRoleResponseFilterSensitiveLog = AssumeRoleResponseFilterSensitiveLog; -const AssumeRoleWithSAMLRequestFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.SAMLAssertion && { SAMLAssertion: smithy_client_1.SENSITIVE_STRING }), -}); -exports.AssumeRoleWithSAMLRequestFilterSensitiveLog = AssumeRoleWithSAMLRequestFilterSensitiveLog; -const AssumeRoleWithSAMLResponseFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }), -}); -exports.AssumeRoleWithSAMLResponseFilterSensitiveLog = AssumeRoleWithSAMLResponseFilterSensitiveLog; -const AssumeRoleWithWebIdentityRequestFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.WebIdentityToken && { WebIdentityToken: smithy_client_1.SENSITIVE_STRING }), -}); -exports.AssumeRoleWithWebIdentityRequestFilterSensitiveLog = AssumeRoleWithWebIdentityRequestFilterSensitiveLog; -const AssumeRoleWithWebIdentityResponseFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }), -}); -exports.AssumeRoleWithWebIdentityResponseFilterSensitiveLog = AssumeRoleWithWebIdentityResponseFilterSensitiveLog; -const GetFederationTokenResponseFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }), -}); -exports.GetFederationTokenResponseFilterSensitiveLog = GetFederationTokenResponseFilterSensitiveLog; -const GetSessionTokenResponseFilterSensitiveLog = (obj) => ({ - ...obj, - ...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }), -}); -exports.GetSessionTokenResponseFilterSensitiveLog = GetSessionTokenResponseFilterSensitiveLog; /***/ }), -/***/ 10740: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 29689: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.de_GetSessionTokenCommand = exports.de_GetFederationTokenCommand = exports.de_GetCallerIdentityCommand = exports.de_GetAccessKeyInfoCommand = exports.de_DecodeAuthorizationMessageCommand = exports.de_AssumeRoleWithWebIdentityCommand = exports.de_AssumeRoleWithSAMLCommand = exports.de_AssumeRoleCommand = exports.se_GetSessionTokenCommand = exports.se_GetFederationTokenCommand = exports.se_GetCallerIdentityCommand = exports.se_GetAccessKeyInfoCommand = exports.se_DecodeAuthorizationMessageCommand = exports.se_AssumeRoleWithWebIdentityCommand = exports.se_AssumeRoleWithSAMLCommand = exports.se_AssumeRoleCommand = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const protocol_http_1 = __nccwpck_require__(64418); -const fast_xml_parser_1 = __nccwpck_require__(12603); -const models_0_1 = __nccwpck_require__(21780); -const STSServiceException_1 = __nccwpck_require__(26450); -const se_AssumeRoleCommand = async (input, context) => { - const headers = SHARED_HEADERS; - let body; - body = buildFormUrlencodedString({ - ...se_AssumeRoleRequest(input, context), - Action: "AssumeRole", - Version: "2011-06-15", - }); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_AssumeRoleCommand = se_AssumeRoleCommand; -const se_AssumeRoleWithSAMLCommand = async (input, context) => { - const headers = SHARED_HEADERS; - let body; - body = buildFormUrlencodedString({ - ...se_AssumeRoleWithSAMLRequest(input, context), - Action: "AssumeRoleWithSAML", - Version: "2011-06-15", - }); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_AssumeRoleWithSAMLCommand = se_AssumeRoleWithSAMLCommand; -const se_AssumeRoleWithWebIdentityCommand = async (input, context) => { - const headers = SHARED_HEADERS; - let body; - body = buildFormUrlencodedString({ - ...se_AssumeRoleWithWebIdentityRequest(input, context), - Action: "AssumeRoleWithWebIdentity", - Version: "2011-06-15", - }); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_AssumeRoleWithWebIdentityCommand = se_AssumeRoleWithWebIdentityCommand; -const se_DecodeAuthorizationMessageCommand = async (input, context) => { - const headers = SHARED_HEADERS; - let body; - body = buildFormUrlencodedString({ - ...se_DecodeAuthorizationMessageRequest(input, context), - Action: "DecodeAuthorizationMessage", - Version: "2011-06-15", - }); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_DecodeAuthorizationMessageCommand = se_DecodeAuthorizationMessageCommand; -const se_GetAccessKeyInfoCommand = async (input, context) => { - const headers = SHARED_HEADERS; - let body; - body = buildFormUrlencodedString({ - ...se_GetAccessKeyInfoRequest(input, context), - Action: "GetAccessKeyInfo", - Version: "2011-06-15", - }); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_GetAccessKeyInfoCommand = se_GetAccessKeyInfoCommand; -const se_GetCallerIdentityCommand = async (input, context) => { - const headers = SHARED_HEADERS; - let body; - body = buildFormUrlencodedString({ - ...se_GetCallerIdentityRequest(input, context), - Action: "GetCallerIdentity", - Version: "2011-06-15", - }); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_GetCallerIdentityCommand = se_GetCallerIdentityCommand; -const se_GetFederationTokenCommand = async (input, context) => { - const headers = SHARED_HEADERS; - let body; - body = buildFormUrlencodedString({ - ...se_GetFederationTokenRequest(input, context), - Action: "GetFederationToken", - Version: "2011-06-15", - }); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_GetFederationTokenCommand = se_GetFederationTokenCommand; -const se_GetSessionTokenCommand = async (input, context) => { - const headers = SHARED_HEADERS; - let body; - body = buildFormUrlencodedString({ - ...se_GetSessionTokenRequest(input, context), - Action: "GetSessionToken", - Version: "2011-06-15", - }); - return buildHttpRpcRequest(context, headers, "/", undefined, body); -}; -exports.se_GetSessionTokenCommand = se_GetSessionTokenCommand; -const de_AssumeRoleCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_AssumeRoleCommandError(output, context); - } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_AssumeRoleResponse(data.AssumeRoleResult, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_AssumeRoleCommand = de_AssumeRoleCommand; -const de_AssumeRoleCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadQueryErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "ExpiredTokenException": - case "com.amazonaws.sts#ExpiredTokenException": - throw await de_ExpiredTokenExceptionRes(parsedOutput, context); - case "MalformedPolicyDocument": - case "com.amazonaws.sts#MalformedPolicyDocumentException": - throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); - case "PackedPolicyTooLarge": - case "com.amazonaws.sts#PackedPolicyTooLargeException": - throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context); - case "RegionDisabledException": - case "com.amazonaws.sts#RegionDisabledException": - throw await de_RegionDisabledExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody: parsedBody.Error, - errorCode, - }); - } -}; -const de_AssumeRoleWithSAMLCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_AssumeRoleWithSAMLCommandError(output, context); - } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_AssumeRoleWithSAMLResponse(data.AssumeRoleWithSAMLResult, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_AssumeRoleWithSAMLCommand = de_AssumeRoleWithSAMLCommand; -const de_AssumeRoleWithSAMLCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadQueryErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "ExpiredTokenException": - case "com.amazonaws.sts#ExpiredTokenException": - throw await de_ExpiredTokenExceptionRes(parsedOutput, context); - case "IDPRejectedClaim": - case "com.amazonaws.sts#IDPRejectedClaimException": - throw await de_IDPRejectedClaimExceptionRes(parsedOutput, context); - case "InvalidIdentityToken": - case "com.amazonaws.sts#InvalidIdentityTokenException": - throw await de_InvalidIdentityTokenExceptionRes(parsedOutput, context); - case "MalformedPolicyDocument": - case "com.amazonaws.sts#MalformedPolicyDocumentException": - throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); - case "PackedPolicyTooLarge": - case "com.amazonaws.sts#PackedPolicyTooLargeException": - throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context); - case "RegionDisabledException": - case "com.amazonaws.sts#RegionDisabledException": - throw await de_RegionDisabledExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody: parsedBody.Error, - errorCode, - }); - } -}; -const de_AssumeRoleWithWebIdentityCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_AssumeRoleWithWebIdentityCommandError(output, context); - } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_AssumeRoleWithWebIdentityResponse(data.AssumeRoleWithWebIdentityResult, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_AssumeRoleWithWebIdentityCommand = de_AssumeRoleWithWebIdentityCommand; -const de_AssumeRoleWithWebIdentityCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadQueryErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "ExpiredTokenException": - case "com.amazonaws.sts#ExpiredTokenException": - throw await de_ExpiredTokenExceptionRes(parsedOutput, context); - case "IDPCommunicationError": - case "com.amazonaws.sts#IDPCommunicationErrorException": - throw await de_IDPCommunicationErrorExceptionRes(parsedOutput, context); - case "IDPRejectedClaim": - case "com.amazonaws.sts#IDPRejectedClaimException": - throw await de_IDPRejectedClaimExceptionRes(parsedOutput, context); - case "InvalidIdentityToken": - case "com.amazonaws.sts#InvalidIdentityTokenException": - throw await de_InvalidIdentityTokenExceptionRes(parsedOutput, context); - case "MalformedPolicyDocument": - case "com.amazonaws.sts#MalformedPolicyDocumentException": - throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); - case "PackedPolicyTooLarge": - case "com.amazonaws.sts#PackedPolicyTooLargeException": - throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context); - case "RegionDisabledException": - case "com.amazonaws.sts#RegionDisabledException": - throw await de_RegionDisabledExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody: parsedBody.Error, - errorCode, - }); - } -}; -const de_DecodeAuthorizationMessageCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_DecodeAuthorizationMessageCommandError(output, context); - } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_DecodeAuthorizationMessageResponse(data.DecodeAuthorizationMessageResult, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_DecodeAuthorizationMessageCommand = de_DecodeAuthorizationMessageCommand; -const de_DecodeAuthorizationMessageCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadQueryErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "InvalidAuthorizationMessageException": - case "com.amazonaws.sts#InvalidAuthorizationMessageException": - throw await de_InvalidAuthorizationMessageExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody: parsedBody.Error, - errorCode, - }); - } -}; -const de_GetAccessKeyInfoCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_GetAccessKeyInfoCommandError(output, context); - } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_GetAccessKeyInfoResponse(data.GetAccessKeyInfoResult, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_GetAccessKeyInfoCommand = de_GetAccessKeyInfoCommand; -const de_GetAccessKeyInfoCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadQueryErrorCode(output, parsedOutput.body); - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody: parsedBody.Error, - errorCode, - }); -}; -const de_GetCallerIdentityCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_GetCallerIdentityCommandError(output, context); + + +/***/ }), + +/***/ 80678: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_GetCallerIdentityResponse(data.GetCallerIdentityResult, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, - }; - return response; -}; -exports.de_GetCallerIdentityCommand = de_GetCallerIdentityCommand; -const de_GetCallerIdentityCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadQueryErrorCode(output, parsedOutput.body); - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody: parsedBody.Error, - errorCode, - }); -}; -const de_GetFederationTokenCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_GetFederationTokenCommandError(output, context); + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_GetFederationTokenResponse(data.GetFederationTokenResult, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, }; - return response; }; -exports.de_GetFederationTokenCommand = de_GetFederationTokenCommand; -const de_GetFederationTokenCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), - }; - const errorCode = loadQueryErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "MalformedPolicyDocument": - case "com.amazonaws.sts#MalformedPolicyDocumentException": - throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); - case "PackedPolicyTooLarge": - case "com.amazonaws.sts#PackedPolicyTooLargeException": - throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context); - case "RegionDisabledException": - case "com.amazonaws.sts#RegionDisabledException": - throw await de_RegionDisabledExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody: parsedBody.Error, - errorCode, - }); - } +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; }; -const de_GetSessionTokenCommand = async (output, context) => { - if (output.statusCode >= 300) { - return de_GetSessionTokenCommandError(output, context); - } - const data = await parseBody(output.body, context); - let contents = {}; - contents = de_GetSessionTokenResponse(data.GetSessionTokenResult, context); - const response = { - $metadata: deserializeMetadata(output), - ...contents, +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; + + +/***/ }), + +/***/ 9102: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(80678); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), }; - return response; }; -exports.de_GetSessionTokenCommand = de_GetSessionTokenCommand; -const de_GetSessionTokenCommandError = async (output, context) => { - const parsedOutput = { - ...output, - body: await parseErrorBody(output.body, context), +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), }; - const errorCode = loadQueryErrorCode(output, parsedOutput.body); - switch (errorCode) { - case "RegionDisabledException": - case "com.amazonaws.sts#RegionDisabledException": - throw await de_RegionDisabledExceptionRes(parsedOutput, context); - default: - const parsedBody = parsedOutput.body; - return throwDefaultError({ - output, - parsedBody: parsedBody.Error, - errorCode, - }); - } -}; -const de_ExpiredTokenExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_ExpiredTokenException(body.Error, context); - const exception = new models_0_1.ExpiredTokenException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_IDPCommunicationErrorExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_IDPCommunicationErrorException(body.Error, context); - const exception = new models_0_1.IDPCommunicationErrorException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_IDPRejectedClaimExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_IDPRejectedClaimException(body.Error, context); - const exception = new models_0_1.IDPRejectedClaimException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_InvalidAuthorizationMessageExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_InvalidAuthorizationMessageException(body.Error, context); - const exception = new models_0_1.InvalidAuthorizationMessageException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_InvalidIdentityTokenExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_InvalidIdentityTokenException(body.Error, context); - const exception = new models_0_1.InvalidIdentityTokenException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_MalformedPolicyDocumentExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_MalformedPolicyDocumentException(body.Error, context); - const exception = new models_0_1.MalformedPolicyDocumentException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_PackedPolicyTooLargeExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_PackedPolicyTooLargeException(body.Error, context); - const exception = new models_0_1.PackedPolicyTooLargeException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); -}; -const de_RegionDisabledExceptionRes = async (parsedOutput, context) => { - const body = parsedOutput.body; - const deserialized = de_RegionDisabledException(body.Error, context); - const exception = new models_0_1.RegionDisabledException({ - $metadata: deserializeMetadata(parsedOutput), - ...deserialized, - }); - return (0, smithy_client_1.decorateServiceException)(exception, body); }; -const se_AssumeRoleRequest = (input, context) => { - const entries = {}; - if (input.RoleArn != null) { - entries["RoleArn"] = input.RoleArn; - } - if (input.RoleSessionName != null) { - entries["RoleSessionName"] = input.RoleSessionName; - } - if (input.PolicyArns != null) { - const memberEntries = se_policyDescriptorListType(input.PolicyArns, context); - if (input.PolicyArns?.length === 0) { - entries.PolicyArns = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `PolicyArns.${key}`; - entries[loc] = value; - }); - } - if (input.Policy != null) { - entries["Policy"] = input.Policy; - } - if (input.DurationSeconds != null) { - entries["DurationSeconds"] = input.DurationSeconds; - } - if (input.Tags != null) { - const memberEntries = se_tagListType(input.Tags, context); - if (input.Tags?.length === 0) { - entries.Tags = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `Tags.${key}`; - entries[loc] = value; - }); - } - if (input.TransitiveTagKeys != null) { - const memberEntries = se_tagKeyListType(input.TransitiveTagKeys, context); - if (input.TransitiveTagKeys?.length === 0) { - entries.TransitiveTagKeys = []; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; + + +/***/ }), + +/***/ 82748: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 67498: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(9102), exports); +tslib_1.__exportStar(__nccwpck_require__(82748), exports); +var checksum_1 = __nccwpck_require__(80678); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); + + +/***/ }), + +/***/ 83218: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); + + +/***/ }), + +/***/ 44809: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 47484: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 84010: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(44809), exports); +tslib_1.__exportStar(__nccwpck_require__(47484), exports); + + +/***/ }), + +/***/ 78954: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(8637), exports); +tslib_1.__exportStar(__nccwpck_require__(795), exports); +tslib_1.__exportStar(__nccwpck_require__(15282), exports); +tslib_1.__exportStar(__nccwpck_require__(39085), exports); +tslib_1.__exportStar(__nccwpck_require__(60864), exports); +tslib_1.__exportStar(__nccwpck_require__(23001), exports); +tslib_1.__exportStar(__nccwpck_require__(70664), exports); +tslib_1.__exportStar(__nccwpck_require__(86979), exports); +tslib_1.__exportStar(__nccwpck_require__(23312), exports); +tslib_1.__exportStar(__nccwpck_require__(26042), exports); +tslib_1.__exportStar(__nccwpck_require__(57615), exports); +tslib_1.__exportStar(__nccwpck_require__(29689), exports); +tslib_1.__exportStar(__nccwpck_require__(67498), exports); +tslib_1.__exportStar(__nccwpck_require__(83218), exports); +tslib_1.__exportStar(__nccwpck_require__(84010), exports); +tslib_1.__exportStar(__nccwpck_require__(81087), exports); +tslib_1.__exportStar(__nccwpck_require__(97058), exports); +tslib_1.__exportStar(__nccwpck_require__(77531), exports); +tslib_1.__exportStar(__nccwpck_require__(60215), exports); +tslib_1.__exportStar(__nccwpck_require__(66088), exports); +tslib_1.__exportStar(__nccwpck_require__(83732), exports); +tslib_1.__exportStar(__nccwpck_require__(8129), exports); +tslib_1.__exportStar(__nccwpck_require__(62061), exports); +tslib_1.__exportStar(__nccwpck_require__(18424), exports); +tslib_1.__exportStar(__nccwpck_require__(3428), exports); +tslib_1.__exportStar(__nccwpck_require__(84263), exports); +tslib_1.__exportStar(__nccwpck_require__(48603), exports); +tslib_1.__exportStar(__nccwpck_require__(46103), exports); +tslib_1.__exportStar(__nccwpck_require__(75310), exports); +tslib_1.__exportStar(__nccwpck_require__(6008), exports); +tslib_1.__exportStar(__nccwpck_require__(34926), exports); +tslib_1.__exportStar(__nccwpck_require__(87850), exports); +tslib_1.__exportStar(__nccwpck_require__(37295), exports); +tslib_1.__exportStar(__nccwpck_require__(6575), exports); + + +/***/ }), + +/***/ 81087: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 97058: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; + + +/***/ }), + +/***/ 77531: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 60215: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 66088: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 83732: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 8129: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 62061: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 18424: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 3428: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 84263: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 48603: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 46103: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 75310: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); + + +/***/ }), + +/***/ 6008: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 34926: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 87850: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 37295: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 6575: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 465: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.createConfigValueProvider = void 0; +const createConfigValueProvider = (configKey, canonicalEndpointParamKey, config) => { + const configProvider = async () => { + var _a; + const configValue = (_a = config[configKey]) !== null && _a !== void 0 ? _a : config[canonicalEndpointParamKey]; + if (typeof configValue === "function") { + return configValue(); } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `TransitiveTagKeys.${key}`; - entries[loc] = value; - }); - } - if (input.ExternalId != null) { - entries["ExternalId"] = input.ExternalId; - } - if (input.SerialNumber != null) { - entries["SerialNumber"] = input.SerialNumber; - } - if (input.TokenCode != null) { - entries["TokenCode"] = input.TokenCode; - } - if (input.SourceIdentity != null) { - entries["SourceIdentity"] = input.SourceIdentity; + return configValue; + }; + if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { + return async () => { + const endpoint = await configProvider(); + if (endpoint && typeof endpoint === "object") { + if ("url" in endpoint) { + return endpoint.url.href; + } + if ("hostname" in endpoint) { + const { protocol, hostname, port, path } = endpoint; + return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; + } + } + return endpoint; + }; } - return entries; + return configProvider; }; -const se_AssumeRoleWithSAMLRequest = (input, context) => { - const entries = {}; - if (input.RoleArn != null) { - entries["RoleArn"] = input.RoleArn; - } - if (input.PrincipalArn != null) { - entries["PrincipalArn"] = input.PrincipalArn; - } - if (input.SAMLAssertion != null) { - entries["SAMLAssertion"] = input.SAMLAssertion; +exports.createConfigValueProvider = createConfigValueProvider; + + +/***/ }), + +/***/ 73929: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveParams = exports.getEndpointFromInstructions = void 0; +const service_customizations_1 = __nccwpck_require__(13105); +const createConfigValueProvider_1 = __nccwpck_require__(465); +const getEndpointFromInstructions = async (commandInput, instructionsSupplier, clientConfig, context) => { + const endpointParams = await (0, exports.resolveParams)(commandInput, instructionsSupplier, clientConfig); + if (typeof clientConfig.endpointProvider !== "function") { + throw new Error("config.endpointProvider is not set."); } - if (input.PolicyArns != null) { - const memberEntries = se_policyDescriptorListType(input.PolicyArns, context); - if (input.PolicyArns?.length === 0) { - entries.PolicyArns = []; + const endpoint = clientConfig.endpointProvider(endpointParams, context); + return endpoint; +}; +exports.getEndpointFromInstructions = getEndpointFromInstructions; +const resolveParams = async (commandInput, instructionsSupplier, clientConfig) => { + var _a; + const endpointParams = {}; + const instructions = ((_a = instructionsSupplier === null || instructionsSupplier === void 0 ? void 0 : instructionsSupplier.getEndpointParameterInstructions) === null || _a === void 0 ? void 0 : _a.call(instructionsSupplier)) || {}; + for (const [name, instruction] of Object.entries(instructions)) { + switch (instruction.type) { + case "staticContextParams": + endpointParams[name] = instruction.value; + break; + case "contextParams": + endpointParams[name] = commandInput[instruction.name]; + break; + case "clientContextParams": + case "builtInParams": + endpointParams[name] = await (0, createConfigValueProvider_1.createConfigValueProvider)(instruction.name, name, clientConfig)(); + break; + default: + throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `PolicyArns.${key}`; - entries[loc] = value; - }); } - if (input.Policy != null) { - entries["Policy"] = input.Policy; + if (Object.keys(instructions).length === 0) { + Object.assign(endpointParams, clientConfig); } - if (input.DurationSeconds != null) { - entries["DurationSeconds"] = input.DurationSeconds; + if (String(clientConfig.serviceId).toLowerCase() === "s3") { + await (0, service_customizations_1.resolveParamsForS3)(endpointParams); } - return entries; + return endpointParams; }; -const se_AssumeRoleWithWebIdentityRequest = (input, context) => { - const entries = {}; - if (input.RoleArn != null) { - entries["RoleArn"] = input.RoleArn; - } - if (input.RoleSessionName != null) { - entries["RoleSessionName"] = input.RoleSessionName; - } - if (input.WebIdentityToken != null) { - entries["WebIdentityToken"] = input.WebIdentityToken; - } - if (input.ProviderId != null) { - entries["ProviderId"] = input.ProviderId; - } - if (input.PolicyArns != null) { - const memberEntries = se_policyDescriptorListType(input.PolicyArns, context); - if (input.PolicyArns?.length === 0) { - entries.PolicyArns = []; +exports.resolveParams = resolveParams; + + +/***/ }), + +/***/ 50890: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(73929), exports); +tslib_1.__exportStar(__nccwpck_require__(38938), exports); + + +/***/ }), + +/***/ 38938: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toEndpointV1 = void 0; +const url_parser_1 = __nccwpck_require__(14681); +const toEndpointV1 = (endpoint) => { + if (typeof endpoint === "object") { + if ("url" in endpoint) { + return (0, url_parser_1.parseUrl)(endpoint.url); } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `PolicyArns.${key}`; - entries[loc] = value; - }); - } - if (input.Policy != null) { - entries["Policy"] = input.Policy; - } - if (input.DurationSeconds != null) { - entries["DurationSeconds"] = input.DurationSeconds; + return endpoint; } - return entries; + return (0, url_parser_1.parseUrl)(endpoint); }; -const se_DecodeAuthorizationMessageRequest = (input, context) => { - const entries = {}; - if (input.EncodedMessage != null) { - entries["EncodedMessage"] = input.EncodedMessage; - } - return entries; +exports.toEndpointV1 = toEndpointV1; + + +/***/ }), + +/***/ 55520: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.endpointMiddleware = void 0; +const getEndpointFromInstructions_1 = __nccwpck_require__(73929); +const endpointMiddleware = ({ config, instructions, }) => { + return (next, context) => async (args) => { + var _a, _b; + const endpoint = await (0, getEndpointFromInstructions_1.getEndpointFromInstructions)(args.input, { + getEndpointParameterInstructions() { + return instructions; + }, + }, { ...config }, context); + context.endpointV2 = endpoint; + context.authSchemes = (_a = endpoint.properties) === null || _a === void 0 ? void 0 : _a.authSchemes; + const authScheme = (_b = context.authSchemes) === null || _b === void 0 ? void 0 : _b[0]; + if (authScheme) { + context["signing_region"] = authScheme.signingRegion; + context["signing_service"] = authScheme.signingName; + } + return next({ + ...args, + }); + }; }; -const se_GetAccessKeyInfoRequest = (input, context) => { - const entries = {}; - if (input.AccessKeyId != null) { - entries["AccessKeyId"] = input.AccessKeyId; - } - return entries; +exports.endpointMiddleware = endpointMiddleware; + + +/***/ }), + +/***/ 71329: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointPlugin = exports.endpointMiddlewareOptions = void 0; +const middleware_serde_1 = __nccwpck_require__(81238); +const endpointMiddleware_1 = __nccwpck_require__(55520); +exports.endpointMiddlewareOptions = { + step: "serialize", + tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], + name: "endpointV2Middleware", + override: true, + relation: "before", + toMiddleware: middleware_serde_1.serializerMiddlewareOption.name, }; -const se_GetCallerIdentityRequest = (input, context) => { - const entries = {}; - return entries; +const getEndpointPlugin = (config, instructions) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo((0, endpointMiddleware_1.endpointMiddleware)({ + config, + instructions, + }), exports.endpointMiddlewareOptions); + }, +}); +exports.getEndpointPlugin = getEndpointPlugin; + + +/***/ }), + +/***/ 82918: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(50890), exports); +tslib_1.__exportStar(__nccwpck_require__(55520), exports); +tslib_1.__exportStar(__nccwpck_require__(71329), exports); +tslib_1.__exportStar(__nccwpck_require__(74139), exports); +tslib_1.__exportStar(__nccwpck_require__(39720), exports); + + +/***/ }), + +/***/ 74139: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveEndpointConfig = void 0; +const util_middleware_1 = __nccwpck_require__(2390); +const toEndpointV1_1 = __nccwpck_require__(38938); +const resolveEndpointConfig = (input) => { + var _a, _b, _c; + const tls = (_a = input.tls) !== null && _a !== void 0 ? _a : true; + const { endpoint } = input; + const customEndpointProvider = endpoint != null ? async () => (0, toEndpointV1_1.toEndpointV1)(await (0, util_middleware_1.normalizeProvider)(endpoint)()) : undefined; + const isCustomEndpoint = !!endpoint; + return { + ...input, + endpoint: customEndpointProvider, + tls, + isCustomEndpoint, + useDualstackEndpoint: (0, util_middleware_1.normalizeProvider)((_b = input.useDualstackEndpoint) !== null && _b !== void 0 ? _b : false), + useFipsEndpoint: (0, util_middleware_1.normalizeProvider)((_c = input.useFipsEndpoint) !== null && _c !== void 0 ? _c : false), + }; }; -const se_GetFederationTokenRequest = (input, context) => { - const entries = {}; - if (input.Name != null) { - entries["Name"] = input.Name; - } - if (input.Policy != null) { - entries["Policy"] = input.Policy; +exports.resolveEndpointConfig = resolveEndpointConfig; + + +/***/ }), + +/***/ 13105: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(19194), exports); + + +/***/ }), + +/***/ 19194: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isArnBucketName = exports.isDnsCompatibleBucketName = exports.S3_HOSTNAME_PATTERN = exports.DOT_PATTERN = exports.resolveParamsForS3 = void 0; +const resolveParamsForS3 = async (endpointParams) => { + const bucket = (endpointParams === null || endpointParams === void 0 ? void 0 : endpointParams.Bucket) || ""; + if (typeof endpointParams.Bucket === "string") { + endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); } - if (input.PolicyArns != null) { - const memberEntries = se_policyDescriptorListType(input.PolicyArns, context); - if (input.PolicyArns?.length === 0) { - entries.PolicyArns = []; + if ((0, exports.isArnBucketName)(bucket)) { + if (endpointParams.ForcePathStyle === true) { + throw new Error("Path-style addressing cannot be used with ARN buckets"); } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `PolicyArns.${key}`; - entries[loc] = value; - }); } - if (input.DurationSeconds != null) { - entries["DurationSeconds"] = input.DurationSeconds; + else if (!(0, exports.isDnsCompatibleBucketName)(bucket) || + (bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:")) || + bucket.toLowerCase() !== bucket || + bucket.length < 3) { + endpointParams.ForcePathStyle = true; } - if (input.Tags != null) { - const memberEntries = se_tagListType(input.Tags, context); - if (input.Tags?.length === 0) { - entries.Tags = []; - } - Object.entries(memberEntries).forEach(([key, value]) => { - const loc = `Tags.${key}`; - entries[loc] = value; - }); + if (endpointParams.DisableMultiRegionAccessPoints) { + endpointParams.disableMultiRegionAccessPoints = true; + endpointParams.DisableMRAP = true; } - return entries; + return endpointParams; }; -const se_GetSessionTokenRequest = (input, context) => { - const entries = {}; - if (input.DurationSeconds != null) { - entries["DurationSeconds"] = input.DurationSeconds; - } - if (input.SerialNumber != null) { - entries["SerialNumber"] = input.SerialNumber; - } - if (input.TokenCode != null) { - entries["TokenCode"] = input.TokenCode; +exports.resolveParamsForS3 = resolveParamsForS3; +const DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; +const IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; +const DOTS_PATTERN = /\.\./; +exports.DOT_PATTERN = /\./; +exports.S3_HOSTNAME_PATTERN = /^(.+\.)?s3(-fips)?(\.dualstack)?[.-]([a-z0-9-]+)\./; +const isDnsCompatibleBucketName = (bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName); +exports.isDnsCompatibleBucketName = isDnsCompatibleBucketName; +const isArnBucketName = (bucketName) => { + const [arn, partition, service, region, account, typeOrId] = bucketName.split(":"); + const isArn = arn === "arn" && bucketName.split(":").length >= 6; + const isValidArn = [arn, partition, service, account, typeOrId].filter(Boolean).length === 5; + if (isArn && !isValidArn) { + throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); } - return entries; + return arn === "arn" && !!partition && !!service && !!account && !!typeOrId; }; -const se_policyDescriptorListType = (input, context) => { - const entries = {}; - let counter = 1; - for (const entry of input) { - if (entry === null) { - continue; - } - const memberEntries = se_PolicyDescriptorType(entry, context); - Object.entries(memberEntries).forEach(([key, value]) => { - entries[`member.${counter}.${key}`] = value; +exports.isArnBucketName = isArnBucketName; + + +/***/ }), + +/***/ 39720: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 80155: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AdaptiveRetryStrategy = void 0; +const util_retry_1 = __nccwpck_require__(84902); +const StandardRetryStrategy_1 = __nccwpck_require__(94582); +class AdaptiveRetryStrategy extends StandardRetryStrategy_1.StandardRetryStrategy { + constructor(maxAttemptsProvider, options) { + const { rateLimiter, ...superOptions } = options !== null && options !== void 0 ? options : {}; + super(maxAttemptsProvider, superOptions); + this.rateLimiter = rateLimiter !== null && rateLimiter !== void 0 ? rateLimiter : new util_retry_1.DefaultRateLimiter(); + this.mode = util_retry_1.RETRY_MODES.ADAPTIVE; + } + async retry(next, args) { + return super.retry(next, args, { + beforeRequest: async () => { + return this.rateLimiter.getSendToken(); + }, + afterRequest: (response) => { + this.rateLimiter.updateClientSendingRate(response); + }, }); - counter++; } - return entries; -}; -const se_PolicyDescriptorType = (input, context) => { - const entries = {}; - if (input.arn != null) { - entries["arn"] = input.arn; +} +exports.AdaptiveRetryStrategy = AdaptiveRetryStrategy; + + +/***/ }), + +/***/ 94582: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.StandardRetryStrategy = void 0; +const protocol_http_1 = __nccwpck_require__(3795); +const service_error_classification_1 = __nccwpck_require__(6375); +const util_retry_1 = __nccwpck_require__(84902); +const uuid_1 = __nccwpck_require__(75840); +const defaultRetryQuota_1 = __nccwpck_require__(29991); +const delayDecider_1 = __nccwpck_require__(9465); +const retryDecider_1 = __nccwpck_require__(67653); +const util_1 = __nccwpck_require__(42827); +class StandardRetryStrategy { + constructor(maxAttemptsProvider, options) { + var _a, _b, _c; + this.maxAttemptsProvider = maxAttemptsProvider; + this.mode = util_retry_1.RETRY_MODES.STANDARD; + this.retryDecider = (_a = options === null || options === void 0 ? void 0 : options.retryDecider) !== null && _a !== void 0 ? _a : retryDecider_1.defaultRetryDecider; + this.delayDecider = (_b = options === null || options === void 0 ? void 0 : options.delayDecider) !== null && _b !== void 0 ? _b : delayDecider_1.defaultDelayDecider; + this.retryQuota = (_c = options === null || options === void 0 ? void 0 : options.retryQuota) !== null && _c !== void 0 ? _c : (0, defaultRetryQuota_1.getDefaultRetryQuota)(util_retry_1.INITIAL_RETRY_TOKENS); } - return entries; -}; -const se_Tag = (input, context) => { - const entries = {}; - if (input.Key != null) { - entries["Key"] = input.Key; + shouldRetry(error, attempts, maxAttempts) { + return attempts < maxAttempts && this.retryDecider(error) && this.retryQuota.hasRetryTokens(error); } - if (input.Value != null) { - entries["Value"] = input.Value; + async getMaxAttempts() { + let maxAttempts; + try { + maxAttempts = await this.maxAttemptsProvider(); + } + catch (error) { + maxAttempts = util_retry_1.DEFAULT_MAX_ATTEMPTS; + } + return maxAttempts; } - return entries; -}; -const se_tagKeyListType = (input, context) => { - const entries = {}; - let counter = 1; - for (const entry of input) { - if (entry === null) { - continue; + async retry(next, args, options) { + let retryTokenAmount; + let attempts = 0; + let totalDelay = 0; + const maxAttempts = await this.getMaxAttempts(); + const { request } = args; + if (protocol_http_1.HttpRequest.isInstance(request)) { + request.headers[util_retry_1.INVOCATION_ID_HEADER] = (0, uuid_1.v4)(); + } + while (true) { + try { + if (protocol_http_1.HttpRequest.isInstance(request)) { + request.headers[util_retry_1.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + } + if (options === null || options === void 0 ? void 0 : options.beforeRequest) { + await options.beforeRequest(); + } + const { response, output } = await next(args); + if (options === null || options === void 0 ? void 0 : options.afterRequest) { + options.afterRequest(response); + } + this.retryQuota.releaseRetryTokens(retryTokenAmount); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalDelay; + return { response, output }; + } + catch (e) { + const err = (0, util_1.asSdkError)(e); + attempts++; + if (this.shouldRetry(err, attempts, maxAttempts)) { + retryTokenAmount = this.retryQuota.retrieveRetryTokens(err); + const delayFromDecider = this.delayDecider((0, service_error_classification_1.isThrottlingError)(err) ? util_retry_1.THROTTLING_RETRY_DELAY_BASE : util_retry_1.DEFAULT_RETRY_DELAY_BASE, attempts); + const delayFromResponse = getDelayFromRetryAfterHeader(err.$response); + const delay = Math.max(delayFromResponse || 0, delayFromDecider); + totalDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + continue; + } + if (!err.$metadata) { + err.$metadata = {}; + } + err.$metadata.attempts = attempts; + err.$metadata.totalRetryDelay = totalDelay; + throw err; + } } - entries[`member.${counter}`] = entry; - counter++; } - return entries; +} +exports.StandardRetryStrategy = StandardRetryStrategy; +const getDelayFromRetryAfterHeader = (response) => { + if (!protocol_http_1.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return retryAfterSeconds * 1000; + const retryAfterDate = new Date(retryAfter); + return retryAfterDate.getTime() - Date.now(); }; -const se_tagListType = (input, context) => { - const entries = {}; - let counter = 1; - for (const entry of input) { - if (entry === null) { - continue; + + +/***/ }), + +/***/ 58709: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODE_RETRY_MODE_CONFIG_OPTIONS = exports.CONFIG_RETRY_MODE = exports.ENV_RETRY_MODE = exports.resolveRetryConfig = exports.NODE_MAX_ATTEMPT_CONFIG_OPTIONS = exports.CONFIG_MAX_ATTEMPTS = exports.ENV_MAX_ATTEMPTS = void 0; +const util_middleware_1 = __nccwpck_require__(2390); +const util_retry_1 = __nccwpck_require__(84902); +exports.ENV_MAX_ATTEMPTS = "AWS_MAX_ATTEMPTS"; +exports.CONFIG_MAX_ATTEMPTS = "max_attempts"; +exports.NODE_MAX_ATTEMPT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + const value = env[exports.ENV_MAX_ATTEMPTS]; + if (!value) + return undefined; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Environment variable ${exports.ENV_MAX_ATTEMPTS} mast be a number, got "${value}"`); } - const memberEntries = se_Tag(entry, context); - Object.entries(memberEntries).forEach(([key, value]) => { - entries[`member.${counter}.${key}`] = value; - }); - counter++; - } - return entries; -}; -const de_AssumedRoleUser = (output, context) => { - const contents = {}; - if (output["AssumedRoleId"] !== undefined) { - contents.AssumedRoleId = (0, smithy_client_1.expectString)(output["AssumedRoleId"]); - } - if (output["Arn"] !== undefined) { - contents.Arn = (0, smithy_client_1.expectString)(output["Arn"]); - } - return contents; + return maxAttempt; + }, + configFileSelector: (profile) => { + const value = profile[exports.CONFIG_MAX_ATTEMPTS]; + if (!value) + return undefined; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Shared config file entry ${exports.CONFIG_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + default: util_retry_1.DEFAULT_MAX_ATTEMPTS, }; -const de_AssumeRoleResponse = (output, context) => { - const contents = {}; - if (output["Credentials"] !== undefined) { - contents.Credentials = de_Credentials(output["Credentials"], context); - } - if (output["AssumedRoleUser"] !== undefined) { - contents.AssumedRoleUser = de_AssumedRoleUser(output["AssumedRoleUser"], context); - } - if (output["PackedPolicySize"] !== undefined) { - contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]); - } - if (output["SourceIdentity"] !== undefined) { - contents.SourceIdentity = (0, smithy_client_1.expectString)(output["SourceIdentity"]); - } - return contents; +const resolveRetryConfig = (input) => { + var _a; + const { retryStrategy } = input; + const maxAttempts = (0, util_middleware_1.normalizeProvider)((_a = input.maxAttempts) !== null && _a !== void 0 ? _a : util_retry_1.DEFAULT_MAX_ATTEMPTS); + return { + ...input, + maxAttempts, + retryStrategy: async () => { + if (retryStrategy) { + return retryStrategy; + } + const retryMode = await (0, util_middleware_1.normalizeProvider)(input.retryMode)(); + if (retryMode === util_retry_1.RETRY_MODES.ADAPTIVE) { + return new util_retry_1.AdaptiveRetryStrategy(maxAttempts); + } + return new util_retry_1.StandardRetryStrategy(maxAttempts); + }, + }; }; -const de_AssumeRoleWithSAMLResponse = (output, context) => { - const contents = {}; - if (output["Credentials"] !== undefined) { - contents.Credentials = de_Credentials(output["Credentials"], context); - } - if (output["AssumedRoleUser"] !== undefined) { - contents.AssumedRoleUser = de_AssumedRoleUser(output["AssumedRoleUser"], context); - } - if (output["PackedPolicySize"] !== undefined) { - contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]); - } - if (output["Subject"] !== undefined) { - contents.Subject = (0, smithy_client_1.expectString)(output["Subject"]); - } - if (output["SubjectType"] !== undefined) { - contents.SubjectType = (0, smithy_client_1.expectString)(output["SubjectType"]); - } - if (output["Issuer"] !== undefined) { - contents.Issuer = (0, smithy_client_1.expectString)(output["Issuer"]); - } - if (output["Audience"] !== undefined) { - contents.Audience = (0, smithy_client_1.expectString)(output["Audience"]); - } - if (output["NameQualifier"] !== undefined) { - contents.NameQualifier = (0, smithy_client_1.expectString)(output["NameQualifier"]); - } - if (output["SourceIdentity"] !== undefined) { - contents.SourceIdentity = (0, smithy_client_1.expectString)(output["SourceIdentity"]); - } - return contents; +exports.resolveRetryConfig = resolveRetryConfig; +exports.ENV_RETRY_MODE = "AWS_RETRY_MODE"; +exports.CONFIG_RETRY_MODE = "retry_mode"; +exports.NODE_RETRY_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[exports.ENV_RETRY_MODE], + configFileSelector: (profile) => profile[exports.CONFIG_RETRY_MODE], + default: util_retry_1.DEFAULT_RETRY_MODE, }; -const de_AssumeRoleWithWebIdentityResponse = (output, context) => { - const contents = {}; - if (output["Credentials"] !== undefined) { - contents.Credentials = de_Credentials(output["Credentials"], context); - } - if (output["SubjectFromWebIdentityToken"] !== undefined) { - contents.SubjectFromWebIdentityToken = (0, smithy_client_1.expectString)(output["SubjectFromWebIdentityToken"]); - } - if (output["AssumedRoleUser"] !== undefined) { - contents.AssumedRoleUser = de_AssumedRoleUser(output["AssumedRoleUser"], context); - } - if (output["PackedPolicySize"] !== undefined) { - contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]); - } - if (output["Provider"] !== undefined) { - contents.Provider = (0, smithy_client_1.expectString)(output["Provider"]); - } - if (output["Audience"] !== undefined) { - contents.Audience = (0, smithy_client_1.expectString)(output["Audience"]); - } - if (output["SourceIdentity"] !== undefined) { - contents.SourceIdentity = (0, smithy_client_1.expectString)(output["SourceIdentity"]); - } - return contents; + + +/***/ }), + +/***/ 29991: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getDefaultRetryQuota = void 0; +const util_retry_1 = __nccwpck_require__(84902); +const getDefaultRetryQuota = (initialRetryTokens, options) => { + var _a, _b, _c; + const MAX_CAPACITY = initialRetryTokens; + const noRetryIncrement = (_a = options === null || options === void 0 ? void 0 : options.noRetryIncrement) !== null && _a !== void 0 ? _a : util_retry_1.NO_RETRY_INCREMENT; + const retryCost = (_b = options === null || options === void 0 ? void 0 : options.retryCost) !== null && _b !== void 0 ? _b : util_retry_1.RETRY_COST; + const timeoutRetryCost = (_c = options === null || options === void 0 ? void 0 : options.timeoutRetryCost) !== null && _c !== void 0 ? _c : util_retry_1.TIMEOUT_RETRY_COST; + let availableCapacity = initialRetryTokens; + const getCapacityAmount = (error) => (error.name === "TimeoutError" ? timeoutRetryCost : retryCost); + const hasRetryTokens = (error) => getCapacityAmount(error) <= availableCapacity; + const retrieveRetryTokens = (error) => { + if (!hasRetryTokens(error)) { + throw new Error("No retry token available"); + } + const capacityAmount = getCapacityAmount(error); + availableCapacity -= capacityAmount; + return capacityAmount; + }; + const releaseRetryTokens = (capacityReleaseAmount) => { + availableCapacity += capacityReleaseAmount !== null && capacityReleaseAmount !== void 0 ? capacityReleaseAmount : noRetryIncrement; + availableCapacity = Math.min(availableCapacity, MAX_CAPACITY); + }; + return Object.freeze({ + hasRetryTokens, + retrieveRetryTokens, + releaseRetryTokens, + }); }; -const de_Credentials = (output, context) => { - const contents = {}; - if (output["AccessKeyId"] !== undefined) { - contents.AccessKeyId = (0, smithy_client_1.expectString)(output["AccessKeyId"]); - } - if (output["SecretAccessKey"] !== undefined) { - contents.SecretAccessKey = (0, smithy_client_1.expectString)(output["SecretAccessKey"]); - } - if (output["SessionToken"] !== undefined) { - contents.SessionToken = (0, smithy_client_1.expectString)(output["SessionToken"]); - } - if (output["Expiration"] !== undefined) { - contents.Expiration = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseRfc3339DateTimeWithOffset)(output["Expiration"])); +exports.getDefaultRetryQuota = getDefaultRetryQuota; + + +/***/ }), + +/***/ 9465: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultDelayDecider = void 0; +const util_retry_1 = __nccwpck_require__(84902); +const defaultDelayDecider = (delayBase, attempts) => Math.floor(Math.min(util_retry_1.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); +exports.defaultDelayDecider = defaultDelayDecider; + + +/***/ }), + +/***/ 96039: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(80155), exports); +tslib_1.__exportStar(__nccwpck_require__(94582), exports); +tslib_1.__exportStar(__nccwpck_require__(58709), exports); +tslib_1.__exportStar(__nccwpck_require__(9465), exports); +tslib_1.__exportStar(__nccwpck_require__(76556), exports); +tslib_1.__exportStar(__nccwpck_require__(67653), exports); +tslib_1.__exportStar(__nccwpck_require__(81434), exports); + + +/***/ }), + +/***/ 76556: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getOmitRetryHeadersPlugin = exports.omitRetryHeadersMiddlewareOptions = exports.omitRetryHeadersMiddleware = void 0; +const protocol_http_1 = __nccwpck_require__(3795); +const util_retry_1 = __nccwpck_require__(84902); +const omitRetryHeadersMiddleware = () => (next) => async (args) => { + const { request } = args; + if (protocol_http_1.HttpRequest.isInstance(request)) { + delete request.headers[util_retry_1.INVOCATION_ID_HEADER]; + delete request.headers[util_retry_1.REQUEST_HEADER]; } - return contents; + return next(args); }; -const de_DecodeAuthorizationMessageResponse = (output, context) => { - const contents = {}; - if (output["DecodedMessage"] !== undefined) { - contents.DecodedMessage = (0, smithy_client_1.expectString)(output["DecodedMessage"]); - } - return contents; +exports.omitRetryHeadersMiddleware = omitRetryHeadersMiddleware; +exports.omitRetryHeadersMiddlewareOptions = { + name: "omitRetryHeadersMiddleware", + tags: ["RETRY", "HEADERS", "OMIT_RETRY_HEADERS"], + relation: "before", + toMiddleware: "awsAuthMiddleware", + override: true, }; -const de_ExpiredTokenException = (output, context) => { - const contents = {}; - if (output["message"] !== undefined) { - contents.message = (0, smithy_client_1.expectString)(output["message"]); +const getOmitRetryHeadersPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo((0, exports.omitRetryHeadersMiddleware)(), exports.omitRetryHeadersMiddlewareOptions); + }, +}); +exports.getOmitRetryHeadersPlugin = getOmitRetryHeadersPlugin; + + +/***/ }), + +/***/ 67653: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultRetryDecider = void 0; +const service_error_classification_1 = __nccwpck_require__(6375); +const defaultRetryDecider = (error) => { + if (!error) { + return false; } - return contents; + return (0, service_error_classification_1.isRetryableByTrait)(error) || (0, service_error_classification_1.isClockSkewError)(error) || (0, service_error_classification_1.isThrottlingError)(error) || (0, service_error_classification_1.isTransientError)(error); }; -const de_FederatedUser = (output, context) => { - const contents = {}; - if (output["FederatedUserId"] !== undefined) { - contents.FederatedUserId = (0, smithy_client_1.expectString)(output["FederatedUserId"]); - } - if (output["Arn"] !== undefined) { - contents.Arn = (0, smithy_client_1.expectString)(output["Arn"]); +exports.defaultRetryDecider = defaultRetryDecider; + + +/***/ }), + +/***/ 81434: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRetryAfterHint = exports.getRetryPlugin = exports.retryMiddlewareOptions = exports.retryMiddleware = void 0; +const protocol_http_1 = __nccwpck_require__(3795); +const service_error_classification_1 = __nccwpck_require__(6375); +const util_retry_1 = __nccwpck_require__(84902); +const uuid_1 = __nccwpck_require__(75840); +const util_1 = __nccwpck_require__(42827); +const retryMiddleware = (options) => (next, context) => async (args) => { + let retryStrategy = await options.retryStrategy(); + const maxAttempts = await options.maxAttempts(); + if (isRetryStrategyV2(retryStrategy)) { + retryStrategy = retryStrategy; + let retryToken = await retryStrategy.acquireInitialRetryToken(context["partition_id"]); + let lastError = new Error(); + let attempts = 0; + let totalRetryDelay = 0; + const { request } = args; + if (protocol_http_1.HttpRequest.isInstance(request)) { + request.headers[util_retry_1.INVOCATION_ID_HEADER] = (0, uuid_1.v4)(); + } + while (true) { + try { + if (protocol_http_1.HttpRequest.isInstance(request)) { + request.headers[util_retry_1.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + } + const { response, output } = await next(args); + retryStrategy.recordSuccess(retryToken); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalRetryDelay; + return { response, output }; + } + catch (e) { + const retryErrorInfo = getRetryErrorInfo(e); + lastError = (0, util_1.asSdkError)(e); + try { + retryToken = await retryStrategy.refreshRetryTokenForRetry(retryToken, retryErrorInfo); + } + catch (refreshError) { + if (!lastError.$metadata) { + lastError.$metadata = {}; + } + lastError.$metadata.attempts = attempts + 1; + lastError.$metadata.totalRetryDelay = totalRetryDelay; + throw lastError; + } + attempts = retryToken.getRetryCount(); + const delay = retryToken.getRetryDelay(); + totalRetryDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + } + } } - return contents; -}; -const de_GetAccessKeyInfoResponse = (output, context) => { - const contents = {}; - if (output["Account"] !== undefined) { - contents.Account = (0, smithy_client_1.expectString)(output["Account"]); + else { + retryStrategy = retryStrategy; + if (retryStrategy === null || retryStrategy === void 0 ? void 0 : retryStrategy.mode) + context.userAgent = [...(context.userAgent || []), ["cfg/retry-mode", retryStrategy.mode]]; + return retryStrategy.retry(next, args); } - return contents; }; -const de_GetCallerIdentityResponse = (output, context) => { - const contents = {}; - if (output["UserId"] !== undefined) { - contents.UserId = (0, smithy_client_1.expectString)(output["UserId"]); - } - if (output["Account"] !== undefined) { - contents.Account = (0, smithy_client_1.expectString)(output["Account"]); - } - if (output["Arn"] !== undefined) { - contents.Arn = (0, smithy_client_1.expectString)(output["Arn"]); +exports.retryMiddleware = retryMiddleware; +const isRetryStrategyV2 = (retryStrategy) => typeof retryStrategy.acquireInitialRetryToken !== "undefined" && + typeof retryStrategy.refreshRetryTokenForRetry !== "undefined" && + typeof retryStrategy.recordSuccess !== "undefined"; +const getRetryErrorInfo = (error) => { + const errorInfo = { + errorType: getRetryErrorType(error), + }; + const retryAfterHint = (0, exports.getRetryAfterHint)(error.$response); + if (retryAfterHint) { + errorInfo.retryAfterHint = retryAfterHint; } - return contents; + return errorInfo; }; -const de_GetFederationTokenResponse = (output, context) => { - const contents = {}; - if (output["Credentials"] !== undefined) { - contents.Credentials = de_Credentials(output["Credentials"], context); - } - if (output["FederatedUser"] !== undefined) { - contents.FederatedUser = de_FederatedUser(output["FederatedUser"], context); - } - if (output["PackedPolicySize"] !== undefined) { - contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]); - } - return contents; +const getRetryErrorType = (error) => { + if ((0, service_error_classification_1.isThrottlingError)(error)) + return "THROTTLING"; + if ((0, service_error_classification_1.isTransientError)(error)) + return "TRANSIENT"; + if ((0, service_error_classification_1.isServerError)(error)) + return "SERVER_ERROR"; + return "CLIENT_ERROR"; }; -const de_GetSessionTokenResponse = (output, context) => { - const contents = {}; - if (output["Credentials"] !== undefined) { - contents.Credentials = de_Credentials(output["Credentials"], context); - } - return contents; +exports.retryMiddlewareOptions = { + name: "retryMiddleware", + tags: ["RETRY"], + step: "finalizeRequest", + priority: "high", + override: true, }; -const de_IDPCommunicationErrorException = (output, context) => { - const contents = {}; - if (output["message"] !== undefined) { - contents.message = (0, smithy_client_1.expectString)(output["message"]); - } - return contents; +const getRetryPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add((0, exports.retryMiddleware)(options), exports.retryMiddlewareOptions); + }, +}); +exports.getRetryPlugin = getRetryPlugin; +const getRetryAfterHint = (response) => { + if (!protocol_http_1.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return new Date(retryAfterSeconds * 1000); + const retryAfterDate = new Date(retryAfter); + return retryAfterDate; }; -const de_IDPRejectedClaimException = (output, context) => { - const contents = {}; - if (output["message"] !== undefined) { - contents.message = (0, smithy_client_1.expectString)(output["message"]); - } - return contents; +exports.getRetryAfterHint = getRetryAfterHint; + + +/***/ }), + +/***/ 42827: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.asSdkError = void 0; +const asSdkError = (error) => { + if (error instanceof Error) + return error; + if (error instanceof Object) + return Object.assign(new Error(), error); + if (typeof error === "string") + return new Error(error); + return new Error(`AWS SDK error wrapper for ${error}`); }; -const de_InvalidAuthorizationMessageException = (output, context) => { - const contents = {}; - if (output["message"] !== undefined) { - contents.message = (0, smithy_client_1.expectString)(output["message"]); +exports.asSdkError = asSdkError; + + +/***/ }), + +/***/ 16052: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Field = void 0; +const types_1 = __nccwpck_require__(81460); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; } - return contents; -}; -const de_InvalidIdentityTokenException = (output, context) => { - const contents = {}; - if (output["message"] !== undefined) { - contents.message = (0, smithy_client_1.expectString)(output["message"]); + add(value) { + this.values.push(value); } - return contents; -}; -const de_MalformedPolicyDocumentException = (output, context) => { - const contents = {}; - if (output["message"] !== undefined) { - contents.message = (0, smithy_client_1.expectString)(output["message"]); + set(values) { + this.values = values; } - return contents; -}; -const de_PackedPolicyTooLargeException = (output, context) => { - const contents = {}; - if (output["message"] !== undefined) { - contents.message = (0, smithy_client_1.expectString)(output["message"]); + remove(value) { + this.values = this.values.filter((v) => v !== value); } - return contents; -}; -const de_RegionDisabledException = (output, context) => { - const contents = {}; - if (output["message"] !== undefined) { - contents.message = (0, smithy_client_1.expectString)(output["message"]); + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); } - return contents; -}; -const deserializeMetadata = (output) => ({ - httpStatusCode: output.statusCode, - requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"], -}); -const collectBodyString = (streamBody, context) => (0, smithy_client_1.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)); -const throwDefaultError = (0, smithy_client_1.withBaseException)(STSServiceException_1.STSServiceException); -const buildHttpRpcRequest = async (context, headers, path, resolvedHostname, body) => { - const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); - const contents = { - protocol, - hostname, - port, - method: "POST", - path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, - headers, - }; - if (resolvedHostname !== undefined) { - contents.hostname = resolvedHostname; + get() { + return this.values; } - if (body !== undefined) { - contents.body = body; +} +exports.Field = Field; + + +/***/ }), + +/***/ 93409: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; } - return new protocol_http_1.HttpRequest(contents); -}; -const SHARED_HEADERS = { - "content-type": "application/x-www-form-urlencoded", -}; -const parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { - if (encoded.length) { - const parser = new fast_xml_parser_1.XMLParser({ - attributeNamePrefix: "", - htmlEntities: true, - ignoreAttributes: false, - ignoreDeclaration: true, - parseTagValue: false, - trimValues: false, - tagValueProcessor: (_, val) => (val.trim() === "" && val.includes("\n") ? "" : undefined), - }); - parser.addEntity("#xD", "\r"); - parser.addEntity("#10", "\n"); - const parsedObj = parser.parse(encoded); - const textNodeName = "#text"; - const key = Object.keys(parsedObj)[0]; - const parsedObjToReturn = parsedObj[key]; - if (parsedObjToReturn[textNodeName]) { - parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; - delete parsedObjToReturn[textNodeName]; - } - return (0, smithy_client_1.getValueFromTextNode)(parsedObjToReturn); + setField(field) { + this.entries[field.name.toLowerCase()] = field; } - return {}; -}); -const parseErrorBody = async (errorBody, context) => { - const value = await parseBody(errorBody, context); - if (value.Error) { - value.Error.message = value.Error.message ?? value.Error.Message; + getField(name) { + return this.entries[name.toLowerCase()]; } - return value; -}; -const buildFormUrlencodedString = (formEntries) => Object.entries(formEntries) - .map(([key, value]) => (0, smithy_client_1.extendedEncodeURIComponent)(key) + "=" + (0, smithy_client_1.extendedEncodeURIComponent)(value)) - .join("&"); -const loadQueryErrorCode = (output, data) => { - if (data.Error?.Code !== undefined) { - return data.Error.Code; + removeField(name) { + delete this.entries[name.toLowerCase()]; } - if (output.statusCode == 404) { - return "NotFound"; + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); } -}; +} +exports.Fields = Fields; /***/ }), -/***/ 83405: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 50540: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const tslib_1 = __nccwpck_require__(4351); -const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(7947)); -const defaultStsRoleAssumers_1 = __nccwpck_require__(90048); -const config_resolver_1 = __nccwpck_require__(56153); -const credential_provider_node_1 = __nccwpck_require__(75531); -const hash_node_1 = __nccwpck_require__(97442); -const middleware_retry_1 = __nccwpck_require__(96064); -const node_config_provider_1 = __nccwpck_require__(87684); -const node_http_handler_1 = __nccwpck_require__(68805); -const util_body_length_node_1 = __nccwpck_require__(74147); -const util_retry_1 = __nccwpck_require__(99395); -const util_user_agent_node_1 = __nccwpck_require__(98095); -const runtimeConfig_shared_1 = __nccwpck_require__(52642); -const smithy_client_1 = __nccwpck_require__(4963); -const util_defaults_mode_node_1 = __nccwpck_require__(74243); -const smithy_client_2 = __nccwpck_require__(4963); -const getRuntimeConfig = (config) => { - (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); - const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); - const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); - const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); +exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0; +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; return { - ...clientSharedValues, - ...config, - runtime: "node", - defaultsMode, - bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, - credentialDefaultProvider: config?.credentialDefaultProvider ?? (0, defaultStsRoleAssumers_1.decorateDefaultCredentialProvider)(credential_provider_node_1.defaultProvider), - defaultUserAgentProvider: config?.defaultUserAgentProvider ?? - (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), - maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), - region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), - requestHandler: config?.requestHandler ?? new node_http_handler_1.NodeHttpHandler(defaultConfigProvider), - retryMode: config?.retryMode ?? - (0, node_config_provider_1.loadConfig)({ - ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, - default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, - }), - sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), - streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, - useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), - useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + }, }; }; -exports.getRuntimeConfig = getRuntimeConfig; +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), + }; +}; +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; /***/ }), -/***/ 52642: +/***/ 57021: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRuntimeConfig = void 0; -const smithy_client_1 = __nccwpck_require__(4963); -const url_parser_1 = __nccwpck_require__(2992); -const util_base64_1 = __nccwpck_require__(97727); -const util_utf8_1 = __nccwpck_require__(2855); -const endpointResolver_1 = __nccwpck_require__(41203); -const getRuntimeConfig = (config) => ({ - apiVersion: "2011-06-15", - base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, - base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, - disableHostPrefix: config?.disableHostPrefix ?? false, - endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, - logger: config?.logger ?? new smithy_client_1.NoOpLogger(), - serviceId: config?.serviceId ?? "STS", - urlParser: config?.urlParser ?? url_parser_1.parseUrl, - utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, - utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, -}); -exports.getRuntimeConfig = getRuntimeConfig; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(50540), exports); /***/ }), -/***/ 14723: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 63682: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = exports.DEFAULT_USE_DUALSTACK_ENDPOINT = exports.CONFIG_USE_DUALSTACK_ENDPOINT = exports.ENV_USE_DUALSTACK_ENDPOINT = void 0; -const util_config_provider_1 = __nccwpck_require__(6168); -exports.ENV_USE_DUALSTACK_ENDPOINT = "AWS_USE_DUALSTACK_ENDPOINT"; -exports.CONFIG_USE_DUALSTACK_ENDPOINT = "use_dualstack_endpoint"; -exports.DEFAULT_USE_DUALSTACK_ENDPOINT = false; -exports.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => (0, util_config_provider_1.booleanSelector)(env, exports.ENV_USE_DUALSTACK_ENDPOINT, util_config_provider_1.SelectorType.ENV), - configFileSelector: (profile) => (0, util_config_provider_1.booleanSelector)(profile, exports.CONFIG_USE_DUALSTACK_ENDPOINT, util_config_provider_1.SelectorType.CONFIG), - default: false, -}; /***/ }), -/***/ 42478: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 57943: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = exports.DEFAULT_USE_FIPS_ENDPOINT = exports.CONFIG_USE_FIPS_ENDPOINT = exports.ENV_USE_FIPS_ENDPOINT = void 0; -const util_config_provider_1 = __nccwpck_require__(6168); -exports.ENV_USE_FIPS_ENDPOINT = "AWS_USE_FIPS_ENDPOINT"; -exports.CONFIG_USE_FIPS_ENDPOINT = "use_fips_endpoint"; -exports.DEFAULT_USE_FIPS_ENDPOINT = false; -exports.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => (0, util_config_provider_1.booleanSelector)(env, exports.ENV_USE_FIPS_ENDPOINT, util_config_provider_1.SelectorType.ENV), - configFileSelector: (profile) => (0, util_config_provider_1.booleanSelector)(profile, exports.CONFIG_USE_FIPS_ENDPOINT, util_config_provider_1.SelectorType.CONFIG), - default: false, -}; +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); + } + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; + } +} +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} + + +/***/ }), + +/***/ 6475: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} +exports.HttpResponse = HttpResponse; /***/ }), -/***/ 47392: +/***/ 3795: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(14723), exports); -tslib_1.__exportStar(__nccwpck_require__(42478), exports); -tslib_1.__exportStar(__nccwpck_require__(92108), exports); -tslib_1.__exportStar(__nccwpck_require__(92327), exports); +tslib_1.__exportStar(__nccwpck_require__(57021), exports); +tslib_1.__exportStar(__nccwpck_require__(16052), exports); +tslib_1.__exportStar(__nccwpck_require__(93409), exports); +tslib_1.__exportStar(__nccwpck_require__(63682), exports); +tslib_1.__exportStar(__nccwpck_require__(57943), exports); +tslib_1.__exportStar(__nccwpck_require__(6475), exports); +tslib_1.__exportStar(__nccwpck_require__(19329), exports); +tslib_1.__exportStar(__nccwpck_require__(2871), exports); /***/ }), -/***/ 92108: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 19329: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveCustomEndpointsConfig = void 0; -const util_middleware_1 = __nccwpck_require__(10236); -const resolveCustomEndpointsConfig = (input) => { - var _a, _b; - const { endpoint, urlParser } = input; - return { - ...input, - tls: (_a = input.tls) !== null && _a !== void 0 ? _a : true, - endpoint: (0, util_middleware_1.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint), - isCustomEndpoint: true, - useDualstackEndpoint: (0, util_middleware_1.normalizeProvider)((_b = input.useDualstackEndpoint) !== null && _b !== void 0 ? _b : false), - }; -}; -exports.resolveCustomEndpointsConfig = resolveCustomEndpointsConfig; +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; /***/ }), -/***/ 92327: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 2871: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveEndpointsConfig = void 0; -const util_middleware_1 = __nccwpck_require__(10236); -const getEndpointFromRegion_1 = __nccwpck_require__(94159); -const resolveEndpointsConfig = (input) => { - var _a, _b; - const useDualstackEndpoint = (0, util_middleware_1.normalizeProvider)((_a = input.useDualstackEndpoint) !== null && _a !== void 0 ? _a : false); - const { endpoint, useFipsEndpoint, urlParser } = input; - return { - ...input, - tls: (_b = input.tls) !== null && _b !== void 0 ? _b : true, - endpoint: endpoint - ? (0, util_middleware_1.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint) - : () => (0, getEndpointFromRegion_1.getEndpointFromRegion)({ ...input, useDualstackEndpoint, useFipsEndpoint }), - isCustomEndpoint: !!endpoint, - useDualstackEndpoint, - }; -}; -exports.resolveEndpointsConfig = resolveEndpointsConfig; /***/ }), -/***/ 94159: +/***/ 985: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 13197: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); + + +/***/ }), + +/***/ 68397: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 19964: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 48296: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 72931: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 79294: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getEndpointFromRegion = void 0; -const getEndpointFromRegion = async (input) => { - var _a; - const { tls = true } = input; - const region = await input.region(); - const dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/); - if (!dnsHostRegex.test(region)) { - throw new Error("Invalid region in client config"); - } - const useDualstackEndpoint = await input.useDualstackEndpoint(); - const useFipsEndpoint = await input.useFipsEndpoint(); - const { hostname } = (_a = (await input.regionInfoProvider(region, { useDualstackEndpoint, useFipsEndpoint }))) !== null && _a !== void 0 ? _a : {}; - if (!hostname) { - throw new Error("Cannot resolve hostname from client config"); - } - return input.urlParser(`${tls ? "https:" : "http:"}//${hostname}`); -}; -exports.getEndpointFromRegion = getEndpointFromRegion; /***/ }), -/***/ 56153: +/***/ 88091: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(47392), exports); -tslib_1.__exportStar(__nccwpck_require__(85441), exports); -tslib_1.__exportStar(__nccwpck_require__(86258), exports); +tslib_1.__exportStar(__nccwpck_require__(79294), exports); +tslib_1.__exportStar(__nccwpck_require__(4970), exports); +tslib_1.__exportStar(__nccwpck_require__(57275), exports); /***/ }), -/***/ 70422: +/***/ 4970: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NODE_REGION_CONFIG_FILE_OPTIONS = exports.NODE_REGION_CONFIG_OPTIONS = exports.REGION_INI_NAME = exports.REGION_ENV_NAME = void 0; -exports.REGION_ENV_NAME = "AWS_REGION"; -exports.REGION_INI_NAME = "region"; -exports.NODE_REGION_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[exports.REGION_ENV_NAME], - configFileSelector: (profile) => profile[exports.REGION_INI_NAME], - default: () => { - throw new Error("Region is missing"); - }, -}; -exports.NODE_REGION_CONFIG_FILE_OPTIONS = { - preferredFile: "credentials", -}; /***/ }), -/***/ 52844: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 57275: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRealRegion = void 0; -const isFipsRegion_1 = __nccwpck_require__(82440); -const getRealRegion = (region) => (0, isFipsRegion_1.isFipsRegion)(region) - ? ["fips-aws-global", "aws-fips"].includes(region) - ? "us-east-1" - : region.replace(/fips-(dkr-|prod-)?|-fips/, "") - : region; -exports.getRealRegion = getRealRegion; /***/ }), -/***/ 85441: +/***/ 96671: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 3473: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 52693: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 3394: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 34041: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 81984: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 85317: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 76193: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(70422), exports); -tslib_1.__exportStar(__nccwpck_require__(60174), exports); +tslib_1.__exportStar(__nccwpck_require__(3394), exports); +tslib_1.__exportStar(__nccwpck_require__(34041), exports); +tslib_1.__exportStar(__nccwpck_require__(81984), exports); +tslib_1.__exportStar(__nccwpck_require__(29702), exports); +tslib_1.__exportStar(__nccwpck_require__(85317), exports); /***/ }), -/***/ 82440: +/***/ 29702: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isFipsRegion = void 0; -const isFipsRegion = (region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")); -exports.isFipsRegion = isFipsRegion; /***/ }), -/***/ 60174: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 16272: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveRegionConfig = void 0; -const getRealRegion_1 = __nccwpck_require__(52844); -const isFipsRegion_1 = __nccwpck_require__(82440); -const resolveRegionConfig = (input) => { - const { region, useFipsEndpoint } = input; - if (!region) { - throw new Error("Region is missing"); + + +/***/ }), + +/***/ 20152: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); + } + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); } return { - ...input, - region: async () => { - if (typeof region === "string") { - return (0, getRealRegion_1.getRealRegion)(region); - } - const providedRegion = await region(); - return (0, getRealRegion_1.getRealRegion)(providedRegion); + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); }, - useFipsEndpoint: async () => { - const providedRegion = typeof region === "string" ? region : await region(); - if ((0, isFipsRegion_1.isFipsRegion)(providedRegion)) { - return true; - } - return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); + checksumAlgorithms() { + return this._checksumAlgorithms; }, }; }; -exports.resolveRegionConfig = resolveRegionConfig; +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; + + +/***/ }), + +/***/ 53018: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(20152); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + }; +}; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; +}; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; + + +/***/ }), + +/***/ 67390: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 45929: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(53018), exports); +tslib_1.__exportStar(__nccwpck_require__(67390), exports); +var checksum_1 = __nccwpck_require__(20152); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); + + +/***/ }), + +/***/ 34503: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); /***/ }), -/***/ 3566: +/***/ 15096: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -18246,7 +37675,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 56057: +/***/ 45117: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -18256,555 +37685,254 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 15280: -/***/ ((__unused_webpack_module, exports) => { +/***/ 17920: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getHostnameFromVariants = void 0; -const getHostnameFromVariants = (variants = [], { useFipsEndpoint, useDualstackEndpoint }) => { - var _a; - return (_a = variants.find(({ tags }) => useFipsEndpoint === tags.includes("fips") && useDualstackEndpoint === tags.includes("dualstack"))) === null || _a === void 0 ? void 0 : _a.hostname; -}; -exports.getHostnameFromVariants = getHostnameFromVariants; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(15096), exports); +tslib_1.__exportStar(__nccwpck_require__(45117), exports); /***/ }), -/***/ 26167: +/***/ 81460: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRegionInfo = void 0; -const getHostnameFromVariants_1 = __nccwpck_require__(15280); -const getResolvedHostname_1 = __nccwpck_require__(63877); -const getResolvedPartition_1 = __nccwpck_require__(37642); -const getResolvedSigningRegion_1 = __nccwpck_require__(53517); -const getRegionInfo = (region, { useFipsEndpoint = false, useDualstackEndpoint = false, signingService, regionHash, partitionHash, }) => { - var _a, _b, _c, _d, _e, _f; - const partition = (0, getResolvedPartition_1.getResolvedPartition)(region, { partitionHash }); - const resolvedRegion = region in regionHash ? region : (_b = (_a = partitionHash[partition]) === null || _a === void 0 ? void 0 : _a.endpoint) !== null && _b !== void 0 ? _b : region; - const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint }; - const regionHostname = (0, getHostnameFromVariants_1.getHostnameFromVariants)((_c = regionHash[resolvedRegion]) === null || _c === void 0 ? void 0 : _c.variants, hostnameOptions); - const partitionHostname = (0, getHostnameFromVariants_1.getHostnameFromVariants)((_d = partitionHash[partition]) === null || _d === void 0 ? void 0 : _d.variants, hostnameOptions); - const hostname = (0, getResolvedHostname_1.getResolvedHostname)(resolvedRegion, { regionHostname, partitionHostname }); - if (hostname === undefined) { - throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`); - } - const signingRegion = (0, getResolvedSigningRegion_1.getResolvedSigningRegion)(hostname, { - signingRegion: (_e = regionHash[resolvedRegion]) === null || _e === void 0 ? void 0 : _e.signingRegion, - regionRegex: partitionHash[partition].regionRegex, - useFipsEndpoint, - }); - return { - partition, - signingService, - hostname, - ...(signingRegion && { signingRegion }), - ...(((_f = regionHash[resolvedRegion]) === null || _f === void 0 ? void 0 : _f.signingService) && { - signingService: regionHash[resolvedRegion].signingService, - }), - }; -}; -exports.getRegionInfo = getRegionInfo; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(985), exports); +tslib_1.__exportStar(__nccwpck_require__(13197), exports); +tslib_1.__exportStar(__nccwpck_require__(68397), exports); +tslib_1.__exportStar(__nccwpck_require__(19964), exports); +tslib_1.__exportStar(__nccwpck_require__(48296), exports); +tslib_1.__exportStar(__nccwpck_require__(72931), exports); +tslib_1.__exportStar(__nccwpck_require__(88091), exports); +tslib_1.__exportStar(__nccwpck_require__(96671), exports); +tslib_1.__exportStar(__nccwpck_require__(3473), exports); +tslib_1.__exportStar(__nccwpck_require__(52693), exports); +tslib_1.__exportStar(__nccwpck_require__(76193), exports); +tslib_1.__exportStar(__nccwpck_require__(16272), exports); +tslib_1.__exportStar(__nccwpck_require__(45929), exports); +tslib_1.__exportStar(__nccwpck_require__(34503), exports); +tslib_1.__exportStar(__nccwpck_require__(17920), exports); +tslib_1.__exportStar(__nccwpck_require__(58938), exports); +tslib_1.__exportStar(__nccwpck_require__(23724), exports); +tslib_1.__exportStar(__nccwpck_require__(86894), exports); +tslib_1.__exportStar(__nccwpck_require__(55720), exports); +tslib_1.__exportStar(__nccwpck_require__(11754), exports); +tslib_1.__exportStar(__nccwpck_require__(42168), exports); +tslib_1.__exportStar(__nccwpck_require__(37933), exports); +tslib_1.__exportStar(__nccwpck_require__(4903), exports); +tslib_1.__exportStar(__nccwpck_require__(66538), exports); +tslib_1.__exportStar(__nccwpck_require__(81594), exports); +tslib_1.__exportStar(__nccwpck_require__(43533), exports); +tslib_1.__exportStar(__nccwpck_require__(5405), exports); +tslib_1.__exportStar(__nccwpck_require__(96555), exports); +tslib_1.__exportStar(__nccwpck_require__(17129), exports); +tslib_1.__exportStar(__nccwpck_require__(12614), exports); +tslib_1.__exportStar(__nccwpck_require__(53396), exports); +tslib_1.__exportStar(__nccwpck_require__(21353), exports); +tslib_1.__exportStar(__nccwpck_require__(93105), exports); +tslib_1.__exportStar(__nccwpck_require__(60568), exports); + + +/***/ }), + +/***/ 58938: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 63877: +/***/ 23724: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getResolvedHostname = void 0; -const getResolvedHostname = (resolvedRegion, { regionHostname, partitionHostname }) => regionHostname - ? regionHostname - : partitionHostname - ? partitionHostname.replace("{region}", resolvedRegion) - : undefined; -exports.getResolvedHostname = getResolvedHostname; +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; /***/ }), -/***/ 37642: +/***/ 86894: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getResolvedPartition = void 0; -const getResolvedPartition = (region, { partitionHash }) => { var _a; return (_a = Object.keys(partitionHash || {}).find((key) => partitionHash[key].regions.includes(region))) !== null && _a !== void 0 ? _a : "aws"; }; -exports.getResolvedPartition = getResolvedPartition; /***/ }), -/***/ 53517: +/***/ 55720: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getResolvedSigningRegion = void 0; -const getResolvedSigningRegion = (hostname, { signingRegion, regionRegex, useFipsEndpoint }) => { - if (signingRegion) { - return signingRegion; - } - else if (useFipsEndpoint) { - const regionRegexJs = regionRegex.replace("\\\\", "\\").replace(/^\^/g, "\\.").replace(/\$$/g, "\\."); - const regionRegexmatchArray = hostname.match(regionRegexJs); - if (regionRegexmatchArray) { - return regionRegexmatchArray[0].slice(1, -1); - } - } -}; -exports.getResolvedSigningRegion = getResolvedSigningRegion; /***/ }), -/***/ 86258: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 11754: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(3566), exports); -tslib_1.__exportStar(__nccwpck_require__(56057), exports); -tslib_1.__exportStar(__nccwpck_require__(26167), exports); /***/ }), -/***/ 80255: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 42168: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromEnv = exports.ENV_EXPIRATION = exports.ENV_SESSION = exports.ENV_SECRET = exports.ENV_KEY = void 0; -const property_provider_1 = __nccwpck_require__(74462); -exports.ENV_KEY = "AWS_ACCESS_KEY_ID"; -exports.ENV_SECRET = "AWS_SECRET_ACCESS_KEY"; -exports.ENV_SESSION = "AWS_SESSION_TOKEN"; -exports.ENV_EXPIRATION = "AWS_CREDENTIAL_EXPIRATION"; -const fromEnv = () => async () => { - const accessKeyId = process.env[exports.ENV_KEY]; - const secretAccessKey = process.env[exports.ENV_SECRET]; - const sessionToken = process.env[exports.ENV_SESSION]; - const expiry = process.env[exports.ENV_EXPIRATION]; - if (accessKeyId && secretAccessKey) { - return { - accessKeyId, - secretAccessKey, - ...(sessionToken && { sessionToken }), - ...(expiry && { expiration: new Date(expiry) }), - }; - } - throw new property_provider_1.CredentialsProviderError("Unable to find environment variable credentials."); -}; -exports.fromEnv = fromEnv; /***/ }), -/***/ 15972: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 37933: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(80255), exports); /***/ }), -/***/ 3736: +/***/ 4903: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.Endpoint = void 0; -var Endpoint; -(function (Endpoint) { - Endpoint["IPv4"] = "http://169.254.169.254"; - Endpoint["IPv6"] = "http://[fd00:ec2::254]"; -})(Endpoint = exports.Endpoint || (exports.Endpoint = {})); /***/ }), -/***/ 18438: +/***/ 66538: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ENDPOINT_CONFIG_OPTIONS = exports.CONFIG_ENDPOINT_NAME = exports.ENV_ENDPOINT_NAME = void 0; -exports.ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT"; -exports.CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint"; -exports.ENDPOINT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[exports.ENV_ENDPOINT_NAME], - configFileSelector: (profile) => profile[exports.CONFIG_ENDPOINT_NAME], - default: undefined, -}; /***/ }), -/***/ 21695: +/***/ 81594: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.EndpointMode = void 0; -var EndpointMode; -(function (EndpointMode) { - EndpointMode["IPv4"] = "IPv4"; - EndpointMode["IPv6"] = "IPv6"; -})(EndpointMode = exports.EndpointMode || (exports.EndpointMode = {})); /***/ }), -/***/ 97824: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 43533: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ENDPOINT_MODE_CONFIG_OPTIONS = exports.CONFIG_ENDPOINT_MODE_NAME = exports.ENV_ENDPOINT_MODE_NAME = void 0; -const EndpointMode_1 = __nccwpck_require__(21695); -exports.ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE"; -exports.CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode"; -exports.ENDPOINT_MODE_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[exports.ENV_ENDPOINT_MODE_NAME], - configFileSelector: (profile) => profile[exports.CONFIG_ENDPOINT_MODE_NAME], - default: EndpointMode_1.EndpointMode.IPv4, -}; /***/ }), -/***/ 75232: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 5405: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromContainerMetadata = exports.ENV_CMDS_AUTH_TOKEN = exports.ENV_CMDS_RELATIVE_URI = exports.ENV_CMDS_FULL_URI = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const url_1 = __nccwpck_require__(57310); -const httpRequest_1 = __nccwpck_require__(81303); -const ImdsCredentials_1 = __nccwpck_require__(91467); -const RemoteProviderInit_1 = __nccwpck_require__(72314); -const retry_1 = __nccwpck_require__(49912); -exports.ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; -exports.ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; -exports.ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; -const fromContainerMetadata = (init = {}) => { - const { timeout, maxRetries } = (0, RemoteProviderInit_1.providerConfigFromInit)(init); - return () => (0, retry_1.retry)(async () => { - const requestOptions = await getCmdsUri(); - const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions)); - if (!(0, ImdsCredentials_1.isImdsCredentials)(credsResponse)) { - throw new property_provider_1.CredentialsProviderError("Invalid response received from instance metadata service."); - } - return (0, ImdsCredentials_1.fromImdsCredentials)(credsResponse); - }, maxRetries); -}; -exports.fromContainerMetadata = fromContainerMetadata; -const requestFromEcsImds = async (timeout, options) => { - if (process.env[exports.ENV_CMDS_AUTH_TOKEN]) { - options.headers = { - ...options.headers, - Authorization: process.env[exports.ENV_CMDS_AUTH_TOKEN], - }; - } - const buffer = await (0, httpRequest_1.httpRequest)({ - ...options, - timeout, - }); - return buffer.toString(); -}; -const CMDS_IP = "169.254.170.2"; -const GREENGRASS_HOSTS = { - localhost: true, - "127.0.0.1": true, -}; -const GREENGRASS_PROTOCOLS = { - "http:": true, - "https:": true, -}; -const getCmdsUri = async () => { - if (process.env[exports.ENV_CMDS_RELATIVE_URI]) { - return { - hostname: CMDS_IP, - path: process.env[exports.ENV_CMDS_RELATIVE_URI], - }; - } - if (process.env[exports.ENV_CMDS_FULL_URI]) { - const parsed = (0, url_1.parse)(process.env[exports.ENV_CMDS_FULL_URI]); - if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) { - throw new property_provider_1.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, false); - } - if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) { - throw new property_provider_1.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, false); - } - return { - ...parsed, - port: parsed.port ? parseInt(parsed.port, 10) : undefined, - }; - } - throw new property_provider_1.CredentialsProviderError("The container metadata credential provider cannot be used unless" + - ` the ${exports.ENV_CMDS_RELATIVE_URI} or ${exports.ENV_CMDS_FULL_URI} environment` + - " variable is set", false); -}; /***/ }), -/***/ 35813: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 96555: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromInstanceMetadata = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const httpRequest_1 = __nccwpck_require__(81303); -const ImdsCredentials_1 = __nccwpck_require__(91467); -const RemoteProviderInit_1 = __nccwpck_require__(72314); -const retry_1 = __nccwpck_require__(49912); -const getInstanceMetadataEndpoint_1 = __nccwpck_require__(41206); -const staticStabilityProvider_1 = __nccwpck_require__(54620); -const IMDS_PATH = "/latest/meta-data/iam/security-credentials/"; -const IMDS_TOKEN_PATH = "/latest/api/token"; -const fromInstanceMetadata = (init = {}) => (0, staticStabilityProvider_1.staticStabilityProvider)(getInstanceImdsProvider(init), { logger: init.logger }); -exports.fromInstanceMetadata = fromInstanceMetadata; -const getInstanceImdsProvider = (init) => { - let disableFetchToken = false; - const { timeout, maxRetries } = (0, RemoteProviderInit_1.providerConfigFromInit)(init); - const getCredentials = async (maxRetries, options) => { - const profile = (await (0, retry_1.retry)(async () => { - let profile; - try { - profile = await getProfile(options); - } - catch (err) { - if (err.statusCode === 401) { - disableFetchToken = false; - } - throw err; - } - return profile; - }, maxRetries)).trim(); - return (0, retry_1.retry)(async () => { - let creds; - try { - creds = await getCredentialsFromProfile(profile, options); - } - catch (err) { - if (err.statusCode === 401) { - disableFetchToken = false; - } - throw err; - } - return creds; - }, maxRetries); - }; - return async () => { - const endpoint = await (0, getInstanceMetadataEndpoint_1.getInstanceMetadataEndpoint)(); - if (disableFetchToken) { - return getCredentials(maxRetries, { ...endpoint, timeout }); - } - else { - let token; - try { - token = (await getMetadataToken({ ...endpoint, timeout })).toString(); - } - catch (error) { - if ((error === null || error === void 0 ? void 0 : error.statusCode) === 400) { - throw Object.assign(error, { - message: "EC2 Metadata token request returned error", - }); - } - else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) { - disableFetchToken = true; - } - return getCredentials(maxRetries, { ...endpoint, timeout }); - } - return getCredentials(maxRetries, { - ...endpoint, - headers: { - "x-aws-ec2-metadata-token": token, - }, - timeout, - }); - } - }; -}; -const getMetadataToken = async (options) => (0, httpRequest_1.httpRequest)({ - ...options, - path: IMDS_TOKEN_PATH, - method: "PUT", - headers: { - "x-aws-ec2-metadata-token-ttl-seconds": "21600", - }, -}); -const getProfile = async (options) => (await (0, httpRequest_1.httpRequest)({ ...options, path: IMDS_PATH })).toString(); -const getCredentialsFromProfile = async (profile, options) => { - const credsResponse = JSON.parse((await (0, httpRequest_1.httpRequest)({ - ...options, - path: IMDS_PATH + profile, - })).toString()); - if (!(0, ImdsCredentials_1.isImdsCredentials)(credsResponse)) { - throw new property_provider_1.CredentialsProviderError("Invalid response received from instance metadata service."); - } - return (0, ImdsCredentials_1.fromImdsCredentials)(credsResponse); -}; /***/ }), -/***/ 25898: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 17129: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getInstanceMetadataEndpoint = exports.httpRequest = void 0; -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(75232), exports); -tslib_1.__exportStar(__nccwpck_require__(35813), exports); -tslib_1.__exportStar(__nccwpck_require__(72314), exports); -tslib_1.__exportStar(__nccwpck_require__(91178), exports); -var httpRequest_1 = __nccwpck_require__(81303); -Object.defineProperty(exports, "httpRequest", ({ enumerable: true, get: function () { return httpRequest_1.httpRequest; } })); -var getInstanceMetadataEndpoint_1 = __nccwpck_require__(41206); -Object.defineProperty(exports, "getInstanceMetadataEndpoint", ({ enumerable: true, get: function () { return getInstanceMetadataEndpoint_1.getInstanceMetadataEndpoint; } })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); /***/ }), -/***/ 91467: +/***/ 12614: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromImdsCredentials = exports.isImdsCredentials = void 0; -const isImdsCredentials = (arg) => Boolean(arg) && - typeof arg === "object" && - typeof arg.AccessKeyId === "string" && - typeof arg.SecretAccessKey === "string" && - typeof arg.Token === "string" && - typeof arg.Expiration === "string"; -exports.isImdsCredentials = isImdsCredentials; -const fromImdsCredentials = (creds) => ({ - accessKeyId: creds.AccessKeyId, - secretAccessKey: creds.SecretAccessKey, - sessionToken: creds.Token, - expiration: new Date(creds.Expiration), -}); -exports.fromImdsCredentials = fromImdsCredentials; /***/ }), -/***/ 72314: +/***/ 53396: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.providerConfigFromInit = exports.DEFAULT_MAX_RETRIES = exports.DEFAULT_TIMEOUT = void 0; -exports.DEFAULT_TIMEOUT = 1000; -exports.DEFAULT_MAX_RETRIES = 0; -const providerConfigFromInit = ({ maxRetries = exports.DEFAULT_MAX_RETRIES, timeout = exports.DEFAULT_TIMEOUT, }) => ({ maxRetries, timeout }); -exports.providerConfigFromInit = providerConfigFromInit; /***/ }), -/***/ 81303: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 21353: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.httpRequest = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const buffer_1 = __nccwpck_require__(14300); -const http_1 = __nccwpck_require__(13685); -function httpRequest(options) { - return new Promise((resolve, reject) => { - var _a; - const req = (0, http_1.request)({ - method: "GET", - ...options, - hostname: (_a = options.hostname) === null || _a === void 0 ? void 0 : _a.replace(/^\[(.+)\]$/, "$1"), - }); - req.on("error", (err) => { - reject(Object.assign(new property_provider_1.ProviderError("Unable to connect to instance metadata service"), err)); - req.destroy(); - }); - req.on("timeout", () => { - reject(new property_provider_1.ProviderError("TimeoutError from instance metadata service")); - req.destroy(); - }); - req.on("response", (res) => { - const { statusCode = 400 } = res; - if (statusCode < 200 || 300 <= statusCode) { - reject(Object.assign(new property_provider_1.ProviderError("Error response received from instance metadata service"), { statusCode })); - req.destroy(); - } - const chunks = []; - res.on("data", (chunk) => { - chunks.push(chunk); - }); - res.on("end", () => { - resolve(buffer_1.Buffer.concat(chunks)); - req.destroy(); - }); - }); - req.end(); - }); -} -exports.httpRequest = httpRequest; /***/ }), -/***/ 49912: +/***/ 93105: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.retry = void 0; -const retry = (toRetry, maxRetries) => { - let promise = toRetry(); - for (let i = 0; i < maxRetries; i++) { - promise = promise.catch(toRetry); - } - return promise; -}; -exports.retry = retry; /***/ }), -/***/ 91178: +/***/ 60568: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -18814,1118 +37942,1387 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 8473: +/***/ 21595: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getExtendedInstanceMetadataCredentials = void 0; -const STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60; -const STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60; -const STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html"; -const getExtendedInstanceMetadataCredentials = (credentials, logger) => { - var _a; - const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + - Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS); - const newExpiration = new Date(Date.now() + refreshInterval * 1000); - logger.warn("Attempting credential expiration extension due to a credential service availability issue. A refresh of these " + - "credentials will be attempted after ${new Date(newExpiration)}.\nFor more information, please visit: " + - STATIC_STABILITY_DOC_URL); - const originalExpiration = (_a = credentials.originalExpiration) !== null && _a !== void 0 ? _a : credentials.expiration; - return { - ...credentials, - ...(originalExpiration ? { originalExpiration } : {}), - expiration: newExpiration, - }; +exports.deserializerMiddleware = void 0; +const deserializerMiddleware = (options, deserializer) => (next, context) => async (args) => { + const { response } = await next(args); + try { + const parsed = await deserializer(response, options); + return { + response, + output: parsed, + }; + } + catch (error) { + Object.defineProperty(error, "$response", { + value: response, + }); + if (!("$metadata" in error)) { + const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; + error.message += "\n " + hint; + } + throw error; + } }; -exports.getExtendedInstanceMetadataCredentials = getExtendedInstanceMetadataCredentials; +exports.deserializerMiddleware = deserializerMiddleware; /***/ }), -/***/ 41206: +/***/ 81238: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getInstanceMetadataEndpoint = void 0; -const node_config_provider_1 = __nccwpck_require__(87684); -const url_parser_1 = __nccwpck_require__(2992); -const Endpoint_1 = __nccwpck_require__(3736); -const EndpointConfigOptions_1 = __nccwpck_require__(18438); -const EndpointMode_1 = __nccwpck_require__(21695); -const EndpointModeConfigOptions_1 = __nccwpck_require__(97824); -const getInstanceMetadataEndpoint = async () => (0, url_parser_1.parseUrl)((await getFromEndpointConfig()) || (await getFromEndpointModeConfig())); -exports.getInstanceMetadataEndpoint = getInstanceMetadataEndpoint; -const getFromEndpointConfig = async () => (0, node_config_provider_1.loadConfig)(EndpointConfigOptions_1.ENDPOINT_CONFIG_OPTIONS)(); -const getFromEndpointModeConfig = async () => { - const endpointMode = await (0, node_config_provider_1.loadConfig)(EndpointModeConfigOptions_1.ENDPOINT_MODE_CONFIG_OPTIONS)(); - switch (endpointMode) { - case EndpointMode_1.EndpointMode.IPv4: - return Endpoint_1.Endpoint.IPv4; - case EndpointMode_1.EndpointMode.IPv6: - return Endpoint_1.Endpoint.IPv6; - default: - throw new Error(`Unsupported endpoint mode: ${endpointMode}.` + ` Select from ${Object.values(EndpointMode_1.EndpointMode)}`); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(21595), exports); +tslib_1.__exportStar(__nccwpck_require__(72338), exports); +tslib_1.__exportStar(__nccwpck_require__(23566), exports); + + +/***/ }), + +/***/ 72338: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSerdePlugin = exports.serializerMiddlewareOption = exports.deserializerMiddlewareOption = void 0; +const deserializerMiddleware_1 = __nccwpck_require__(21595); +const serializerMiddleware_1 = __nccwpck_require__(23566); +exports.deserializerMiddlewareOption = { + name: "deserializerMiddleware", + step: "deserialize", + tags: ["DESERIALIZER"], + override: true, +}; +exports.serializerMiddlewareOption = { + name: "serializerMiddleware", + step: "serialize", + tags: ["SERIALIZER"], + override: true, +}; +function getSerdePlugin(config, serializer, deserializer) { + return { + applyToStack: (commandStack) => { + commandStack.add((0, deserializerMiddleware_1.deserializerMiddleware)(config, deserializer), exports.deserializerMiddlewareOption); + commandStack.add((0, serializerMiddleware_1.serializerMiddleware)(config, serializer), exports.serializerMiddlewareOption); + }, + }; +} +exports.getSerdePlugin = getSerdePlugin; + + +/***/ }), + +/***/ 23566: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.serializerMiddleware = void 0; +const serializerMiddleware = (options, serializer) => (next, context) => async (args) => { + var _a; + const endpoint = ((_a = context.endpointV2) === null || _a === void 0 ? void 0 : _a.url) && options.urlParser + ? async () => options.urlParser(context.endpointV2.url) + : options.endpoint; + if (!endpoint) { + throw new Error("No valid endpoint provider available."); } + const request = await serializer(args.input, { ...options, endpoint }); + return next({ + ...args, + request, + }); }; +exports.serializerMiddleware = serializerMiddleware; /***/ }), -/***/ 54620: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 2404: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.staticStabilityProvider = void 0; -const getExtendedInstanceMetadataCredentials_1 = __nccwpck_require__(8473); -const staticStabilityProvider = (provider, options = {}) => { - const logger = (options === null || options === void 0 ? void 0 : options.logger) || console; - let pastCredentials; - return async () => { - let credentials; - try { - credentials = await provider(); - if (credentials.expiration && credentials.expiration.getTime() < Date.now()) { - credentials = (0, getExtendedInstanceMetadataCredentials_1.getExtendedInstanceMetadataCredentials)(credentials, logger); +exports.constructStack = void 0; +const constructStack = () => { + let absoluteEntries = []; + let relativeEntries = []; + let identifyOnResolve = false; + const entriesNameSet = new Set(); + const sort = (entries) => entries.sort((a, b) => stepWeights[b.step] - stepWeights[a.step] || + priorityWeights[b.priority || "normal"] - priorityWeights[a.priority || "normal"]); + const removeByName = (toRemove) => { + let isRemoved = false; + const filterCb = (entry) => { + if (entry.name && entry.name === toRemove) { + isRemoved = true; + entriesNameSet.delete(toRemove); + return false; + } + return true; + }; + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }; + const removeByReference = (toRemove) => { + let isRemoved = false; + const filterCb = (entry) => { + if (entry.middleware === toRemove) { + isRemoved = true; + if (entry.name) + entriesNameSet.delete(entry.name); + return false; } - } - catch (e) { - if (pastCredentials) { - logger.warn("Credential renew failed: ", e); - credentials = (0, getExtendedInstanceMetadataCredentials_1.getExtendedInstanceMetadataCredentials)(pastCredentials, logger); + return true; + }; + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }; + const cloneTo = (toStack) => { + var _a; + absoluteEntries.forEach((entry) => { + toStack.add(entry.middleware, { ...entry }); + }); + relativeEntries.forEach((entry) => { + toStack.addRelativeTo(entry.middleware, { ...entry }); + }); + (_a = toStack.identifyOnResolve) === null || _a === void 0 ? void 0 : _a.call(toStack, stack.identifyOnResolve()); + return toStack; + }; + const expandRelativeMiddlewareList = (from) => { + const expandedMiddlewareList = []; + from.before.forEach((entry) => { + if (entry.before.length === 0 && entry.after.length === 0) { + expandedMiddlewareList.push(entry); } else { - throw e; + expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); } - } - pastCredentials = credentials; - return credentials; + }); + expandedMiddlewareList.push(from); + from.after.reverse().forEach((entry) => { + if (entry.before.length === 0 && entry.after.length === 0) { + expandedMiddlewareList.push(entry); + } + else { + expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); + } + }); + return expandedMiddlewareList; + }; + const getMiddlewareList = (debug = false) => { + const normalizedAbsoluteEntries = []; + const normalizedRelativeEntries = []; + const normalizedEntriesNameMap = {}; + absoluteEntries.forEach((entry) => { + const normalizedEntry = { + ...entry, + before: [], + after: [], + }; + if (normalizedEntry.name) + normalizedEntriesNameMap[normalizedEntry.name] = normalizedEntry; + normalizedAbsoluteEntries.push(normalizedEntry); + }); + relativeEntries.forEach((entry) => { + const normalizedEntry = { + ...entry, + before: [], + after: [], + }; + if (normalizedEntry.name) + normalizedEntriesNameMap[normalizedEntry.name] = normalizedEntry; + normalizedRelativeEntries.push(normalizedEntry); + }); + normalizedRelativeEntries.forEach((entry) => { + if (entry.toMiddleware) { + const toMiddleware = normalizedEntriesNameMap[entry.toMiddleware]; + if (toMiddleware === undefined) { + if (debug) { + return; + } + throw new Error(`${entry.toMiddleware} is not found when adding ${entry.name || "anonymous"} middleware ${entry.relation} ${entry.toMiddleware}`); + } + if (entry.relation === "after") { + toMiddleware.after.push(entry); + } + if (entry.relation === "before") { + toMiddleware.before.push(entry); + } + } + }); + const mainChain = sort(normalizedAbsoluteEntries) + .map(expandRelativeMiddlewareList) + .reduce((wholeList, expandedMiddlewareList) => { + wholeList.push(...expandedMiddlewareList); + return wholeList; + }, []); + return mainChain; + }; + const stack = { + add: (middleware, options = {}) => { + const { name, override } = options; + const entry = { + step: "initialize", + priority: "normal", + middleware, + ...options, + }; + if (name) { + if (entriesNameSet.has(name)) { + if (!override) + throw new Error(`Duplicate middleware name '${name}'`); + const toOverrideIndex = absoluteEntries.findIndex((entry) => entry.name === name); + const toOverride = absoluteEntries[toOverrideIndex]; + if (toOverride.step !== entry.step || toOverride.priority !== entry.priority) { + throw new Error(`"${name}" middleware with ${toOverride.priority} priority in ${toOverride.step} step cannot be ` + + `overridden by same-name middleware with ${entry.priority} priority in ${entry.step} step.`); + } + absoluteEntries.splice(toOverrideIndex, 1); + } + entriesNameSet.add(name); + } + absoluteEntries.push(entry); + }, + addRelativeTo: (middleware, options) => { + const { name, override } = options; + const entry = { + middleware, + ...options, + }; + if (name) { + if (entriesNameSet.has(name)) { + if (!override) + throw new Error(`Duplicate middleware name '${name}'`); + const toOverrideIndex = relativeEntries.findIndex((entry) => entry.name === name); + const toOverride = relativeEntries[toOverrideIndex]; + if (toOverride.toMiddleware !== entry.toMiddleware || toOverride.relation !== entry.relation) { + throw new Error(`"${name}" middleware ${toOverride.relation} "${toOverride.toMiddleware}" middleware cannot be overridden ` + + `by same-name middleware ${entry.relation} "${entry.toMiddleware}" middleware.`); + } + relativeEntries.splice(toOverrideIndex, 1); + } + entriesNameSet.add(name); + } + relativeEntries.push(entry); + }, + clone: () => cloneTo((0, exports.constructStack)()), + use: (plugin) => { + plugin.applyToStack(stack); + }, + remove: (toRemove) => { + if (typeof toRemove === "string") + return removeByName(toRemove); + else + return removeByReference(toRemove); + }, + removeByTag: (toRemove) => { + let isRemoved = false; + const filterCb = (entry) => { + const { tags, name } = entry; + if (tags && tags.includes(toRemove)) { + if (name) + entriesNameSet.delete(name); + isRemoved = true; + return false; + } + return true; + }; + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, + concat: (from) => { + var _a, _b; + const cloned = cloneTo((0, exports.constructStack)()); + cloned.use(from); + cloned.identifyOnResolve(identifyOnResolve || cloned.identifyOnResolve() || ((_b = (_a = from.identifyOnResolve) === null || _a === void 0 ? void 0 : _a.call(from)) !== null && _b !== void 0 ? _b : false)); + return cloned; + }, + applyToStack: cloneTo, + identify: () => { + return getMiddlewareList(true).map((mw) => { + var _a; + const step = (_a = mw.step) !== null && _a !== void 0 ? _a : mw.relation + + " " + + mw.toMiddleware; + return mw.name + " - " + step; + }); + }, + identifyOnResolve(toggle) { + if (typeof toggle === "boolean") + identifyOnResolve = toggle; + return identifyOnResolve; + }, + resolve: (handler, context) => { + for (const middleware of getMiddlewareList() + .map((entry) => entry.middleware) + .reverse()) { + handler = middleware(handler, context); + } + if (identifyOnResolve) { + console.log(stack.identify()); + } + return handler; + }, }; + return stack; +}; +exports.constructStack = constructStack; +const stepWeights = { + initialize: 5, + serialize: 4, + build: 3, + finalizeRequest: 2, + deserialize: 1, +}; +const priorityWeights = { + high: 3, + normal: 2, + low: 1, }; -exports.staticStabilityProvider = staticStabilityProvider; /***/ }), -/***/ 55442: +/***/ 97911: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromIni = void 0; -const shared_ini_file_loader_1 = __nccwpck_require__(67387); -const resolveProfileData_1 = __nccwpck_require__(95653); -const fromIni = (init = {}) => async () => { - const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init); - return (0, resolveProfileData_1.resolveProfileData)((0, shared_ini_file_loader_1.getProfileName)(init), profiles, init); -}; -exports.fromIni = fromIni; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(2404), exports); /***/ }), -/***/ 74203: +/***/ 54766: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(55442), exports); +exports.loadConfig = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const fromEnv_1 = __nccwpck_require__(15606); +const fromSharedConfigFiles_1 = __nccwpck_require__(45784); +const fromStatic_1 = __nccwpck_require__(23091); +const loadConfig = ({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => (0, property_provider_1.memoize)((0, property_provider_1.chain)((0, fromEnv_1.fromEnv)(environmentVariableSelector), (0, fromSharedConfigFiles_1.fromSharedConfigFiles)(configFileSelector, configuration), (0, fromStatic_1.fromStatic)(defaultValue))); +exports.loadConfig = loadConfig; /***/ }), -/***/ 60853: +/***/ 15606: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveAssumeRoleCredentials = exports.isAssumeRoleProfile = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const shared_ini_file_loader_1 = __nccwpck_require__(67387); -const resolveCredentialSource_1 = __nccwpck_require__(82458); -const resolveProfileData_1 = __nccwpck_require__(95653); -const isAssumeRoleProfile = (arg) => Boolean(arg) && - typeof arg === "object" && - typeof arg.role_arn === "string" && - ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1 && - ["undefined", "string"].indexOf(typeof arg.external_id) > -1 && - ["undefined", "string"].indexOf(typeof arg.mfa_serial) > -1 && - (isAssumeRoleWithSourceProfile(arg) || isAssumeRoleWithProviderProfile(arg)); -exports.isAssumeRoleProfile = isAssumeRoleProfile; -const isAssumeRoleWithSourceProfile = (arg) => typeof arg.source_profile === "string" && typeof arg.credential_source === "undefined"; -const isAssumeRoleWithProviderProfile = (arg) => typeof arg.credential_source === "string" && typeof arg.source_profile === "undefined"; -const resolveAssumeRoleCredentials = async (profileName, profiles, options, visitedProfiles = {}) => { - const data = profiles[profileName]; - if (!options.roleAssumer) { - throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} requires a role to be assumed, but no role assumption callback was provided.`, false); - } - const { source_profile } = data; - if (source_profile && source_profile in visitedProfiles) { - throw new property_provider_1.CredentialsProviderError(`Detected a cycle attempting to resolve credentials for profile` + - ` ${(0, shared_ini_file_loader_1.getProfileName)(options)}. Profiles visited: ` + - Object.keys(visitedProfiles).join(", "), false); - } - const sourceCredsProvider = source_profile - ? (0, resolveProfileData_1.resolveProfileData)(source_profile, profiles, options, { - ...visitedProfiles, - [source_profile]: true, - }) - : (0, resolveCredentialSource_1.resolveCredentialSource)(data.credential_source, profileName)(); - const params = { - RoleArn: data.role_arn, - RoleSessionName: data.role_session_name || `aws-sdk-js-${Date.now()}`, - ExternalId: data.external_id, - }; - const { mfa_serial } = data; - if (mfa_serial) { - if (!options.mfaCodeProvider) { - throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} requires multi-factor authentication, but no MFA code callback was provided.`, false); +exports.fromEnv = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const fromEnv = (envVarSelector) => async () => { + try { + const config = envVarSelector(process.env); + if (config === undefined) { + throw new Error(); } - params.SerialNumber = mfa_serial; - params.TokenCode = await options.mfaCodeProvider(mfa_serial); + return config; + } + catch (e) { + throw new property_provider_1.CredentialsProviderError(e.message || `Cannot load config from environment variables with getter: ${envVarSelector}`); } - const sourceCreds = await sourceCredsProvider; - return options.roleAssumer(sourceCreds, params); }; -exports.resolveAssumeRoleCredentials = resolveAssumeRoleCredentials; +exports.fromEnv = fromEnv; /***/ }), -/***/ 82458: +/***/ 45784: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveCredentialSource = void 0; -const credential_provider_env_1 = __nccwpck_require__(15972); -const credential_provider_imds_1 = __nccwpck_require__(25898); -const property_provider_1 = __nccwpck_require__(74462); -const resolveCredentialSource = (credentialSource, profileName) => { - const sourceProvidersMap = { - EcsContainer: credential_provider_imds_1.fromContainerMetadata, - Ec2InstanceMetadata: credential_provider_imds_1.fromInstanceMetadata, - Environment: credential_provider_env_1.fromEnv, - }; - if (credentialSource in sourceProvidersMap) { - return sourceProvidersMap[credentialSource](); +exports.fromSharedConfigFiles = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const shared_ini_file_loader_1 = __nccwpck_require__(43507); +const fromSharedConfigFiles = (configSelector, { preferredFile = "config", ...init } = {}) => async () => { + const profile = (0, shared_ini_file_loader_1.getProfileName)(init); + const { configFile, credentialsFile } = await (0, shared_ini_file_loader_1.loadSharedConfigFiles)(init); + const profileFromCredentials = credentialsFile[profile] || {}; + const profileFromConfig = configFile[profile] || {}; + const mergedProfile = preferredFile === "config" + ? { ...profileFromCredentials, ...profileFromConfig } + : { ...profileFromConfig, ...profileFromCredentials }; + try { + const configValue = configSelector(mergedProfile); + if (configValue === undefined) { + throw new Error(); + } + return configValue; } - else { - throw new property_provider_1.CredentialsProviderError(`Unsupported credential source in profile ${profileName}. Got ${credentialSource}, ` + - `expected EcsContainer or Ec2InstanceMetadata or Environment.`); + catch (e) { + throw new property_provider_1.CredentialsProviderError(e.message || `Cannot load config for profile ${profile} in SDK configuration files with getter: ${configSelector}`); } }; -exports.resolveCredentialSource = resolveCredentialSource; +exports.fromSharedConfigFiles = fromSharedConfigFiles; /***/ }), -/***/ 69993: +/***/ 23091: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveProcessCredentials = exports.isProcessProfile = void 0; -const credential_provider_process_1 = __nccwpck_require__(89969); -const isProcessProfile = (arg) => Boolean(arg) && typeof arg === "object" && typeof arg.credential_process === "string"; -exports.isProcessProfile = isProcessProfile; -const resolveProcessCredentials = async (options, profile) => (0, credential_provider_process_1.fromProcess)({ - ...options, - profile, -})(); -exports.resolveProcessCredentials = resolveProcessCredentials; +exports.fromStatic = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const isFunction = (func) => typeof func === "function"; +const fromStatic = (defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, property_provider_1.fromStatic)(defaultValue); +exports.fromStatic = fromStatic; /***/ }), -/***/ 95653: +/***/ 33461: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveProfileData = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const resolveAssumeRoleCredentials_1 = __nccwpck_require__(60853); -const resolveProcessCredentials_1 = __nccwpck_require__(69993); -const resolveSsoCredentials_1 = __nccwpck_require__(59867); -const resolveStaticCredentials_1 = __nccwpck_require__(33071); -const resolveWebIdentityCredentials_1 = __nccwpck_require__(58342); -const resolveProfileData = async (profileName, profiles, options, visitedProfiles = {}) => { - const data = profiles[profileName]; - if (Object.keys(visitedProfiles).length > 0 && (0, resolveStaticCredentials_1.isStaticCredsProfile)(data)) { - return (0, resolveStaticCredentials_1.resolveStaticCredentials)(data); - } - if ((0, resolveAssumeRoleCredentials_1.isAssumeRoleProfile)(data)) { - return (0, resolveAssumeRoleCredentials_1.resolveAssumeRoleCredentials)(profileName, profiles, options, visitedProfiles); - } - if ((0, resolveStaticCredentials_1.isStaticCredsProfile)(data)) { - return (0, resolveStaticCredentials_1.resolveStaticCredentials)(data); - } - if ((0, resolveWebIdentityCredentials_1.isWebIdentityProfile)(data)) { - return (0, resolveWebIdentityCredentials_1.resolveWebIdentityCredentials)(data, options); - } - if ((0, resolveProcessCredentials_1.isProcessProfile)(data)) { - return (0, resolveProcessCredentials_1.resolveProcessCredentials)(options, profileName); - } - if ((0, resolveSsoCredentials_1.isSsoProfile)(data)) { - return (0, resolveSsoCredentials_1.resolveSsoCredentials)(data); - } - throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} could not be found or parsed in shared credentials file.`); -}; -exports.resolveProfileData = resolveProfileData; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(54766), exports); /***/ }), -/***/ 59867: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 33946: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveSsoCredentials = exports.isSsoProfile = void 0; -const credential_provider_sso_1 = __nccwpck_require__(26414); -var credential_provider_sso_2 = __nccwpck_require__(26414); -Object.defineProperty(exports, "isSsoProfile", ({ enumerable: true, get: function () { return credential_provider_sso_2.isSsoProfile; } })); -const resolveSsoCredentials = (data) => { - const { sso_start_url, sso_account_id, sso_session, sso_region, sso_role_name } = (0, credential_provider_sso_1.validateSsoProfile)(data); - return (0, credential_provider_sso_1.fromSSO)({ - ssoStartUrl: sso_start_url, - ssoAccountId: sso_account_id, - ssoSession: sso_session, - ssoRegion: sso_region, - ssoRoleName: sso_role_name, - })(); -}; -exports.resolveSsoCredentials = resolveSsoCredentials; +exports.NODEJS_TIMEOUT_ERROR_CODES = void 0; +exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; /***/ }), -/***/ 33071: +/***/ 70508: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveStaticCredentials = exports.isStaticCredsProfile = void 0; -const isStaticCredsProfile = (arg) => Boolean(arg) && - typeof arg === "object" && - typeof arg.aws_access_key_id === "string" && - typeof arg.aws_secret_access_key === "string" && - ["undefined", "string"].indexOf(typeof arg.aws_session_token) > -1; -exports.isStaticCredsProfile = isStaticCredsProfile; -const resolveStaticCredentials = (profile) => Promise.resolve({ - accessKeyId: profile.aws_access_key_id, - secretAccessKey: profile.aws_secret_access_key, - sessionToken: profile.aws_session_token, -}); -exports.resolveStaticCredentials = resolveStaticCredentials; +exports.getTransformedHeaders = void 0; +const getTransformedHeaders = (headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; + } + return transformedHeaders; +}; +exports.getTransformedHeaders = getTransformedHeaders; /***/ }), -/***/ 58342: +/***/ 20258: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveWebIdentityCredentials = exports.isWebIdentityProfile = void 0; -const credential_provider_web_identity_1 = __nccwpck_require__(15646); -const isWebIdentityProfile = (arg) => Boolean(arg) && - typeof arg === "object" && - typeof arg.web_identity_token_file === "string" && - typeof arg.role_arn === "string" && - ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1; -exports.isWebIdentityProfile = isWebIdentityProfile; -const resolveWebIdentityCredentials = async (profile, options) => (0, credential_provider_web_identity_1.fromTokenFile)({ - webIdentityTokenFile: profile.web_identity_token_file, - roleArn: profile.role_arn, - roleSessionName: profile.role_session_name, - roleAssumerWithWebIdentity: options.roleAssumerWithWebIdentity, -})(); -exports.resolveWebIdentityCredentials = resolveWebIdentityCredentials; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(96948), exports); +tslib_1.__exportStar(__nccwpck_require__(46999), exports); +tslib_1.__exportStar(__nccwpck_require__(81030), exports); /***/ }), -/***/ 15560: +/***/ 96948: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultProvider = void 0; -const credential_provider_env_1 = __nccwpck_require__(15972); -const credential_provider_ini_1 = __nccwpck_require__(74203); -const credential_provider_process_1 = __nccwpck_require__(89969); -const credential_provider_sso_1 = __nccwpck_require__(26414); -const credential_provider_web_identity_1 = __nccwpck_require__(15646); -const property_provider_1 = __nccwpck_require__(74462); -const shared_ini_file_loader_1 = __nccwpck_require__(67387); -const remoteProvider_1 = __nccwpck_require__(50626); -const defaultProvider = (init = {}) => (0, property_provider_1.memoize)((0, property_provider_1.chain)(...(init.profile || process.env[shared_ini_file_loader_1.ENV_PROFILE] ? [] : [(0, credential_provider_env_1.fromEnv)()]), (0, credential_provider_sso_1.fromSSO)(init), (0, credential_provider_ini_1.fromIni)(init), (0, credential_provider_process_1.fromProcess)(init), (0, credential_provider_web_identity_1.fromTokenFile)(init), (0, remoteProvider_1.remoteProvider)(init), async () => { - throw new property_provider_1.CredentialsProviderError("Could not load credentials from any providers", false); -}), (credentials) => credentials.expiration !== undefined && credentials.expiration.getTime() - Date.now() < 300000, (credentials) => credentials.expiration !== undefined); -exports.defaultProvider = defaultProvider; +exports.NodeHttpHandler = exports.DEFAULT_REQUEST_TIMEOUT = void 0; +const protocol_http_1 = __nccwpck_require__(64418); +const querystring_builder_1 = __nccwpck_require__(68031); +const http_1 = __nccwpck_require__(13685); +const https_1 = __nccwpck_require__(95687); +const constants_1 = __nccwpck_require__(33946); +const get_transformed_headers_1 = __nccwpck_require__(70508); +const set_connection_timeout_1 = __nccwpck_require__(25545); +const set_socket_keep_alive_1 = __nccwpck_require__(83751); +const set_socket_timeout_1 = __nccwpck_require__(42618); +const write_request_body_1 = __nccwpck_require__(73766); +exports.DEFAULT_REQUEST_TIMEOUT = 0; +class NodeHttpHandler { + constructor(options) { + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }) + .catch(reject); + } + else { + resolve(this.resolveDefaultConfig(options)); + } + }); + } + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + requestTimeout: requestTimeout !== null && requestTimeout !== void 0 ? requestTimeout : socketTimeout, + httpAgent: httpAgent || new http_1.Agent({ keepAlive, maxSockets }), + httpsAgent: httpsAgent || new https_1.Agent({ keepAlive, maxSockets }), + }; + } + destroy() { + var _a, _b, _c, _d; + (_b = (_a = this.config) === null || _a === void 0 ? void 0 : _a.httpAgent) === null || _b === void 0 ? void 0 : _b.destroy(); + (_d = (_c = this.config) === null || _c === void 0 ? void 0 : _c.httpsAgent) === null || _d === void 0 ? void 0 : _d.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + return new Promise((_resolve, _reject) => { + var _a, _b; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const queryString = (0, querystring_builder_1.buildQueryString)(request.query || {}); + let auth = undefined; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}`; + } + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const nodeHttpsOptions = { + headers: request.headers, + host: request.hostname, + method: request.method, + path, + port: request.port, + agent: isSSL ? this.config.httpsAgent : this.config.httpAgent, + auth, + }; + const requestFunc = isSSL ? https_1.request : http_1.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(res.headers), + body: res, + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } + else { + reject(err); + } + }); + (0, set_connection_timeout_1.setConnectionTimeout)(req, reject, this.config.connectionTimeout); + (0, set_socket_timeout_1.setSocketTimeout)(req, reject, this.config.requestTimeout); + if (abortSignal) { + abortSignal.onabort = () => { + req.abort(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }; + } + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + (0, set_socket_keep_alive_1.setSocketKeepAlive)(req, { + keepAlive: httpAgent.keepAlive, + keepAliveMsecs: httpAgent.keepAliveMsecs, + }); + } + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, this.config.requestTimeout).catch(_reject); + }); + } +} +exports.NodeHttpHandler = NodeHttpHandler; /***/ }), -/***/ 75531: +/***/ 5771: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2ConnectionManager = void 0; const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(15560), exports); +const http2_1 = tslib_1.__importDefault(__nccwpck_require__(85158)); +const node_http2_connection_pool_1 = __nccwpck_require__(95157); +class NodeHttp2ConnectionManager { + constructor(config) { + this.sessionCache = new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); + } + } + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; + } + } + const session = http2_1.default.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error("Fail to set maxConcurrentStreams to " + + this.config.maxConcurrency + + "when creating new session for " + + requestContext.destination.toString()); + } + }); + } + session.unref(); + const destroySessionCb = () => { + session.destroy(); + this.deleteSession(url, session); + }; + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new node_http2_connection_pool_1.NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; + } + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; + } + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); + } + release(requestContext, session) { + var _a; + const cacheKey = this.getUrlString(requestContext); + (_a = this.sessionCache.get(cacheKey)) === null || _a === void 0 ? void 0 : _a.offerLast(session); + } + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); + } + this.sessionCache.delete(key); + } + } + setMaxConcurrentStreams(maxConcurrentStreams) { + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); + } + this.config.maxConcurrency = maxConcurrentStreams; + } + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; + } + getUrlString(request) { + return request.destination.toString(); + } +} +exports.NodeHttp2ConnectionManager = NodeHttp2ConnectionManager; /***/ }), -/***/ 50626: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 95157: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.remoteProvider = exports.ENV_IMDS_DISABLED = void 0; -const credential_provider_imds_1 = __nccwpck_require__(25898); -const property_provider_1 = __nccwpck_require__(74462); -exports.ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; -const remoteProvider = (init) => { - if (process.env[credential_provider_imds_1.ENV_CMDS_RELATIVE_URI] || process.env[credential_provider_imds_1.ENV_CMDS_FULL_URI]) { - return (0, credential_provider_imds_1.fromContainerMetadata)(init); +exports.NodeHttp2ConnectionPool = void 0; +class NodeHttp2ConnectionPool { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions !== null && sessions !== void 0 ? sessions : []; } - if (process.env[exports.ENV_IMDS_DISABLED]) { - return async () => { - throw new property_provider_1.CredentialsProviderError("EC2 Instance Metadata Service access disabled"); - }; + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); + } } - return (0, credential_provider_imds_1.fromInstanceMetadata)(init); -}; -exports.remoteProvider = remoteProvider; + offerLast(session) { + this.sessions.push(session); + } + contains(session) { + return this.sessions.includes(session); + } + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); + } + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); + } + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } + } + } + } +} +exports.NodeHttp2ConnectionPool = NodeHttp2ConnectionPool; /***/ }), -/***/ 72650: +/***/ 46999: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromProcess = void 0; -const shared_ini_file_loader_1 = __nccwpck_require__(67387); -const resolveProcessCredentials_1 = __nccwpck_require__(74926); -const fromProcess = (init = {}) => async () => { - const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init); - return (0, resolveProcessCredentials_1.resolveProcessCredentials)((0, shared_ini_file_loader_1.getProfileName)(init), profiles); -}; -exports.fromProcess = fromProcess; +exports.NodeHttp2Handler = void 0; +const protocol_http_1 = __nccwpck_require__(64418); +const querystring_builder_1 = __nccwpck_require__(68031); +const http2_1 = __nccwpck_require__(85158); +const get_transformed_headers_1 = __nccwpck_require__(70508); +const node_http2_connection_manager_1 = __nccwpck_require__(5771); +const write_request_body_1 = __nccwpck_require__(73766); +class NodeHttp2Handler { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new node_http2_connection_manager_1.NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((opts) => { + resolve(opts || {}); + }) + .catch(reject); + } + else { + resolve(options || {}); + } + }); + } + destroy() { + this.connectionManager.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } + } + const { requestTimeout, disableConcurrentStreams } = this.config; + return new Promise((_resolve, _reject) => { + var _a, _b, _c; + let fulfilled = false; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request; + let auth = ""; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: (_c = this.config) === null || _c === void 0 ? void 0 : _c.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false, + }); + const rejectWithDestroy = (err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + reject(err); + }; + const queryString = (0, querystring_builder_1.buildQueryString)(query || {}); + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const req = session.request({ + ...request.headers, + [http2_1.constants.HTTP2_HEADER_PATH]: path, + [http2_1.constants.HTTP2_HEADER_METHOD]: method, + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(headers), + body: req, + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (requestTimeout) { + req.setTimeout(requestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + abortSignal.onabort = () => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }; + } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy(new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`)); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, requestTimeout); + }); + } + destroySession(session) { + if (!session.destroyed) { + session.destroy(); + } + } +} +exports.NodeHttp2Handler = NodeHttp2Handler; /***/ }), -/***/ 41104: +/***/ 25545: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getValidatedProcessCredentials = void 0; -const getValidatedProcessCredentials = (profileName, data) => { - if (data.Version !== 1) { - throw Error(`Profile ${profileName} credential_process did not return Version 1.`); - } - if (data.AccessKeyId === undefined || data.SecretAccessKey === undefined) { - throw Error(`Profile ${profileName} credential_process returned invalid credentials.`); +exports.setConnectionTimeout = void 0; +const setConnectionTimeout = (request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return; } - if (data.Expiration) { - const currentTime = new Date(); - const expireTime = new Date(data.Expiration); - if (expireTime < currentTime) { - throw Error(`Profile ${profileName} credential_process returned expired credentials.`); + const timeoutId = setTimeout(() => { + request.destroy(); + reject(Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError", + })); + }, timeoutInMs); + request.on("socket", (socket) => { + if (socket.connecting) { + socket.on("connect", () => { + clearTimeout(timeoutId); + }); } - } - return { - accessKeyId: data.AccessKeyId, - secretAccessKey: data.SecretAccessKey, - ...(data.SessionToken && { sessionToken: data.SessionToken }), - ...(data.Expiration && { expiration: new Date(data.Expiration) }), - }; + else { + clearTimeout(timeoutId); + } + }); }; -exports.getValidatedProcessCredentials = getValidatedProcessCredentials; +exports.setConnectionTimeout = setConnectionTimeout; /***/ }), -/***/ 89969: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 83751: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(72650), exports); +exports.setSocketKeepAlive = void 0; +const setSocketKeepAlive = (request, { keepAlive, keepAliveMsecs }) => { + if (keepAlive !== true) { + return; + } + request.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); +}; +exports.setSocketKeepAlive = setSocketKeepAlive; /***/ }), -/***/ 74926: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 42618: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveProcessCredentials = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const child_process_1 = __nccwpck_require__(32081); -const util_1 = __nccwpck_require__(73837); -const getValidatedProcessCredentials_1 = __nccwpck_require__(41104); -const resolveProcessCredentials = async (profileName, profiles) => { - const profile = profiles[profileName]; - if (profiles[profileName]) { - const credentialProcess = profile["credential_process"]; - if (credentialProcess !== undefined) { - const execPromise = (0, util_1.promisify)(child_process_1.exec); - try { - const { stdout } = await execPromise(credentialProcess); - let data; - try { - data = JSON.parse(stdout.trim()); - } - catch (_a) { - throw Error(`Profile ${profileName} credential_process returned invalid JSON.`); - } - return (0, getValidatedProcessCredentials_1.getValidatedProcessCredentials)(profileName, data); - } - catch (error) { - throw new property_provider_1.CredentialsProviderError(error.message); - } - } - else { - throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} did not contain credential_process.`); - } - } - else { - throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} could not be found in shared credentials file.`); - } +exports.setSocketTimeout = void 0; +const setSocketTimeout = (request, reject, timeoutInMs = 0) => { + request.setTimeout(timeoutInMs, () => { + request.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }); }; -exports.resolveProcessCredentials = resolveProcessCredentials; +exports.setSocketTimeout = setSocketTimeout; /***/ }), -/***/ 35959: +/***/ 23211: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromSSO = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const shared_ini_file_loader_1 = __nccwpck_require__(67387); -const isSsoProfile_1 = __nccwpck_require__(32572); -const resolveSSOCredentials_1 = __nccwpck_require__(94729); -const validateSsoProfile_1 = __nccwpck_require__(48098); -const fromSSO = (init = {}) => async () => { - const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoClient, ssoSession } = init; - const profileName = (0, shared_ini_file_loader_1.getProfileName)(init); - if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) { - const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init); - const profile = profiles[profileName]; - if (!profile) { - throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} was not found.`); - } - if (!(0, isSsoProfile_1.isSsoProfile)(profile)) { - throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} is not configured with SSO credentials.`); - } - if (profile === null || profile === void 0 ? void 0 : profile.sso_session) { - const ssoSessions = await (0, shared_ini_file_loader_1.loadSsoSessionData)(init); - const session = ssoSessions[profile.sso_session]; - const conflictMsg = ` configurations in profile ${profileName} and sso-session ${profile.sso_session}`; - if (ssoRegion && ssoRegion !== session.sso_region) { - throw new property_provider_1.CredentialsProviderError(`Conflicting SSO region` + conflictMsg, false); - } - if (ssoStartUrl && ssoStartUrl !== session.sso_start_url) { - throw new property_provider_1.CredentialsProviderError(`Conflicting SSO start_url` + conflictMsg, false); - } - profile.sso_region = session.sso_region; - profile.sso_start_url = session.sso_start_url; - } - const { sso_start_url, sso_account_id, sso_region, sso_role_name, sso_session } = (0, validateSsoProfile_1.validateSsoProfile)(profile); - return (0, resolveSSOCredentials_1.resolveSSOCredentials)({ - ssoStartUrl: sso_start_url, - ssoSession: sso_session, - ssoAccountId: sso_account_id, - ssoRegion: sso_region, - ssoRoleName: sso_role_name, - ssoClient: ssoClient, - profile: profileName, - }); - } - else if (!ssoStartUrl || !ssoAccountId || !ssoRegion || !ssoRoleName) { - throw new property_provider_1.CredentialsProviderError("Incomplete configuration. The fromSSO() argument hash must include " + - '"ssoStartUrl", "ssoAccountId", "ssoRegion", "ssoRoleName"'); +exports.Collector = void 0; +const stream_1 = __nccwpck_require__(12781); +class Collector extends stream_1.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; } - else { - return (0, resolveSSOCredentials_1.resolveSSOCredentials)({ - ssoStartUrl, - ssoSession, - ssoAccountId, - ssoRegion, - ssoRoleName, - ssoClient, - profile: profileName, - }); + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); } -}; -exports.fromSSO = fromSSO; +} +exports.Collector = Collector; /***/ }), -/***/ 26414: +/***/ 81030: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(35959), exports); -tslib_1.__exportStar(__nccwpck_require__(32572), exports); -tslib_1.__exportStar(__nccwpck_require__(86623), exports); -tslib_1.__exportStar(__nccwpck_require__(48098), exports); +exports.streamCollector = void 0; +const collector_1 = __nccwpck_require__(23211); +const streamCollector = (stream) => new Promise((resolve, reject) => { + const collector = new collector_1.Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function () { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); +}); +exports.streamCollector = streamCollector; /***/ }), -/***/ 32572: -/***/ ((__unused_webpack_module, exports) => { +/***/ 73766: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isSsoProfile = void 0; -const isSsoProfile = (arg) => arg && - (typeof arg.sso_start_url === "string" || - typeof arg.sso_account_id === "string" || - typeof arg.sso_session === "string" || - typeof arg.sso_region === "string" || - typeof arg.sso_role_name === "string"); -exports.isSsoProfile = isSsoProfile; +exports.writeRequestBody = void 0; +const stream_1 = __nccwpck_require__(12781); +const MIN_WAIT_TIME = 1000; +async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { + var _a; + const headers = (_a = request.headers) !== null && _a !== void 0 ? _a : {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let hasError = false; + if (expect === "100-continue") { + await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + clearTimeout(timeoutId); + resolve(); + }); + httpRequest.on("error", () => { + hasError = true; + clearTimeout(timeoutId); + resolve(); + }); + }), + ]); + } + if (!hasError) { + writeBody(httpRequest, request.body); + } +} +exports.writeRequestBody = writeRequestBody; +function writeBody(httpRequest, body) { + if (body instanceof stream_1.Readable) { + body.pipe(httpRequest); + } + else if (body) { + httpRequest.end(Buffer.from(body)); + } + else { + httpRequest.end(); + } +} /***/ }), -/***/ 94729: +/***/ 63936: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveSSOCredentials = void 0; -const client_sso_1 = __nccwpck_require__(82666); -const property_provider_1 = __nccwpck_require__(74462); -const shared_ini_file_loader_1 = __nccwpck_require__(67387); -const token_providers_1 = __nccwpck_require__(52843); -const EXPIRE_WINDOW_MS = 15 * 60 * 1000; -const SHOULD_FAIL_CREDENTIAL_CHAIN = false; -const resolveSSOCredentials = async ({ ssoStartUrl, ssoSession, ssoAccountId, ssoRegion, ssoRoleName, ssoClient, profile, }) => { - let token; - const refreshMessage = `To refresh this SSO session run aws sso login with the corresponding profile.`; - if (ssoSession) { - try { - const _token = await (0, token_providers_1.fromSso)({ profile })(); - token = { - accessToken: _token.token, - expiresAt: new Date(_token.expiration).toISOString(), - }; - } - catch (e) { - throw new property_provider_1.CredentialsProviderError(e.message, SHOULD_FAIL_CREDENTIAL_CHAIN); - } - } - else { - try { - token = await (0, shared_ini_file_loader_1.getSSOTokenFromFile)(ssoStartUrl); - } - catch (e) { - throw new property_provider_1.CredentialsProviderError(`The SSO session associated with this profile is invalid. ${refreshMessage}`, SHOULD_FAIL_CREDENTIAL_CHAIN); - } - } - if (new Date(token.expiresAt).getTime() - Date.now() <= EXPIRE_WINDOW_MS) { - throw new property_provider_1.CredentialsProviderError(`The SSO session associated with this profile has expired. ${refreshMessage}`, SHOULD_FAIL_CREDENTIAL_CHAIN); - } - const { accessToken } = token; - const sso = ssoClient || new client_sso_1.SSOClient({ region: ssoRegion }); - let ssoResp; - try { - ssoResp = await sso.send(new client_sso_1.GetRoleCredentialsCommand({ - accountId: ssoAccountId, - roleName: ssoRoleName, - accessToken, - })); - } - catch (e) { - throw property_provider_1.CredentialsProviderError.from(e, SHOULD_FAIL_CREDENTIAL_CHAIN); - } - const { roleCredentials: { accessKeyId, secretAccessKey, sessionToken, expiration } = {} } = ssoResp; - if (!accessKeyId || !secretAccessKey || !sessionToken || !expiration) { - throw new property_provider_1.CredentialsProviderError("SSO returns an invalid temporary credential.", SHOULD_FAIL_CREDENTIAL_CHAIN); +exports.CredentialsProviderError = void 0; +const ProviderError_1 = __nccwpck_require__(23324); +class CredentialsProviderError extends ProviderError_1.ProviderError { + constructor(message, tryNextLink = true) { + super(message, tryNextLink); + this.tryNextLink = tryNextLink; + this.name = "CredentialsProviderError"; + Object.setPrototypeOf(this, CredentialsProviderError.prototype); } - return { accessKeyId, secretAccessKey, sessionToken, expiration: new Date(expiration) }; -}; -exports.resolveSSOCredentials = resolveSSOCredentials; +} +exports.CredentialsProviderError = CredentialsProviderError; /***/ }), -/***/ 86623: +/***/ 23324: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ProviderError = void 0; +class ProviderError extends Error { + constructor(message, tryNextLink = true) { + super(message); + this.tryNextLink = tryNextLink; + this.name = "ProviderError"; + Object.setPrototypeOf(this, ProviderError.prototype); + } + static from(error, tryNextLink = true) { + return Object.assign(new this(error.message, tryNextLink), error); + } +} +exports.ProviderError = ProviderError; /***/ }), -/***/ 48098: +/***/ 50429: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.validateSsoProfile = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const validateSsoProfile = (profile) => { - const { sso_start_url, sso_account_id, sso_region, sso_role_name } = profile; - if (!sso_start_url || !sso_account_id || !sso_region || !sso_role_name) { - throw new property_provider_1.CredentialsProviderError(`Profile is configured with invalid SSO credentials. Required parameters "sso_account_id", ` + - `"sso_region", "sso_role_name", "sso_start_url". Got ${Object.keys(profile).join(", ")}\nReference: https://docs.aws.amazon.com/cli/latest/userguide/cli-configure-sso.html`, false); +exports.TokenProviderError = void 0; +const ProviderError_1 = __nccwpck_require__(23324); +class TokenProviderError extends ProviderError_1.ProviderError { + constructor(message, tryNextLink = true) { + super(message, tryNextLink); + this.tryNextLink = tryNextLink; + this.name = "TokenProviderError"; + Object.setPrototypeOf(this, TokenProviderError.prototype); } - return profile; -}; -exports.validateSsoProfile = validateSsoProfile; +} +exports.TokenProviderError = TokenProviderError; /***/ }), -/***/ 35614: +/***/ 45079: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromTokenFile = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const fs_1 = __nccwpck_require__(57147); -const fromWebToken_1 = __nccwpck_require__(47905); -const ENV_TOKEN_FILE = "AWS_WEB_IDENTITY_TOKEN_FILE"; -const ENV_ROLE_ARN = "AWS_ROLE_ARN"; -const ENV_ROLE_SESSION_NAME = "AWS_ROLE_SESSION_NAME"; -const fromTokenFile = (init = {}) => async () => { - var _a, _b, _c; - const webIdentityTokenFile = (_a = init === null || init === void 0 ? void 0 : init.webIdentityTokenFile) !== null && _a !== void 0 ? _a : process.env[ENV_TOKEN_FILE]; - const roleArn = (_b = init === null || init === void 0 ? void 0 : init.roleArn) !== null && _b !== void 0 ? _b : process.env[ENV_ROLE_ARN]; - const roleSessionName = (_c = init === null || init === void 0 ? void 0 : init.roleSessionName) !== null && _c !== void 0 ? _c : process.env[ENV_ROLE_SESSION_NAME]; - if (!webIdentityTokenFile || !roleArn) { - throw new property_provider_1.CredentialsProviderError("Web identity configuration not specified"); +exports.chain = void 0; +const ProviderError_1 = __nccwpck_require__(23324); +const chain = (...providers) => async () => { + if (providers.length === 0) { + throw new ProviderError_1.ProviderError("No providers in chain"); } - return (0, fromWebToken_1.fromWebToken)({ - ...init, - webIdentityToken: (0, fs_1.readFileSync)(webIdentityTokenFile, { encoding: "ascii" }), - roleArn, - roleSessionName, - })(); + let lastProviderError; + for (const provider of providers) { + try { + const credentials = await provider(); + return credentials; + } + catch (err) { + lastProviderError = err; + if (err === null || err === void 0 ? void 0 : err.tryNextLink) { + continue; + } + throw err; + } + } + throw lastProviderError; }; -exports.fromTokenFile = fromTokenFile; +exports.chain = chain; /***/ }), -/***/ 47905: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 51322: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromWebToken = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const fromWebToken = (init) => () => { - const { roleArn, roleSessionName, webIdentityToken, providerId, policyArns, policy, durationSeconds, roleAssumerWithWebIdentity, } = init; - if (!roleAssumerWithWebIdentity) { - throw new property_provider_1.CredentialsProviderError(`Role Arn '${roleArn}' needs to be assumed with web identity,` + - ` but no role assumption callback was provided.`, false); - } - return roleAssumerWithWebIdentity({ - RoleArn: roleArn, - RoleSessionName: roleSessionName !== null && roleSessionName !== void 0 ? roleSessionName : `aws-sdk-js-session-${Date.now()}`, - WebIdentityToken: webIdentityToken, - ProviderId: providerId, - PolicyArns: policyArns, - Policy: policy, - DurationSeconds: durationSeconds, - }); -}; -exports.fromWebToken = fromWebToken; +exports.fromStatic = void 0; +const fromStatic = (staticValue) => () => Promise.resolve(staticValue); +exports.fromStatic = fromStatic; /***/ }), -/***/ 15646: +/***/ 79721: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(35614), exports); -tslib_1.__exportStar(__nccwpck_require__(47905), exports); +tslib_1.__exportStar(__nccwpck_require__(63936), exports); +tslib_1.__exportStar(__nccwpck_require__(23324), exports); +tslib_1.__exportStar(__nccwpck_require__(50429), exports); +tslib_1.__exportStar(__nccwpck_require__(45079), exports); +tslib_1.__exportStar(__nccwpck_require__(51322), exports); +tslib_1.__exportStar(__nccwpck_require__(49762), exports); /***/ }), -/***/ 5779: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 49762: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.EventStreamCodec = void 0; -const crc32_1 = __nccwpck_require__(47327); -const HeaderMarshaller_1 = __nccwpck_require__(22650); -const splitMessage_1 = __nccwpck_require__(84558); -class EventStreamCodec { - constructor(toUtf8, fromUtf8) { - this.headerMarshaller = new HeaderMarshaller_1.HeaderMarshaller(toUtf8, fromUtf8); - this.messageBuffer = []; - this.isEndOfStream = false; - } - feed(message) { - this.messageBuffer.push(this.decode(message)); - } - endOfStream() { - this.isEndOfStream = true; - } - getMessage() { - const message = this.messageBuffer.pop(); - const isEndOfStream = this.isEndOfStream; - return { - getMessage() { - return message; - }, - isEndOfStream() { - return isEndOfStream; - }, - }; - } - getAvailableMessages() { - const messages = this.messageBuffer; - this.messageBuffer = []; - const isEndOfStream = this.isEndOfStream; - return { - getMessages() { - return messages; - }, - isEndOfStream() { - return isEndOfStream; - }, +exports.memoize = void 0; +const memoize = (provider, isExpired, requiresRefresh) => { + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = async () => { + if (!pending) { + pending = provider(); + } + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } + finally { + pending = undefined; + } + return resolved; + }; + if (isExpired === undefined) { + return async (options) => { + if (!hasResult || (options === null || options === void 0 ? void 0 : options.forceRefresh)) { + resolved = await coalesceProvider(); + } + return resolved; }; } - encode({ headers: rawHeaders, body }) { - const headers = this.headerMarshaller.format(rawHeaders); - const length = headers.byteLength + body.byteLength + 16; - const out = new Uint8Array(length); - const view = new DataView(out.buffer, out.byteOffset, out.byteLength); - const checksum = new crc32_1.Crc32(); - view.setUint32(0, length, false); - view.setUint32(4, headers.byteLength, false); - view.setUint32(8, checksum.update(out.subarray(0, 8)).digest(), false); - out.set(headers, 12); - out.set(body, headers.byteLength + 12); - view.setUint32(length - 4, checksum.update(out.subarray(8, length - 4)).digest(), false); - return out; - } - decode(message) { - const { headers, body } = (0, splitMessage_1.splitMessage)(message); - return { headers: this.headerMarshaller.parse(headers), body }; - } - formatHeaders(rawHeaders) { - return this.headerMarshaller.format(rawHeaders); - } -} -exports.EventStreamCodec = EventStreamCodec; + return async (options) => { + if (!hasResult || (options === null || options === void 0 ? void 0 : options.forceRefresh)) { + resolved = await coalesceProvider(); + } + if (isConstant) { + return resolved; + } + if (requiresRefresh && !requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(); + return resolved; + } + return resolved; + }; +}; +exports.memoize = memoize; /***/ }), -/***/ 22650: +/***/ 89179: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.HeaderMarshaller = void 0; -const util_hex_encoding_1 = __nccwpck_require__(1968); -const Int64_1 = __nccwpck_require__(86220); -class HeaderMarshaller { - constructor(toUtf8, fromUtf8) { - this.toUtf8 = toUtf8; - this.fromUtf8 = fromUtf8; +exports.Field = void 0; +const types_1 = __nccwpck_require__(55756); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; } - format(headers) { - const chunks = []; - for (const headerName of Object.keys(headers)) { - const bytes = this.fromUtf8(headerName); - chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName])); - } - const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0)); - let position = 0; - for (const chunk of chunks) { - out.set(chunk, position); - position += chunk.byteLength; - } - return out; + add(value) { + this.values.push(value); } - formatHeaderValue(header) { - switch (header.type) { - case "boolean": - return Uint8Array.from([header.value ? 0 : 1]); - case "byte": - return Uint8Array.from([2, header.value]); - case "short": - const shortView = new DataView(new ArrayBuffer(3)); - shortView.setUint8(0, 3); - shortView.setInt16(1, header.value, false); - return new Uint8Array(shortView.buffer); - case "integer": - const intView = new DataView(new ArrayBuffer(5)); - intView.setUint8(0, 4); - intView.setInt32(1, header.value, false); - return new Uint8Array(intView.buffer); - case "long": - const longBytes = new Uint8Array(9); - longBytes[0] = 5; - longBytes.set(header.value.bytes, 1); - return longBytes; - case "binary": - const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength)); - binView.setUint8(0, 6); - binView.setUint16(1, header.value.byteLength, false); - const binBytes = new Uint8Array(binView.buffer); - binBytes.set(header.value, 3); - return binBytes; - case "string": - const utf8Bytes = this.fromUtf8(header.value); - const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength)); - strView.setUint8(0, 7); - strView.setUint16(1, utf8Bytes.byteLength, false); - const strBytes = new Uint8Array(strView.buffer); - strBytes.set(utf8Bytes, 3); - return strBytes; - case "timestamp": - const tsBytes = new Uint8Array(9); - tsBytes[0] = 8; - tsBytes.set(Int64_1.Int64.fromNumber(header.value.valueOf()).bytes, 1); - return tsBytes; - case "uuid": - if (!UUID_PATTERN.test(header.value)) { - throw new Error(`Invalid UUID received: ${header.value}`); - } - const uuidBytes = new Uint8Array(17); - uuidBytes[0] = 9; - uuidBytes.set((0, util_hex_encoding_1.fromHex)(header.value.replace(/\-/g, "")), 1); - return uuidBytes; - } + set(values) { + this.values = values; } - parse(headers) { - const out = {}; - let position = 0; - while (position < headers.byteLength) { - const nameLength = headers.getUint8(position++); - const name = this.toUtf8(new Uint8Array(headers.buffer, headers.byteOffset + position, nameLength)); - position += nameLength; - switch (headers.getUint8(position++)) { - case 0: - out[name] = { - type: BOOLEAN_TAG, - value: true, - }; - break; - case 1: - out[name] = { - type: BOOLEAN_TAG, - value: false, - }; - break; - case 2: - out[name] = { - type: BYTE_TAG, - value: headers.getInt8(position++), - }; - break; - case 3: - out[name] = { - type: SHORT_TAG, - value: headers.getInt16(position, false), - }; - position += 2; - break; - case 4: - out[name] = { - type: INT_TAG, - value: headers.getInt32(position, false), - }; - position += 4; - break; - case 5: - out[name] = { - type: LONG_TAG, - value: new Int64_1.Int64(new Uint8Array(headers.buffer, headers.byteOffset + position, 8)), - }; - position += 8; - break; - case 6: - const binaryLength = headers.getUint16(position, false); - position += 2; - out[name] = { - type: BINARY_TAG, - value: new Uint8Array(headers.buffer, headers.byteOffset + position, binaryLength), - }; - position += binaryLength; - break; - case 7: - const stringLength = headers.getUint16(position, false); - position += 2; - out[name] = { - type: STRING_TAG, - value: this.toUtf8(new Uint8Array(headers.buffer, headers.byteOffset + position, stringLength)), - }; - position += stringLength; - break; - case 8: - out[name] = { - type: TIMESTAMP_TAG, - value: new Date(new Int64_1.Int64(new Uint8Array(headers.buffer, headers.byteOffset + position, 8)).valueOf()), - }; - position += 8; - break; - case 9: - const uuidBytes = new Uint8Array(headers.buffer, headers.byteOffset + position, 16); - position += 16; - out[name] = { - type: UUID_TAG, - value: `${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(0, 4))}-${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(4, 6))}-${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(6, 8))}-${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(8, 10))}-${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(10))}`, - }; - break; - default: - throw new Error(`Unrecognized header type tag`); - } - } - return out; + remove(value) { + this.values = this.values.filter((v) => v !== value); } -} -exports.HeaderMarshaller = HeaderMarshaller; -var HEADER_VALUE_TYPE; -(function (HEADER_VALUE_TYPE) { - HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["boolTrue"] = 0] = "boolTrue"; - HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["boolFalse"] = 1] = "boolFalse"; - HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["byte"] = 2] = "byte"; - HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["short"] = 3] = "short"; - HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["integer"] = 4] = "integer"; - HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["long"] = 5] = "long"; - HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["byteArray"] = 6] = "byteArray"; - HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["string"] = 7] = "string"; - HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["timestamp"] = 8] = "timestamp"; - HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["uuid"] = 9] = "uuid"; -})(HEADER_VALUE_TYPE || (HEADER_VALUE_TYPE = {})); -const BOOLEAN_TAG = "boolean"; -const BYTE_TAG = "byte"; -const SHORT_TAG = "short"; -const INT_TAG = "integer"; -const LONG_TAG = "long"; -const BINARY_TAG = "binary"; -const STRING_TAG = "string"; -const TIMESTAMP_TAG = "timestamp"; -const UUID_TAG = "uuid"; -const UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/; + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; + } +} +exports.Field = Field; /***/ }), -/***/ 86220: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 99242: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.Int64 = void 0; -const util_hex_encoding_1 = __nccwpck_require__(1968); -class Int64 { - constructor(bytes) { - this.bytes = bytes; - if (bytes.byteLength !== 8) { - throw new Error("Int64 buffers must be exactly 8 bytes"); - } - } - static fromNumber(number) { - if (number > 9223372036854776000 || number < -9223372036854776000) { - throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`); - } - const bytes = new Uint8Array(8); - for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) { - bytes[i] = remaining; - } - if (number < 0) { - negate(bytes); - } - return new Int64(bytes); +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; } - valueOf() { - const bytes = this.bytes.slice(0); - const negative = bytes[0] & 0b10000000; - if (negative) { - negate(bytes); - } - return parseInt((0, util_hex_encoding_1.toHex)(bytes), 16) * (negative ? -1 : 1); + setField(field) { + this.entries[field.name.toLowerCase()] = field; } - toString() { - return String(this.valueOf()); + getField(name) { + return this.entries[name.toLowerCase()]; } -} -exports.Int64 = Int64; -function negate(bytes) { - for (let i = 0; i < 8; i++) { - bytes[i] ^= 0xff; + removeField(name) { + delete this.entries[name.toLowerCase()]; } - for (let i = 7; i > -1; i--) { - bytes[i]++; - if (bytes[i] !== 0) - break; + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); } } +exports.Fields = Fields; /***/ }), -/***/ 59516: +/***/ 63206: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -19935,2941 +39332,2790 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 31166: +/***/ 38746: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.MessageDecoderStream = void 0; -class MessageDecoderStream { +exports.HttpRequest = void 0; +class HttpRequest { constructor(options) { - this.options = options; + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; } - [Symbol.asyncIterator]() { - return this.asyncIterator(); + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); } - async *asyncIterator() { - for await (const bytes of this.options.inputStream) { - const decoded = this.options.decoder.decode(bytes); - yield decoded; - } + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; } } -exports.MessageDecoderStream = MessageDecoderStream; +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} /***/ }), -/***/ 24498: +/***/ 26322: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.MessageEncoderStream = void 0; -class MessageEncoderStream { +exports.HttpResponse = void 0; +class HttpResponse { constructor(options) { - this.options = options; + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; } - [Symbol.asyncIterator]() { - return this.asyncIterator(); + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; } - async *asyncIterator() { - for await (const msg of this.options.messageStream) { - const encoded = this.options.encoder.encode(msg); - yield encoded; +} +exports.HttpResponse = HttpResponse; + + +/***/ }), + +/***/ 64418: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(89179), exports); +tslib_1.__exportStar(__nccwpck_require__(99242), exports); +tslib_1.__exportStar(__nccwpck_require__(63206), exports); +tslib_1.__exportStar(__nccwpck_require__(38746), exports); +tslib_1.__exportStar(__nccwpck_require__(26322), exports); +tslib_1.__exportStar(__nccwpck_require__(61466), exports); +tslib_1.__exportStar(__nccwpck_require__(19135), exports); + + +/***/ }), + +/***/ 61466: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; + + +/***/ }), + +/***/ 19135: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 68031: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.buildQueryString = void 0; +const util_uri_escape_1 = __nccwpck_require__(54197); +function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, util_uri_escape_1.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, util_uri_escape_1.escapeUri)(value[i])}`); + } } - if (this.options.includeEndFrame) { - yield new Uint8Array(0); + else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, util_uri_escape_1.escapeUri)(value)}`; + } + parts.push(qsEntry); } } + return parts.join("&"); } -exports.MessageEncoderStream = MessageEncoderStream; +exports.buildQueryString = buildQueryString; /***/ }), -/***/ 3947: +/***/ 4769: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SmithyMessageDecoderStream = void 0; -class SmithyMessageDecoderStream { - constructor(options) { - this.options = options; - } - [Symbol.asyncIterator]() { - return this.asyncIterator(); - } - async *asyncIterator() { - for await (const message of this.options.messageStream) { - const deserialized = await this.options.deserializer(message); - if (deserialized === undefined) - continue; - yield deserialized; +exports.parseQueryString = void 0; +function parseQueryString(querystring) { + const query = {}; + querystring = querystring.replace(/^\?/, ""); + if (querystring) { + for (const pair of querystring.split("&")) { + let [key, value = null] = pair.split("="); + key = decodeURIComponent(key); + if (value) { + value = decodeURIComponent(value); + } + if (!(key in query)) { + query[key] = value; + } + else if (Array.isArray(query[key])) { + query[key].push(value); + } + else { + query[key] = [query[key], value]; + } } } + return query; } -exports.SmithyMessageDecoderStream = SmithyMessageDecoderStream; +exports.parseQueryString = parseQueryString; /***/ }), -/***/ 52582: +/***/ 68415: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SmithyMessageEncoderStream = void 0; -class SmithyMessageEncoderStream { - constructor(options) { - this.options = options; - } - [Symbol.asyncIterator]() { - return this.asyncIterator(); - } - async *asyncIterator() { - for await (const chunk of this.options.inputStream) { - const payloadBuf = this.options.serializer(chunk); - yield payloadBuf; +exports.NODEJS_TIMEOUT_ERROR_CODES = exports.TRANSIENT_ERROR_STATUS_CODES = exports.TRANSIENT_ERROR_CODES = exports.THROTTLING_ERROR_CODES = exports.CLOCK_SKEW_ERROR_CODES = void 0; +exports.CLOCK_SKEW_ERROR_CODES = [ + "AuthFailure", + "InvalidSignatureException", + "RequestExpired", + "RequestInTheFuture", + "RequestTimeTooSkewed", + "SignatureDoesNotMatch", +]; +exports.THROTTLING_ERROR_CODES = [ + "BandwidthLimitExceeded", + "EC2ThrottledException", + "LimitExceededException", + "PriorRequestNotComplete", + "ProvisionedThroughputExceededException", + "RequestLimitExceeded", + "RequestThrottled", + "RequestThrottledException", + "SlowDown", + "ThrottledException", + "Throttling", + "ThrottlingException", + "TooManyRequestsException", + "TransactionInProgressException", +]; +exports.TRANSIENT_ERROR_CODES = ["TimeoutError", "RequestTimeout", "RequestTimeoutException"]; +exports.TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504]; +exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "ECONNREFUSED", "EPIPE", "ETIMEDOUT"]; + + +/***/ }), + +/***/ 6375: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isServerError = exports.isTransientError = exports.isThrottlingError = exports.isClockSkewError = exports.isRetryableByTrait = void 0; +const constants_1 = __nccwpck_require__(68415); +const isRetryableByTrait = (error) => error.$retryable !== undefined; +exports.isRetryableByTrait = isRetryableByTrait; +const isClockSkewError = (error) => constants_1.CLOCK_SKEW_ERROR_CODES.includes(error.name); +exports.isClockSkewError = isClockSkewError; +const isThrottlingError = (error) => { + var _a, _b; + return ((_a = error.$metadata) === null || _a === void 0 ? void 0 : _a.httpStatusCode) === 429 || + constants_1.THROTTLING_ERROR_CODES.includes(error.name) || + ((_b = error.$retryable) === null || _b === void 0 ? void 0 : _b.throttling) == true; +}; +exports.isThrottlingError = isThrottlingError; +const isTransientError = (error) => { + var _a; + return constants_1.TRANSIENT_ERROR_CODES.includes(error.name) || + constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes((error === null || error === void 0 ? void 0 : error.code) || "") || + constants_1.TRANSIENT_ERROR_STATUS_CODES.includes(((_a = error.$metadata) === null || _a === void 0 ? void 0 : _a.httpStatusCode) || 0); +}; +exports.isTransientError = isTransientError; +const isServerError = (error) => { + var _a; + if (((_a = error.$metadata) === null || _a === void 0 ? void 0 : _a.httpStatusCode) !== undefined) { + const statusCode = error.$metadata.httpStatusCode; + if (500 <= statusCode && statusCode <= 599 && !(0, exports.isTransientError)(error)) { + return true; } + return false; } -} -exports.SmithyMessageEncoderStream = SmithyMessageEncoderStream; + return false; +}; +exports.isServerError = isServerError; /***/ }), -/***/ 14825: +/***/ 47237: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(5779), exports); -tslib_1.__exportStar(__nccwpck_require__(22650), exports); -tslib_1.__exportStar(__nccwpck_require__(86220), exports); -tslib_1.__exportStar(__nccwpck_require__(59516), exports); -tslib_1.__exportStar(__nccwpck_require__(31166), exports); -tslib_1.__exportStar(__nccwpck_require__(24498), exports); -tslib_1.__exportStar(__nccwpck_require__(3947), exports); -tslib_1.__exportStar(__nccwpck_require__(52582), exports); +exports.getConfigFilepath = exports.ENV_CONFIG_PATH = void 0; +const path_1 = __nccwpck_require__(71017); +const getHomeDir_1 = __nccwpck_require__(68340); +exports.ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; +const getConfigFilepath = () => process.env[exports.ENV_CONFIG_PATH] || (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "config"); +exports.getConfigFilepath = getConfigFilepath; /***/ }), -/***/ 84558: +/***/ 99036: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.splitMessage = void 0; -const crc32_1 = __nccwpck_require__(47327); -const PRELUDE_MEMBER_LENGTH = 4; -const PRELUDE_LENGTH = PRELUDE_MEMBER_LENGTH * 2; -const CHECKSUM_LENGTH = 4; -const MINIMUM_MESSAGE_LENGTH = PRELUDE_LENGTH + CHECKSUM_LENGTH * 2; -function splitMessage({ byteLength, byteOffset, buffer }) { - if (byteLength < MINIMUM_MESSAGE_LENGTH) { - throw new Error("Provided message too short to accommodate event stream message overhead"); - } - const view = new DataView(buffer, byteOffset, byteLength); - const messageLength = view.getUint32(0, false); - if (byteLength !== messageLength) { - throw new Error("Reported message length does not match received message length"); - } - const headerLength = view.getUint32(PRELUDE_MEMBER_LENGTH, false); - const expectedPreludeChecksum = view.getUint32(PRELUDE_LENGTH, false); - const expectedMessageChecksum = view.getUint32(byteLength - CHECKSUM_LENGTH, false); - const checksummer = new crc32_1.Crc32().update(new Uint8Array(buffer, byteOffset, PRELUDE_LENGTH)); - if (expectedPreludeChecksum !== checksummer.digest()) { - throw new Error(`The prelude checksum specified in the message (${expectedPreludeChecksum}) does not match the calculated CRC32 checksum (${checksummer.digest()})`); - } - checksummer.update(new Uint8Array(buffer, byteOffset + PRELUDE_LENGTH, byteLength - (PRELUDE_LENGTH + CHECKSUM_LENGTH))); - if (expectedMessageChecksum !== checksummer.digest()) { - throw new Error(`The message checksum (${checksummer.digest()}) did not match the expected value of ${expectedMessageChecksum}`); +exports.getCredentialsFilepath = exports.ENV_CREDENTIALS_PATH = void 0; +const path_1 = __nccwpck_require__(71017); +const getHomeDir_1 = __nccwpck_require__(68340); +exports.ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; +const getCredentialsFilepath = () => process.env[exports.ENV_CREDENTIALS_PATH] || (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "credentials"); +exports.getCredentialsFilepath = getCredentialsFilepath; + + +/***/ }), + +/***/ 68340: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getHomeDir = void 0; +const os_1 = __nccwpck_require__(22037); +const path_1 = __nccwpck_require__(71017); +const homeDirCache = {}; +const getHomeDirCacheKey = () => { + if (process && process.geteuid) { + return `${process.geteuid()}`; } - return { - headers: new DataView(buffer, byteOffset + PRELUDE_LENGTH + CHECKSUM_LENGTH, headerLength), - body: new Uint8Array(buffer, byteOffset + PRELUDE_LENGTH + CHECKSUM_LENGTH + headerLength, messageLength - headerLength - (PRELUDE_LENGTH + CHECKSUM_LENGTH + CHECKSUM_LENGTH)), - }; -} -exports.splitMessage = splitMessage; + return "DEFAULT"; +}; +const getHomeDir = () => { + const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; + if (HOME) + return HOME; + if (USERPROFILE) + return USERPROFILE; + if (HOMEPATH) + return `${HOMEDRIVE}${HOMEPATH}`; + const homeDirCacheKey = getHomeDirCacheKey(); + if (!homeDirCache[homeDirCacheKey]) + homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); + return homeDirCache[homeDirCacheKey]; +}; +exports.getHomeDir = getHomeDir; + + +/***/ }), + +/***/ 32041: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getProfileData = void 0; +const profileKeyRegex = /^profile\s(["'])?([^\1]+)\1$/; +const getProfileData = (data) => Object.entries(data) + .filter(([key]) => profileKeyRegex.test(key)) + .reduce((acc, [key, value]) => ({ ...acc, [profileKeyRegex.exec(key)[2]]: value }), { + ...(data.default && { default: data.default }), +}); +exports.getProfileData = getProfileData; /***/ }), -/***/ 97442: +/***/ 52802: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getProfileName = exports.DEFAULT_PROFILE = exports.ENV_PROFILE = void 0; +exports.ENV_PROFILE = "AWS_PROFILE"; +exports.DEFAULT_PROFILE = "default"; +const getProfileName = (init) => init.profile || process.env[exports.ENV_PROFILE] || exports.DEFAULT_PROFILE; +exports.getProfileName = getProfileName; + + +/***/ }), + +/***/ 24740: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.Hash = void 0; -const util_buffer_from_1 = __nccwpck_require__(36010); -const util_utf8_1 = __nccwpck_require__(2855); -const buffer_1 = __nccwpck_require__(14300); +exports.getSSOTokenFilepath = void 0; const crypto_1 = __nccwpck_require__(6113); -class Hash { - constructor(algorithmIdentifier, secret) { - this.algorithmIdentifier = algorithmIdentifier; - this.secret = secret; - this.reset(); - } - update(toHash, encoding) { - this.hash.update((0, util_utf8_1.toUint8Array)(castSourceData(toHash, encoding))); - } - digest() { - return Promise.resolve(this.hash.digest()); - } - reset() { - this.hash = this.secret - ? (0, crypto_1.createHmac)(this.algorithmIdentifier, castSourceData(this.secret)) - : (0, crypto_1.createHash)(this.algorithmIdentifier); - } -} -exports.Hash = Hash; -function castSourceData(toCast, encoding) { - if (buffer_1.Buffer.isBuffer(toCast)) { - return toCast; - } - if (typeof toCast === "string") { - return (0, util_buffer_from_1.fromString)(toCast, encoding); - } - if (ArrayBuffer.isView(toCast)) { - return (0, util_buffer_from_1.fromArrayBuffer)(toCast.buffer, toCast.byteOffset, toCast.byteLength); - } - return (0, util_buffer_from_1.fromArrayBuffer)(toCast); -} +const path_1 = __nccwpck_require__(71017); +const getHomeDir_1 = __nccwpck_require__(68340); +const getSSOTokenFilepath = (id) => { + const hasher = (0, crypto_1.createHash)("sha1"); + const cacheName = hasher.update(id).digest("hex"); + return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); +}; +exports.getSSOTokenFilepath = getSSOTokenFilepath; + + +/***/ }), + +/***/ 69678: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSSOTokenFromFile = void 0; +const fs_1 = __nccwpck_require__(57147); +const getSSOTokenFilepath_1 = __nccwpck_require__(24740); +const { readFile } = fs_1.promises; +const getSSOTokenFromFile = async (id) => { + const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); + const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); + return JSON.parse(ssoTokenText); +}; +exports.getSSOTokenFromFile = getSSOTokenFromFile; + + +/***/ }), + +/***/ 82820: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSsoSessionData = void 0; +const ssoSessionKeyRegex = /^sso-session\s(["'])?([^\1]+)\1$/; +const getSsoSessionData = (data) => Object.entries(data) + .filter(([key]) => ssoSessionKeyRegex.test(key)) + .reduce((acc, [key, value]) => ({ ...acc, [ssoSessionKeyRegex.exec(key)[2]]: value }), {}); +exports.getSsoSessionData = getSsoSessionData; + + +/***/ }), + +/***/ 43507: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(68340), exports); +tslib_1.__exportStar(__nccwpck_require__(52802), exports); +tslib_1.__exportStar(__nccwpck_require__(24740), exports); +tslib_1.__exportStar(__nccwpck_require__(69678), exports); +tslib_1.__exportStar(__nccwpck_require__(41879), exports); +tslib_1.__exportStar(__nccwpck_require__(34649), exports); +tslib_1.__exportStar(__nccwpck_require__(2546), exports); +tslib_1.__exportStar(__nccwpck_require__(63191), exports); /***/ }), -/***/ 69126: -/***/ ((__unused_webpack_module, exports) => { +/***/ 41879: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isArrayBuffer = void 0; -const isArrayBuffer = (arg) => (typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer) || - Object.prototype.toString.call(arg) === "[object ArrayBuffer]"; -exports.isArrayBuffer = isArrayBuffer; +exports.loadSharedConfigFiles = void 0; +const getConfigFilepath_1 = __nccwpck_require__(47237); +const getCredentialsFilepath_1 = __nccwpck_require__(99036); +const getProfileData_1 = __nccwpck_require__(32041); +const parseIni_1 = __nccwpck_require__(54262); +const slurpFile_1 = __nccwpck_require__(19155); +const swallowError = () => ({}); +const loadSharedConfigFiles = async (init = {}) => { + const { filepath = (0, getCredentialsFilepath_1.getCredentialsFilepath)(), configFilepath = (0, getConfigFilepath_1.getConfigFilepath)() } = init; + const parsedFiles = await Promise.all([ + (0, slurpFile_1.slurpFile)(configFilepath, { + ignoreCache: init.ignoreCache, + }) + .then(parseIni_1.parseIni) + .then(getProfileData_1.getProfileData) + .catch(swallowError), + (0, slurpFile_1.slurpFile)(filepath, { + ignoreCache: init.ignoreCache, + }) + .then(parseIni_1.parseIni) + .catch(swallowError), + ]); + return { + configFile: parsedFiles[0], + credentialsFile: parsedFiles[1], + }; +}; +exports.loadSharedConfigFiles = loadSharedConfigFiles; /***/ }), -/***/ 42245: +/***/ 34649: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getContentLengthPlugin = exports.contentLengthMiddlewareOptions = exports.contentLengthMiddleware = void 0; -const protocol_http_1 = __nccwpck_require__(70223); -const CONTENT_LENGTH_HEADER = "content-length"; -function contentLengthMiddleware(bodyLengthChecker) { - return (next) => async (args) => { - const request = args.request; - if (protocol_http_1.HttpRequest.isInstance(request)) { - const { body, headers } = request; - if (body && - Object.keys(headers) - .map((str) => str.toLowerCase()) - .indexOf(CONTENT_LENGTH_HEADER) === -1) { - try { - const length = bodyLengthChecker(body); - request.headers = { - ...request.headers, - [CONTENT_LENGTH_HEADER]: String(length), - }; - } - catch (error) { - } +exports.loadSsoSessionData = void 0; +const getConfigFilepath_1 = __nccwpck_require__(47237); +const getSsoSessionData_1 = __nccwpck_require__(82820); +const parseIni_1 = __nccwpck_require__(54262); +const slurpFile_1 = __nccwpck_require__(19155); +const swallowError = () => ({}); +const loadSsoSessionData = async (init = {}) => { + var _a; + return (0, slurpFile_1.slurpFile)((_a = init.configFilepath) !== null && _a !== void 0 ? _a : (0, getConfigFilepath_1.getConfigFilepath)()) + .then(parseIni_1.parseIni) + .then(getSsoSessionData_1.getSsoSessionData) + .catch(swallowError); +}; +exports.loadSsoSessionData = loadSsoSessionData; + + +/***/ }), + +/***/ 19447: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.mergeConfigFiles = void 0; +const mergeConfigFiles = (...files) => { + const merged = {}; + for (const file of files) { + for (const [key, values] of Object.entries(file)) { + if (merged[key] !== undefined) { + Object.assign(merged[key], values); + } + else { + merged[key] = values; } } - return next({ - ...args, - request, - }); - }; -} -exports.contentLengthMiddleware = contentLengthMiddleware; -exports.contentLengthMiddlewareOptions = { - step: "build", - tags: ["SET_CONTENT_LENGTH", "CONTENT_LENGTH"], - name: "contentLengthMiddleware", - override: true, + } + return merged; }; -const getContentLengthPlugin = (options) => ({ - applyToStack: (clientStack) => { - clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), exports.contentLengthMiddlewareOptions); - }, -}); -exports.getContentLengthPlugin = getContentLengthPlugin; +exports.mergeConfigFiles = mergeConfigFiles; /***/ }), -/***/ 53504: +/***/ 54262: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.createConfigValueProvider = void 0; -const createConfigValueProvider = (configKey, canonicalEndpointParamKey, config) => { - const configProvider = async () => { - var _a; - const configValue = (_a = config[configKey]) !== null && _a !== void 0 ? _a : config[canonicalEndpointParamKey]; - if (typeof configValue === "function") { - return configValue(); +exports.parseIni = void 0; +const profileNameBlockList = ["__proto__", "profile __proto__"]; +const parseIni = (iniData) => { + const map = {}; + let currentSection; + for (let line of iniData.split(/\r?\n/)) { + line = line.split(/(^|\s)[;#]/)[0].trim(); + const isSection = line[0] === "[" && line[line.length - 1] === "]"; + if (isSection) { + currentSection = line.substring(1, line.length - 1); + if (profileNameBlockList.includes(currentSection)) { + throw new Error(`Found invalid profile name "${currentSection}"`); + } } - return configValue; - }; - if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { - return async () => { - const endpoint = await configProvider(); - if (endpoint && typeof endpoint === "object") { - if ("url" in endpoint) { - return endpoint.url.href; - } - if ("hostname" in endpoint) { - const { protocol, hostname, port, path } = endpoint; - return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; - } + else if (currentSection) { + const indexOfEqualsSign = line.indexOf("="); + const start = 0; + const end = line.length - 1; + const isAssignment = indexOfEqualsSign !== -1 && indexOfEqualsSign !== start && indexOfEqualsSign !== end; + if (isAssignment) { + const [name, value] = [ + line.substring(0, indexOfEqualsSign).trim(), + line.substring(indexOfEqualsSign + 1).trim(), + ]; + map[currentSection] = map[currentSection] || {}; + map[currentSection][name] = value; } - return endpoint; - }; + } } - return configProvider; + return map; }; -exports.createConfigValueProvider = createConfigValueProvider; +exports.parseIni = parseIni; /***/ }), -/***/ 62419: +/***/ 2546: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveParams = exports.getEndpointFromInstructions = void 0; -const service_customizations_1 = __nccwpck_require__(3589); -const createConfigValueProvider_1 = __nccwpck_require__(53504); -const getEndpointFromInstructions = async (commandInput, instructionsSupplier, clientConfig, context) => { - const endpointParams = await (0, exports.resolveParams)(commandInput, instructionsSupplier, clientConfig); - if (typeof clientConfig.endpointProvider !== "function") { - throw new Error("config.endpointProvider is not set."); - } - const endpoint = clientConfig.endpointProvider(endpointParams, context); - return endpoint; +exports.parseKnownFiles = void 0; +const loadSharedConfigFiles_1 = __nccwpck_require__(41879); +const mergeConfigFiles_1 = __nccwpck_require__(19447); +const parseKnownFiles = async (init) => { + const parsedFiles = await (0, loadSharedConfigFiles_1.loadSharedConfigFiles)(init); + return (0, mergeConfigFiles_1.mergeConfigFiles)(parsedFiles.configFile, parsedFiles.credentialsFile); }; -exports.getEndpointFromInstructions = getEndpointFromInstructions; -const resolveParams = async (commandInput, instructionsSupplier, clientConfig) => { - var _a; - const endpointParams = {}; - const instructions = ((_a = instructionsSupplier === null || instructionsSupplier === void 0 ? void 0 : instructionsSupplier.getEndpointParameterInstructions) === null || _a === void 0 ? void 0 : _a.call(instructionsSupplier)) || {}; - for (const [name, instruction] of Object.entries(instructions)) { - switch (instruction.type) { - case "staticContextParams": - endpointParams[name] = instruction.value; - break; - case "contextParams": - endpointParams[name] = commandInput[instruction.name]; - break; - case "clientContextParams": - case "builtInParams": - endpointParams[name] = await (0, createConfigValueProvider_1.createConfigValueProvider)(instruction.name, name, clientConfig)(); - break; - default: - throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); - } - } - if (Object.keys(instructions).length === 0) { - Object.assign(endpointParams, clientConfig); - } - if (String(clientConfig.serviceId).toLowerCase() === "s3") { - await (0, service_customizations_1.resolveParamsForS3)(endpointParams); +exports.parseKnownFiles = parseKnownFiles; + + +/***/ }), + +/***/ 19155: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.slurpFile = void 0; +const fs_1 = __nccwpck_require__(57147); +const { readFile } = fs_1.promises; +const filePromisesHash = {}; +const slurpFile = (path, options) => { + if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { + filePromisesHash[path] = readFile(path, "utf8"); } - return endpointParams; + return filePromisesHash[path]; }; -exports.resolveParams = resolveParams; +exports.slurpFile = slurpFile; /***/ }), -/***/ 50197: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 63191: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(62419), exports); -tslib_1.__exportStar(__nccwpck_require__(98289), exports); /***/ }), -/***/ 98289: +/***/ 39733: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.toEndpointV1 = void 0; -const url_parser_1 = __nccwpck_require__(2992); -const toEndpointV1 = (endpoint) => { - if (typeof endpoint === "object") { - if ("url" in endpoint) { - return (0, url_parser_1.parseUrl)(endpoint.url); +exports.SignatureV4 = void 0; +const eventstream_codec_1 = __nccwpck_require__(56459); +const util_hex_encoding_1 = __nccwpck_require__(45364); +const util_middleware_1 = __nccwpck_require__(2390); +const util_utf8_1 = __nccwpck_require__(41895); +const constants_1 = __nccwpck_require__(48644); +const credentialDerivation_1 = __nccwpck_require__(19623); +const getCanonicalHeaders_1 = __nccwpck_require__(51393); +const getCanonicalQuery_1 = __nccwpck_require__(33243); +const getPayloadHash_1 = __nccwpck_require__(48545); +const headerUtil_1 = __nccwpck_require__(62179); +const moveHeadersToQuery_1 = __nccwpck_require__(49828); +const prepareRequest_1 = __nccwpck_require__(60075); +const utilDate_1 = __nccwpck_require__(39299); +class SignatureV4 { + constructor({ applyChecksum, credentials, region, service, sha256, uriEscapePath = true, }) { + this.headerMarshaller = new eventstream_codec_1.HeaderMarshaller(util_utf8_1.toUtf8, util_utf8_1.fromUtf8); + this.service = service; + this.sha256 = sha256; + this.uriEscapePath = uriEscapePath; + this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true; + this.regionProvider = (0, util_middleware_1.normalizeProvider)(region); + this.credentialProvider = (0, util_middleware_1.normalizeProvider)(credentials); + } + async presign(originalRequest, options = {}) { + const { signingDate = new Date(), expiresIn = 3600, unsignableHeaders, unhoistableHeaders, signableHeaders, signingRegion, signingService, } = options; + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider()); + const { longDate, shortDate } = formatDate(signingDate); + if (expiresIn > constants_1.MAX_PRESIGNED_TTL) { + return Promise.reject("Signature version 4 presigned URLs" + " must have an expiration date less than one week in" + " the future"); } - return endpoint; + const scope = (0, credentialDerivation_1.createScope)(shortDate, region, signingService !== null && signingService !== void 0 ? signingService : this.service); + const request = (0, moveHeadersToQuery_1.moveHeadersToQuery)((0, prepareRequest_1.prepareRequest)(originalRequest), { unhoistableHeaders }); + if (credentials.sessionToken) { + request.query[constants_1.TOKEN_QUERY_PARAM] = credentials.sessionToken; + } + request.query[constants_1.ALGORITHM_QUERY_PARAM] = constants_1.ALGORITHM_IDENTIFIER; + request.query[constants_1.CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`; + request.query[constants_1.AMZ_DATE_QUERY_PARAM] = longDate; + request.query[constants_1.EXPIRES_QUERY_PARAM] = expiresIn.toString(10); + const canonicalHeaders = (0, getCanonicalHeaders_1.getCanonicalHeaders)(request, unsignableHeaders, signableHeaders); + request.query[constants_1.SIGNED_HEADERS_QUERY_PARAM] = getCanonicalHeaderList(canonicalHeaders); + request.query[constants_1.SIGNATURE_QUERY_PARAM] = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, await (0, getPayloadHash_1.getPayloadHash)(originalRequest, this.sha256))); + return request; } - return (0, url_parser_1.parseUrl)(endpoint); + async sign(toSign, options) { + if (typeof toSign === "string") { + return this.signString(toSign, options); + } + else if (toSign.headers && toSign.payload) { + return this.signEvent(toSign, options); + } + else if (toSign.message) { + return this.signMessage(toSign, options); + } + else { + return this.signRequest(toSign, options); + } + } + async signEvent({ headers, payload }, { signingDate = new Date(), priorSignature, signingRegion, signingService }) { + const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider()); + const { shortDate, longDate } = formatDate(signingDate); + const scope = (0, credentialDerivation_1.createScope)(shortDate, region, signingService !== null && signingService !== void 0 ? signingService : this.service); + const hashedPayload = await (0, getPayloadHash_1.getPayloadHash)({ headers: {}, body: payload }, this.sha256); + const hash = new this.sha256(); + hash.update(headers); + const hashedHeaders = (0, util_hex_encoding_1.toHex)(await hash.digest()); + const stringToSign = [ + constants_1.EVENT_ALGORITHM_IDENTIFIER, + longDate, + scope, + priorSignature, + hashedHeaders, + hashedPayload, + ].join("\n"); + return this.signString(stringToSign, { signingDate, signingRegion: region, signingService }); + } + async signMessage(signableMessage, { signingDate = new Date(), signingRegion, signingService }) { + const promise = this.signEvent({ + headers: this.headerMarshaller.format(signableMessage.message.headers), + payload: signableMessage.message.body, + }, { + signingDate, + signingRegion, + signingService, + priorSignature: signableMessage.priorSignature, + }); + return promise.then((signature) => { + return { message: signableMessage.message, signature }; + }); + } + async signString(stringToSign, { signingDate = new Date(), signingRegion, signingService } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider()); + const { shortDate } = formatDate(signingDate); + const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService)); + hash.update((0, util_utf8_1.toUint8Array)(stringToSign)); + return (0, util_hex_encoding_1.toHex)(await hash.digest()); + } + async signRequest(requestToSign, { signingDate = new Date(), signableHeaders, unsignableHeaders, signingRegion, signingService, } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider()); + const request = (0, prepareRequest_1.prepareRequest)(requestToSign); + const { longDate, shortDate } = formatDate(signingDate); + const scope = (0, credentialDerivation_1.createScope)(shortDate, region, signingService !== null && signingService !== void 0 ? signingService : this.service); + request.headers[constants_1.AMZ_DATE_HEADER] = longDate; + if (credentials.sessionToken) { + request.headers[constants_1.TOKEN_HEADER] = credentials.sessionToken; + } + const payloadHash = await (0, getPayloadHash_1.getPayloadHash)(request, this.sha256); + if (!(0, headerUtil_1.hasHeader)(constants_1.SHA256_HEADER, request.headers) && this.applyChecksum) { + request.headers[constants_1.SHA256_HEADER] = payloadHash; + } + const canonicalHeaders = (0, getCanonicalHeaders_1.getCanonicalHeaders)(request, unsignableHeaders, signableHeaders); + const signature = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, payloadHash)); + request.headers[constants_1.AUTH_HEADER] = + `${constants_1.ALGORITHM_IDENTIFIER} ` + + `Credential=${credentials.accessKeyId}/${scope}, ` + + `SignedHeaders=${getCanonicalHeaderList(canonicalHeaders)}, ` + + `Signature=${signature}`; + return request; + } + createCanonicalRequest(request, canonicalHeaders, payloadHash) { + const sortedHeaders = Object.keys(canonicalHeaders).sort(); + return `${request.method} +${this.getCanonicalPath(request)} +${(0, getCanonicalQuery_1.getCanonicalQuery)(request)} +${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join("\n")} + +${sortedHeaders.join(";")} +${payloadHash}`; + } + async createStringToSign(longDate, credentialScope, canonicalRequest) { + const hash = new this.sha256(); + hash.update((0, util_utf8_1.toUint8Array)(canonicalRequest)); + const hashedRequest = await hash.digest(); + return `${constants_1.ALGORITHM_IDENTIFIER} +${longDate} +${credentialScope} +${(0, util_hex_encoding_1.toHex)(hashedRequest)}`; + } + getCanonicalPath({ path }) { + if (this.uriEscapePath) { + const normalizedPathSegments = []; + for (const pathSegment of path.split("/")) { + if ((pathSegment === null || pathSegment === void 0 ? void 0 : pathSegment.length) === 0) + continue; + if (pathSegment === ".") + continue; + if (pathSegment === "..") { + normalizedPathSegments.pop(); + } + else { + normalizedPathSegments.push(pathSegment); + } + } + const normalizedPath = `${(path === null || path === void 0 ? void 0 : path.startsWith("/")) ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && (path === null || path === void 0 ? void 0 : path.endsWith("/")) ? "/" : ""}`; + const doubleEncoded = encodeURIComponent(normalizedPath); + return doubleEncoded.replace(/%2F/g, "/"); + } + return path; + } + async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) { + const stringToSign = await this.createStringToSign(longDate, credentialScope, canonicalRequest); + const hash = new this.sha256(await keyPromise); + hash.update((0, util_utf8_1.toUint8Array)(stringToSign)); + return (0, util_hex_encoding_1.toHex)(await hash.digest()); + } + getSigningKey(credentials, region, shortDate, service) { + return (0, credentialDerivation_1.getSigningKey)(this.sha256, credentials, shortDate, region, service || this.service); + } + validateResolvedCredentials(credentials) { + if (typeof credentials !== "object" || + typeof credentials.accessKeyId !== "string" || + typeof credentials.secretAccessKey !== "string") { + throw new Error("Resolved credential object is not valid"); + } + } +} +exports.SignatureV4 = SignatureV4; +const formatDate = (now) => { + const longDate = (0, utilDate_1.iso8601)(now).replace(/[\-:]/g, ""); + return { + longDate, + shortDate: longDate.slice(0, 8), + }; }; -exports.toEndpointV1 = toEndpointV1; +const getCanonicalHeaderList = (headers) => Object.keys(headers).sort().join(";"); /***/ }), -/***/ 72639: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 69098: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.endpointMiddleware = void 0; -const getEndpointFromInstructions_1 = __nccwpck_require__(62419); -const endpointMiddleware = ({ config, instructions, }) => { - return (next, context) => async (args) => { - var _a, _b; - const endpoint = await (0, getEndpointFromInstructions_1.getEndpointFromInstructions)(args.input, { - getEndpointParameterInstructions() { - return instructions; - }, - }, { ...config }, context); - context.endpointV2 = endpoint; - context.authSchemes = (_a = endpoint.properties) === null || _a === void 0 ? void 0 : _a.authSchemes; - const authScheme = (_b = context.authSchemes) === null || _b === void 0 ? void 0 : _b[0]; - if (authScheme) { - context["signing_region"] = authScheme.signingRegion; - context["signing_service"] = authScheme.signingName; - } - return next({ - ...args, - }); +exports.cloneQuery = exports.cloneRequest = void 0; +const cloneRequest = ({ headers, query, ...rest }) => ({ + ...rest, + headers: { ...headers }, + query: query ? (0, exports.cloneQuery)(query) : undefined, +}); +exports.cloneRequest = cloneRequest; +const cloneQuery = (query) => Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, }; +}, {}); +exports.cloneQuery = cloneQuery; + + +/***/ }), + +/***/ 48644: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.MAX_PRESIGNED_TTL = exports.KEY_TYPE_IDENTIFIER = exports.MAX_CACHE_SIZE = exports.UNSIGNED_PAYLOAD = exports.EVENT_ALGORITHM_IDENTIFIER = exports.ALGORITHM_IDENTIFIER_V4A = exports.ALGORITHM_IDENTIFIER = exports.UNSIGNABLE_PATTERNS = exports.SEC_HEADER_PATTERN = exports.PROXY_HEADER_PATTERN = exports.ALWAYS_UNSIGNABLE_HEADERS = exports.HOST_HEADER = exports.TOKEN_HEADER = exports.SHA256_HEADER = exports.SIGNATURE_HEADER = exports.GENERATED_HEADERS = exports.DATE_HEADER = exports.AMZ_DATE_HEADER = exports.AUTH_HEADER = exports.REGION_SET_PARAM = exports.TOKEN_QUERY_PARAM = exports.SIGNATURE_QUERY_PARAM = exports.EXPIRES_QUERY_PARAM = exports.SIGNED_HEADERS_QUERY_PARAM = exports.AMZ_DATE_QUERY_PARAM = exports.CREDENTIAL_QUERY_PARAM = exports.ALGORITHM_QUERY_PARAM = void 0; +exports.ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm"; +exports.CREDENTIAL_QUERY_PARAM = "X-Amz-Credential"; +exports.AMZ_DATE_QUERY_PARAM = "X-Amz-Date"; +exports.SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders"; +exports.EXPIRES_QUERY_PARAM = "X-Amz-Expires"; +exports.SIGNATURE_QUERY_PARAM = "X-Amz-Signature"; +exports.TOKEN_QUERY_PARAM = "X-Amz-Security-Token"; +exports.REGION_SET_PARAM = "X-Amz-Region-Set"; +exports.AUTH_HEADER = "authorization"; +exports.AMZ_DATE_HEADER = exports.AMZ_DATE_QUERY_PARAM.toLowerCase(); +exports.DATE_HEADER = "date"; +exports.GENERATED_HEADERS = [exports.AUTH_HEADER, exports.AMZ_DATE_HEADER, exports.DATE_HEADER]; +exports.SIGNATURE_HEADER = exports.SIGNATURE_QUERY_PARAM.toLowerCase(); +exports.SHA256_HEADER = "x-amz-content-sha256"; +exports.TOKEN_HEADER = exports.TOKEN_QUERY_PARAM.toLowerCase(); +exports.HOST_HEADER = "host"; +exports.ALWAYS_UNSIGNABLE_HEADERS = { + authorization: true, + "cache-control": true, + connection: true, + expect: true, + from: true, + "keep-alive": true, + "max-forwards": true, + pragma: true, + referer: true, + te: true, + trailer: true, + "transfer-encoding": true, + upgrade: true, + "user-agent": true, + "x-amzn-trace-id": true, }; -exports.endpointMiddleware = endpointMiddleware; +exports.PROXY_HEADER_PATTERN = /^proxy-/; +exports.SEC_HEADER_PATTERN = /^sec-/; +exports.UNSIGNABLE_PATTERNS = [/^proxy-/i, /^sec-/i]; +exports.ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256"; +exports.ALGORITHM_IDENTIFIER_V4A = "AWS4-ECDSA-P256-SHA256"; +exports.EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD"; +exports.UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD"; +exports.MAX_CACHE_SIZE = 50; +exports.KEY_TYPE_IDENTIFIER = "aws4_request"; +exports.MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7; /***/ }), -/***/ 37981: +/***/ 19623: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getEndpointPlugin = exports.endpointMiddlewareOptions = void 0; -const middleware_serde_1 = __nccwpck_require__(93631); -const endpointMiddleware_1 = __nccwpck_require__(72639); -exports.endpointMiddlewareOptions = { - step: "serialize", - tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], - name: "endpointV2Middleware", - override: true, - relation: "before", - toMiddleware: middleware_serde_1.serializerMiddlewareOption.name, +exports.clearCredentialCache = exports.getSigningKey = exports.createScope = void 0; +const util_hex_encoding_1 = __nccwpck_require__(45364); +const util_utf8_1 = __nccwpck_require__(41895); +const constants_1 = __nccwpck_require__(48644); +const signingKeyCache = {}; +const cacheQueue = []; +const createScope = (shortDate, region, service) => `${shortDate}/${region}/${service}/${constants_1.KEY_TYPE_IDENTIFIER}`; +exports.createScope = createScope; +const getSigningKey = async (sha256Constructor, credentials, shortDate, region, service) => { + const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId); + const cacheKey = `${shortDate}:${region}:${service}:${(0, util_hex_encoding_1.toHex)(credsHash)}:${credentials.sessionToken}`; + if (cacheKey in signingKeyCache) { + return signingKeyCache[cacheKey]; + } + cacheQueue.push(cacheKey); + while (cacheQueue.length > constants_1.MAX_CACHE_SIZE) { + delete signingKeyCache[cacheQueue.shift()]; + } + let key = `AWS4${credentials.secretAccessKey}`; + for (const signable of [shortDate, region, service, constants_1.KEY_TYPE_IDENTIFIER]) { + key = await hmac(sha256Constructor, key, signable); + } + return (signingKeyCache[cacheKey] = key); +}; +exports.getSigningKey = getSigningKey; +const clearCredentialCache = () => { + cacheQueue.length = 0; + Object.keys(signingKeyCache).forEach((cacheKey) => { + delete signingKeyCache[cacheKey]; + }); +}; +exports.clearCredentialCache = clearCredentialCache; +const hmac = (ctor, secret, data) => { + const hash = new ctor(secret); + hash.update((0, util_utf8_1.toUint8Array)(data)); + return hash.digest(); }; -const getEndpointPlugin = (config, instructions) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo((0, endpointMiddleware_1.endpointMiddleware)({ - config, - instructions, - }), exports.endpointMiddlewareOptions); - }, -}); -exports.getEndpointPlugin = getEndpointPlugin; /***/ }), -/***/ 5497: +/***/ 51393: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(50197), exports); -tslib_1.__exportStar(__nccwpck_require__(72639), exports); -tslib_1.__exportStar(__nccwpck_require__(37981), exports); -tslib_1.__exportStar(__nccwpck_require__(13157), exports); -tslib_1.__exportStar(__nccwpck_require__(32521), exports); +exports.getCanonicalHeaders = void 0; +const constants_1 = __nccwpck_require__(48644); +const getCanonicalHeaders = ({ headers }, unsignableHeaders, signableHeaders) => { + const canonical = {}; + for (const headerName of Object.keys(headers).sort()) { + if (headers[headerName] == undefined) { + continue; + } + const canonicalHeaderName = headerName.toLowerCase(); + if (canonicalHeaderName in constants_1.ALWAYS_UNSIGNABLE_HEADERS || + (unsignableHeaders === null || unsignableHeaders === void 0 ? void 0 : unsignableHeaders.has(canonicalHeaderName)) || + constants_1.PROXY_HEADER_PATTERN.test(canonicalHeaderName) || + constants_1.SEC_HEADER_PATTERN.test(canonicalHeaderName)) { + if (!signableHeaders || (signableHeaders && !signableHeaders.has(canonicalHeaderName))) { + continue; + } + } + canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " "); + } + return canonical; +}; +exports.getCanonicalHeaders = getCanonicalHeaders; /***/ }), -/***/ 13157: +/***/ 33243: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveEndpointConfig = void 0; -const util_middleware_1 = __nccwpck_require__(10236); -const toEndpointV1_1 = __nccwpck_require__(98289); -const resolveEndpointConfig = (input) => { - var _a, _b, _c; - const tls = (_a = input.tls) !== null && _a !== void 0 ? _a : true; - const { endpoint } = input; - const customEndpointProvider = endpoint != null ? async () => (0, toEndpointV1_1.toEndpointV1)(await (0, util_middleware_1.normalizeProvider)(endpoint)()) : undefined; - const isCustomEndpoint = !!endpoint; - return { - ...input, - endpoint: customEndpointProvider, - tls, - isCustomEndpoint, - useDualstackEndpoint: (0, util_middleware_1.normalizeProvider)((_b = input.useDualstackEndpoint) !== null && _b !== void 0 ? _b : false), - useFipsEndpoint: (0, util_middleware_1.normalizeProvider)((_c = input.useFipsEndpoint) !== null && _c !== void 0 ? _c : false), - }; +exports.getCanonicalQuery = void 0; +const util_uri_escape_1 = __nccwpck_require__(49617); +const constants_1 = __nccwpck_require__(48644); +const getCanonicalQuery = ({ query = {} }) => { + const keys = []; + const serialized = {}; + for (const key of Object.keys(query).sort()) { + if (key.toLowerCase() === constants_1.SIGNATURE_HEADER) { + continue; + } + keys.push(key); + const value = query[key]; + if (typeof value === "string") { + serialized[key] = `${(0, util_uri_escape_1.escapeUri)(key)}=${(0, util_uri_escape_1.escapeUri)(value)}`; + } + else if (Array.isArray(value)) { + serialized[key] = value + .slice(0) + .sort() + .reduce((encoded, value) => encoded.concat([`${(0, util_uri_escape_1.escapeUri)(key)}=${(0, util_uri_escape_1.escapeUri)(value)}`]), []) + .join("&"); + } + } + return keys + .map((key) => serialized[key]) + .filter((serialized) => serialized) + .join("&"); }; -exports.resolveEndpointConfig = resolveEndpointConfig; +exports.getCanonicalQuery = getCanonicalQuery; /***/ }), -/***/ 3589: +/***/ 48545: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(18648), exports); +exports.getPayloadHash = void 0; +const is_array_buffer_1 = __nccwpck_require__(10780); +const util_hex_encoding_1 = __nccwpck_require__(45364); +const util_utf8_1 = __nccwpck_require__(41895); +const constants_1 = __nccwpck_require__(48644); +const getPayloadHash = async ({ headers, body }, hashConstructor) => { + for (const headerName of Object.keys(headers)) { + if (headerName.toLowerCase() === constants_1.SHA256_HEADER) { + return headers[headerName]; + } + } + if (body == undefined) { + return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855"; + } + else if (typeof body === "string" || ArrayBuffer.isView(body) || (0, is_array_buffer_1.isArrayBuffer)(body)) { + const hashCtor = new hashConstructor(); + hashCtor.update((0, util_utf8_1.toUint8Array)(body)); + return (0, util_hex_encoding_1.toHex)(await hashCtor.digest()); + } + return constants_1.UNSIGNED_PAYLOAD; +}; +exports.getPayloadHash = getPayloadHash; /***/ }), -/***/ 18648: +/***/ 62179: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isArnBucketName = exports.isDnsCompatibleBucketName = exports.S3_HOSTNAME_PATTERN = exports.DOT_PATTERN = exports.resolveParamsForS3 = void 0; -const resolveParamsForS3 = async (endpointParams) => { - const bucket = (endpointParams === null || endpointParams === void 0 ? void 0 : endpointParams.Bucket) || ""; - if (typeof endpointParams.Bucket === "string") { - endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); - } - if ((0, exports.isArnBucketName)(bucket)) { - if (endpointParams.ForcePathStyle === true) { - throw new Error("Path-style addressing cannot be used with ARN buckets"); +exports.deleteHeader = exports.getHeaderValue = exports.hasHeader = void 0; +const hasHeader = (soughtHeader, headers) => { + soughtHeader = soughtHeader.toLowerCase(); + for (const headerName of Object.keys(headers)) { + if (soughtHeader === headerName.toLowerCase()) { + return true; } } - else if (!(0, exports.isDnsCompatibleBucketName)(bucket) || - (bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:")) || - bucket.toLowerCase() !== bucket || - bucket.length < 3) { - endpointParams.ForcePathStyle = true; - } - if (endpointParams.DisableMultiRegionAccessPoints) { - endpointParams.disableMultiRegionAccessPoints = true; - endpointParams.DisableMRAP = true; + return false; +}; +exports.hasHeader = hasHeader; +const getHeaderValue = (soughtHeader, headers) => { + soughtHeader = soughtHeader.toLowerCase(); + for (const headerName of Object.keys(headers)) { + if (soughtHeader === headerName.toLowerCase()) { + return headers[headerName]; + } } - return endpointParams; + return undefined; }; -exports.resolveParamsForS3 = resolveParamsForS3; -const DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; -const IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; -const DOTS_PATTERN = /\.\./; -exports.DOT_PATTERN = /\./; -exports.S3_HOSTNAME_PATTERN = /^(.+\.)?s3(-fips)?(\.dualstack)?[.-]([a-z0-9-]+)\./; -const isDnsCompatibleBucketName = (bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName); -exports.isDnsCompatibleBucketName = isDnsCompatibleBucketName; -const isArnBucketName = (bucketName) => { - const [arn, partition, service, region, account, typeOrId] = bucketName.split(":"); - const isArn = arn === "arn" && bucketName.split(":").length >= 6; - const isValidArn = [arn, partition, service, account, typeOrId].filter(Boolean).length === 5; - if (isArn && !isValidArn) { - throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); +exports.getHeaderValue = getHeaderValue; +const deleteHeader = (soughtHeader, headers) => { + soughtHeader = soughtHeader.toLowerCase(); + for (const headerName of Object.keys(headers)) { + if (soughtHeader === headerName.toLowerCase()) { + delete headers[headerName]; + } } - return arn === "arn" && !!partition && !!service && !!account && !!typeOrId; }; -exports.isArnBucketName = isArnBucketName; +exports.deleteHeader = deleteHeader; /***/ }), -/***/ 32521: -/***/ ((__unused_webpack_module, exports) => { +/***/ 11528: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.prepareRequest = exports.moveHeadersToQuery = exports.getPayloadHash = exports.getCanonicalQuery = exports.getCanonicalHeaders = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(39733), exports); +var getCanonicalHeaders_1 = __nccwpck_require__(51393); +Object.defineProperty(exports, "getCanonicalHeaders", ({ enumerable: true, get: function () { return getCanonicalHeaders_1.getCanonicalHeaders; } })); +var getCanonicalQuery_1 = __nccwpck_require__(33243); +Object.defineProperty(exports, "getCanonicalQuery", ({ enumerable: true, get: function () { return getCanonicalQuery_1.getCanonicalQuery; } })); +var getPayloadHash_1 = __nccwpck_require__(48545); +Object.defineProperty(exports, "getPayloadHash", ({ enumerable: true, get: function () { return getPayloadHash_1.getPayloadHash; } })); +var moveHeadersToQuery_1 = __nccwpck_require__(49828); +Object.defineProperty(exports, "moveHeadersToQuery", ({ enumerable: true, get: function () { return moveHeadersToQuery_1.moveHeadersToQuery; } })); +var prepareRequest_1 = __nccwpck_require__(60075); +Object.defineProperty(exports, "prepareRequest", ({ enumerable: true, get: function () { return prepareRequest_1.prepareRequest; } })); +tslib_1.__exportStar(__nccwpck_require__(19623), exports); /***/ }), -/***/ 22545: +/***/ 49828: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getHostHeaderPlugin = exports.hostHeaderMiddlewareOptions = exports.hostHeaderMiddleware = exports.resolveHostHeaderConfig = void 0; -const protocol_http_1 = __nccwpck_require__(70223); -function resolveHostHeaderConfig(input) { - return input; -} -exports.resolveHostHeaderConfig = resolveHostHeaderConfig; -const hostHeaderMiddleware = (options) => (next) => async (args) => { - if (!protocol_http_1.HttpRequest.isInstance(args.request)) - return next(args); - const { request } = args; - const { handlerProtocol = "" } = options.requestHandler.metadata || {}; - if (handlerProtocol.indexOf("h2") >= 0 && !request.headers[":authority"]) { - delete request.headers["host"]; - request.headers[":authority"] = ""; - } - else if (!request.headers["host"]) { - let host = request.hostname; - if (request.port != null) - host += `:${request.port}`; - request.headers["host"] = host; +exports.moveHeadersToQuery = void 0; +const cloneRequest_1 = __nccwpck_require__(69098); +const moveHeadersToQuery = (request, options = {}) => { + var _a; + const { headers, query = {} } = typeof request.clone === "function" ? request.clone() : (0, cloneRequest_1.cloneRequest)(request); + for (const name of Object.keys(headers)) { + const lname = name.toLowerCase(); + if (lname.slice(0, 6) === "x-amz-" && !((_a = options.unhoistableHeaders) === null || _a === void 0 ? void 0 : _a.has(lname))) { + query[name] = headers[name]; + delete headers[name]; + } } - return next(args); -}; -exports.hostHeaderMiddleware = hostHeaderMiddleware; -exports.hostHeaderMiddlewareOptions = { - name: "hostHeaderMiddleware", - step: "build", - priority: "low", - tags: ["HOST"], - override: true, + return { + ...request, + headers, + query, + }; }; -const getHostHeaderPlugin = (options) => ({ - applyToStack: (clientStack) => { - clientStack.add((0, exports.hostHeaderMiddleware)(options), exports.hostHeaderMiddlewareOptions); - }, -}); -exports.getHostHeaderPlugin = getHostHeaderPlugin; +exports.moveHeadersToQuery = moveHeadersToQuery; /***/ }), -/***/ 20014: +/***/ 60075: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(9754), exports); +exports.prepareRequest = void 0; +const cloneRequest_1 = __nccwpck_require__(69098); +const constants_1 = __nccwpck_require__(48644); +const prepareRequest = (request) => { + request = typeof request.clone === "function" ? request.clone() : (0, cloneRequest_1.cloneRequest)(request); + for (const headerName of Object.keys(request.headers)) { + if (constants_1.GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) { + delete request.headers[headerName]; + } + } + return request; +}; +exports.prepareRequest = prepareRequest; /***/ }), -/***/ 9754: +/***/ 39299: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getLoggerPlugin = exports.loggerMiddlewareOptions = exports.loggerMiddleware = void 0; -const loggerMiddleware = () => (next, context) => async (args) => { - var _a, _b; - try { - const response = await next(args); - const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; - const { overrideInputFilterSensitiveLog, overrideOutputFilterSensitiveLog } = dynamoDbDocumentClientOptions; - const inputFilterSensitiveLog = overrideInputFilterSensitiveLog !== null && overrideInputFilterSensitiveLog !== void 0 ? overrideInputFilterSensitiveLog : context.inputFilterSensitiveLog; - const outputFilterSensitiveLog = overrideOutputFilterSensitiveLog !== null && overrideOutputFilterSensitiveLog !== void 0 ? overrideOutputFilterSensitiveLog : context.outputFilterSensitiveLog; - const { $metadata, ...outputWithoutMetadata } = response.output; - (_a = logger === null || logger === void 0 ? void 0 : logger.info) === null || _a === void 0 ? void 0 : _a.call(logger, { - clientName, - commandName, - input: inputFilterSensitiveLog(args.input), - output: outputFilterSensitiveLog(outputWithoutMetadata), - metadata: $metadata, - }); - return response; +exports.toDate = exports.iso8601 = void 0; +const iso8601 = (time) => (0, exports.toDate)(time) + .toISOString() + .replace(/\.\d{3}Z$/, "Z"); +exports.iso8601 = iso8601; +const toDate = (time) => { + if (typeof time === "number") { + return new Date(time * 1000); } - catch (error) { - const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; - const { overrideInputFilterSensitiveLog } = dynamoDbDocumentClientOptions; - const inputFilterSensitiveLog = overrideInputFilterSensitiveLog !== null && overrideInputFilterSensitiveLog !== void 0 ? overrideInputFilterSensitiveLog : context.inputFilterSensitiveLog; - (_b = logger === null || logger === void 0 ? void 0 : logger.error) === null || _b === void 0 ? void 0 : _b.call(logger, { - clientName, - commandName, - input: inputFilterSensitiveLog(args.input), - error, - metadata: error.$metadata, - }); - throw error; + if (typeof time === "string") { + if (Number(time)) { + return new Date(Number(time) * 1000); + } + return new Date(time); } + return time; }; -exports.loggerMiddleware = loggerMiddleware; -exports.loggerMiddlewareOptions = { - name: "loggerMiddleware", - tags: ["LOGGER"], - step: "initialize", - override: true, -}; -const getLoggerPlugin = (options) => ({ - applyToStack: (clientStack) => { - clientStack.add((0, exports.loggerMiddleware)(), exports.loggerMiddlewareOptions); - }, -}); -exports.getLoggerPlugin = getLoggerPlugin; +exports.toDate = toDate; /***/ }), -/***/ 85525: +/***/ 39674: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRecursionDetectionPlugin = exports.addRecursionDetectionMiddlewareOptions = exports.recursionDetectionMiddleware = void 0; -const protocol_http_1 = __nccwpck_require__(70223); -const TRACE_ID_HEADER_NAME = "X-Amzn-Trace-Id"; -const ENV_LAMBDA_FUNCTION_NAME = "AWS_LAMBDA_FUNCTION_NAME"; -const ENV_TRACE_ID = "_X_AMZN_TRACE_ID"; -const recursionDetectionMiddleware = (options) => (next) => async (args) => { - const { request } = args; - if (!protocol_http_1.HttpRequest.isInstance(request) || - options.runtime !== "node" || - request.headers.hasOwnProperty(TRACE_ID_HEADER_NAME)) { - return next(args); - } - const functionName = process.env[ENV_LAMBDA_FUNCTION_NAME]; - const traceId = process.env[ENV_TRACE_ID]; - const nonEmptyString = (str) => typeof str === "string" && str.length > 0; - if (nonEmptyString(functionName) && nonEmptyString(traceId)) { - request.headers[TRACE_ID_HEADER_NAME] = traceId; - } - return next({ - ...args, - request, - }); -}; -exports.recursionDetectionMiddleware = recursionDetectionMiddleware; -exports.addRecursionDetectionMiddlewareOptions = { - step: "build", - tags: ["RECURSION_DETECTION"], - name: "recursionDetectionMiddleware", - override: true, - priority: "low", -}; -const getRecursionDetectionPlugin = (options) => ({ - applyToStack: (clientStack) => { - clientStack.add((0, exports.recursionDetectionMiddleware)(options), exports.addRecursionDetectionMiddlewareOptions); - }, -}); -exports.getRecursionDetectionPlugin = getRecursionDetectionPlugin; +exports.escapeUriPath = void 0; +const escape_uri_1 = __nccwpck_require__(49312); +const escapeUriPath = (uri) => uri.split("/").map(escape_uri_1.escapeUri).join("/"); +exports.escapeUriPath = escapeUriPath; /***/ }), -/***/ 47328: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 49312: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.AdaptiveRetryStrategy = void 0; -const util_retry_1 = __nccwpck_require__(99395); -const StandardRetryStrategy_1 = __nccwpck_require__(533); -class AdaptiveRetryStrategy extends StandardRetryStrategy_1.StandardRetryStrategy { - constructor(maxAttemptsProvider, options) { - const { rateLimiter, ...superOptions } = options !== null && options !== void 0 ? options : {}; - super(maxAttemptsProvider, superOptions); - this.rateLimiter = rateLimiter !== null && rateLimiter !== void 0 ? rateLimiter : new util_retry_1.DefaultRateLimiter(); - this.mode = util_retry_1.RETRY_MODES.ADAPTIVE; - } - async retry(next, args) { - return super.retry(next, args, { - beforeRequest: async () => { - return this.rateLimiter.getSendToken(); - }, - afterRequest: (response) => { - this.rateLimiter.updateClientSendingRate(response); - }, - }); - } -} -exports.AdaptiveRetryStrategy = AdaptiveRetryStrategy; +exports.escapeUri = void 0; +const escapeUri = (uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode); +exports.escapeUri = escapeUri; +const hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`; /***/ }), -/***/ 533: +/***/ 49617: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.StandardRetryStrategy = void 0; -const protocol_http_1 = __nccwpck_require__(70223); -const service_error_classification_1 = __nccwpck_require__(61921); -const util_retry_1 = __nccwpck_require__(99395); -const uuid_1 = __nccwpck_require__(75840); -const defaultRetryQuota_1 = __nccwpck_require__(12568); -const delayDecider_1 = __nccwpck_require__(55940); -const retryDecider_1 = __nccwpck_require__(19572); -const util_1 = __nccwpck_require__(17154); -class StandardRetryStrategy { - constructor(maxAttemptsProvider, options) { - var _a, _b, _c; - this.maxAttemptsProvider = maxAttemptsProvider; - this.mode = util_retry_1.RETRY_MODES.STANDARD; - this.retryDecider = (_a = options === null || options === void 0 ? void 0 : options.retryDecider) !== null && _a !== void 0 ? _a : retryDecider_1.defaultRetryDecider; - this.delayDecider = (_b = options === null || options === void 0 ? void 0 : options.delayDecider) !== null && _b !== void 0 ? _b : delayDecider_1.defaultDelayDecider; - this.retryQuota = (_c = options === null || options === void 0 ? void 0 : options.retryQuota) !== null && _c !== void 0 ? _c : (0, defaultRetryQuota_1.getDefaultRetryQuota)(util_retry_1.INITIAL_RETRY_TOKENS); - } - shouldRetry(error, attempts, maxAttempts) { - return attempts < maxAttempts && this.retryDecider(error) && this.retryQuota.hasRetryTokens(error); - } - async getMaxAttempts() { - let maxAttempts; - try { - maxAttempts = await this.maxAttemptsProvider(); - } - catch (error) { - maxAttempts = util_retry_1.DEFAULT_MAX_ATTEMPTS; - } - return maxAttempts; - } - async retry(next, args, options) { - let retryTokenAmount; - let attempts = 0; - let totalDelay = 0; - const maxAttempts = await this.getMaxAttempts(); - const { request } = args; - if (protocol_http_1.HttpRequest.isInstance(request)) { - request.headers[util_retry_1.INVOCATION_ID_HEADER] = (0, uuid_1.v4)(); - } - while (true) { - try { - if (protocol_http_1.HttpRequest.isInstance(request)) { - request.headers[util_retry_1.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; - } - if (options === null || options === void 0 ? void 0 : options.beforeRequest) { - await options.beforeRequest(); - } - const { response, output } = await next(args); - if (options === null || options === void 0 ? void 0 : options.afterRequest) { - options.afterRequest(response); - } - this.retryQuota.releaseRetryTokens(retryTokenAmount); - output.$metadata.attempts = attempts + 1; - output.$metadata.totalRetryDelay = totalDelay; - return { response, output }; - } - catch (e) { - const err = (0, util_1.asSdkError)(e); - attempts++; - if (this.shouldRetry(err, attempts, maxAttempts)) { - retryTokenAmount = this.retryQuota.retrieveRetryTokens(err); - const delayFromDecider = this.delayDecider((0, service_error_classification_1.isThrottlingError)(err) ? util_retry_1.THROTTLING_RETRY_DELAY_BASE : util_retry_1.DEFAULT_RETRY_DELAY_BASE, attempts); - const delayFromResponse = getDelayFromRetryAfterHeader(err.$response); - const delay = Math.max(delayFromResponse || 0, delayFromDecider); - totalDelay += delay; - await new Promise((resolve) => setTimeout(resolve, delay)); - continue; - } - if (!err.$metadata) { - err.$metadata = {}; - } - err.$metadata.attempts = attempts; - err.$metadata.totalRetryDelay = totalDelay; - throw err; - } - } - } -} -exports.StandardRetryStrategy = StandardRetryStrategy; -const getDelayFromRetryAfterHeader = (response) => { - if (!protocol_http_1.HttpResponse.isInstance(response)) - return; - const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); - if (!retryAfterHeaderName) - return; - const retryAfter = response.headers[retryAfterHeaderName]; - const retryAfterSeconds = Number(retryAfter); - if (!Number.isNaN(retryAfterSeconds)) - return retryAfterSeconds * 1000; - const retryAfterDate = new Date(retryAfter); - return retryAfterDate.getTime() - Date.now(); -}; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(49312), exports); +tslib_1.__exportStar(__nccwpck_require__(39674), exports); /***/ }), -/***/ 76160: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NODE_RETRY_MODE_CONFIG_OPTIONS = exports.CONFIG_RETRY_MODE = exports.ENV_RETRY_MODE = exports.resolveRetryConfig = exports.NODE_MAX_ATTEMPT_CONFIG_OPTIONS = exports.CONFIG_MAX_ATTEMPTS = exports.ENV_MAX_ATTEMPTS = void 0; -const util_middleware_1 = __nccwpck_require__(10236); -const util_retry_1 = __nccwpck_require__(99395); -exports.ENV_MAX_ATTEMPTS = "AWS_MAX_ATTEMPTS"; -exports.CONFIG_MAX_ATTEMPTS = "max_attempts"; -exports.NODE_MAX_ATTEMPT_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => { - const value = env[exports.ENV_MAX_ATTEMPTS]; - if (!value) - return undefined; - const maxAttempt = parseInt(value); - if (Number.isNaN(maxAttempt)) { - throw new Error(`Environment variable ${exports.ENV_MAX_ATTEMPTS} mast be a number, got "${value}"`); - } - return maxAttempt; - }, - configFileSelector: (profile) => { - const value = profile[exports.CONFIG_MAX_ATTEMPTS]; - if (!value) - return undefined; - const maxAttempt = parseInt(value); - if (Number.isNaN(maxAttempt)) { - throw new Error(`Shared config file entry ${exports.CONFIG_MAX_ATTEMPTS} mast be a number, got "${value}"`); - } - return maxAttempt; - }, - default: util_retry_1.DEFAULT_MAX_ATTEMPTS, -}; -const resolveRetryConfig = (input) => { - var _a; - const { retryStrategy } = input; - const maxAttempts = (0, util_middleware_1.normalizeProvider)((_a = input.maxAttempts) !== null && _a !== void 0 ? _a : util_retry_1.DEFAULT_MAX_ATTEMPTS); - return { - ...input, - maxAttempts, - retryStrategy: async () => { - if (retryStrategy) { - return retryStrategy; - } - const retryMode = await (0, util_middleware_1.normalizeProvider)(input.retryMode)(); - if (retryMode === util_retry_1.RETRY_MODES.ADAPTIVE) { - return new util_retry_1.AdaptiveRetryStrategy(maxAttempts); - } - return new util_retry_1.StandardRetryStrategy(maxAttempts); - }, - }; -}; -exports.resolveRetryConfig = resolveRetryConfig; -exports.ENV_RETRY_MODE = "AWS_RETRY_MODE"; -exports.CONFIG_RETRY_MODE = "retry_mode"; -exports.NODE_RETRY_MODE_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => env[exports.ENV_RETRY_MODE], - configFileSelector: (profile) => profile[exports.CONFIG_RETRY_MODE], - default: util_retry_1.DEFAULT_RETRY_MODE, -}; +/***/ 70438: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NoOpLogger = void 0; +class NoOpLogger { + trace() { } + debug() { } + info() { } + warn() { } + error() { } +} +exports.NoOpLogger = NoOpLogger; /***/ }), -/***/ 12568: +/***/ 61600: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getDefaultRetryQuota = void 0; -const util_retry_1 = __nccwpck_require__(99395); -const getDefaultRetryQuota = (initialRetryTokens, options) => { - var _a, _b, _c; - const MAX_CAPACITY = initialRetryTokens; - const noRetryIncrement = (_a = options === null || options === void 0 ? void 0 : options.noRetryIncrement) !== null && _a !== void 0 ? _a : util_retry_1.NO_RETRY_INCREMENT; - const retryCost = (_b = options === null || options === void 0 ? void 0 : options.retryCost) !== null && _b !== void 0 ? _b : util_retry_1.RETRY_COST; - const timeoutRetryCost = (_c = options === null || options === void 0 ? void 0 : options.timeoutRetryCost) !== null && _c !== void 0 ? _c : util_retry_1.TIMEOUT_RETRY_COST; - let availableCapacity = initialRetryTokens; - const getCapacityAmount = (error) => (error.name === "TimeoutError" ? timeoutRetryCost : retryCost); - const hasRetryTokens = (error) => getCapacityAmount(error) <= availableCapacity; - const retrieveRetryTokens = (error) => { - if (!hasRetryTokens(error)) { - throw new Error("No retry token available"); +exports.Client = void 0; +const middleware_stack_1 = __nccwpck_require__(97911); +class Client { + constructor(config) { + this.middlewareStack = (0, middleware_stack_1.constructStack)(); + this.config = config; + } + send(command, optionsOrCb, cb) { + const options = typeof optionsOrCb !== "function" ? optionsOrCb : undefined; + const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb; + const handler = command.resolveMiddleware(this.middlewareStack, this.config, options); + if (callback) { + handler(command) + .then((result) => callback(null, result.output), (err) => callback(err)) + .catch(() => { }); } - const capacityAmount = getCapacityAmount(error); - availableCapacity -= capacityAmount; - return capacityAmount; - }; - const releaseRetryTokens = (capacityReleaseAmount) => { - availableCapacity += capacityReleaseAmount !== null && capacityReleaseAmount !== void 0 ? capacityReleaseAmount : noRetryIncrement; - availableCapacity = Math.min(availableCapacity, MAX_CAPACITY); - }; - return Object.freeze({ - hasRetryTokens, - retrieveRetryTokens, - releaseRetryTokens, - }); -}; -exports.getDefaultRetryQuota = getDefaultRetryQuota; + else { + return handler(command).then((result) => result.output); + } + } + destroy() { + if (this.config.requestHandler.destroy) + this.config.requestHandler.destroy(); + } +} +exports.Client = Client; /***/ }), -/***/ 55940: +/***/ 32813: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultDelayDecider = void 0; -const util_retry_1 = __nccwpck_require__(99395); -const defaultDelayDecider = (delayBase, attempts) => Math.floor(Math.min(util_retry_1.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); -exports.defaultDelayDecider = defaultDelayDecider; +exports.collectBody = void 0; +const util_stream_1 = __nccwpck_require__(96607); +const collectBody = async (streamBody = new Uint8Array(), context) => { + if (streamBody instanceof Uint8Array) { + return util_stream_1.Uint8ArrayBlobAdapter.mutate(streamBody); + } + if (!streamBody) { + return util_stream_1.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); + } + const fromContext = context.streamCollector(streamBody); + return util_stream_1.Uint8ArrayBlobAdapter.mutate(await fromContext); +}; +exports.collectBody = collectBody; /***/ }), -/***/ 96064: +/***/ 75414: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(47328), exports); -tslib_1.__exportStar(__nccwpck_require__(533), exports); -tslib_1.__exportStar(__nccwpck_require__(76160), exports); -tslib_1.__exportStar(__nccwpck_require__(55940), exports); -tslib_1.__exportStar(__nccwpck_require__(43521), exports); -tslib_1.__exportStar(__nccwpck_require__(19572), exports); -tslib_1.__exportStar(__nccwpck_require__(11806), exports); +exports.Command = void 0; +const middleware_stack_1 = __nccwpck_require__(97911); +class Command { + constructor() { + this.middlewareStack = (0, middleware_stack_1.constructStack)(); + } +} +exports.Command = Command; /***/ }), -/***/ 43521: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 92541: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getOmitRetryHeadersPlugin = exports.omitRetryHeadersMiddlewareOptions = exports.omitRetryHeadersMiddleware = void 0; -const protocol_http_1 = __nccwpck_require__(70223); -const util_retry_1 = __nccwpck_require__(99395); -const omitRetryHeadersMiddleware = () => (next) => async (args) => { - const { request } = args; - if (protocol_http_1.HttpRequest.isInstance(request)) { - delete request.headers[util_retry_1.INVOCATION_ID_HEADER]; - delete request.headers[util_retry_1.REQUEST_HEADER]; - } - return next(args); -}; -exports.omitRetryHeadersMiddleware = omitRetryHeadersMiddleware; -exports.omitRetryHeadersMiddlewareOptions = { - name: "omitRetryHeadersMiddleware", - tags: ["RETRY", "HEADERS", "OMIT_RETRY_HEADERS"], - relation: "before", - toMiddleware: "awsAuthMiddleware", - override: true, -}; -const getOmitRetryHeadersPlugin = (options) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo((0, exports.omitRetryHeadersMiddleware)(), exports.omitRetryHeadersMiddlewareOptions); - }, -}); -exports.getOmitRetryHeadersPlugin = getOmitRetryHeadersPlugin; +exports.SENSITIVE_STRING = void 0; +exports.SENSITIVE_STRING = "***SensitiveInformation***"; /***/ }), -/***/ 19572: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 56929: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultRetryDecider = void 0; -const service_error_classification_1 = __nccwpck_require__(61921); -const defaultRetryDecider = (error) => { - if (!error) { - return false; +exports.createAggregatedClient = void 0; +const createAggregatedClient = (commands, Client) => { + for (const command of Object.keys(commands)) { + const CommandCtor = commands[command]; + const methodImpl = async function (args, optionsOrCb, cb) { + const command = new CommandCtor(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expected http options but got ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + }; + const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, ""); + Client.prototype[methodName] = methodImpl; } - return (0, service_error_classification_1.isRetryableByTrait)(error) || (0, service_error_classification_1.isClockSkewError)(error) || (0, service_error_classification_1.isThrottlingError)(error) || (0, service_error_classification_1.isTransientError)(error); }; -exports.defaultRetryDecider = defaultRetryDecider; +exports.createAggregatedClient = createAggregatedClient; /***/ }), -/***/ 11806: +/***/ 21737: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRetryAfterHint = exports.getRetryPlugin = exports.retryMiddlewareOptions = exports.retryMiddleware = void 0; -const protocol_http_1 = __nccwpck_require__(70223); -const service_error_classification_1 = __nccwpck_require__(61921); -const util_retry_1 = __nccwpck_require__(99395); -const uuid_1 = __nccwpck_require__(75840); -const util_1 = __nccwpck_require__(17154); -const retryMiddleware = (options) => (next, context) => async (args) => { - let retryStrategy = await options.retryStrategy(); - const maxAttempts = await options.maxAttempts(); - if (isRetryStrategyV2(retryStrategy)) { - retryStrategy = retryStrategy; - let retryToken = await retryStrategy.acquireInitialRetryToken(context["partition_id"]); - let lastError = new Error(); - let attempts = 0; - let totalRetryDelay = 0; - const { request } = args; - if (protocol_http_1.HttpRequest.isInstance(request)) { - request.headers[util_retry_1.INVOCATION_ID_HEADER] = (0, uuid_1.v4)(); - } - while (true) { - try { - if (protocol_http_1.HttpRequest.isInstance(request)) { - request.headers[util_retry_1.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; - } - const { response, output } = await next(args); - retryStrategy.recordSuccess(retryToken); - output.$metadata.attempts = attempts + 1; - output.$metadata.totalRetryDelay = totalRetryDelay; - return { response, output }; - } - catch (e) { - const retryErrorInfo = getRetryErrorInfo(e); - lastError = (0, util_1.asSdkError)(e); - try { - retryToken = await retryStrategy.refreshRetryTokenForRetry(retryToken, retryErrorInfo); - } - catch (refreshError) { - if (!lastError.$metadata) { - lastError.$metadata = {}; - } - lastError.$metadata.attempts = attempts + 1; - lastError.$metadata.totalRetryDelay = totalRetryDelay; - throw lastError; - } - attempts = retryToken.getRetryCount(); - const delay = retryToken.getRetryDelay(); - totalRetryDelay += delay; - await new Promise((resolve) => setTimeout(resolve, delay)); - } - } +exports.parseEpochTimestamp = exports.parseRfc7231DateTime = exports.parseRfc3339DateTimeWithOffset = exports.parseRfc3339DateTime = exports.dateToUtcString = void 0; +const parse_utils_1 = __nccwpck_require__(74857); +const DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; +const MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; +function dateToUtcString(date) { + const year = date.getUTCFullYear(); + const month = date.getUTCMonth(); + const dayOfWeek = date.getUTCDay(); + const dayOfMonthInt = date.getUTCDate(); + const hoursInt = date.getUTCHours(); + const minutesInt = date.getUTCMinutes(); + const secondsInt = date.getUTCSeconds(); + const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; + const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; + const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; + const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; + return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; +} +exports.dateToUtcString = dateToUtcString; +const RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); +const parseRfc3339DateTime = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; + const year = (0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); +}; +exports.parseRfc3339DateTime = parseRfc3339DateTime; +const RFC3339_WITH_OFFSET = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/); +const parseRfc3339DateTimeWithOffset = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339_WITH_OFFSET.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; + const year = (0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); + if (offsetStr.toUpperCase() != "Z") { + date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); + } + return date; +}; +exports.parseRfc3339DateTimeWithOffset = parseRfc3339DateTimeWithOffset; +const IMF_FIXDATE = new RegExp(/^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/); +const RFC_850_DATE = new RegExp(/^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/); +const ASC_TIME = new RegExp(/^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/); +const parseRfc7231DateTime = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value !== "string") { + throw new TypeError("RFC-7231 date-times must be expressed as strings"); + } + let match = IMF_FIXDATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return buildDate((0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { hours, minutes, seconds, fractionalMilliseconds }); + } + match = RFC_850_DATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return adjustRfc850Year(buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { + hours, + minutes, + seconds, + fractionalMilliseconds, + })); + } + match = ASC_TIME.exec(value); + if (match) { + const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; + return buildDate((0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)), parseMonthByShortName(monthStr), parseDateValue(dayStr.trimLeft(), "day", 1, 31), { hours, minutes, seconds, fractionalMilliseconds }); + } + throw new TypeError("Invalid RFC-7231 date-time value"); +}; +exports.parseRfc7231DateTime = parseRfc7231DateTime; +const parseEpochTimestamp = (value) => { + if (value === null || value === undefined) { + return undefined; + } + let valueAsDouble; + if (typeof value === "number") { + valueAsDouble = value; + } + else if (typeof value === "string") { + valueAsDouble = (0, parse_utils_1.strictParseDouble)(value); } else { - retryStrategy = retryStrategy; - if (retryStrategy === null || retryStrategy === void 0 ? void 0 : retryStrategy.mode) - context.userAgent = [...(context.userAgent || []), ["cfg/retry-mode", retryStrategy.mode]]; - return retryStrategy.retry(next, args); + throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); + } + if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { + throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); } + return new Date(Math.round(valueAsDouble * 1000)); }; -exports.retryMiddleware = retryMiddleware; -const isRetryStrategyV2 = (retryStrategy) => typeof retryStrategy.acquireInitialRetryToken !== "undefined" && - typeof retryStrategy.refreshRetryTokenForRetry !== "undefined" && - typeof retryStrategy.recordSuccess !== "undefined"; -const getRetryErrorInfo = (error) => { - const errorInfo = { - errorType: getRetryErrorType(error), - }; - const retryAfterHint = (0, exports.getRetryAfterHint)(error.$response); - if (retryAfterHint) { - errorInfo.retryAfterHint = retryAfterHint; +exports.parseEpochTimestamp = parseEpochTimestamp; +const buildDate = (year, month, day, time) => { + const adjustedMonth = month - 1; + validateDayOfMonth(year, adjustedMonth, day); + return new Date(Date.UTC(year, adjustedMonth, day, parseDateValue(time.hours, "hour", 0, 23), parseDateValue(time.minutes, "minute", 0, 59), parseDateValue(time.seconds, "seconds", 0, 60), parseMilliseconds(time.fractionalMilliseconds))); +}; +const parseTwoDigitYear = (value) => { + const thisYear = new Date().getUTCFullYear(); + const valueInThisCentury = Math.floor(thisYear / 100) * 100 + (0, parse_utils_1.strictParseShort)(stripLeadingZeroes(value)); + if (valueInThisCentury < thisYear) { + return valueInThisCentury + 100; } - return errorInfo; + return valueInThisCentury; }; -const getRetryErrorType = (error) => { - if ((0, service_error_classification_1.isThrottlingError)(error)) - return "THROTTLING"; - if ((0, service_error_classification_1.isTransientError)(error)) - return "TRANSIENT"; - if ((0, service_error_classification_1.isServerError)(error)) - return "SERVER_ERROR"; - return "CLIENT_ERROR"; +const FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1000; +const adjustRfc850Year = (input) => { + if (input.getTime() - new Date().getTime() > FIFTY_YEARS_IN_MILLIS) { + return new Date(Date.UTC(input.getUTCFullYear() - 100, input.getUTCMonth(), input.getUTCDate(), input.getUTCHours(), input.getUTCMinutes(), input.getUTCSeconds(), input.getUTCMilliseconds())); + } + return input; }; -exports.retryMiddlewareOptions = { - name: "retryMiddleware", - tags: ["RETRY"], - step: "finalizeRequest", - priority: "high", - override: true, +const parseMonthByShortName = (value) => { + const monthIdx = MONTHS.indexOf(value); + if (monthIdx < 0) { + throw new TypeError(`Invalid month: ${value}`); + } + return monthIdx + 1; }; -const getRetryPlugin = (options) => ({ - applyToStack: (clientStack) => { - clientStack.add((0, exports.retryMiddleware)(options), exports.retryMiddlewareOptions); - }, -}); -exports.getRetryPlugin = getRetryPlugin; -const getRetryAfterHint = (response) => { - if (!protocol_http_1.HttpResponse.isInstance(response)) - return; - const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); - if (!retryAfterHeaderName) - return; - const retryAfter = response.headers[retryAfterHeaderName]; - const retryAfterSeconds = Number(retryAfter); - if (!Number.isNaN(retryAfterSeconds)) - return new Date(retryAfterSeconds * 1000); - const retryAfterDate = new Date(retryAfter); - return retryAfterDate; +const DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; +const validateDayOfMonth = (year, month, day) => { + let maxDays = DAYS_IN_MONTH[month]; + if (month === 1 && isLeapYear(year)) { + maxDays = 29; + } + if (day > maxDays) { + throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); + } }; -exports.getRetryAfterHint = getRetryAfterHint; - - -/***/ }), - -/***/ 17154: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.asSdkError = void 0; -const asSdkError = (error) => { - if (error instanceof Error) - return error; - if (error instanceof Object) - return Object.assign(new Error(), error); - if (typeof error === "string") - return new Error(error); - return new Error(`AWS SDK error wrapper for ${error}`); +const isLeapYear = (year) => { + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); +}; +const parseDateValue = (value, type, lower, upper) => { + const dateVal = (0, parse_utils_1.strictParseByte)(stripLeadingZeroes(value)); + if (dateVal < lower || dateVal > upper) { + throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); + } + return dateVal; +}; +const parseMilliseconds = (value) => { + if (value === null || value === undefined) { + return 0; + } + return (0, parse_utils_1.strictParseFloat32)("0." + value) * 1000; +}; +const parseOffsetToMilliseconds = (value) => { + const directionStr = value[0]; + let direction = 1; + if (directionStr == "+") { + direction = 1; + } + else if (directionStr == "-") { + direction = -1; + } + else { + throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); + } + const hour = Number(value.substring(1, 3)); + const minute = Number(value.substring(4, 6)); + return direction * (hour * 60 + minute) * 60 * 1000; +}; +const stripLeadingZeroes = (value) => { + let idx = 0; + while (idx < value.length - 1 && value.charAt(idx) === "0") { + idx++; + } + if (idx === 0) { + return value; + } + return value.slice(idx); }; -exports.asSdkError = asSdkError; /***/ }), -/***/ 55959: +/***/ 9681: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveStsAuthConfig = void 0; -const middleware_signing_1 = __nccwpck_require__(14935); -const resolveStsAuthConfig = (input, { stsClientCtor }) => (0, middleware_signing_1.resolveAwsAuthConfig)({ - ...input, - stsClientCtor, -}); -exports.resolveStsAuthConfig = resolveStsAuthConfig; +exports.withBaseException = exports.throwDefaultError = void 0; +const exceptions_1 = __nccwpck_require__(88074); +const throwDefaultError = ({ output, parsedBody, exceptionCtor, errorCode }) => { + const $metadata = deserializeMetadata(output); + const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : undefined; + const response = new exceptionCtor({ + name: (parsedBody === null || parsedBody === void 0 ? void 0 : parsedBody.code) || (parsedBody === null || parsedBody === void 0 ? void 0 : parsedBody.Code) || errorCode || statusCode || "UnknownError", + $fault: "client", + $metadata, + }); + throw (0, exceptions_1.decorateServiceException)(response, parsedBody); +}; +exports.throwDefaultError = throwDefaultError; +const withBaseException = (ExceptionCtor) => { + return ({ output, parsedBody, errorCode }) => { + (0, exports.throwDefaultError)({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode }); + }; +}; +exports.withBaseException = withBaseException; +const deserializeMetadata = (output) => { + var _a, _b; + return ({ + httpStatusCode: output.statusCode, + requestId: (_b = (_a = output.headers["x-amzn-requestid"]) !== null && _a !== void 0 ? _a : output.headers["x-amzn-request-id"]) !== null && _b !== void 0 ? _b : output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"], + }); +}; /***/ }), -/***/ 65648: +/***/ 11163: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.deserializerMiddleware = void 0; -const deserializerMiddleware = (options, deserializer) => (next, context) => async (args) => { - const { response } = await next(args); - try { - const parsed = await deserializer(response, options); - return { - response, - output: parsed, - }; - } - catch (error) { - Object.defineProperty(error, "$response", { - value: response, - }); - if (!('$metadata' in error)) { - const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; - error.message += "\n " + hint; - } - throw error; +exports.loadConfigsForDefaultMode = void 0; +const loadConfigsForDefaultMode = (mode) => { + switch (mode) { + case "standard": + return { + retryMode: "standard", + connectionTimeout: 3100, + }; + case "in-region": + return { + retryMode: "standard", + connectionTimeout: 1100, + }; + case "cross-region": + return { + retryMode: "standard", + connectionTimeout: 3100, + }; + case "mobile": + return { + retryMode: "standard", + connectionTimeout: 30000, + }; + default: + return {}; } }; -exports.deserializerMiddleware = deserializerMiddleware; +exports.loadConfigsForDefaultMode = loadConfigsForDefaultMode; /***/ }), -/***/ 93631: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 91809: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(65648), exports); -tslib_1.__exportStar(__nccwpck_require__(99328), exports); -tslib_1.__exportStar(__nccwpck_require__(19511), exports); +exports.emitWarningIfUnsupportedVersion = void 0; +let warningEmitted = false; +const emitWarningIfUnsupportedVersion = (version) => { + if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 14) { + warningEmitted = true; + } +}; +exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion; /***/ }), -/***/ 99328: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 88074: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSerdePlugin = exports.serializerMiddlewareOption = exports.deserializerMiddlewareOption = void 0; -const deserializerMiddleware_1 = __nccwpck_require__(65648); -const serializerMiddleware_1 = __nccwpck_require__(19511); -exports.deserializerMiddlewareOption = { - name: "deserializerMiddleware", - step: "deserialize", - tags: ["DESERIALIZER"], - override: true, -}; -exports.serializerMiddlewareOption = { - name: "serializerMiddleware", - step: "serialize", - tags: ["SERIALIZER"], - override: true, -}; -function getSerdePlugin(config, serializer, deserializer) { - return { - applyToStack: (commandStack) => { - commandStack.add((0, deserializerMiddleware_1.deserializerMiddleware)(config, deserializer), exports.deserializerMiddlewareOption); - commandStack.add((0, serializerMiddleware_1.serializerMiddleware)(config, serializer), exports.serializerMiddlewareOption); - }, - }; +exports.decorateServiceException = exports.ServiceException = void 0; +class ServiceException extends Error { + constructor(options) { + super(options.message); + Object.setPrototypeOf(this, ServiceException.prototype); + this.name = options.name; + this.$fault = options.$fault; + this.$metadata = options.$metadata; + } } -exports.getSerdePlugin = getSerdePlugin; +exports.ServiceException = ServiceException; +const decorateServiceException = (exception, additions = {}) => { + Object.entries(additions) + .filter(([, v]) => v !== undefined) + .forEach(([k, v]) => { + if (exception[k] == undefined || exception[k] === "") { + exception[k] = v; + } + }); + const message = exception.message || exception.Message || "UnknownError"; + exception.message = message; + delete exception.Message; + return exception; +}; +exports.decorateServiceException = decorateServiceException; /***/ }), -/***/ 19511: +/***/ 76016: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.serializerMiddleware = void 0; -const serializerMiddleware = (options, serializer) => (next, context) => async (args) => { - var _a; - const endpoint = ((_a = context.endpointV2) === null || _a === void 0 ? void 0 : _a.url) && options.urlParser - ? async () => options.urlParser(context.endpointV2.url) - : options.endpoint; - if (!endpoint) { - throw new Error("No valid endpoint provider available."); - } - const request = await serializer(args.input, { ...options, endpoint }); - return next({ - ...args, - request, +exports.extendedEncodeURIComponent = void 0; +function extendedEncodeURIComponent(str) { + return encodeURIComponent(str).replace(/[!'()*]/g, function (c) { + return "%" + c.charCodeAt(0).toString(16).toUpperCase(); }); -}; -exports.serializerMiddleware = serializerMiddleware; +} +exports.extendedEncodeURIComponent = extendedEncodeURIComponent; /***/ }), -/***/ 84193: +/***/ 30941: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveSigV4AuthConfig = exports.resolveAwsAuthConfig = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const signature_v4_1 = __nccwpck_require__(37776); -const util_middleware_1 = __nccwpck_require__(10236); -const CREDENTIAL_EXPIRE_WINDOW = 300000; -const resolveAwsAuthConfig = (input) => { - const normalizedCreds = input.credentials - ? normalizeCredentialProvider(input.credentials) - : input.credentialDefaultProvider(input); - const { signingEscapePath = true, systemClockOffset = input.systemClockOffset || 0, sha256 } = input; - let signer; - if (input.signer) { - signer = (0, util_middleware_1.normalizeProvider)(input.signer); - } - else if (input.regionInfoProvider) { - signer = () => (0, util_middleware_1.normalizeProvider)(input.region)() - .then(async (region) => [ - (await input.regionInfoProvider(region, { - useFipsEndpoint: await input.useFipsEndpoint(), - useDualstackEndpoint: await input.useDualstackEndpoint(), - })) || {}, - region, - ]) - .then(([regionInfo, region]) => { - const { signingRegion, signingService } = regionInfo; - input.signingRegion = input.signingRegion || signingRegion || region; - input.signingName = input.signingName || signingService || input.serviceId; - const params = { - ...input, - credentials: normalizedCreds, - region: input.signingRegion, - service: input.signingName, - sha256, - uriEscapePath: signingEscapePath, - }; - const SignerCtor = input.signerConstructor || signature_v4_1.SignatureV4; - return new SignerCtor(params); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +const types_1 = __nccwpck_require__(49185); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return types_1.AlgorithmId; } })); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + for (const id in types_1.AlgorithmId) { + const algorithmId = types_1.AlgorithmId[id]; + if (runtimeConfig[algorithmId] === undefined) { + continue; + } + checksumAlgorithms.push({ + algorithmId: () => algorithmId, + checksumConstructor: () => runtimeConfig[algorithmId], }); } - else { - signer = async (authScheme) => { - authScheme = Object.assign({}, { - name: "sigv4", - signingName: input.signingName || input.defaultSigningName, - signingRegion: await (0, util_middleware_1.normalizeProvider)(input.region)(), - properties: {}, - }, authScheme); - const signingRegion = authScheme.signingRegion; - const signingService = authScheme.signingName; - input.signingRegion = input.signingRegion || signingRegion; - input.signingName = input.signingName || signingService || input.serviceId; - const params = { - ...input, - credentials: normalizedCreds, - region: input.signingRegion, - service: input.signingName, - sha256, - uriEscapePath: signingEscapePath, - }; - const SignerCtor = input.signerConstructor || signature_v4_1.SignatureV4; - return new SignerCtor(params); - }; - } - return { - ...input, - systemClockOffset, - signingEscapePath, - credentials: normalizedCreds, - signer, - }; -}; -exports.resolveAwsAuthConfig = resolveAwsAuthConfig; -const resolveSigV4AuthConfig = (input) => { - const normalizedCreds = input.credentials - ? normalizeCredentialProvider(input.credentials) - : input.credentialDefaultProvider(input); - const { signingEscapePath = true, systemClockOffset = input.systemClockOffset || 0, sha256 } = input; - let signer; - if (input.signer) { - signer = (0, util_middleware_1.normalizeProvider)(input.signer); - } - else { - signer = (0, util_middleware_1.normalizeProvider)(new signature_v4_1.SignatureV4({ - credentials: normalizedCreds, - region: input.region, - service: input.signingName, - sha256, - uriEscapePath: signingEscapePath, - })); - } return { - ...input, - systemClockOffset, - signingEscapePath, - credentials: normalizedCreds, - signer, + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, }; }; -exports.resolveSigV4AuthConfig = resolveSigV4AuthConfig; -const normalizeCredentialProvider = (credentials) => { - if (typeof credentials === "function") { - return (0, property_provider_1.memoize)(credentials, (credentials) => credentials.expiration !== undefined && - credentials.expiration.getTime() - Date.now() < CREDENTIAL_EXPIRE_WINDOW, (credentials) => credentials.expiration !== undefined); - } - return (0, util_middleware_1.normalizeProvider)(credentials); +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; }; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; /***/ }), -/***/ 88053: +/***/ 78643: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSigV4AuthPlugin = exports.getAwsAuthPlugin = exports.awsAuthMiddlewareOptions = exports.awsAuthMiddleware = void 0; -const protocol_http_1 = __nccwpck_require__(70223); -const getSkewCorrectedDate_1 = __nccwpck_require__(68253); -const getUpdatedSystemClockOffset_1 = __nccwpck_require__(35863); -const awsAuthMiddleware = (options) => (next, context) => async function (args) { - var _a, _b, _c, _d; - if (!protocol_http_1.HttpRequest.isInstance(args.request)) - return next(args); - const authScheme = (_c = (_b = (_a = context.endpointV2) === null || _a === void 0 ? void 0 : _a.properties) === null || _b === void 0 ? void 0 : _b.authSchemes) === null || _c === void 0 ? void 0 : _c[0]; - const multiRegionOverride = (authScheme === null || authScheme === void 0 ? void 0 : authScheme.name) === "sigv4a" ? (_d = authScheme === null || authScheme === void 0 ? void 0 : authScheme.signingRegionSet) === null || _d === void 0 ? void 0 : _d.join(",") : undefined; - const signer = await options.signer(authScheme); - const output = await next({ - ...args, - request: await signer.sign(args.request, { - signingDate: (0, getSkewCorrectedDate_1.getSkewCorrectedDate)(options.systemClockOffset), - signingRegion: multiRegionOverride || context["signing_region"], - signingService: context["signing_service"], - }), - }).catch((error) => { - var _a; - const serverTime = (_a = error.ServerTime) !== null && _a !== void 0 ? _a : getDateHeader(error.$response); - if (serverTime) { - options.systemClockOffset = (0, getUpdatedSystemClockOffset_1.getUpdatedSystemClockOffset)(serverTime, options.systemClockOffset); - } - throw error; - }); - const dateHeader = getDateHeader(output.response); - if (dateHeader) { - options.systemClockOffset = (0, getUpdatedSystemClockOffset_1.getUpdatedSystemClockOffset)(dateHeader, options.systemClockOffset); - } - return output; +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = exports.getDefaultExtensionConfiguration = void 0; +const checksum_1 = __nccwpck_require__(30941); +const retry_1 = __nccwpck_require__(67367); +const getDefaultExtensionConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + ...(0, retry_1.getRetryConfiguration)(runtimeConfig), + }; }; -exports.awsAuthMiddleware = awsAuthMiddleware; -const getDateHeader = (response) => { var _a, _b, _c; return protocol_http_1.HttpResponse.isInstance(response) ? (_b = (_a = response.headers) === null || _a === void 0 ? void 0 : _a.date) !== null && _b !== void 0 ? _b : (_c = response.headers) === null || _c === void 0 ? void 0 : _c.Date : undefined; }; -exports.awsAuthMiddlewareOptions = { - name: "awsAuthMiddleware", - tags: ["SIGNATURE", "AWSAUTH"], - relation: "after", - toMiddleware: "retryMiddleware", - override: true, +exports.getDefaultExtensionConfiguration = getDefaultExtensionConfiguration; +exports.getDefaultClientConfiguration = exports.getDefaultExtensionConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + ...(0, retry_1.resolveRetryRuntimeConfig)(config), + }; }; -const getAwsAuthPlugin = (options) => ({ - applyToStack: (clientStack) => { - clientStack.addRelativeTo((0, exports.awsAuthMiddleware)(options), exports.awsAuthMiddlewareOptions); - }, -}); -exports.getAwsAuthPlugin = getAwsAuthPlugin; -exports.getSigV4AuthPlugin = exports.getAwsAuthPlugin; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; /***/ }), -/***/ 14935: +/***/ 1822: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(84193), exports); -tslib_1.__exportStar(__nccwpck_require__(88053), exports); +tslib_1.__exportStar(__nccwpck_require__(78643), exports); /***/ }), -/***/ 68253: +/***/ 67367: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSkewCorrectedDate = void 0; -const getSkewCorrectedDate = (systemClockOffset) => new Date(Date.now() + systemClockOffset); -exports.getSkewCorrectedDate = getSkewCorrectedDate; - - -/***/ }), - -/***/ 35863: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getUpdatedSystemClockOffset = void 0; -const isClockSkewed_1 = __nccwpck_require__(85301); -const getUpdatedSystemClockOffset = (clockTime, currentSystemClockOffset) => { - const clockTimeInMs = Date.parse(clockTime); - if ((0, isClockSkewed_1.isClockSkewed)(clockTimeInMs, currentSystemClockOffset)) { - return clockTimeInMs - Date.now(); - } - return currentSystemClockOffset; +exports.resolveRetryRuntimeConfig = exports.getRetryConfiguration = void 0; +const getRetryConfiguration = (runtimeConfig) => { + let _retryStrategy = runtimeConfig.retryStrategy; + return { + setRetryStrategy(retryStrategy) { + _retryStrategy = retryStrategy; + }, + retryStrategy() { + return _retryStrategy; + }, + }; }; -exports.getUpdatedSystemClockOffset = getUpdatedSystemClockOffset; +exports.getRetryConfiguration = getRetryConfiguration; +const resolveRetryRuntimeConfig = (retryStrategyConfiguration) => { + const runtimeConfig = {}; + runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy(); + return runtimeConfig; +}; +exports.resolveRetryRuntimeConfig = resolveRetryRuntimeConfig; /***/ }), -/***/ 85301: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 42638: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isClockSkewed = void 0; -const getSkewCorrectedDate_1 = __nccwpck_require__(68253); -const isClockSkewed = (clockTime, systemClockOffset) => Math.abs((0, getSkewCorrectedDate_1.getSkewCorrectedDate)(systemClockOffset).getTime() - clockTime) >= 300000; -exports.isClockSkewed = isClockSkewed; +exports.getArrayIfSingleItem = void 0; +const getArrayIfSingleItem = (mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray]; +exports.getArrayIfSingleItem = getArrayIfSingleItem; /***/ }), -/***/ 38399: +/***/ 92188: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.constructStack = void 0; -const constructStack = () => { - let absoluteEntries = []; - let relativeEntries = []; - const entriesNameSet = new Set(); - const sort = (entries) => entries.sort((a, b) => stepWeights[b.step] - stepWeights[a.step] || - priorityWeights[b.priority || "normal"] - priorityWeights[a.priority || "normal"]); - const removeByName = (toRemove) => { - let isRemoved = false; - const filterCb = (entry) => { - if (entry.name && entry.name === toRemove) { - isRemoved = true; - entriesNameSet.delete(toRemove); - return false; - } - return true; - }; - absoluteEntries = absoluteEntries.filter(filterCb); - relativeEntries = relativeEntries.filter(filterCb); - return isRemoved; - }; - const removeByReference = (toRemove) => { - let isRemoved = false; - const filterCb = (entry) => { - if (entry.middleware === toRemove) { - isRemoved = true; - if (entry.name) - entriesNameSet.delete(entry.name); - return false; - } - return true; - }; - absoluteEntries = absoluteEntries.filter(filterCb); - relativeEntries = relativeEntries.filter(filterCb); - return isRemoved; - }; - const cloneTo = (toStack) => { - absoluteEntries.forEach((entry) => { - toStack.add(entry.middleware, { ...entry }); - }); - relativeEntries.forEach((entry) => { - toStack.addRelativeTo(entry.middleware, { ...entry }); - }); - return toStack; - }; - const expandRelativeMiddlewareList = (from) => { - const expandedMiddlewareList = []; - from.before.forEach((entry) => { - if (entry.before.length === 0 && entry.after.length === 0) { - expandedMiddlewareList.push(entry); - } - else { - expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); - } - }); - expandedMiddlewareList.push(from); - from.after.reverse().forEach((entry) => { - if (entry.before.length === 0 && entry.after.length === 0) { - expandedMiddlewareList.push(entry); - } - else { - expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); - } - }); - return expandedMiddlewareList; - }; - const getMiddlewareList = (debug = false) => { - const normalizedAbsoluteEntries = []; - const normalizedRelativeEntries = []; - const normalizedEntriesNameMap = {}; - absoluteEntries.forEach((entry) => { - const normalizedEntry = { - ...entry, - before: [], - after: [], - }; - if (normalizedEntry.name) - normalizedEntriesNameMap[normalizedEntry.name] = normalizedEntry; - normalizedAbsoluteEntries.push(normalizedEntry); - }); - relativeEntries.forEach((entry) => { - const normalizedEntry = { - ...entry, - before: [], - after: [], - }; - if (normalizedEntry.name) - normalizedEntriesNameMap[normalizedEntry.name] = normalizedEntry; - normalizedRelativeEntries.push(normalizedEntry); - }); - normalizedRelativeEntries.forEach((entry) => { - if (entry.toMiddleware) { - const toMiddleware = normalizedEntriesNameMap[entry.toMiddleware]; - if (toMiddleware === undefined) { - if (debug) { - return; - } - throw new Error(`${entry.toMiddleware} is not found when adding ${entry.name || "anonymous"} middleware ${entry.relation} ${entry.toMiddleware}`); - } - if (entry.relation === "after") { - toMiddleware.after.push(entry); - } - if (entry.relation === "before") { - toMiddleware.before.push(entry); - } - } - }); - const mainChain = sort(normalizedAbsoluteEntries) - .map(expandRelativeMiddlewareList) - .reduce((wholeList, expendedMiddlewareList) => { - wholeList.push(...expendedMiddlewareList); - return wholeList; - }, []); - return mainChain; - }; - const stack = { - add: (middleware, options = {}) => { - const { name, override } = options; - const entry = { - step: "initialize", - priority: "normal", - middleware, - ...options, - }; - if (name) { - if (entriesNameSet.has(name)) { - if (!override) - throw new Error(`Duplicate middleware name '${name}'`); - const toOverrideIndex = absoluteEntries.findIndex((entry) => entry.name === name); - const toOverride = absoluteEntries[toOverrideIndex]; - if (toOverride.step !== entry.step || toOverride.priority !== entry.priority) { - throw new Error(`"${name}" middleware with ${toOverride.priority} priority in ${toOverride.step} step cannot be ` + - `overridden by same-name middleware with ${entry.priority} priority in ${entry.step} step.`); - } - absoluteEntries.splice(toOverrideIndex, 1); - } - entriesNameSet.add(name); - } - absoluteEntries.push(entry); - }, - addRelativeTo: (middleware, options) => { - const { name, override } = options; - const entry = { - middleware, - ...options, - }; - if (name) { - if (entriesNameSet.has(name)) { - if (!override) - throw new Error(`Duplicate middleware name '${name}'`); - const toOverrideIndex = relativeEntries.findIndex((entry) => entry.name === name); - const toOverride = relativeEntries[toOverrideIndex]; - if (toOverride.toMiddleware !== entry.toMiddleware || toOverride.relation !== entry.relation) { - throw new Error(`"${name}" middleware ${toOverride.relation} "${toOverride.toMiddleware}" middleware cannot be overridden ` + - `by same-name middleware ${entry.relation} "${entry.toMiddleware}" middleware.`); - } - relativeEntries.splice(toOverrideIndex, 1); - } - entriesNameSet.add(name); - } - relativeEntries.push(entry); - }, - clone: () => cloneTo((0, exports.constructStack)()), - use: (plugin) => { - plugin.applyToStack(stack); - }, - remove: (toRemove) => { - if (typeof toRemove === "string") - return removeByName(toRemove); - else - return removeByReference(toRemove); - }, - removeByTag: (toRemove) => { - let isRemoved = false; - const filterCb = (entry) => { - const { tags, name } = entry; - if (tags && tags.includes(toRemove)) { - if (name) - entriesNameSet.delete(name); - isRemoved = true; - return false; - } - return true; - }; - absoluteEntries = absoluteEntries.filter(filterCb); - relativeEntries = relativeEntries.filter(filterCb); - return isRemoved; - }, - concat: (from) => { - const cloned = cloneTo((0, exports.constructStack)()); - cloned.use(from); - return cloned; - }, - applyToStack: cloneTo, - identify: () => { - return getMiddlewareList(true).map((mw) => { - return mw.name + ": " + (mw.tags || []).join(","); - }); - }, - resolve: (handler, context) => { - for (const middleware of getMiddlewareList() - .map((entry) => entry.middleware) - .reverse()) { - handler = middleware(handler, context); - } - return handler; - }, - }; - return stack; -}; -exports.constructStack = constructStack; -const stepWeights = { - initialize: 5, - serialize: 4, - build: 3, - finalizeRequest: 2, - deserialize: 1, -}; -const priorityWeights = { - high: 3, - normal: 2, - low: 1, +exports.getValueFromTextNode = void 0; +const getValueFromTextNode = (obj) => { + const textNodeName = "#text"; + for (const key in obj) { + if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== undefined) { + obj[key] = obj[key][textNodeName]; + } + else if (typeof obj[key] === "object" && obj[key] !== null) { + obj[key] = (0, exports.getValueFromTextNode)(obj[key]); + } + } + return obj; }; +exports.getValueFromTextNode = getValueFromTextNode; /***/ }), -/***/ 11461: +/***/ 63570: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(38399), exports); - - -/***/ }), - -/***/ 36546: +tslib_1.__exportStar(__nccwpck_require__(70438), exports); +tslib_1.__exportStar(__nccwpck_require__(61600), exports); +tslib_1.__exportStar(__nccwpck_require__(32813), exports); +tslib_1.__exportStar(__nccwpck_require__(75414), exports); +tslib_1.__exportStar(__nccwpck_require__(92541), exports); +tslib_1.__exportStar(__nccwpck_require__(56929), exports); +tslib_1.__exportStar(__nccwpck_require__(21737), exports); +tslib_1.__exportStar(__nccwpck_require__(9681), exports); +tslib_1.__exportStar(__nccwpck_require__(11163), exports); +tslib_1.__exportStar(__nccwpck_require__(91809), exports); +tslib_1.__exportStar(__nccwpck_require__(1822), exports); +tslib_1.__exportStar(__nccwpck_require__(88074), exports); +tslib_1.__exportStar(__nccwpck_require__(76016), exports); +tslib_1.__exportStar(__nccwpck_require__(42638), exports); +tslib_1.__exportStar(__nccwpck_require__(92188), exports); +tslib_1.__exportStar(__nccwpck_require__(32964), exports); +tslib_1.__exportStar(__nccwpck_require__(83495), exports); +tslib_1.__exportStar(__nccwpck_require__(74857), exports); +tslib_1.__exportStar(__nccwpck_require__(15342), exports); +tslib_1.__exportStar(__nccwpck_require__(59796), exports); +tslib_1.__exportStar(__nccwpck_require__(1752), exports); +tslib_1.__exportStar(__nccwpck_require__(92480), exports); + + +/***/ }), + +/***/ 32964: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveUserAgentConfig = void 0; -function resolveUserAgentConfig(input) { - return { - ...input, - customUserAgent: typeof input.customUserAgent === "string" ? [[input.customUserAgent]] : input.customUserAgent, - }; +exports.LazyJsonString = exports.StringWrapper = void 0; +const StringWrapper = function () { + const Class = Object.getPrototypeOf(this).constructor; + const Constructor = Function.bind.apply(String, [null, ...arguments]); + const instance = new Constructor(); + Object.setPrototypeOf(instance, Class.prototype); + return instance; +}; +exports.StringWrapper = StringWrapper; +exports.StringWrapper.prototype = Object.create(String.prototype, { + constructor: { + value: exports.StringWrapper, + enumerable: false, + writable: true, + configurable: true, + }, +}); +Object.setPrototypeOf(exports.StringWrapper, String); +class LazyJsonString extends exports.StringWrapper { + deserializeJSON() { + return JSON.parse(super.toString()); + } + toJSON() { + return super.toString(); + } + static fromObject(object) { + if (object instanceof LazyJsonString) { + return object; + } + else if (object instanceof String || typeof object === "string") { + return new LazyJsonString(object); + } + return new LazyJsonString(JSON.stringify(object)); + } } -exports.resolveUserAgentConfig = resolveUserAgentConfig; +exports.LazyJsonString = LazyJsonString; /***/ }), -/***/ 28025: +/***/ 83495: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.UA_ESCAPE_CHAR = exports.UA_VALUE_ESCAPE_REGEX = exports.UA_NAME_ESCAPE_REGEX = exports.UA_NAME_SEPARATOR = exports.SPACE = exports.X_AMZ_USER_AGENT = exports.USER_AGENT = void 0; -exports.USER_AGENT = "user-agent"; -exports.X_AMZ_USER_AGENT = "x-amz-user-agent"; -exports.SPACE = " "; -exports.UA_NAME_SEPARATOR = "/"; -exports.UA_NAME_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w]/g; -exports.UA_VALUE_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w\#]/g; -exports.UA_ESCAPE_CHAR = "-"; +exports.take = exports.convertMap = exports.map = void 0; +function map(arg0, arg1, arg2) { + let target; + let filter; + let instructions; + if (typeof arg1 === "undefined" && typeof arg2 === "undefined") { + target = {}; + instructions = arg0; + } + else { + target = arg0; + if (typeof arg1 === "function") { + filter = arg1; + instructions = arg2; + return mapWithFilter(target, filter, instructions); + } + else { + instructions = arg1; + } + } + for (const key of Object.keys(instructions)) { + if (!Array.isArray(instructions[key])) { + target[key] = instructions[key]; + continue; + } + applyInstruction(target, null, instructions, key); + } + return target; +} +exports.map = map; +const convertMap = (target) => { + const output = {}; + for (const [k, v] of Object.entries(target || {})) { + output[k] = [, v]; + } + return output; +}; +exports.convertMap = convertMap; +const take = (source, instructions) => { + const out = {}; + for (const key in instructions) { + applyInstruction(out, source, instructions, key); + } + return out; +}; +exports.take = take; +const mapWithFilter = (target, filter, instructions) => { + return map(target, Object.entries(instructions).reduce((_instructions, [key, value]) => { + if (Array.isArray(value)) { + _instructions[key] = value; + } + else { + if (typeof value === "function") { + _instructions[key] = [filter, value()]; + } + else { + _instructions[key] = [filter, value]; + } + } + return _instructions; + }, {})); +}; +const applyInstruction = (target, source, instructions, targetKey) => { + if (source !== null) { + let instruction = instructions[targetKey]; + if (typeof instruction === "function") { + instruction = [, instruction]; + } + const [filter = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction; + if ((typeof filter === "function" && filter(source[sourceKey])) || (typeof filter !== "function" && !!filter)) { + target[targetKey] = valueFn(source[sourceKey]); + } + return; + } + let [filter, value] = instructions[targetKey]; + if (typeof value === "function") { + let _value; + const defaultFilterPassed = filter === undefined && (_value = value()) != null; + const customFilterPassed = (typeof filter === "function" && !!filter(void 0)) || (typeof filter !== "function" && !!filter); + if (defaultFilterPassed) { + target[targetKey] = _value; + } + else if (customFilterPassed) { + target[targetKey] = value(); + } + } + else { + const defaultFilterPassed = filter === undefined && value != null; + const customFilterPassed = (typeof filter === "function" && !!filter(value)) || (typeof filter !== "function" && !!filter); + if (defaultFilterPassed || customFilterPassed) { + target[targetKey] = value; + } + } +}; +const nonNullish = (_) => _ != null; +const pass = (_) => _; /***/ }), -/***/ 64688: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 74857: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(36546), exports); -tslib_1.__exportStar(__nccwpck_require__(76236), exports); +exports.logger = exports.strictParseByte = exports.strictParseShort = exports.strictParseInt32 = exports.strictParseInt = exports.strictParseLong = exports.limitedParseFloat32 = exports.limitedParseFloat = exports.handleFloat = exports.limitedParseDouble = exports.strictParseFloat32 = exports.strictParseFloat = exports.strictParseDouble = exports.expectUnion = exports.expectString = exports.expectObject = exports.expectNonNull = exports.expectByte = exports.expectShort = exports.expectInt32 = exports.expectInt = exports.expectLong = exports.expectFloat32 = exports.expectNumber = exports.expectBoolean = exports.parseBoolean = void 0; +const parseBoolean = (value) => { + switch (value) { + case "true": + return true; + case "false": + return false; + default: + throw new Error(`Unable to parse boolean value "${value}"`); + } +}; +exports.parseBoolean = parseBoolean; +const expectBoolean = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value === "number") { + if (value === 0 || value === 1) { + exports.logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (value === 0) { + return false; + } + if (value === 1) { + return true; + } + } + if (typeof value === "string") { + const lower = value.toLowerCase(); + if (lower === "false" || lower === "true") { + exports.logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (lower === "false") { + return false; + } + if (lower === "true") { + return true; + } + } + if (typeof value === "boolean") { + return value; + } + throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); +}; +exports.expectBoolean = expectBoolean; +const expectNumber = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value === "string") { + const parsed = parseFloat(value); + if (!Number.isNaN(parsed)) { + if (String(parsed) !== String(value)) { + exports.logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); + } + return parsed; + } + } + if (typeof value === "number") { + return value; + } + throw new TypeError(`Expected number, got ${typeof value}: ${value}`); +}; +exports.expectNumber = expectNumber; +const MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); +const expectFloat32 = (value) => { + const expected = (0, exports.expectNumber)(value); + if (expected !== undefined && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { + if (Math.abs(expected) > MAX_FLOAT) { + throw new TypeError(`Expected 32-bit float, got ${value}`); + } + } + return expected; +}; +exports.expectFloat32 = expectFloat32; +const expectLong = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (Number.isInteger(value) && !Number.isNaN(value)) { + return value; + } + throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); +}; +exports.expectLong = expectLong; +exports.expectInt = exports.expectLong; +const expectInt32 = (value) => expectSizedInt(value, 32); +exports.expectInt32 = expectInt32; +const expectShort = (value) => expectSizedInt(value, 16); +exports.expectShort = expectShort; +const expectByte = (value) => expectSizedInt(value, 8); +exports.expectByte = expectByte; +const expectSizedInt = (value, size) => { + const expected = (0, exports.expectLong)(value); + if (expected !== undefined && castInt(expected, size) !== expected) { + throw new TypeError(`Expected ${size}-bit integer, got ${value}`); + } + return expected; +}; +const castInt = (value, size) => { + switch (size) { + case 32: + return Int32Array.of(value)[0]; + case 16: + return Int16Array.of(value)[0]; + case 8: + return Int8Array.of(value)[0]; + } +}; +const expectNonNull = (value, location) => { + if (value === null || value === undefined) { + if (location) { + throw new TypeError(`Expected a non-null value for ${location}`); + } + throw new TypeError("Expected a non-null value"); + } + return value; +}; +exports.expectNonNull = expectNonNull; +const expectObject = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value === "object" && !Array.isArray(value)) { + return value; + } + const receivedType = Array.isArray(value) ? "array" : typeof value; + throw new TypeError(`Expected object, got ${receivedType}: ${value}`); +}; +exports.expectObject = expectObject; +const expectString = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value === "string") { + return value; + } + if (["boolean", "number", "bigint"].includes(typeof value)) { + exports.logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); + return String(value); + } + throw new TypeError(`Expected string, got ${typeof value}: ${value}`); +}; +exports.expectString = expectString; +const expectUnion = (value) => { + if (value === null || value === undefined) { + return undefined; + } + const asObject = (0, exports.expectObject)(value); + const setKeys = Object.entries(asObject) + .filter(([, v]) => v != null) + .map(([k]) => k); + if (setKeys.length === 0) { + throw new TypeError(`Unions must have exactly one non-null member. None were found.`); + } + if (setKeys.length > 1) { + throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); + } + return asObject; +}; +exports.expectUnion = expectUnion; +const strictParseDouble = (value) => { + if (typeof value == "string") { + return (0, exports.expectNumber)(parseNumber(value)); + } + return (0, exports.expectNumber)(value); +}; +exports.strictParseDouble = strictParseDouble; +exports.strictParseFloat = exports.strictParseDouble; +const strictParseFloat32 = (value) => { + if (typeof value == "string") { + return (0, exports.expectFloat32)(parseNumber(value)); + } + return (0, exports.expectFloat32)(value); +}; +exports.strictParseFloat32 = strictParseFloat32; +const NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; +const parseNumber = (value) => { + const matches = value.match(NUMBER_REGEX); + if (matches === null || matches[0].length !== value.length) { + throw new TypeError(`Expected real number, got implicit NaN`); + } + return parseFloat(value); +}; +const limitedParseDouble = (value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return (0, exports.expectNumber)(value); +}; +exports.limitedParseDouble = limitedParseDouble; +exports.handleFloat = exports.limitedParseDouble; +exports.limitedParseFloat = exports.limitedParseDouble; +const limitedParseFloat32 = (value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return (0, exports.expectFloat32)(value); +}; +exports.limitedParseFloat32 = limitedParseFloat32; +const parseFloatString = (value) => { + switch (value) { + case "NaN": + return NaN; + case "Infinity": + return Infinity; + case "-Infinity": + return -Infinity; + default: + throw new Error(`Unable to parse float value: ${value}`); + } +}; +const strictParseLong = (value) => { + if (typeof value === "string") { + return (0, exports.expectLong)(parseNumber(value)); + } + return (0, exports.expectLong)(value); +}; +exports.strictParseLong = strictParseLong; +exports.strictParseInt = exports.strictParseLong; +const strictParseInt32 = (value) => { + if (typeof value === "string") { + return (0, exports.expectInt32)(parseNumber(value)); + } + return (0, exports.expectInt32)(value); +}; +exports.strictParseInt32 = strictParseInt32; +const strictParseShort = (value) => { + if (typeof value === "string") { + return (0, exports.expectShort)(parseNumber(value)); + } + return (0, exports.expectShort)(value); +}; +exports.strictParseShort = strictParseShort; +const strictParseByte = (value) => { + if (typeof value === "string") { + return (0, exports.expectByte)(parseNumber(value)); + } + return (0, exports.expectByte)(value); +}; +exports.strictParseByte = strictParseByte; +const stackTraceWarning = (message) => { + return String(new TypeError(message).stack || message) + .split("\n") + .slice(0, 5) + .filter((s) => !s.includes("stackTraceWarning")) + .join("\n"); +}; +exports.logger = { + warn: console.warn, +}; /***/ }), -/***/ 76236: +/***/ 15342: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getUserAgentPlugin = exports.getUserAgentMiddlewareOptions = exports.userAgentMiddleware = void 0; -const protocol_http_1 = __nccwpck_require__(70223); -const util_endpoints_1 = __nccwpck_require__(13350); -const constants_1 = __nccwpck_require__(28025); -const userAgentMiddleware = (options) => (next, context) => async (args) => { - var _a, _b; - const { request } = args; - if (!protocol_http_1.HttpRequest.isInstance(request)) - return next(args); - const { headers } = request; - const userAgent = ((_a = context === null || context === void 0 ? void 0 : context.userAgent) === null || _a === void 0 ? void 0 : _a.map(escapeUserAgent)) || []; - const defaultUserAgent = (await options.defaultUserAgentProvider()).map(escapeUserAgent); - const customUserAgent = ((_b = options === null || options === void 0 ? void 0 : options.customUserAgent) === null || _b === void 0 ? void 0 : _b.map(escapeUserAgent)) || []; - const prefix = (0, util_endpoints_1.getUserAgentPrefix)(); - const sdkUserAgentValue = (prefix ? [prefix] : []) - .concat([...defaultUserAgent, ...userAgent, ...customUserAgent]) - .join(constants_1.SPACE); - const normalUAValue = [ - ...defaultUserAgent.filter((section) => section.startsWith("aws-sdk-")), - ...customUserAgent, - ].join(constants_1.SPACE); - if (options.runtime !== "browser") { - if (normalUAValue) { - headers[constants_1.X_AMZ_USER_AGENT] = headers[constants_1.X_AMZ_USER_AGENT] - ? `${headers[constants_1.USER_AGENT]} ${normalUAValue}` - : normalUAValue; +exports.resolvedPath = void 0; +const extended_encode_uri_component_1 = __nccwpck_require__(76016); +const resolvedPath = (resolvedPath, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { + if (input != null && input[memberName] !== undefined) { + const labelValue = labelValueProvider(); + if (labelValue.length <= 0) { + throw new Error("Empty value provided for input HTTP label: " + memberName + "."); } - headers[constants_1.USER_AGENT] = sdkUserAgentValue; + resolvedPath = resolvedPath.replace(uriLabel, isGreedyLabel + ? labelValue + .split("/") + .map((segment) => (0, extended_encode_uri_component_1.extendedEncodeURIComponent)(segment)) + .join("/") + : (0, extended_encode_uri_component_1.extendedEncodeURIComponent)(labelValue)); } else { - headers[constants_1.X_AMZ_USER_AGENT] = sdkUserAgentValue; - } - return next({ - ...args, - request, - }); -}; -exports.userAgentMiddleware = userAgentMiddleware; -const escapeUserAgent = (userAgentPair) => { - var _a; - const name = userAgentPair[0] - .split(constants_1.UA_NAME_SEPARATOR) - .map((part) => part.replace(constants_1.UA_NAME_ESCAPE_REGEX, constants_1.UA_ESCAPE_CHAR)) - .join(constants_1.UA_NAME_SEPARATOR); - const version = (_a = userAgentPair[1]) === null || _a === void 0 ? void 0 : _a.replace(constants_1.UA_VALUE_ESCAPE_REGEX, constants_1.UA_ESCAPE_CHAR); - const prefixSeparatorIndex = name.indexOf(constants_1.UA_NAME_SEPARATOR); - const prefix = name.substring(0, prefixSeparatorIndex); - let uaName = name.substring(prefixSeparatorIndex + 1); - if (prefix === "api") { - uaName = uaName.toLowerCase(); + throw new Error("No value provided for input HTTP label: " + memberName + "."); } - return [prefix, uaName, version] - .filter((item) => item && item.length > 0) - .reduce((acc, item, index) => { - switch (index) { - case 0: - return item; - case 1: - return `${acc}/${item}`; - default: - return `${acc}#${item}`; - } - }, ""); -}; -exports.getUserAgentMiddlewareOptions = { - name: "getUserAgentMiddleware", - step: "build", - priority: "low", - tags: ["SET_USER_AGENT", "USER_AGENT"], - override: true, + return resolvedPath; }; -const getUserAgentPlugin = (config) => ({ - applyToStack: (clientStack) => { - clientStack.add((0, exports.userAgentMiddleware)(config), exports.getUserAgentMiddlewareOptions); - }, -}); -exports.getUserAgentPlugin = getUserAgentPlugin; +exports.resolvedPath = resolvedPath; /***/ }), -/***/ 52175: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 59796: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.loadConfig = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const fromEnv_1 = __nccwpck_require__(46161); -const fromSharedConfigFiles_1 = __nccwpck_require__(63905); -const fromStatic_1 = __nccwpck_require__(5881); -const loadConfig = ({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => (0, property_provider_1.memoize)((0, property_provider_1.chain)((0, fromEnv_1.fromEnv)(environmentVariableSelector), (0, fromSharedConfigFiles_1.fromSharedConfigFiles)(configFileSelector, configuration), (0, fromStatic_1.fromStatic)(defaultValue))); -exports.loadConfig = loadConfig; +exports.serializeFloat = void 0; +const serializeFloat = (value) => { + if (value !== value) { + return "NaN"; + } + switch (value) { + case Infinity: + return "Infinity"; + case -Infinity: + return "-Infinity"; + default: + return value; + } +}; +exports.serializeFloat = serializeFloat; /***/ }), -/***/ 46161: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 1752: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromEnv = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const fromEnv = (envVarSelector) => async () => { - try { - const config = envVarSelector(process.env); - if (config === undefined) { - throw new Error(); - } - return config; +exports._json = void 0; +const _json = (obj) => { + if (obj == null) { + return {}; } - catch (e) { - throw new property_provider_1.CredentialsProviderError(e.message || `Cannot load config from environment variables with getter: ${envVarSelector}`); + if (Array.isArray(obj)) { + return obj.filter((_) => _ != null); + } + if (typeof obj === "object") { + const target = {}; + for (const key of Object.keys(obj)) { + if (obj[key] == null) { + continue; + } + target[key] = (0, exports._json)(obj[key]); + } + return target; } + return obj; }; -exports.fromEnv = fromEnv; +exports._json = _json; /***/ }), -/***/ 63905: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 92480: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromSharedConfigFiles = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const shared_ini_file_loader_1 = __nccwpck_require__(67387); -const fromSharedConfigFiles = (configSelector, { preferredFile = "config", ...init } = {}) => async () => { - const profile = (0, shared_ini_file_loader_1.getProfileName)(init); - const { configFile, credentialsFile } = await (0, shared_ini_file_loader_1.loadSharedConfigFiles)(init); - const profileFromCredentials = credentialsFile[profile] || {}; - const profileFromConfig = configFile[profile] || {}; - const mergedProfile = preferredFile === "config" - ? { ...profileFromCredentials, ...profileFromConfig } - : { ...profileFromConfig, ...profileFromCredentials }; - try { - const configValue = configSelector(mergedProfile); - if (configValue === undefined) { - throw new Error(); +exports.splitEvery = void 0; +function splitEvery(value, delimiter, numDelimiters) { + if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { + throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); + } + const segments = value.split(delimiter); + if (numDelimiters === 1) { + return segments; + } + const compoundSegments = []; + let currentSegment = ""; + for (let i = 0; i < segments.length; i++) { + if (currentSegment === "") { + currentSegment = segments[i]; + } + else { + currentSegment += delimiter + segments[i]; + } + if ((i + 1) % numDelimiters === 0) { + compoundSegments.push(currentSegment); + currentSegment = ""; } - return configValue; } - catch (e) { - throw new property_provider_1.CredentialsProviderError(e.message || - `Cannot load config for profile ${profile} in SDK configuration files with getter: ${configSelector}`); + if (currentSegment !== "") { + compoundSegments.push(currentSegment); } -}; -exports.fromSharedConfigFiles = fromSharedConfigFiles; + return compoundSegments; +} +exports.splitEvery = splitEvery; /***/ }), -/***/ 5881: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 10301: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromStatic = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const isFunction = (func) => typeof func === "function"; -const fromStatic = (defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, property_provider_1.fromStatic)(defaultValue); -exports.fromStatic = fromStatic; /***/ }), -/***/ 87684: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 81401: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(52175), exports); +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); /***/ }), -/***/ 33647: +/***/ 74394: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NODEJS_TIMEOUT_ERROR_CODES = void 0; -exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; /***/ }), -/***/ 96225: +/***/ 67504: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getTransformedHeaders = void 0; -const getTransformedHeaders = (headers) => { - const transformedHeaders = {}; - for (const name of Object.keys(headers)) { - const headerValues = headers[name]; - transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; - } - return transformedHeaders; -}; -exports.getTransformedHeaders = getTransformedHeaders; /***/ }), -/***/ 68805: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 82511: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(2298), exports); -tslib_1.__exportStar(__nccwpck_require__(92533), exports); -tslib_1.__exportStar(__nccwpck_require__(72198), exports); /***/ }), -/***/ 2298: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 37651: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NodeHttpHandler = exports.DEFAULT_REQUEST_TIMEOUT = void 0; -const protocol_http_1 = __nccwpck_require__(70223); -const querystring_builder_1 = __nccwpck_require__(43402); -const http_1 = __nccwpck_require__(13685); -const https_1 = __nccwpck_require__(95687); -const constants_1 = __nccwpck_require__(33647); -const get_transformed_headers_1 = __nccwpck_require__(96225); -const set_connection_timeout_1 = __nccwpck_require__(63598); -const set_socket_keep_alive_1 = __nccwpck_require__(44035); -const set_socket_timeout_1 = __nccwpck_require__(44751); -const write_request_body_1 = __nccwpck_require__(5248); -exports.DEFAULT_REQUEST_TIMEOUT = 0; -class NodeHttpHandler { - constructor(options) { - this.metadata = { handlerProtocol: "http/1.1" }; - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options() - .then((_options) => { - resolve(this.resolveDefaultConfig(_options)); - }) - .catch(reject); - } - else { - resolve(this.resolveDefaultConfig(options)); - } - }); - } - resolveDefaultConfig(options) { - const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; - const keepAlive = true; - const maxSockets = 50; - return { - connectionTimeout, - requestTimeout: requestTimeout !== null && requestTimeout !== void 0 ? requestTimeout : socketTimeout, - httpAgent: httpAgent || new http_1.Agent({ keepAlive, maxSockets }), - httpsAgent: httpsAgent || new https_1.Agent({ keepAlive, maxSockets }), - }; - } - destroy() { - var _a, _b, _c, _d; - (_b = (_a = this.config) === null || _a === void 0 ? void 0 : _a.httpAgent) === null || _b === void 0 ? void 0 : _b.destroy(); - (_d = (_c = this.config) === null || _c === void 0 ? void 0 : _c.httpsAgent) === null || _d === void 0 ? void 0 : _d.destroy(); - } - async handle(request, { abortSignal } = {}) { - if (!this.config) { - this.config = await this.configProvider; - } - return new Promise((_resolve, _reject) => { - var _a, _b; - let writeRequestBodyPromise = undefined; - const resolve = async (arg) => { - await writeRequestBodyPromise; - _resolve(arg); - }; - const reject = async (arg) => { - await writeRequestBodyPromise; - _reject(arg); - }; - if (!this.config) { - throw new Error("Node HTTP request handler config is not resolved"); - } - if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const isSSL = request.protocol === "https:"; - const queryString = (0, querystring_builder_1.buildQueryString)(request.query || {}); - let auth = undefined; - if (request.username != null || request.password != null) { - const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; - const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; - auth = `${username}:${password}`; - } - let path = request.path; - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; - } - const nodeHttpsOptions = { - headers: request.headers, - host: request.hostname, - method: request.method, - path, - port: request.port, - agent: isSSL ? this.config.httpsAgent : this.config.httpAgent, - auth, - }; - const requestFunc = isSSL ? https_1.request : http_1.request; - const req = requestFunc(nodeHttpsOptions, (res) => { - const httpResponse = new protocol_http_1.HttpResponse({ - statusCode: res.statusCode || -1, - reason: res.statusMessage, - headers: (0, get_transformed_headers_1.getTransformedHeaders)(res.headers), - body: res, - }); - resolve({ response: httpResponse }); - }); - req.on("error", (err) => { - if (constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { - reject(Object.assign(err, { name: "TimeoutError" })); - } - else { - reject(err); - } - }); - (0, set_connection_timeout_1.setConnectionTimeout)(req, reject, this.config.connectionTimeout); - (0, set_socket_timeout_1.setSocketTimeout)(req, reject, this.config.requestTimeout); - if (abortSignal) { - abortSignal.onabort = () => { - req.abort(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - }; - } - const httpAgent = nodeHttpsOptions.agent; - if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { - (0, set_socket_keep_alive_1.setSocketKeepAlive)(req, { - keepAlive: httpAgent.keepAlive, - keepAliveMsecs: httpAgent.keepAliveMsecs, - }); - } - writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, this.config.requestTimeout).catch(_reject); - }); - } -} -exports.NodeHttpHandler = NodeHttpHandler; /***/ }), -/***/ 36675: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 3063: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NodeHttp2ConnectionManager = void 0; -const tslib_1 = __nccwpck_require__(4351); -const http2_1 = tslib_1.__importDefault(__nccwpck_require__(85158)); -const node_http2_connection_pool_1 = __nccwpck_require__(74368); -class NodeHttp2ConnectionManager { - constructor(config) { - this.sessionCache = new Map(); - this.config = config; - if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { - throw new RangeError("maxConcurrency must be greater than zero."); - } - } - lease(requestContext, connectionConfiguration) { - const url = this.getUrlString(requestContext); - const existingPool = this.sessionCache.get(url); - if (existingPool) { - const existingSession = existingPool.poll(); - if (existingSession && !this.config.disableConcurrency) { - return existingSession; - } - } - const session = http2_1.default.connect(url); - if (this.config.maxConcurrency) { - session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { - if (err) { - throw new Error("Fail to set maxConcurrentStreams to " + - this.config.maxConcurrency + - "when creating new session for " + - requestContext.destination.toString()); - } - }); - } - session.unref(); - const destroySessionCb = () => { - session.destroy(); - this.deleteSession(url, session); - }; - session.on("goaway", destroySessionCb); - session.on("error", destroySessionCb); - session.on("frameError", destroySessionCb); - session.on("close", () => this.deleteSession(url, session)); - if (connectionConfiguration.requestTimeout) { - session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); - } - const connectionPool = this.sessionCache.get(url) || new node_http2_connection_pool_1.NodeHttp2ConnectionPool(); - connectionPool.offerLast(session); - this.sessionCache.set(url, connectionPool); - return session; - } - deleteSession(authority, session) { - const existingConnectionPool = this.sessionCache.get(authority); - if (!existingConnectionPool) { - return; - } - if (!existingConnectionPool.contains(session)) { - return; - } - existingConnectionPool.remove(session); - this.sessionCache.set(authority, existingConnectionPool); - } - release(requestContext, session) { - var _a; - const cacheKey = this.getUrlString(requestContext); - (_a = this.sessionCache.get(cacheKey)) === null || _a === void 0 ? void 0 : _a.offerLast(session); - } - destroy() { - for (const [key, connectionPool] of this.sessionCache) { - for (const session of connectionPool) { - if (!session.destroyed) { - session.destroy(); - } - connectionPool.remove(session); - } - this.sessionCache.delete(key); - } - } - setMaxConcurrentStreams(maxConcurrentStreams) { - if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { - throw new RangeError("maxConcurrentStreams must be greater than zero."); - } - this.config.maxConcurrency = maxConcurrentStreams; - } - setDisableConcurrentStreams(disableConcurrentStreams) { - this.config.disableConcurrency = disableConcurrentStreams; - } - getUrlString(request) { - return request.destination.toString(); - } -} -exports.NodeHttp2ConnectionManager = NodeHttp2ConnectionManager; /***/ }), -/***/ 74368: -/***/ ((__unused_webpack_module, exports) => { +/***/ 44900: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NodeHttp2ConnectionPool = void 0; -class NodeHttp2ConnectionPool { - constructor(sessions) { - this.sessions = []; - this.sessions = sessions !== null && sessions !== void 0 ? sessions : []; - } - poll() { - if (this.sessions.length > 0) { - return this.sessions.shift(); - } - } - offerLast(session) { - this.sessions.push(session); - } - contains(session) { - return this.sessions.includes(session); - } - remove(session) { - this.sessions = this.sessions.filter((s) => s !== session); - } - [Symbol.iterator]() { - return this.sessions[Symbol.iterator](); - } - destroy(connection) { - for (const session of this.sessions) { - if (session === connection) { - if (!session.destroyed) { - session.destroy(); - } - } - } - } -} -exports.NodeHttp2ConnectionPool = NodeHttp2ConnectionPool; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(3063), exports); +tslib_1.__exportStar(__nccwpck_require__(25705), exports); +tslib_1.__exportStar(__nccwpck_require__(36826), exports); /***/ }), -/***/ 92533: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NodeHttp2Handler = void 0; -const protocol_http_1 = __nccwpck_require__(70223); -const querystring_builder_1 = __nccwpck_require__(43402); -const http2_1 = __nccwpck_require__(85158); -const get_transformed_headers_1 = __nccwpck_require__(96225); -const node_http2_connection_manager_1 = __nccwpck_require__(36675); -const write_request_body_1 = __nccwpck_require__(5248); -class NodeHttp2Handler { - constructor(options) { - this.metadata = { handlerProtocol: "h2" }; - this.connectionManager = new node_http2_connection_manager_1.NodeHttp2ConnectionManager({}); - this.configProvider = new Promise((resolve, reject) => { - if (typeof options === "function") { - options() - .then((opts) => { - resolve(opts || {}); - }) - .catch(reject); - } - else { - resolve(options || {}); - } - }); - } - destroy() { - this.connectionManager.destroy(); - } - async handle(request, { abortSignal } = {}) { - if (!this.config) { - this.config = await this.configProvider; - this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); - if (this.config.maxConcurrentStreams) { - this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); - } - } - const { requestTimeout, disableConcurrentStreams } = this.config; - return new Promise((_resolve, _reject) => { - var _a, _b, _c; - let fulfilled = false; - let writeRequestBodyPromise = undefined; - const resolve = async (arg) => { - await writeRequestBodyPromise; - _resolve(arg); - }; - const reject = async (arg) => { - await writeRequestBodyPromise; - _reject(arg); - }; - if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { - fulfilled = true; - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - reject(abortError); - return; - } - const { hostname, method, port, protocol, query } = request; - let auth = ""; - if (request.username != null || request.password != null) { - const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; - const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; - auth = `${username}:${password}@`; - } - const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; - const requestContext = { destination: new URL(authority) }; - const session = this.connectionManager.lease(requestContext, { - requestTimeout: (_c = this.config) === null || _c === void 0 ? void 0 : _c.sessionTimeout, - disableConcurrentStreams: disableConcurrentStreams || false, - }); - const rejectWithDestroy = (err) => { - if (disableConcurrentStreams) { - this.destroySession(session); - } - fulfilled = true; - reject(err); - }; - const queryString = (0, querystring_builder_1.buildQueryString)(query || {}); - let path = request.path; - if (queryString) { - path += `?${queryString}`; - } - if (request.fragment) { - path += `#${request.fragment}`; - } - const req = session.request({ - ...request.headers, - [http2_1.constants.HTTP2_HEADER_PATH]: path, - [http2_1.constants.HTTP2_HEADER_METHOD]: method, - }); - session.ref(); - req.on("response", (headers) => { - const httpResponse = new protocol_http_1.HttpResponse({ - statusCode: headers[":status"] || -1, - headers: (0, get_transformed_headers_1.getTransformedHeaders)(headers), - body: req, - }); - fulfilled = true; - resolve({ response: httpResponse }); - if (disableConcurrentStreams) { - session.close(); - this.connectionManager.deleteSession(authority, session); - } - }); - if (requestTimeout) { - req.setTimeout(requestTimeout, () => { - req.close(); - const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); - timeoutError.name = "TimeoutError"; - rejectWithDestroy(timeoutError); - }); - } - if (abortSignal) { - abortSignal.onabort = () => { - req.close(); - const abortError = new Error("Request aborted"); - abortError.name = "AbortError"; - rejectWithDestroy(abortError); - }; - } - req.on("frameError", (type, code, id) => { - rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); - }); - req.on("error", rejectWithDestroy); - req.on("aborted", () => { - rejectWithDestroy(new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`)); - }); - req.on("close", () => { - session.unref(); - if (disableConcurrentStreams) { - session.destroy(); - } - if (!fulfilled) { - rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); - } - }); - writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, requestTimeout); - }); - } - destroySession(session) { - if (!session.destroyed) { - session.destroy(); - } - } -} -exports.NodeHttp2Handler = NodeHttp2Handler; - +/***/ 25705: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + /***/ }), -/***/ 63598: +/***/ 36826: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.setConnectionTimeout = void 0; -const setConnectionTimeout = (request, reject, timeoutInMs = 0) => { - if (!timeoutInMs) { - return; - } - const timeoutId = setTimeout(() => { - request.destroy(); - reject(Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { - name: "TimeoutError", - })); - }, timeoutInMs); - request.on("socket", (socket) => { - if (socket.connecting) { - socket.on("connect", () => { - clearTimeout(timeoutId); - }); - } - else { - clearTimeout(timeoutId); - } - }); -}; -exports.setConnectionTimeout = setConnectionTimeout; /***/ }), -/***/ 44035: +/***/ 2037: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.setSocketKeepAlive = void 0; -const setSocketKeepAlive = (request, { keepAlive, keepAliveMsecs }) => { - if (keepAlive !== true) { - return; - } - request.on("socket", (socket) => { - socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); - }); -}; -exports.setSocketKeepAlive = setSocketKeepAlive; /***/ }), -/***/ 44751: +/***/ 68866: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.setSocketTimeout = void 0; -const setSocketTimeout = (request, reject, timeoutInMs = 0) => { - request.setTimeout(timeoutInMs, () => { - request.destroy(); - reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); - }); -}; -exports.setSocketTimeout = setSocketTimeout; /***/ }), -/***/ 84362: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 75623: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.Collector = void 0; -const stream_1 = __nccwpck_require__(12781); -class Collector extends stream_1.Writable { - constructor() { - super(...arguments); - this.bufferedBytes = []; - } - _write(chunk, encoding, callback) { - this.bufferedBytes.push(chunk); - callback(); - } -} -exports.Collector = Collector; +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); /***/ }), -/***/ 72198: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 89595: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.streamCollector = void 0; -const collector_1 = __nccwpck_require__(84362); -const streamCollector = (stream) => new Promise((resolve, reject) => { - const collector = new collector_1.Collector(); - stream.pipe(collector); - stream.on("error", (err) => { - collector.end(); - reject(err); - }); - collector.on("error", reject); - collector.on("finish", function () { - const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); - resolve(bytes); - }); -}); -exports.streamCollector = streamCollector; /***/ }), -/***/ 5248: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 99451: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.writeRequestBody = void 0; -const stream_1 = __nccwpck_require__(12781); -const MIN_WAIT_TIME = 1000; -async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { - var _a; - const headers = (_a = request.headers) !== null && _a !== void 0 ? _a : {}; - const expect = headers["Expect"] || headers["expect"]; - let timeoutId = -1; - let hasError = false; - if (expect === "100-continue") { - await Promise.race([ - new Promise((resolve) => { - timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); - }), - new Promise((resolve) => { - httpRequest.on("continue", () => { - clearTimeout(timeoutId); - resolve(); - }); - httpRequest.on("error", () => { - hasError = true; - clearTimeout(timeoutId); - resolve(); - }); - }), - ]); - } - if (!hasError) { - writeBody(httpRequest, request.body); - } -} -exports.writeRequestBody = writeRequestBody; -function writeBody(httpRequest, body) { - if (body instanceof stream_1.Readable) { - body.pipe(httpRequest); - } - else if (body) { - httpRequest.end(Buffer.from(body)); - } - else { - httpRequest.end(); - } -} /***/ }), -/***/ 96875: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 99766: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.CredentialsProviderError = void 0; -const ProviderError_1 = __nccwpck_require__(81786); -class CredentialsProviderError extends ProviderError_1.ProviderError { - constructor(message, tryNextLink = true) { - super(message, tryNextLink); - this.tryNextLink = tryNextLink; - this.name = "CredentialsProviderError"; - Object.setPrototypeOf(this, CredentialsProviderError.prototype); - } -} -exports.CredentialsProviderError = CredentialsProviderError; /***/ }), -/***/ 81786: +/***/ 34898: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ProviderError = void 0; -class ProviderError extends Error { - constructor(message, tryNextLink = true) { - super(message); - this.tryNextLink = tryNextLink; - this.name = "ProviderError"; - Object.setPrototypeOf(this, ProviderError.prototype); - } - static from(error, tryNextLink = true) { - return Object.assign(new this(error.message, tryNextLink), error); - } -} -exports.ProviderError = ProviderError; /***/ }), -/***/ 22173: +/***/ 4527: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.TokenProviderError = void 0; -const ProviderError_1 = __nccwpck_require__(81786); -class TokenProviderError extends ProviderError_1.ProviderError { - constructor(message, tryNextLink = true) { - super(message, tryNextLink); - this.tryNextLink = tryNextLink; - this.name = "TokenProviderError"; - Object.setPrototypeOf(this, TokenProviderError.prototype); - } -} -exports.TokenProviderError = TokenProviderError; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(89595), exports); +tslib_1.__exportStar(__nccwpck_require__(99451), exports); +tslib_1.__exportStar(__nccwpck_require__(99766), exports); +tslib_1.__exportStar(__nccwpck_require__(93330), exports); +tslib_1.__exportStar(__nccwpck_require__(34898), exports); /***/ }), -/***/ 51444: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 93330: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.chain = void 0; -const ProviderError_1 = __nccwpck_require__(81786); -const chain = (...providers) => async () => { - if (providers.length === 0) { - throw new ProviderError_1.ProviderError("No providers in chain"); - } - let lastProviderError; - for (const provider of providers) { - try { - const credentials = await provider(); - return credentials; - } - catch (err) { - lastProviderError = err; - if (err === null || err === void 0 ? void 0 : err.tryNextLink) { - continue; - } - throw err; - } - } - throw lastProviderError; -}; -exports.chain = chain; /***/ }), -/***/ 10529: +/***/ 16845: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromStatic = void 0; -const fromStatic = (staticValue) => () => Promise.resolve(staticValue); -exports.fromStatic = fromStatic; /***/ }), -/***/ 74462: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 70490: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(96875), exports); -tslib_1.__exportStar(__nccwpck_require__(81786), exports); -tslib_1.__exportStar(__nccwpck_require__(22173), exports); -tslib_1.__exportStar(__nccwpck_require__(51444), exports); -tslib_1.__exportStar(__nccwpck_require__(10529), exports); -tslib_1.__exportStar(__nccwpck_require__(714), exports); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); + } + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; +}; +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; /***/ }), -/***/ 714: -/***/ ((__unused_webpack_module, exports) => { +/***/ 44762: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.memoize = void 0; -const memoize = (provider, isExpired, requiresRefresh) => { - let resolved; - let pending; - let hasResult; - let isConstant = false; - const coalesceProvider = async () => { - if (!pending) { - pending = provider(); - } - try { - resolved = await pending; - hasResult = true; - isConstant = false; - } - finally { - pending = undefined; - } - return resolved; +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(70490); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), }; - if (isExpired === undefined) { - return async (options) => { - if (!hasResult || (options === null || options === void 0 ? void 0 : options.forceRefresh)) { - resolved = await coalesceProvider(); - } - return resolved; - }; - } - return async (options) => { - if (!hasResult || (options === null || options === void 0 ? void 0 : options.forceRefresh)) { - resolved = await coalesceProvider(); - } - if (isConstant) { - return resolved; - } - if (requiresRefresh && !requiresRefresh(resolved)) { - isConstant = true; - return resolved; - } - if (isExpired(resolved)) { - await coalesceProvider(); - return resolved; - } - return resolved; +}; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), }; }; -exports.memoize = memoize; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; /***/ }), -/***/ 23915: +/***/ 34581: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 97169: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.Field = void 0; -const FieldPosition_1 = __nccwpck_require__(33908); -class Field { - constructor({ name, kind = FieldPosition_1.FieldPosition.HEADER, values = [] }) { - this.name = name; - this.kind = kind; - this.values = values; - } - add(value) { - this.values.push(value); - } - set(values) { - this.values = values; - } - remove(value) { - this.values = this.values.filter((v) => v !== value); - } - toString() { - return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); - } - get() { - return this.values; - } -} -exports.Field = Field; +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(44762), exports); +tslib_1.__exportStar(__nccwpck_require__(34581), exports); +var checksum_1 = __nccwpck_require__(70490); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); /***/ }), -/***/ 33908: +/***/ 47461: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -22885,38 +42131,17 @@ var FieldPosition; /***/ }), -/***/ 18343: +/***/ 39502: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.Fields = void 0; -class Fields { - constructor({ fields = [], encoding = "utf-8" }) { - this.entries = {}; - fields.forEach(this.setField.bind(this)); - this.encoding = encoding; - } - setField(field) { - this.entries[field.name.toLowerCase()] = field; - } - getField(name) { - return this.entries[name.toLowerCase()]; - } - removeField(name) { - delete this.entries[name.toLowerCase()]; - } - getByType(kind) { - return Object.values(this.entries).filter((field) => field.kind === kind); - } -} -exports.Fields = Fields; /***/ }), -/***/ 56779: +/***/ 57741: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -22926,608 +42151,320 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 52872: +/***/ 20509: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(39502), exports); +tslib_1.__exportStar(__nccwpck_require__(57741), exports); + + +/***/ }), + +/***/ 49185: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(10301), exports); +tslib_1.__exportStar(__nccwpck_require__(81401), exports); +tslib_1.__exportStar(__nccwpck_require__(74394), exports); +tslib_1.__exportStar(__nccwpck_require__(67504), exports); +tslib_1.__exportStar(__nccwpck_require__(82511), exports); +tslib_1.__exportStar(__nccwpck_require__(37651), exports); +tslib_1.__exportStar(__nccwpck_require__(44900), exports); +tslib_1.__exportStar(__nccwpck_require__(2037), exports); +tslib_1.__exportStar(__nccwpck_require__(68866), exports); +tslib_1.__exportStar(__nccwpck_require__(75623), exports); +tslib_1.__exportStar(__nccwpck_require__(4527), exports); +tslib_1.__exportStar(__nccwpck_require__(16845), exports); +tslib_1.__exportStar(__nccwpck_require__(97169), exports); +tslib_1.__exportStar(__nccwpck_require__(47461), exports); +tslib_1.__exportStar(__nccwpck_require__(20509), exports); +tslib_1.__exportStar(__nccwpck_require__(81715), exports); +tslib_1.__exportStar(__nccwpck_require__(98702), exports); +tslib_1.__exportStar(__nccwpck_require__(71123), exports); +tslib_1.__exportStar(__nccwpck_require__(1413), exports); +tslib_1.__exportStar(__nccwpck_require__(3528), exports); +tslib_1.__exportStar(__nccwpck_require__(81983), exports); +tslib_1.__exportStar(__nccwpck_require__(64125), exports); +tslib_1.__exportStar(__nccwpck_require__(28694), exports); +tslib_1.__exportStar(__nccwpck_require__(91573), exports); +tslib_1.__exportStar(__nccwpck_require__(17790), exports); +tslib_1.__exportStar(__nccwpck_require__(6228), exports); +tslib_1.__exportStar(__nccwpck_require__(10209), exports); +tslib_1.__exportStar(__nccwpck_require__(57026), exports); +tslib_1.__exportStar(__nccwpck_require__(82698), exports); +tslib_1.__exportStar(__nccwpck_require__(14891), exports); +tslib_1.__exportStar(__nccwpck_require__(11255), exports); +tslib_1.__exportStar(__nccwpck_require__(49953), exports); +tslib_1.__exportStar(__nccwpck_require__(34660), exports); +tslib_1.__exportStar(__nccwpck_require__(41047), exports); + + +/***/ }), + +/***/ 81715: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.HttpRequest = void 0; -class HttpRequest { - constructor(options) { - this.method = options.method || "GET"; - this.hostname = options.hostname || "localhost"; - this.port = options.port; - this.query = options.query || {}; - this.headers = options.headers || {}; - this.body = options.body; - this.protocol = options.protocol - ? options.protocol.slice(-1) !== ":" - ? `${options.protocol}:` - : options.protocol - : "https:"; - this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; - this.username = options.username; - this.password = options.password; - this.fragment = options.fragment; - } - static isInstance(request) { - if (!request) - return false; - const req = request; - return ("method" in req && - "protocol" in req && - "hostname" in req && - "path" in req && - typeof req["query"] === "object" && - typeof req["headers"] === "object"); - } - clone() { - const cloned = new HttpRequest({ - ...this, - headers: { ...this.headers }, - }); - if (cloned.query) - cloned.query = cloneQuery(cloned.query); - return cloned; - } -} -exports.HttpRequest = HttpRequest; -function cloneQuery(query) { - return Object.keys(query).reduce((carry, paramName) => { - const param = query[paramName]; - return { - ...carry, - [paramName]: Array.isArray(param) ? [...param] : param, - }; - }, {}); -} /***/ }), -/***/ 92348: +/***/ 98702: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.HttpResponse = void 0; -class HttpResponse { - constructor(options) { - this.statusCode = options.statusCode; - this.reason = options.reason; - this.headers = options.headers || {}; - this.body = options.body; - } - static isInstance(response) { - if (!response) - return false; - const resp = response; - return typeof resp.statusCode === "number" && typeof resp.headers === "object"; - } -} -exports.HttpResponse = HttpResponse; +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; /***/ }), -/***/ 70223: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 71123: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(23915), exports); -tslib_1.__exportStar(__nccwpck_require__(33908), exports); -tslib_1.__exportStar(__nccwpck_require__(18343), exports); -tslib_1.__exportStar(__nccwpck_require__(56779), exports); -tslib_1.__exportStar(__nccwpck_require__(52872), exports); -tslib_1.__exportStar(__nccwpck_require__(92348), exports); -tslib_1.__exportStar(__nccwpck_require__(85694), exports); /***/ }), -/***/ 85694: +/***/ 1413: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isValidHostname = void 0; -function isValidHostname(hostname) { - const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; - return hostPattern.test(hostname); -} -exports.isValidHostname = isValidHostname; /***/ }), -/***/ 43402: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 3528: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.buildQueryString = void 0; -const util_uri_escape_1 = __nccwpck_require__(57952); -function buildQueryString(query) { - const parts = []; - for (let key of Object.keys(query).sort()) { - const value = query[key]; - key = (0, util_uri_escape_1.escapeUri)(key); - if (Array.isArray(value)) { - for (let i = 0, iLen = value.length; i < iLen; i++) { - parts.push(`${key}=${(0, util_uri_escape_1.escapeUri)(value[i])}`); - } - } - else { - let qsEntry = key; - if (value || typeof value === "string") { - qsEntry += `=${(0, util_uri_escape_1.escapeUri)(value)}`; - } - parts.push(qsEntry); - } - } - return parts.join("&"); -} -exports.buildQueryString = buildQueryString; /***/ }), -/***/ 47424: +/***/ 81983: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.parseQueryString = void 0; -function parseQueryString(querystring) { - const query = {}; - querystring = querystring.replace(/^\?/, ""); - if (querystring) { - for (const pair of querystring.split("&")) { - let [key, value = null] = pair.split("="); - key = decodeURIComponent(key); - if (value) { - value = decodeURIComponent(value); - } - if (!(key in query)) { - query[key] = value; - } - else if (Array.isArray(query[key])) { - query[key].push(value); - } - else { - query[key] = [query[key], value]; - } - } - } - return query; -} -exports.parseQueryString = parseQueryString; /***/ }), -/***/ 7352: +/***/ 64125: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NODEJS_TIMEOUT_ERROR_CODES = exports.TRANSIENT_ERROR_STATUS_CODES = exports.TRANSIENT_ERROR_CODES = exports.THROTTLING_ERROR_CODES = exports.CLOCK_SKEW_ERROR_CODES = void 0; -exports.CLOCK_SKEW_ERROR_CODES = [ - "AuthFailure", - "InvalidSignatureException", - "RequestExpired", - "RequestInTheFuture", - "RequestTimeTooSkewed", - "SignatureDoesNotMatch", -]; -exports.THROTTLING_ERROR_CODES = [ - "BandwidthLimitExceeded", - "EC2ThrottledException", - "LimitExceededException", - "PriorRequestNotComplete", - "ProvisionedThroughputExceededException", - "RequestLimitExceeded", - "RequestThrottled", - "RequestThrottledException", - "SlowDown", - "ThrottledException", - "Throttling", - "ThrottlingException", - "TooManyRequestsException", - "TransactionInProgressException", -]; -exports.TRANSIENT_ERROR_CODES = ["AbortError", "TimeoutError", "RequestTimeout", "RequestTimeoutException"]; -exports.TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504]; -exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "ECONNREFUSED", "EPIPE", "ETIMEDOUT"]; /***/ }), -/***/ 61921: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 28694: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 91573: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isServerError = exports.isTransientError = exports.isThrottlingError = exports.isClockSkewError = exports.isRetryableByTrait = void 0; -const constants_1 = __nccwpck_require__(7352); -const isRetryableByTrait = (error) => error.$retryable !== undefined; -exports.isRetryableByTrait = isRetryableByTrait; -const isClockSkewError = (error) => constants_1.CLOCK_SKEW_ERROR_CODES.includes(error.name); -exports.isClockSkewError = isClockSkewError; -const isThrottlingError = (error) => { - var _a, _b; - return ((_a = error.$metadata) === null || _a === void 0 ? void 0 : _a.httpStatusCode) === 429 || - constants_1.THROTTLING_ERROR_CODES.includes(error.name) || - ((_b = error.$retryable) === null || _b === void 0 ? void 0 : _b.throttling) == true; -}; -exports.isThrottlingError = isThrottlingError; -const isTransientError = (error) => { - var _a; - return constants_1.TRANSIENT_ERROR_CODES.includes(error.name) || - constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes((error === null || error === void 0 ? void 0 : error.code) || "") || - constants_1.TRANSIENT_ERROR_STATUS_CODES.includes(((_a = error.$metadata) === null || _a === void 0 ? void 0 : _a.httpStatusCode) || 0); -}; -exports.isTransientError = isTransientError; -const isServerError = (error) => { - var _a; - if (((_a = error.$metadata) === null || _a === void 0 ? void 0 : _a.httpStatusCode) !== undefined) { - const statusCode = error.$metadata.httpStatusCode; - if (500 <= statusCode && statusCode <= 599 && !(0, exports.isTransientError)(error)) { - return true; - } - return false; - } - return false; -}; -exports.isServerError = isServerError; /***/ }), -/***/ 75216: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 17790: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getConfigFilepath = exports.ENV_CONFIG_PATH = void 0; -const path_1 = __nccwpck_require__(71017); -const getHomeDir_1 = __nccwpck_require__(97363); -exports.ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; -const getConfigFilepath = () => process.env[exports.ENV_CONFIG_PATH] || (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "config"); -exports.getConfigFilepath = getConfigFilepath; /***/ }), -/***/ 91569: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 6228: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getCredentialsFilepath = exports.ENV_CREDENTIALS_PATH = void 0; -const path_1 = __nccwpck_require__(71017); -const getHomeDir_1 = __nccwpck_require__(97363); -exports.ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; -const getCredentialsFilepath = () => process.env[exports.ENV_CREDENTIALS_PATH] || (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "credentials"); -exports.getCredentialsFilepath = getCredentialsFilepath; /***/ }), -/***/ 97363: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 10209: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getHomeDir = void 0; -const os_1 = __nccwpck_require__(22037); -const path_1 = __nccwpck_require__(71017); -const getHomeDir = () => { - const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; - if (HOME) - return HOME; - if (USERPROFILE) - return USERPROFILE; - if (HOMEPATH) - return `${HOMEDRIVE}${HOMEPATH}`; - return (0, os_1.homedir)(); -}; -exports.getHomeDir = getHomeDir; /***/ }), -/***/ 57498: +/***/ 57026: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getProfileData = void 0; -const profileKeyRegex = /^profile\s(["'])?([^\1]+)\1$/; -const getProfileData = (data) => Object.entries(data) - .filter(([key]) => profileKeyRegex.test(key)) - .reduce((acc, [key, value]) => ({ ...acc, [profileKeyRegex.exec(key)[2]]: value }), { - ...(data.default && { default: data.default }), -}); -exports.getProfileData = getProfileData; /***/ }), -/***/ 36776: +/***/ 82698: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getProfileName = exports.DEFAULT_PROFILE = exports.ENV_PROFILE = void 0; -exports.ENV_PROFILE = "AWS_PROFILE"; -exports.DEFAULT_PROFILE = "default"; -const getProfileName = (init) => init.profile || process.env[exports.ENV_PROFILE] || exports.DEFAULT_PROFILE; -exports.getProfileName = getProfileName; +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); /***/ }), -/***/ 42992: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 14891: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSSOTokenFilepath = void 0; -const crypto_1 = __nccwpck_require__(6113); -const path_1 = __nccwpck_require__(71017); -const getHomeDir_1 = __nccwpck_require__(97363); -const getSSOTokenFilepath = (id) => { - const hasher = (0, crypto_1.createHash)("sha1"); - const cacheName = hasher.update(id).digest("hex"); - return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); -}; -exports.getSSOTokenFilepath = getSSOTokenFilepath; /***/ }), -/***/ 18553: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 11255: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSSOTokenFromFile = void 0; -const fs_1 = __nccwpck_require__(57147); -const getSSOTokenFilepath_1 = __nccwpck_require__(42992); -const { readFile } = fs_1.promises; -const getSSOTokenFromFile = async (id) => { - const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); - const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); - return JSON.parse(ssoTokenText); -}; -exports.getSSOTokenFromFile = getSSOTokenFromFile; /***/ }), -/***/ 5175: +/***/ 49953: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSsoSessionData = void 0; -const ssoSessionKeyRegex = /^sso-session\s(["'])?([^\1]+)\1$/; -const getSsoSessionData = (data) => Object.entries(data) - .filter(([key]) => ssoSessionKeyRegex.test(key)) - .reduce((acc, [key, value]) => ({ ...acc, [ssoSessionKeyRegex.exec(key)[2]]: value }), {}); -exports.getSsoSessionData = getSsoSessionData; /***/ }), -/***/ 67387: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 34660: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(97363), exports); -tslib_1.__exportStar(__nccwpck_require__(36776), exports); -tslib_1.__exportStar(__nccwpck_require__(42992), exports); -tslib_1.__exportStar(__nccwpck_require__(18553), exports); -tslib_1.__exportStar(__nccwpck_require__(57871), exports); -tslib_1.__exportStar(__nccwpck_require__(96179), exports); -tslib_1.__exportStar(__nccwpck_require__(26533), exports); -tslib_1.__exportStar(__nccwpck_require__(84105), exports); /***/ }), -/***/ 57871: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 41047: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.loadSharedConfigFiles = void 0; -const getConfigFilepath_1 = __nccwpck_require__(75216); -const getCredentialsFilepath_1 = __nccwpck_require__(91569); -const getProfileData_1 = __nccwpck_require__(57498); -const parseIni_1 = __nccwpck_require__(82806); -const slurpFile_1 = __nccwpck_require__(79242); -const swallowError = () => ({}); -const loadSharedConfigFiles = async (init = {}) => { - const { filepath = (0, getCredentialsFilepath_1.getCredentialsFilepath)(), configFilepath = (0, getConfigFilepath_1.getConfigFilepath)() } = init; - const parsedFiles = await Promise.all([ - (0, slurpFile_1.slurpFile)(configFilepath, { - ignoreCache: init.ignoreCache, - }) - .then(parseIni_1.parseIni) - .then(getProfileData_1.getProfileData) - .catch(swallowError), - (0, slurpFile_1.slurpFile)(filepath, { - ignoreCache: init.ignoreCache, - }) - .then(parseIni_1.parseIni) - .catch(swallowError), - ]); - return { - configFile: parsedFiles[0], - credentialsFile: parsedFiles[1], - }; -}; -exports.loadSharedConfigFiles = loadSharedConfigFiles; /***/ }), -/***/ 96179: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 74075: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.loadSsoSessionData = void 0; -const getConfigFilepath_1 = __nccwpck_require__(75216); -const getSsoSessionData_1 = __nccwpck_require__(5175); -const parseIni_1 = __nccwpck_require__(82806); -const slurpFile_1 = __nccwpck_require__(79242); -const swallowError = () => ({}); -const loadSsoSessionData = async (init = {}) => { - var _a; - return (0, slurpFile_1.slurpFile)((_a = init.configFilepath) !== null && _a !== void 0 ? _a : (0, getConfigFilepath_1.getConfigFilepath)()) - .then(parseIni_1.parseIni) - .then(getSsoSessionData_1.getSsoSessionData) - .catch(swallowError); -}; -exports.loadSsoSessionData = loadSsoSessionData; /***/ }), -/***/ 81224: +/***/ 48960: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.mergeConfigFiles = void 0; -const mergeConfigFiles = (...files) => { - const merged = {}; - for (const file of files) { - for (const [key, values] of Object.entries(file)) { - if (merged[key] !== undefined) { - Object.assign(merged[key], values); - } - else { - merged[key] = values; - } - } - } - return merged; -}; -exports.mergeConfigFiles = mergeConfigFiles; +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); /***/ }), -/***/ 82806: +/***/ 78340: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.parseIni = void 0; -const profileNameBlockList = ["__proto__", "profile __proto__"]; -const parseIni = (iniData) => { - const map = {}; - let currentSection; - for (let line of iniData.split(/\r?\n/)) { - line = line.split(/(^|\s)[;#]/)[0].trim(); - const isSection = line[0] === "[" && line[line.length - 1] === "]"; - if (isSection) { - currentSection = line.substring(1, line.length - 1); - if (profileNameBlockList.includes(currentSection)) { - throw new Error(`Found invalid profile name "${currentSection}"`); - } - } - else if (currentSection) { - const indexOfEqualsSign = line.indexOf("="); - const start = 0; - const end = line.length - 1; - const isAssignment = indexOfEqualsSign !== -1 && indexOfEqualsSign !== start && indexOfEqualsSign !== end; - if (isAssignment) { - const [name, value] = [ - line.substring(0, indexOfEqualsSign).trim(), - line.substring(indexOfEqualsSign + 1).trim(), - ]; - map[currentSection] = map[currentSection] || {}; - map[currentSection][name] = value; - } - } - } - return map; -}; -exports.parseIni = parseIni; /***/ }), -/***/ 26533: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 4744: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.parseKnownFiles = void 0; -const loadSharedConfigFiles_1 = __nccwpck_require__(57871); -const mergeConfigFiles_1 = __nccwpck_require__(81224); -const parseKnownFiles = async (init) => { - const parsedFiles = await (0, loadSharedConfigFiles_1.loadSharedConfigFiles)(init); - return (0, mergeConfigFiles_1.mergeConfigFiles)(parsedFiles.configFile, parsedFiles.credentialsFile); -}; -exports.parseKnownFiles = parseKnownFiles; /***/ }), -/***/ 79242: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 68270: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.slurpFile = void 0; -const fs_1 = __nccwpck_require__(57147); -const { readFile } = fs_1.promises; -const filePromisesHash = {}; -const slurpFile = (path, options) => { - if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { - filePromisesHash[path] = readFile(path, "utf8"); - } - return filePromisesHash[path]; -}; -exports.slurpFile = slurpFile; /***/ }), -/***/ 84105: +/***/ 39580: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -23537,1962 +42474,1129 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 75086: +/***/ 57628: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SignatureV4 = void 0; -const eventstream_codec_1 = __nccwpck_require__(14825); -const util_hex_encoding_1 = __nccwpck_require__(1968); -const util_middleware_1 = __nccwpck_require__(10236); -const util_utf8_1 = __nccwpck_require__(2855); -const constants_1 = __nccwpck_require__(30342); -const credentialDerivation_1 = __nccwpck_require__(11424); -const getCanonicalHeaders_1 = __nccwpck_require__(93590); -const getCanonicalQuery_1 = __nccwpck_require__(92019); -const getPayloadHash_1 = __nccwpck_require__(47080); -const headerUtil_1 = __nccwpck_require__(34120); -const moveHeadersToQuery_1 = __nccwpck_require__(98201); -const prepareRequest_1 = __nccwpck_require__(75772); -const utilDate_1 = __nccwpck_require__(94799); -class SignatureV4 { - constructor({ applyChecksum, credentials, region, service, sha256, uriEscapePath = true, }) { - this.headerMarshaller = new eventstream_codec_1.HeaderMarshaller(util_utf8_1.toUtf8, util_utf8_1.fromUtf8); - this.service = service; - this.sha256 = sha256; - this.uriEscapePath = uriEscapePath; - this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true; - this.regionProvider = (0, util_middleware_1.normalizeProvider)(region); - this.credentialProvider = (0, util_middleware_1.normalizeProvider)(credentials); - } - async presign(originalRequest, options = {}) { - const { signingDate = new Date(), expiresIn = 3600, unsignableHeaders, unhoistableHeaders, signableHeaders, signingRegion, signingService, } = options; - const credentials = await this.credentialProvider(); - this.validateResolvedCredentials(credentials); - const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider()); - const { longDate, shortDate } = formatDate(signingDate); - if (expiresIn > constants_1.MAX_PRESIGNED_TTL) { - return Promise.reject("Signature version 4 presigned URLs" + " must have an expiration date less than one week in" + " the future"); - } - const scope = (0, credentialDerivation_1.createScope)(shortDate, region, signingService !== null && signingService !== void 0 ? signingService : this.service); - const request = (0, moveHeadersToQuery_1.moveHeadersToQuery)((0, prepareRequest_1.prepareRequest)(originalRequest), { unhoistableHeaders }); - if (credentials.sessionToken) { - request.query[constants_1.TOKEN_QUERY_PARAM] = credentials.sessionToken; - } - request.query[constants_1.ALGORITHM_QUERY_PARAM] = constants_1.ALGORITHM_IDENTIFIER; - request.query[constants_1.CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`; - request.query[constants_1.AMZ_DATE_QUERY_PARAM] = longDate; - request.query[constants_1.EXPIRES_QUERY_PARAM] = expiresIn.toString(10); - const canonicalHeaders = (0, getCanonicalHeaders_1.getCanonicalHeaders)(request, unsignableHeaders, signableHeaders); - request.query[constants_1.SIGNED_HEADERS_QUERY_PARAM] = getCanonicalHeaderList(canonicalHeaders); - request.query[constants_1.SIGNATURE_QUERY_PARAM] = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, await (0, getPayloadHash_1.getPayloadHash)(originalRequest, this.sha256))); - return request; - } - async sign(toSign, options) { - if (typeof toSign === "string") { - return this.signString(toSign, options); - } - else if (toSign.headers && toSign.payload) { - return this.signEvent(toSign, options); - } - else if (toSign.message) { - return this.signMessage(toSign, options); - } - else { - return this.signRequest(toSign, options); - } - } - async signEvent({ headers, payload }, { signingDate = new Date(), priorSignature, signingRegion, signingService }) { - const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider()); - const { shortDate, longDate } = formatDate(signingDate); - const scope = (0, credentialDerivation_1.createScope)(shortDate, region, signingService !== null && signingService !== void 0 ? signingService : this.service); - const hashedPayload = await (0, getPayloadHash_1.getPayloadHash)({ headers: {}, body: payload }, this.sha256); - const hash = new this.sha256(); - hash.update(headers); - const hashedHeaders = (0, util_hex_encoding_1.toHex)(await hash.digest()); - const stringToSign = [ - constants_1.EVENT_ALGORITHM_IDENTIFIER, - longDate, - scope, - priorSignature, - hashedHeaders, - hashedPayload, - ].join("\n"); - return this.signString(stringToSign, { signingDate, signingRegion: region, signingService }); - } - async signMessage(signableMessage, { signingDate = new Date(), signingRegion, signingService }) { - const promise = this.signEvent({ - headers: this.headerMarshaller.format(signableMessage.message.headers), - payload: signableMessage.message.body, - }, { - signingDate, - signingRegion, - signingService, - priorSignature: signableMessage.priorSignature, - }); - return promise.then((signature) => { - return { message: signableMessage.message, signature }; - }); - } - async signString(stringToSign, { signingDate = new Date(), signingRegion, signingService } = {}) { - const credentials = await this.credentialProvider(); - this.validateResolvedCredentials(credentials); - const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider()); - const { shortDate } = formatDate(signingDate); - const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService)); - hash.update((0, util_utf8_1.toUint8Array)(stringToSign)); - return (0, util_hex_encoding_1.toHex)(await hash.digest()); - } - async signRequest(requestToSign, { signingDate = new Date(), signableHeaders, unsignableHeaders, signingRegion, signingService, } = {}) { - const credentials = await this.credentialProvider(); - this.validateResolvedCredentials(credentials); - const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider()); - const request = (0, prepareRequest_1.prepareRequest)(requestToSign); - const { longDate, shortDate } = formatDate(signingDate); - const scope = (0, credentialDerivation_1.createScope)(shortDate, region, signingService !== null && signingService !== void 0 ? signingService : this.service); - request.headers[constants_1.AMZ_DATE_HEADER] = longDate; - if (credentials.sessionToken) { - request.headers[constants_1.TOKEN_HEADER] = credentials.sessionToken; - } - const payloadHash = await (0, getPayloadHash_1.getPayloadHash)(request, this.sha256); - if (!(0, headerUtil_1.hasHeader)(constants_1.SHA256_HEADER, request.headers) && this.applyChecksum) { - request.headers[constants_1.SHA256_HEADER] = payloadHash; - } - const canonicalHeaders = (0, getCanonicalHeaders_1.getCanonicalHeaders)(request, unsignableHeaders, signableHeaders); - const signature = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, payloadHash)); - request.headers[constants_1.AUTH_HEADER] = - `${constants_1.ALGORITHM_IDENTIFIER} ` + - `Credential=${credentials.accessKeyId}/${scope}, ` + - `SignedHeaders=${getCanonicalHeaderList(canonicalHeaders)}, ` + - `Signature=${signature}`; - return request; - } - createCanonicalRequest(request, canonicalHeaders, payloadHash) { - const sortedHeaders = Object.keys(canonicalHeaders).sort(); - return `${request.method} -${this.getCanonicalPath(request)} -${(0, getCanonicalQuery_1.getCanonicalQuery)(request)} -${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join("\n")} +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(39580), exports); +tslib_1.__exportStar(__nccwpck_require__(98398), exports); +tslib_1.__exportStar(__nccwpck_require__(76522), exports); -${sortedHeaders.join(";")} -${payloadHash}`; - } - async createStringToSign(longDate, credentialScope, canonicalRequest) { - const hash = new this.sha256(); - hash.update((0, util_utf8_1.toUint8Array)(canonicalRequest)); - const hashedRequest = await hash.digest(); - return `${constants_1.ALGORITHM_IDENTIFIER} -${longDate} -${credentialScope} -${(0, util_hex_encoding_1.toHex)(hashedRequest)}`; - } - getCanonicalPath({ path }) { - if (this.uriEscapePath) { - const normalizedPathSegments = []; - for (const pathSegment of path.split("/")) { - if ((pathSegment === null || pathSegment === void 0 ? void 0 : pathSegment.length) === 0) - continue; - if (pathSegment === ".") - continue; - if (pathSegment === "..") { - normalizedPathSegments.pop(); - } - else { - normalizedPathSegments.push(pathSegment); - } - } - const normalizedPath = `${(path === null || path === void 0 ? void 0 : path.startsWith("/")) ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && (path === null || path === void 0 ? void 0 : path.endsWith("/")) ? "/" : ""}`; - const doubleEncoded = encodeURIComponent(normalizedPath); - return doubleEncoded.replace(/%2F/g, "/"); - } - return path; - } - async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) { - const stringToSign = await this.createStringToSign(longDate, credentialScope, canonicalRequest); - const hash = new this.sha256(await keyPromise); - hash.update((0, util_utf8_1.toUint8Array)(stringToSign)); - return (0, util_hex_encoding_1.toHex)(await hash.digest()); - } - getSigningKey(credentials, region, shortDate, service) { - return (0, credentialDerivation_1.getSigningKey)(this.sha256, credentials, shortDate, region, service || this.service); - } - validateResolvedCredentials(credentials) { - if (typeof credentials !== "object" || - typeof credentials.accessKeyId !== "string" || - typeof credentials.secretAccessKey !== "string") { - throw new Error("Resolved credential object is not valid"); - } - } -} -exports.SignatureV4 = SignatureV4; -const formatDate = (now) => { - const longDate = (0, utilDate_1.iso8601)(now).replace(/[\-:]/g, ""); - return { - longDate, - shortDate: longDate.slice(0, 8), - }; -}; -const getCanonicalHeaderList = (headers) => Object.keys(headers).sort().join(";"); + +/***/ }), + +/***/ 98398: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 53141: +/***/ 76522: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.cloneQuery = exports.cloneRequest = void 0; -const cloneRequest = ({ headers, query, ...rest }) => ({ - ...rest, - headers: { ...headers }, - query: query ? (0, exports.cloneQuery)(query) : undefined, -}); -exports.cloneRequest = cloneRequest; -const cloneQuery = (query) => Object.keys(query).reduce((carry, paramName) => { - const param = query[paramName]; - return { - ...carry, - [paramName]: Array.isArray(param) ? [...param] : param, - }; -}, {}); -exports.cloneQuery = cloneQuery; /***/ }), -/***/ 30342: +/***/ 89035: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.MAX_PRESIGNED_TTL = exports.KEY_TYPE_IDENTIFIER = exports.MAX_CACHE_SIZE = exports.UNSIGNED_PAYLOAD = exports.EVENT_ALGORITHM_IDENTIFIER = exports.ALGORITHM_IDENTIFIER_V4A = exports.ALGORITHM_IDENTIFIER = exports.UNSIGNABLE_PATTERNS = exports.SEC_HEADER_PATTERN = exports.PROXY_HEADER_PATTERN = exports.ALWAYS_UNSIGNABLE_HEADERS = exports.HOST_HEADER = exports.TOKEN_HEADER = exports.SHA256_HEADER = exports.SIGNATURE_HEADER = exports.GENERATED_HEADERS = exports.DATE_HEADER = exports.AMZ_DATE_HEADER = exports.AUTH_HEADER = exports.REGION_SET_PARAM = exports.TOKEN_QUERY_PARAM = exports.SIGNATURE_QUERY_PARAM = exports.EXPIRES_QUERY_PARAM = exports.SIGNED_HEADERS_QUERY_PARAM = exports.AMZ_DATE_QUERY_PARAM = exports.CREDENTIAL_QUERY_PARAM = exports.ALGORITHM_QUERY_PARAM = void 0; -exports.ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm"; -exports.CREDENTIAL_QUERY_PARAM = "X-Amz-Credential"; -exports.AMZ_DATE_QUERY_PARAM = "X-Amz-Date"; -exports.SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders"; -exports.EXPIRES_QUERY_PARAM = "X-Amz-Expires"; -exports.SIGNATURE_QUERY_PARAM = "X-Amz-Signature"; -exports.TOKEN_QUERY_PARAM = "X-Amz-Security-Token"; -exports.REGION_SET_PARAM = "X-Amz-Region-Set"; -exports.AUTH_HEADER = "authorization"; -exports.AMZ_DATE_HEADER = exports.AMZ_DATE_QUERY_PARAM.toLowerCase(); -exports.DATE_HEADER = "date"; -exports.GENERATED_HEADERS = [exports.AUTH_HEADER, exports.AMZ_DATE_HEADER, exports.DATE_HEADER]; -exports.SIGNATURE_HEADER = exports.SIGNATURE_QUERY_PARAM.toLowerCase(); -exports.SHA256_HEADER = "x-amz-content-sha256"; -exports.TOKEN_HEADER = exports.TOKEN_QUERY_PARAM.toLowerCase(); -exports.HOST_HEADER = "host"; -exports.ALWAYS_UNSIGNABLE_HEADERS = { - authorization: true, - "cache-control": true, - connection: true, - expect: true, - from: true, - "keep-alive": true, - "max-forwards": true, - pragma: true, - referer: true, - te: true, - trailer: true, - "transfer-encoding": true, - upgrade: true, - "user-agent": true, - "x-amzn-trace-id": true, -}; -exports.PROXY_HEADER_PATTERN = /^proxy-/; -exports.SEC_HEADER_PATTERN = /^sec-/; -exports.UNSIGNABLE_PATTERNS = [/^proxy-/i, /^sec-/i]; -exports.ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256"; -exports.ALGORITHM_IDENTIFIER_V4A = "AWS4-ECDSA-P256-SHA256"; -exports.EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD"; -exports.UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD"; -exports.MAX_CACHE_SIZE = 50; -exports.KEY_TYPE_IDENTIFIER = "aws4_request"; -exports.MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7; /***/ }), -/***/ 11424: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 7225: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.clearCredentialCache = exports.getSigningKey = exports.createScope = void 0; -const util_hex_encoding_1 = __nccwpck_require__(1968); -const util_utf8_1 = __nccwpck_require__(2855); -const constants_1 = __nccwpck_require__(30342); -const signingKeyCache = {}; -const cacheQueue = []; -const createScope = (shortDate, region, service) => `${shortDate}/${region}/${service}/${constants_1.KEY_TYPE_IDENTIFIER}`; -exports.createScope = createScope; -const getSigningKey = async (sha256Constructor, credentials, shortDate, region, service) => { - const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId); - const cacheKey = `${shortDate}:${region}:${service}:${(0, util_hex_encoding_1.toHex)(credsHash)}:${credentials.sessionToken}`; - if (cacheKey in signingKeyCache) { - return signingKeyCache[cacheKey]; - } - cacheQueue.push(cacheKey); - while (cacheQueue.length > constants_1.MAX_CACHE_SIZE) { - delete signingKeyCache[cacheQueue.shift()]; - } - let key = `AWS4${credentials.secretAccessKey}`; - for (const signable of [shortDate, region, service, constants_1.KEY_TYPE_IDENTIFIER]) { - key = await hmac(sha256Constructor, key, signable); - } - return (signingKeyCache[cacheKey] = key); -}; -exports.getSigningKey = getSigningKey; -const clearCredentialCache = () => { - cacheQueue.length = 0; - Object.keys(signingKeyCache).forEach((cacheKey) => { - delete signingKeyCache[cacheKey]; - }); -}; -exports.clearCredentialCache = clearCredentialCache; -const hmac = (ctor, secret, data) => { - const hash = new ctor(secret); - hash.update((0, util_utf8_1.toUint8Array)(data)); - return hash.digest(); -}; /***/ }), -/***/ 93590: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 54126: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 55612: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getCanonicalHeaders = void 0; -const constants_1 = __nccwpck_require__(30342); -const getCanonicalHeaders = ({ headers }, unsignableHeaders, signableHeaders) => { - const canonical = {}; - for (const headerName of Object.keys(headers).sort()) { - if (headers[headerName] == undefined) { - continue; - } - const canonicalHeaderName = headerName.toLowerCase(); - if (canonicalHeaderName in constants_1.ALWAYS_UNSIGNABLE_HEADERS || - (unsignableHeaders === null || unsignableHeaders === void 0 ? void 0 : unsignableHeaders.has(canonicalHeaderName)) || - constants_1.PROXY_HEADER_PATTERN.test(canonicalHeaderName) || - constants_1.SEC_HEADER_PATTERN.test(canonicalHeaderName)) { - if (!signableHeaders || (signableHeaders && !signableHeaders.has(canonicalHeaderName))) { - continue; - } - } - canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " "); - } - return canonical; -}; -exports.getCanonicalHeaders = getCanonicalHeaders; /***/ }), -/***/ 92019: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 43084: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getCanonicalQuery = void 0; -const util_uri_escape_1 = __nccwpck_require__(57952); -const constants_1 = __nccwpck_require__(30342); -const getCanonicalQuery = ({ query = {} }) => { - const keys = []; - const serialized = {}; - for (const key of Object.keys(query).sort()) { - if (key.toLowerCase() === constants_1.SIGNATURE_HEADER) { - continue; - } - keys.push(key); - const value = query[key]; - if (typeof value === "string") { - serialized[key] = `${(0, util_uri_escape_1.escapeUri)(key)}=${(0, util_uri_escape_1.escapeUri)(value)}`; - } - else if (Array.isArray(value)) { - serialized[key] = value - .slice(0) - .sort() - .reduce((encoded, value) => encoded.concat([`${(0, util_uri_escape_1.escapeUri)(key)}=${(0, util_uri_escape_1.escapeUri)(value)}`]), []) - .join("&"); - } - } - return keys - .map((key) => serialized[key]) - .filter((serialized) => serialized) - .join("&"); -}; -exports.getCanonicalQuery = getCanonicalQuery; /***/ }), -/***/ 47080: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 89843: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getPayloadHash = void 0; -const is_array_buffer_1 = __nccwpck_require__(69126); -const util_hex_encoding_1 = __nccwpck_require__(1968); -const util_utf8_1 = __nccwpck_require__(2855); -const constants_1 = __nccwpck_require__(30342); -const getPayloadHash = async ({ headers, body }, hashConstructor) => { - for (const headerName of Object.keys(headers)) { - if (headerName.toLowerCase() === constants_1.SHA256_HEADER) { - return headers[headerName]; - } - } - if (body == undefined) { - return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855"; - } - else if (typeof body === "string" || ArrayBuffer.isView(body) || (0, is_array_buffer_1.isArrayBuffer)(body)) { - const hashCtor = new hashConstructor(); - hashCtor.update((0, util_utf8_1.toUint8Array)(body)); - return (0, util_hex_encoding_1.toHex)(await hashCtor.digest()); - } - return constants_1.UNSIGNED_PAYLOAD; -}; -exports.getPayloadHash = getPayloadHash; /***/ }), -/***/ 34120: +/***/ 63799: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.deleteHeader = exports.getHeaderValue = exports.hasHeader = void 0; -const hasHeader = (soughtHeader, headers) => { - soughtHeader = soughtHeader.toLowerCase(); - for (const headerName of Object.keys(headers)) { - if (soughtHeader === headerName.toLowerCase()) { - return true; - } - } - return false; -}; -exports.hasHeader = hasHeader; -const getHeaderValue = (soughtHeader, headers) => { - soughtHeader = soughtHeader.toLowerCase(); - for (const headerName of Object.keys(headers)) { - if (soughtHeader === headerName.toLowerCase()) { - return headers[headerName]; - } - } - return undefined; -}; -exports.getHeaderValue = getHeaderValue; -const deleteHeader = (soughtHeader, headers) => { - soughtHeader = soughtHeader.toLowerCase(); - for (const headerName of Object.keys(headers)) { - if (soughtHeader === headerName.toLowerCase()) { - delete headers[headerName]; - } - } -}; -exports.deleteHeader = deleteHeader; /***/ }), -/***/ 37776: +/***/ 21550: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.prepareRequest = exports.moveHeadersToQuery = exports.getPayloadHash = exports.getCanonicalQuery = exports.getCanonicalHeaders = void 0; const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(75086), exports); -var getCanonicalHeaders_1 = __nccwpck_require__(93590); -Object.defineProperty(exports, "getCanonicalHeaders", ({ enumerable: true, get: function () { return getCanonicalHeaders_1.getCanonicalHeaders; } })); -var getCanonicalQuery_1 = __nccwpck_require__(92019); -Object.defineProperty(exports, "getCanonicalQuery", ({ enumerable: true, get: function () { return getCanonicalQuery_1.getCanonicalQuery; } })); -var getPayloadHash_1 = __nccwpck_require__(47080); -Object.defineProperty(exports, "getPayloadHash", ({ enumerable: true, get: function () { return getPayloadHash_1.getPayloadHash; } })); -var moveHeadersToQuery_1 = __nccwpck_require__(98201); -Object.defineProperty(exports, "moveHeadersToQuery", ({ enumerable: true, get: function () { return moveHeadersToQuery_1.moveHeadersToQuery; } })); -var prepareRequest_1 = __nccwpck_require__(75772); -Object.defineProperty(exports, "prepareRequest", ({ enumerable: true, get: function () { return prepareRequest_1.prepareRequest; } })); -tslib_1.__exportStar(__nccwpck_require__(11424), exports); +tslib_1.__exportStar(__nccwpck_require__(55612), exports); +tslib_1.__exportStar(__nccwpck_require__(43084), exports); +tslib_1.__exportStar(__nccwpck_require__(89843), exports); +tslib_1.__exportStar(__nccwpck_require__(57658), exports); +tslib_1.__exportStar(__nccwpck_require__(63799), exports); /***/ }), -/***/ 98201: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 57658: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.moveHeadersToQuery = void 0; -const cloneRequest_1 = __nccwpck_require__(53141); -const moveHeadersToQuery = (request, options = {}) => { - var _a; - const { headers, query = {} } = typeof request.clone === "function" ? request.clone() : (0, cloneRequest_1.cloneRequest)(request); - for (const name of Object.keys(headers)) { - const lname = name.toLowerCase(); - if (lname.slice(0, 6) === "x-amz-" && !((_a = options.unhoistableHeaders) === null || _a === void 0 ? void 0 : _a.has(lname))) { - query[name] = headers[name]; - delete headers[name]; - } - } - return { - ...request, - headers, - query, - }; -}; -exports.moveHeadersToQuery = moveHeadersToQuery; /***/ }), -/***/ 75772: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 88508: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.prepareRequest = void 0; -const cloneRequest_1 = __nccwpck_require__(53141); -const constants_1 = __nccwpck_require__(30342); -const prepareRequest = (request) => { - request = typeof request.clone === "function" ? request.clone() : (0, cloneRequest_1.cloneRequest)(request); - for (const headerName of Object.keys(request.headers)) { - if (constants_1.GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) { - delete request.headers[headerName]; - } - } - return request; -}; -exports.prepareRequest = prepareRequest; /***/ }), -/***/ 94799: +/***/ 18883: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.toDate = exports.iso8601 = void 0; -const iso8601 = (time) => (0, exports.toDate)(time) - .toISOString() - .replace(/\.\d{3}Z$/, "Z"); -exports.iso8601 = iso8601; -const toDate = (time) => { - if (typeof time === "number") { - return new Date(time * 1000); - } - if (typeof time === "string") { - if (Number(time)) { - return new Date(Number(time) * 1000); - } - return new Date(time); - } - return time; -}; -exports.toDate = toDate; +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); /***/ }), -/***/ 78571: +/***/ 7545: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NoOpLogger = void 0; -class NoOpLogger { - trace() { } - debug() { } - info() { } - warn() { } - error() { } -} -exports.NoOpLogger = NoOpLogger; /***/ }), -/***/ 36034: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 49123: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.Client = void 0; -const middleware_stack_1 = __nccwpck_require__(11461); -class Client { - constructor(config) { - this.middlewareStack = (0, middleware_stack_1.constructStack)(); - this.config = config; - } - send(command, optionsOrCb, cb) { - const options = typeof optionsOrCb !== "function" ? optionsOrCb : undefined; - const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb; - const handler = command.resolveMiddleware(this.middlewareStack, this.config, options); - if (callback) { - handler(command) - .then((result) => callback(null, result.output), (err) => callback(err)) - .catch(() => { }); - } - else { - return handler(command).then((result) => result.output); - } - } - destroy() { - if (this.config.requestHandler.destroy) - this.config.requestHandler.destroy(); - } -} -exports.Client = Client; /***/ }), -/***/ 95933: +/***/ 28006: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.collectBody = void 0; -const util_stream_1 = __nccwpck_require__(77728); -const collectBody = async (streamBody = new Uint8Array(), context) => { - if (streamBody instanceof Uint8Array) { - return util_stream_1.Uint8ArrayBlobAdapter.mutate(streamBody); - } - if (!streamBody) { - return util_stream_1.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); - } - const fromContext = context.streamCollector(streamBody); - return util_stream_1.Uint8ArrayBlobAdapter.mutate(await fromContext); -}; -exports.collectBody = collectBody; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(7545), exports); +tslib_1.__exportStar(__nccwpck_require__(49123), exports); /***/ }), -/***/ 4014: +/***/ 55756: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.Command = void 0; -const middleware_stack_1 = __nccwpck_require__(11461); -class Command { - constructor() { - this.middlewareStack = (0, middleware_stack_1.constructStack)(); - } -} -exports.Command = Command; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(74075), exports); +tslib_1.__exportStar(__nccwpck_require__(48960), exports); +tslib_1.__exportStar(__nccwpck_require__(78340), exports); +tslib_1.__exportStar(__nccwpck_require__(4744), exports); +tslib_1.__exportStar(__nccwpck_require__(68270), exports); +tslib_1.__exportStar(__nccwpck_require__(57628), exports); +tslib_1.__exportStar(__nccwpck_require__(89035), exports); +tslib_1.__exportStar(__nccwpck_require__(7225), exports); +tslib_1.__exportStar(__nccwpck_require__(54126), exports); +tslib_1.__exportStar(__nccwpck_require__(21550), exports); +tslib_1.__exportStar(__nccwpck_require__(88508), exports); +tslib_1.__exportStar(__nccwpck_require__(18883), exports); +tslib_1.__exportStar(__nccwpck_require__(28006), exports); +tslib_1.__exportStar(__nccwpck_require__(52866), exports); +tslib_1.__exportStar(__nccwpck_require__(17756), exports); +tslib_1.__exportStar(__nccwpck_require__(45489), exports); +tslib_1.__exportStar(__nccwpck_require__(26524), exports); +tslib_1.__exportStar(__nccwpck_require__(14603), exports); +tslib_1.__exportStar(__nccwpck_require__(83752), exports); +tslib_1.__exportStar(__nccwpck_require__(30774), exports); +tslib_1.__exportStar(__nccwpck_require__(14089), exports); +tslib_1.__exportStar(__nccwpck_require__(45678), exports); +tslib_1.__exportStar(__nccwpck_require__(69926), exports); +tslib_1.__exportStar(__nccwpck_require__(50364), exports); +tslib_1.__exportStar(__nccwpck_require__(66894), exports); +tslib_1.__exportStar(__nccwpck_require__(57887), exports); +tslib_1.__exportStar(__nccwpck_require__(66255), exports); + + +/***/ }), + +/***/ 52866: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 78392: +/***/ 17756: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SENSITIVE_STRING = void 0; -exports.SENSITIVE_STRING = "***SensitiveInformation***"; /***/ }), -/***/ 65516: +/***/ 45489: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.createAggregatedClient = void 0; -const createAggregatedClient = (commands, Client) => { - for (const command of Object.keys(commands)) { - const CommandCtor = commands[command]; - const methodImpl = async function (args, optionsOrCb, cb) { - const command = new CommandCtor(args); - if (typeof optionsOrCb === "function") { - this.send(command, optionsOrCb); - } - else if (typeof cb === "function") { - if (typeof optionsOrCb !== "object") - throw new Error(`Expected http options but got ${typeof optionsOrCb}`); - this.send(command, optionsOrCb || {}, cb); - } - else { - return this.send(command, optionsOrCb); - } - }; - const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, ""); - Client.prototype[methodName] = methodImpl; - } -}; -exports.createAggregatedClient = createAggregatedClient; /***/ }), -/***/ 24695: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 26524: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.parseEpochTimestamp = exports.parseRfc7231DateTime = exports.parseRfc3339DateTimeWithOffset = exports.parseRfc3339DateTime = exports.dateToUtcString = void 0; -const parse_utils_1 = __nccwpck_require__(34014); -const DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; -const MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; -function dateToUtcString(date) { - const year = date.getUTCFullYear(); - const month = date.getUTCMonth(); - const dayOfWeek = date.getUTCDay(); - const dayOfMonthInt = date.getUTCDate(); - const hoursInt = date.getUTCHours(); - const minutesInt = date.getUTCMinutes(); - const secondsInt = date.getUTCSeconds(); - const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; - const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; - const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; - const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; - return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; -} -exports.dateToUtcString = dateToUtcString; -const RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); -const parseRfc3339DateTime = (value) => { - if (value === null || value === undefined) { - return undefined; - } - if (typeof value !== "string") { - throw new TypeError("RFC-3339 date-times must be expressed as strings"); - } - const match = RFC3339.exec(value); - if (!match) { - throw new TypeError("Invalid RFC-3339 date-time value"); - } - const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; - const year = (0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)); - const month = parseDateValue(monthStr, "month", 1, 12); - const day = parseDateValue(dayStr, "day", 1, 31); - return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); -}; -exports.parseRfc3339DateTime = parseRfc3339DateTime; -const RFC3339_WITH_OFFSET = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/); -const parseRfc3339DateTimeWithOffset = (value) => { - if (value === null || value === undefined) { - return undefined; - } - if (typeof value !== "string") { - throw new TypeError("RFC-3339 date-times must be expressed as strings"); - } - const match = RFC3339_WITH_OFFSET.exec(value); - if (!match) { - throw new TypeError("Invalid RFC-3339 date-time value"); - } - const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; - const year = (0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)); - const month = parseDateValue(monthStr, "month", 1, 12); - const day = parseDateValue(dayStr, "day", 1, 31); - const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); - if (offsetStr.toUpperCase() != "Z") { - date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); - } - return date; -}; -exports.parseRfc3339DateTimeWithOffset = parseRfc3339DateTimeWithOffset; -const IMF_FIXDATE = new RegExp(/^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/); -const RFC_850_DATE = new RegExp(/^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/); -const ASC_TIME = new RegExp(/^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/); -const parseRfc7231DateTime = (value) => { - if (value === null || value === undefined) { - return undefined; - } - if (typeof value !== "string") { - throw new TypeError("RFC-7231 date-times must be expressed as strings"); - } - let match = IMF_FIXDATE.exec(value); - if (match) { - const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; - return buildDate((0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { hours, minutes, seconds, fractionalMilliseconds }); - } - match = RFC_850_DATE.exec(value); - if (match) { - const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; - return adjustRfc850Year(buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { - hours, - minutes, - seconds, - fractionalMilliseconds, - })); - } - match = ASC_TIME.exec(value); - if (match) { - const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; - return buildDate((0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)), parseMonthByShortName(monthStr), parseDateValue(dayStr.trimLeft(), "day", 1, 31), { hours, minutes, seconds, fractionalMilliseconds }); - } - throw new TypeError("Invalid RFC-7231 date-time value"); -}; -exports.parseRfc7231DateTime = parseRfc7231DateTime; -const parseEpochTimestamp = (value) => { - if (value === null || value === undefined) { - return undefined; - } - let valueAsDouble; - if (typeof value === "number") { - valueAsDouble = value; - } - else if (typeof value === "string") { - valueAsDouble = (0, parse_utils_1.strictParseDouble)(value); - } - else { - throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); - } - if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { - throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); - } - return new Date(Math.round(valueAsDouble * 1000)); -}; -exports.parseEpochTimestamp = parseEpochTimestamp; -const buildDate = (year, month, day, time) => { - const adjustedMonth = month - 1; - validateDayOfMonth(year, adjustedMonth, day); - return new Date(Date.UTC(year, adjustedMonth, day, parseDateValue(time.hours, "hour", 0, 23), parseDateValue(time.minutes, "minute", 0, 59), parseDateValue(time.seconds, "seconds", 0, 60), parseMilliseconds(time.fractionalMilliseconds))); -}; -const parseTwoDigitYear = (value) => { - const thisYear = new Date().getUTCFullYear(); - const valueInThisCentury = Math.floor(thisYear / 100) * 100 + (0, parse_utils_1.strictParseShort)(stripLeadingZeroes(value)); - if (valueInThisCentury < thisYear) { - return valueInThisCentury + 100; - } - return valueInThisCentury; -}; -const FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1000; -const adjustRfc850Year = (input) => { - if (input.getTime() - new Date().getTime() > FIFTY_YEARS_IN_MILLIS) { - return new Date(Date.UTC(input.getUTCFullYear() - 100, input.getUTCMonth(), input.getUTCDate(), input.getUTCHours(), input.getUTCMinutes(), input.getUTCSeconds(), input.getUTCMilliseconds())); - } - return input; -}; -const parseMonthByShortName = (value) => { - const monthIdx = MONTHS.indexOf(value); - if (monthIdx < 0) { - throw new TypeError(`Invalid month: ${value}`); - } - return monthIdx + 1; -}; -const DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; -const validateDayOfMonth = (year, month, day) => { - let maxDays = DAYS_IN_MONTH[month]; - if (month === 1 && isLeapYear(year)) { - maxDays = 29; - } - if (day > maxDays) { - throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); - } -}; -const isLeapYear = (year) => { - return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); -}; -const parseDateValue = (value, type, lower, upper) => { - const dateVal = (0, parse_utils_1.strictParseByte)(stripLeadingZeroes(value)); - if (dateVal < lower || dateVal > upper) { - throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); - } - return dateVal; -}; -const parseMilliseconds = (value) => { - if (value === null || value === undefined) { - return 0; - } - return (0, parse_utils_1.strictParseFloat32)("0." + value) * 1000; -}; -const parseOffsetToMilliseconds = (value) => { - const directionStr = value[0]; - let direction = 1; - if (directionStr == "+") { - direction = 1; - } - else if (directionStr == "-") { - direction = -1; - } - else { - throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); - } - const hour = Number(value.substring(1, 3)); - const minute = Number(value.substring(4, 6)); - return direction * (hour * 60 + minute) * 60 * 1000; -}; -const stripLeadingZeroes = (value) => { - let idx = 0; - while (idx < value.length - 1 && value.charAt(idx) === "0") { - idx++; - } - if (idx === 0) { - return value; - } - return value.slice(idx); -}; /***/ }), -/***/ 47222: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 14603: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.withBaseException = exports.throwDefaultError = void 0; -const exceptions_1 = __nccwpck_require__(57778); -const throwDefaultError = ({ output, parsedBody, exceptionCtor, errorCode }) => { - const $metadata = deserializeMetadata(output); - const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : undefined; - const response = new exceptionCtor({ - name: (parsedBody === null || parsedBody === void 0 ? void 0 : parsedBody.code) || (parsedBody === null || parsedBody === void 0 ? void 0 : parsedBody.Code) || errorCode || statusCode || "UnknownError", - $fault: "client", - $metadata, - }); - throw (0, exceptions_1.decorateServiceException)(response, parsedBody); -}; -exports.throwDefaultError = throwDefaultError; -const withBaseException = (ExceptionCtor) => { - return ({ output, parsedBody, errorCode }) => { - (0, exports.throwDefaultError)({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode }); - }; -}; -exports.withBaseException = withBaseException; -const deserializeMetadata = (output) => { - var _a, _b; - return ({ - httpStatusCode: output.statusCode, - requestId: (_b = (_a = output.headers["x-amzn-requestid"]) !== null && _a !== void 0 ? _a : output.headers["x-amzn-request-id"]) !== null && _b !== void 0 ? _b : output.headers["x-amz-request-id"], - extendedRequestId: output.headers["x-amz-id-2"], - cfId: output.headers["x-amz-cf-id"], - }); -}; /***/ }), -/***/ 33088: +/***/ 83752: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.loadConfigsForDefaultMode = void 0; -const loadConfigsForDefaultMode = (mode) => { - switch (mode) { - case "standard": - return { - retryMode: "standard", - connectionTimeout: 3100, - }; - case "in-region": - return { - retryMode: "standard", - connectionTimeout: 1100, - }; - case "cross-region": - return { - retryMode: "standard", - connectionTimeout: 3100, - }; - case "mobile": - return { - retryMode: "standard", - connectionTimeout: 30000, - }; - default: - return {}; - } -}; -exports.loadConfigsForDefaultMode = loadConfigsForDefaultMode; /***/ }), -/***/ 12363: +/***/ 30774: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 14089: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 45678: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 69926: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.emitWarningIfUnsupportedVersion = void 0; -let warningEmitted = false; -const emitWarningIfUnsupportedVersion = (version) => { - if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 14) { - warningEmitted = true; - } -}; -exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion; /***/ }), -/***/ 57778: +/***/ 50364: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.decorateServiceException = exports.ServiceException = void 0; -class ServiceException extends Error { - constructor(options) { - super(options.message); - Object.setPrototypeOf(this, ServiceException.prototype); - this.name = options.name; - this.$fault = options.$fault; - this.$metadata = options.$metadata; - } -} -exports.ServiceException = ServiceException; -const decorateServiceException = (exception, additions = {}) => { - Object.entries(additions) - .filter(([, v]) => v !== undefined) - .forEach(([k, v]) => { - if (exception[k] == undefined || exception[k] === "") { - exception[k] = v; - } - }); - const message = exception.message || exception.Message || "UnknownError"; - exception.message = message; - delete exception.Message; - return exception; -}; -exports.decorateServiceException = decorateServiceException; +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); /***/ }), -/***/ 91927: +/***/ 66894: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.extendedEncodeURIComponent = void 0; -function extendedEncodeURIComponent(str) { - return encodeURIComponent(str).replace(/[!'()*]/g, function (c) { - return "%" + c.charCodeAt(0).toString(16).toUpperCase(); - }); -} -exports.extendedEncodeURIComponent = extendedEncodeURIComponent; /***/ }), -/***/ 86457: +/***/ 57887: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getArrayIfSingleItem = void 0; -const getArrayIfSingleItem = (mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray]; -exports.getArrayIfSingleItem = getArrayIfSingleItem; /***/ }), -/***/ 95830: +/***/ 66255: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getValueFromTextNode = void 0; -const getValueFromTextNode = (obj) => { - const textNodeName = "#text"; - for (const key in obj) { - if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== undefined) { - obj[key] = obj[key][textNodeName]; - } - else if (typeof obj[key] === "object" && obj[key] !== null) { - obj[key] = (0, exports.getValueFromTextNode)(obj[key]); - } - } - return obj; -}; -exports.getValueFromTextNode = getValueFromTextNode; /***/ }), -/***/ 4963: +/***/ 14681: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(78571), exports); -tslib_1.__exportStar(__nccwpck_require__(36034), exports); -tslib_1.__exportStar(__nccwpck_require__(95933), exports); -tslib_1.__exportStar(__nccwpck_require__(4014), exports); -tslib_1.__exportStar(__nccwpck_require__(78392), exports); -tslib_1.__exportStar(__nccwpck_require__(65516), exports); -tslib_1.__exportStar(__nccwpck_require__(24695), exports); -tslib_1.__exportStar(__nccwpck_require__(47222), exports); -tslib_1.__exportStar(__nccwpck_require__(33088), exports); -tslib_1.__exportStar(__nccwpck_require__(12363), exports); -tslib_1.__exportStar(__nccwpck_require__(57778), exports); -tslib_1.__exportStar(__nccwpck_require__(91927), exports); -tslib_1.__exportStar(__nccwpck_require__(86457), exports); -tslib_1.__exportStar(__nccwpck_require__(95830), exports); -tslib_1.__exportStar(__nccwpck_require__(93613), exports); -tslib_1.__exportStar(__nccwpck_require__(21599), exports); -tslib_1.__exportStar(__nccwpck_require__(34014), exports); -tslib_1.__exportStar(__nccwpck_require__(80308), exports); -tslib_1.__exportStar(__nccwpck_require__(38000), exports); -tslib_1.__exportStar(__nccwpck_require__(59801), exports); -tslib_1.__exportStar(__nccwpck_require__(48730), exports); +exports.parseUrl = void 0; +const querystring_parser_1 = __nccwpck_require__(4769); +const parseUrl = (url) => { + if (typeof url === "string") { + return (0, exports.parseUrl)(new URL(url)); + } + const { hostname, pathname, port, protocol, search } = url; + let query; + if (search) { + query = (0, querystring_parser_1.parseQueryString)(search); + } + return { + hostname, + port: port ? parseInt(port) : undefined, + protocol, + path: pathname, + query, + }; +}; +exports.parseUrl = parseUrl; /***/ }), -/***/ 93613: -/***/ ((__unused_webpack_module, exports) => { +/***/ 30305: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.LazyJsonString = exports.StringWrapper = void 0; -const StringWrapper = function () { - const Class = Object.getPrototypeOf(this).constructor; - const Constructor = Function.bind.apply(String, [null, ...arguments]); - const instance = new Constructor(); - Object.setPrototypeOf(instance, Class.prototype); - return instance; -}; -exports.StringWrapper = StringWrapper; -exports.StringWrapper.prototype = Object.create(String.prototype, { - constructor: { - value: exports.StringWrapper, - enumerable: false, - writable: true, - configurable: true, - }, -}); -Object.setPrototypeOf(exports.StringWrapper, String); -class LazyJsonString extends exports.StringWrapper { - deserializeJSON() { - return JSON.parse(super.toString()); - } - toJSON() { - return super.toString(); +exports.fromBase64 = void 0; +const util_buffer_from_1 = __nccwpck_require__(31381); +const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; +const fromBase64 = (input) => { + if ((input.length * 3) % 4 !== 0) { + throw new TypeError(`Incorrect padding on base64 string.`); } - static fromObject(object) { - if (object instanceof LazyJsonString) { - return object; - } - else if (object instanceof String || typeof object === "string") { - return new LazyJsonString(object); - } - return new LazyJsonString(JSON.stringify(object)); + if (!BASE64_REGEX.exec(input)) { + throw new TypeError(`Invalid base64 string.`); } -} -exports.LazyJsonString = LazyJsonString; + const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); + return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); +}; +exports.fromBase64 = fromBase64; /***/ }), -/***/ 21599: -/***/ ((__unused_webpack_module, exports) => { +/***/ 75600: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.take = exports.convertMap = exports.map = void 0; -function map(arg0, arg1, arg2) { - let target; - let filter; - let instructions; - if (typeof arg1 === "undefined" && typeof arg2 === "undefined") { - target = {}; - instructions = arg0; - } - else { - target = arg0; - if (typeof arg1 === "function") { - filter = arg1; - instructions = arg2; - return mapWithFilter(target, filter, instructions); - } - else { - instructions = arg1; - } - } - for (const key of Object.keys(instructions)) { - if (!Array.isArray(instructions[key])) { - target[key] = instructions[key]; - continue; - } - applyInstruction(target, null, instructions, key); - } - return target; -} -exports.map = map; -const convertMap = (target) => { - const output = {}; - for (const [k, v] of Object.entries(target || {})) { - output[k] = [, v]; - } - return output; -}; -exports.convertMap = convertMap; -const take = (source, instructions) => { - const out = {}; - for (const key in instructions) { - applyInstruction(out, source, instructions, key); - } - return out; -}; -exports.take = take; -const mapWithFilter = (target, filter, instructions) => { - return map(target, Object.entries(instructions).reduce((_instructions, [key, value]) => { - if (Array.isArray(value)) { - _instructions[key] = value; - } - else { - if (typeof value === "function") { - _instructions[key] = [filter, value()]; - } - else { - _instructions[key] = [filter, value]; - } - } - return _instructions; - }, {})); -}; -const applyInstruction = (target, source, instructions, targetKey) => { - if (source !== null) { - let instruction = instructions[targetKey]; - if (typeof instruction === "function") { - instruction = [, instruction]; - } - const [filter = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction; - if ((typeof filter === "function" && filter(source[sourceKey])) || (typeof filter !== "function" && !!filter)) { - target[targetKey] = valueFn(source[sourceKey]); - } - return; - } - let [filter, value] = instructions[targetKey]; - if (typeof value === "function") { - let _value; - const defaultFilterPassed = filter === undefined && (_value = value()) != null; - const customFilterPassed = (typeof filter === "function" && !!filter(void 0)) || (typeof filter !== "function" && !!filter); - if (defaultFilterPassed) { - target[targetKey] = _value; - } - else if (customFilterPassed) { - target[targetKey] = value(); - } - } - else { - const defaultFilterPassed = filter === undefined && value != null; - const customFilterPassed = (typeof filter === "function" && !!filter(value)) || (typeof filter !== "function" && !!filter); - if (defaultFilterPassed || customFilterPassed) { - target[targetKey] = value; - } - } -}; -const nonNullish = (_) => _ != null; -const pass = (_) => _; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(30305), exports); +tslib_1.__exportStar(__nccwpck_require__(74730), exports); /***/ }), -/***/ 34014: -/***/ ((__unused_webpack_module, exports) => { +/***/ 74730: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.logger = exports.strictParseByte = exports.strictParseShort = exports.strictParseInt32 = exports.strictParseInt = exports.strictParseLong = exports.limitedParseFloat32 = exports.limitedParseFloat = exports.handleFloat = exports.limitedParseDouble = exports.strictParseFloat32 = exports.strictParseFloat = exports.strictParseDouble = exports.expectUnion = exports.expectString = exports.expectObject = exports.expectNonNull = exports.expectByte = exports.expectShort = exports.expectInt32 = exports.expectInt = exports.expectLong = exports.expectFloat32 = exports.expectNumber = exports.expectBoolean = exports.parseBoolean = void 0; -const parseBoolean = (value) => { - switch (value) { - case "true": - return true; - case "false": - return false; - default: - throw new Error(`Unable to parse boolean value "${value}"`); - } -}; -exports.parseBoolean = parseBoolean; -const expectBoolean = (value) => { - if (value === null || value === undefined) { - return undefined; - } - if (typeof value === "number") { - if (value === 0 || value === 1) { - exports.logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); - } - if (value === 0) { - return false; - } - if (value === 1) { - return true; - } - } - if (typeof value === "string") { - const lower = value.toLowerCase(); - if (lower === "false" || lower === "true") { - exports.logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); - } - if (lower === "false") { - return false; - } - if (lower === "true") { - return true; - } - } - if (typeof value === "boolean") { - return value; - } - throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); -}; -exports.expectBoolean = expectBoolean; -const expectNumber = (value) => { - if (value === null || value === undefined) { - return undefined; - } - if (typeof value === "string") { - const parsed = parseFloat(value); - if (!Number.isNaN(parsed)) { - if (String(parsed) !== String(value)) { - exports.logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); - } - return parsed; - } - } - if (typeof value === "number") { - return value; - } - throw new TypeError(`Expected number, got ${typeof value}: ${value}`); -}; -exports.expectNumber = expectNumber; -const MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); -const expectFloat32 = (value) => { - const expected = (0, exports.expectNumber)(value); - if (expected !== undefined && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { - if (Math.abs(expected) > MAX_FLOAT) { - throw new TypeError(`Expected 32-bit float, got ${value}`); - } - } - return expected; -}; -exports.expectFloat32 = expectFloat32; -const expectLong = (value) => { - if (value === null || value === undefined) { - return undefined; - } - if (Number.isInteger(value) && !Number.isNaN(value)) { - return value; - } - throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); -}; -exports.expectLong = expectLong; -exports.expectInt = exports.expectLong; -const expectInt32 = (value) => expectSizedInt(value, 32); -exports.expectInt32 = expectInt32; -const expectShort = (value) => expectSizedInt(value, 16); -exports.expectShort = expectShort; -const expectByte = (value) => expectSizedInt(value, 8); -exports.expectByte = expectByte; -const expectSizedInt = (value, size) => { - const expected = (0, exports.expectLong)(value); - if (expected !== undefined && castInt(expected, size) !== expected) { - throw new TypeError(`Expected ${size}-bit integer, got ${value}`); - } - return expected; -}; -const castInt = (value, size) => { - switch (size) { - case 32: - return Int32Array.of(value)[0]; - case 16: - return Int16Array.of(value)[0]; - case 8: - return Int8Array.of(value)[0]; - } -}; -const expectNonNull = (value, location) => { - if (value === null || value === undefined) { - if (location) { - throw new TypeError(`Expected a non-null value for ${location}`); - } - throw new TypeError("Expected a non-null value"); - } - return value; -}; -exports.expectNonNull = expectNonNull; -const expectObject = (value) => { - if (value === null || value === undefined) { - return undefined; - } - if (typeof value === "object" && !Array.isArray(value)) { - return value; - } - const receivedType = Array.isArray(value) ? "array" : typeof value; - throw new TypeError(`Expected object, got ${receivedType}: ${value}`); -}; -exports.expectObject = expectObject; -const expectString = (value) => { - if (value === null || value === undefined) { - return undefined; - } - if (typeof value === "string") { - return value; - } - if (["boolean", "number", "bigint"].includes(typeof value)) { - exports.logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); - return String(value); - } - throw new TypeError(`Expected string, got ${typeof value}: ${value}`); -}; -exports.expectString = expectString; -const expectUnion = (value) => { - if (value === null || value === undefined) { - return undefined; - } - const asObject = (0, exports.expectObject)(value); - const setKeys = Object.entries(asObject) - .filter(([, v]) => v != null) - .map(([k]) => k); - if (setKeys.length === 0) { - throw new TypeError(`Unions must have exactly one non-null member. None were found.`); - } - if (setKeys.length > 1) { - throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); - } - return asObject; -}; -exports.expectUnion = expectUnion; -const strictParseDouble = (value) => { - if (typeof value == "string") { - return (0, exports.expectNumber)(parseNumber(value)); - } - return (0, exports.expectNumber)(value); -}; -exports.strictParseDouble = strictParseDouble; -exports.strictParseFloat = exports.strictParseDouble; -const strictParseFloat32 = (value) => { - if (typeof value == "string") { - return (0, exports.expectFloat32)(parseNumber(value)); - } - return (0, exports.expectFloat32)(value); -}; -exports.strictParseFloat32 = strictParseFloat32; -const NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; -const parseNumber = (value) => { - const matches = value.match(NUMBER_REGEX); - if (matches === null || matches[0].length !== value.length) { - throw new TypeError(`Expected real number, got implicit NaN`); - } - return parseFloat(value); -}; -const limitedParseDouble = (value) => { - if (typeof value == "string") { - return parseFloatString(value); +exports.toBase64 = void 0; +const util_buffer_from_1 = __nccwpck_require__(31381); +const toBase64 = (input) => (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); +exports.toBase64 = toBase64; + + +/***/ }), + +/***/ 54880: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.calculateBodyLength = void 0; +const fs_1 = __nccwpck_require__(57147); +const calculateBodyLength = (body) => { + if (!body) { + return 0; } - return (0, exports.expectNumber)(value); -}; -exports.limitedParseDouble = limitedParseDouble; -exports.handleFloat = exports.limitedParseDouble; -exports.limitedParseFloat = exports.limitedParseDouble; -const limitedParseFloat32 = (value) => { - if (typeof value == "string") { - return parseFloatString(value); + if (typeof body === "string") { + return Buffer.from(body).length; } - return (0, exports.expectFloat32)(value); -}; -exports.limitedParseFloat32 = limitedParseFloat32; -const parseFloatString = (value) => { - switch (value) { - case "NaN": - return NaN; - case "Infinity": - return Infinity; - case "-Infinity": - return -Infinity; - default: - throw new Error(`Unable to parse float value: ${value}`); + else if (typeof body.byteLength === "number") { + return body.byteLength; } -}; -const strictParseLong = (value) => { - if (typeof value === "string") { - return (0, exports.expectLong)(parseNumber(value)); + else if (typeof body.size === "number") { + return body.size; } - return (0, exports.expectLong)(value); -}; -exports.strictParseLong = strictParseLong; -exports.strictParseInt = exports.strictParseLong; -const strictParseInt32 = (value) => { - if (typeof value === "string") { - return (0, exports.expectInt32)(parseNumber(value)); + else if (typeof body.start === "number" && typeof body.end === "number") { + return body.end + 1 - body.start; } - return (0, exports.expectInt32)(value); -}; -exports.strictParseInt32 = strictParseInt32; -const strictParseShort = (value) => { - if (typeof value === "string") { - return (0, exports.expectShort)(parseNumber(value)); + else if (typeof body.path === "string" || Buffer.isBuffer(body.path)) { + return (0, fs_1.lstatSync)(body.path).size; } - return (0, exports.expectShort)(value); -}; -exports.strictParseShort = strictParseShort; -const strictParseByte = (value) => { - if (typeof value === "string") { - return (0, exports.expectByte)(parseNumber(value)); + else if (typeof body.fd === "number") { + return (0, fs_1.fstatSync)(body.fd).size; } - return (0, exports.expectByte)(value); -}; -exports.strictParseByte = strictParseByte; -const stackTraceWarning = (message) => { - return String(new TypeError(message).stack || message) - .split("\n") - .slice(0, 5) - .filter((s) => !s.includes("stackTraceWarning")) - .join("\n"); -}; -exports.logger = { - warn: console.warn, + throw new Error(`Body Length computation failed for ${body}`); }; +exports.calculateBodyLength = calculateBodyLength; + + +/***/ }), + +/***/ 68075: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(54880), exports); /***/ }), -/***/ 80308: +/***/ 31381: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolvedPath = void 0; -const extended_encode_uri_component_1 = __nccwpck_require__(91927); -const resolvedPath = (resolvedPath, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { - if (input != null && input[memberName] !== undefined) { - const labelValue = labelValueProvider(); - if (labelValue.length <= 0) { - throw new Error("Empty value provided for input HTTP label: " + memberName + "."); - } - resolvedPath = resolvedPath.replace(uriLabel, isGreedyLabel - ? labelValue - .split("/") - .map((segment) => (0, extended_encode_uri_component_1.extendedEncodeURIComponent)(segment)) - .join("/") - : (0, extended_encode_uri_component_1.extendedEncodeURIComponent)(labelValue)); +exports.fromString = exports.fromArrayBuffer = void 0; +const is_array_buffer_1 = __nccwpck_require__(10780); +const buffer_1 = __nccwpck_require__(14300); +const fromArrayBuffer = (input, offset = 0, length = input.byteLength - offset) => { + if (!(0, is_array_buffer_1.isArrayBuffer)(input)) { + throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); } - else { - throw new Error("No value provided for input HTTP label: " + memberName + "."); + return buffer_1.Buffer.from(input, offset, length); +}; +exports.fromArrayBuffer = fromArrayBuffer; +const fromString = (input, encoding) => { + if (typeof input !== "string") { + throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); } - return resolvedPath; + return encoding ? buffer_1.Buffer.from(input, encoding) : buffer_1.Buffer.from(input); }; -exports.resolvedPath = resolvedPath; +exports.fromString = fromString; /***/ }), -/***/ 38000: +/***/ 42491: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.serializeFloat = void 0; -const serializeFloat = (value) => { - if (value !== value) { - return "NaN"; - } - switch (value) { - case Infinity: - return "Infinity"; - case -Infinity: - return "-Infinity"; - default: - return value; - } +exports.booleanSelector = exports.SelectorType = void 0; +var SelectorType; +(function (SelectorType) { + SelectorType["ENV"] = "env"; + SelectorType["CONFIG"] = "shared config entry"; +})(SelectorType = exports.SelectorType || (exports.SelectorType = {})); +const booleanSelector = (obj, key, type) => { + if (!(key in obj)) + return undefined; + if (obj[key] === "true") + return true; + if (obj[key] === "false") + return false; + throw new Error(`Cannot load ${type} "${key}". Expected "true" or "false", got ${obj[key]}.`); }; -exports.serializeFloat = serializeFloat; +exports.booleanSelector = booleanSelector; /***/ }), -/***/ 59801: -/***/ ((__unused_webpack_module, exports) => { +/***/ 83375: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports._json = void 0; -const _json = (obj) => { - if (obj == null) { - return {}; - } - if (Array.isArray(obj)) { - return obj.filter((_) => _ != null); - } - if (typeof obj === "object") { - const target = {}; - for (const key of Object.keys(obj)) { - if (obj[key] == null) { - continue; - } - target[key] = (0, exports._json)(obj[key]); - } - return target; - } - return obj; -}; -exports._json = _json; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(42491), exports); /***/ }), -/***/ 48730: +/***/ 56470: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.splitEvery = void 0; -function splitEvery(value, delimiter, numDelimiters) { - if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { - throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); - } - const segments = value.split(delimiter); - if (numDelimiters === 1) { - return segments; - } - const compoundSegments = []; - let currentSegment = ""; - for (let i = 0; i < segments.length; i++) { - if (currentSegment === "") { - currentSegment = segments[i]; - } - else { - currentSegment += delimiter + segments[i]; - } - if ((i + 1) % numDelimiters === 0) { - compoundSegments.push(currentSegment); - currentSegment = ""; - } - } - if (currentSegment !== "") { - compoundSegments.push(currentSegment); - } - return compoundSegments; -} -exports.splitEvery = splitEvery; +exports.IMDS_REGION_PATH = exports.DEFAULTS_MODE_OPTIONS = exports.ENV_IMDS_DISABLED = exports.AWS_DEFAULT_REGION_ENV = exports.AWS_REGION_ENV = exports.AWS_EXECUTION_ENV = void 0; +exports.AWS_EXECUTION_ENV = "AWS_EXECUTION_ENV"; +exports.AWS_REGION_ENV = "AWS_REGION"; +exports.AWS_DEFAULT_REGION_ENV = "AWS_DEFAULT_REGION"; +exports.ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; +exports.DEFAULTS_MODE_OPTIONS = ["in-region", "cross-region", "mobile", "standard", "legacy"]; +exports.IMDS_REGION_PATH = "/latest/meta-data/placement/region"; /***/ }), -/***/ 92242: +/***/ 15577: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.REFRESH_MESSAGE = exports.EXPIRE_WINDOW_MS = void 0; -exports.EXPIRE_WINDOW_MS = 5 * 60 * 1000; -exports.REFRESH_MESSAGE = `To refresh this SSO session run 'aws sso login' with the corresponding profile.`; +exports.NODE_DEFAULTS_MODE_CONFIG_OPTIONS = void 0; +const AWS_DEFAULTS_MODE_ENV = "AWS_DEFAULTS_MODE"; +const AWS_DEFAULTS_MODE_CONFIG = "defaults_mode"; +exports.NODE_DEFAULTS_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + return env[AWS_DEFAULTS_MODE_ENV]; + }, + configFileSelector: (profile) => { + return profile[AWS_DEFAULTS_MODE_CONFIG]; + }, + default: "legacy", +}; /***/ }), -/***/ 85125: +/***/ 72429: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromSso = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const shared_ini_file_loader_1 = __nccwpck_require__(67387); -const constants_1 = __nccwpck_require__(92242); -const getNewSsoOidcToken_1 = __nccwpck_require__(93601); -const validateTokenExpiry_1 = __nccwpck_require__(28418); -const validateTokenKey_1 = __nccwpck_require__(2488); -const writeSSOTokenToFile_1 = __nccwpck_require__(48552); -const lastRefreshAttemptTime = new Date(0); -const fromSso = (init = {}) => async () => { - const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init); - const profileName = (0, shared_ini_file_loader_1.getProfileName)(init); - const profile = profiles[profileName]; - if (!profile) { - throw new property_provider_1.TokenProviderError(`Profile '${profileName}' could not be found in shared credentials file.`, false); - } - else if (!profile["sso_session"]) { - throw new property_provider_1.TokenProviderError(`Profile '${profileName}' is missing required property 'sso_session'.`); - } - const ssoSessionName = profile["sso_session"]; - const ssoSessions = await (0, shared_ini_file_loader_1.loadSsoSessionData)(init); - const ssoSession = ssoSessions[ssoSessionName]; - if (!ssoSession) { - throw new property_provider_1.TokenProviderError(`Sso session '${ssoSessionName}' could not be found in shared credentials file.`, false); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(46217), exports); + + +/***/ }), + +/***/ 46217: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultsModeConfig = void 0; +const config_resolver_1 = __nccwpck_require__(53098); +const credential_provider_imds_1 = __nccwpck_require__(7477); +const node_config_provider_1 = __nccwpck_require__(33461); +const property_provider_1 = __nccwpck_require__(79721); +const constants_1 = __nccwpck_require__(56470); +const defaultsModeConfig_1 = __nccwpck_require__(15577); +const resolveDefaultsModeConfig = ({ region = (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS), defaultsMode = (0, node_config_provider_1.loadConfig)(defaultsModeConfig_1.NODE_DEFAULTS_MODE_CONFIG_OPTIONS), } = {}) => (0, property_provider_1.memoize)(async () => { + const mode = typeof defaultsMode === "function" ? await defaultsMode() : defaultsMode; + switch (mode === null || mode === void 0 ? void 0 : mode.toLowerCase()) { + case "auto": + return resolveNodeDefaultsModeAuto(region); + case "in-region": + case "cross-region": + case "mobile": + case "standard": + case "legacy": + return Promise.resolve(mode === null || mode === void 0 ? void 0 : mode.toLocaleLowerCase()); + case undefined: + return Promise.resolve("legacy"); + default: + throw new Error(`Invalid parameter for "defaultsMode", expect ${constants_1.DEFAULTS_MODE_OPTIONS.join(", ")}, got ${mode}`); } - for (const ssoSessionRequiredKey of ["sso_start_url", "sso_region"]) { - if (!ssoSession[ssoSessionRequiredKey]) { - throw new property_provider_1.TokenProviderError(`Sso session '${ssoSessionName}' is missing required property '${ssoSessionRequiredKey}'.`, false); +}); +exports.resolveDefaultsModeConfig = resolveDefaultsModeConfig; +const resolveNodeDefaultsModeAuto = async (clientRegion) => { + if (clientRegion) { + const resolvedRegion = typeof clientRegion === "function" ? await clientRegion() : clientRegion; + const inferredRegion = await inferPhysicalRegion(); + if (!inferredRegion) { + return "standard"; + } + if (resolvedRegion === inferredRegion) { + return "in-region"; + } + else { + return "cross-region"; } } - const ssoStartUrl = ssoSession["sso_start_url"]; - const ssoRegion = ssoSession["sso_region"]; - let ssoToken; - try { - ssoToken = await (0, shared_ini_file_loader_1.getSSOTokenFromFile)(ssoSessionName); + return "standard"; +}; +const inferPhysicalRegion = async () => { + var _a; + if (process.env[constants_1.AWS_EXECUTION_ENV] && (process.env[constants_1.AWS_REGION_ENV] || process.env[constants_1.AWS_DEFAULT_REGION_ENV])) { + return (_a = process.env[constants_1.AWS_REGION_ENV]) !== null && _a !== void 0 ? _a : process.env[constants_1.AWS_DEFAULT_REGION_ENV]; } - catch (e) { - throw new property_provider_1.TokenProviderError(`The SSO session token associated with profile=${profileName} was not found or is invalid. ${constants_1.REFRESH_MESSAGE}`, false); + if (!process.env[constants_1.ENV_IMDS_DISABLED]) { + try { + const endpoint = await (0, credential_provider_imds_1.getInstanceMetadataEndpoint)(); + return (await (0, credential_provider_imds_1.httpRequest)({ ...endpoint, path: constants_1.IMDS_REGION_PATH })).toString(); + } + catch (e) { + } } - (0, validateTokenKey_1.validateTokenKey)("accessToken", ssoToken.accessToken); - (0, validateTokenKey_1.validateTokenKey)("expiresAt", ssoToken.expiresAt); - const { accessToken, expiresAt } = ssoToken; - const existingToken = { token: accessToken, expiration: new Date(expiresAt) }; - if (existingToken.expiration.getTime() - Date.now() > constants_1.EXPIRE_WINDOW_MS) { - return existingToken; +}; + + +/***/ }), + +/***/ 45364: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toHex = exports.fromHex = void 0; +const SHORT_TO_HEX = {}; +const HEX_TO_SHORT = {}; +for (let i = 0; i < 256; i++) { + let encodedByte = i.toString(16).toLowerCase(); + if (encodedByte.length === 1) { + encodedByte = `0${encodedByte}`; } - if (Date.now() - lastRefreshAttemptTime.getTime() < 30 * 1000) { - (0, validateTokenExpiry_1.validateTokenExpiry)(existingToken); - return existingToken; + SHORT_TO_HEX[i] = encodedByte; + HEX_TO_SHORT[encodedByte] = i; +} +function fromHex(encoded) { + if (encoded.length % 2 !== 0) { + throw new Error("Hex encoded strings must have an even number length"); } - (0, validateTokenKey_1.validateTokenKey)("clientId", ssoToken.clientId, true); - (0, validateTokenKey_1.validateTokenKey)("clientSecret", ssoToken.clientSecret, true); - (0, validateTokenKey_1.validateTokenKey)("refreshToken", ssoToken.refreshToken, true); - try { - lastRefreshAttemptTime.setTime(Date.now()); - const newSsoOidcToken = await (0, getNewSsoOidcToken_1.getNewSsoOidcToken)(ssoToken, ssoRegion); - (0, validateTokenKey_1.validateTokenKey)("accessToken", newSsoOidcToken.accessToken); - (0, validateTokenKey_1.validateTokenKey)("expiresIn", newSsoOidcToken.expiresIn); - const newTokenExpiration = new Date(Date.now() + newSsoOidcToken.expiresIn * 1000); - try { - await (0, writeSSOTokenToFile_1.writeSSOTokenToFile)(ssoSessionName, { - ...ssoToken, - accessToken: newSsoOidcToken.accessToken, - expiresAt: newTokenExpiration.toISOString(), - refreshToken: newSsoOidcToken.refreshToken, - }); + const out = new Uint8Array(encoded.length / 2); + for (let i = 0; i < encoded.length; i += 2) { + const encodedByte = encoded.slice(i, i + 2).toLowerCase(); + if (encodedByte in HEX_TO_SHORT) { + out[i / 2] = HEX_TO_SHORT[encodedByte]; } - catch (error) { + else { + throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); } - return { - token: newSsoOidcToken.accessToken, - expiration: newTokenExpiration, - }; } - catch (error) { - (0, validateTokenExpiry_1.validateTokenExpiry)(existingToken); - return existingToken; + return out; +} +exports.fromHex = fromHex; +function toHex(bytes) { + let out = ""; + for (let i = 0; i < bytes.byteLength; i++) { + out += SHORT_TO_HEX[bytes[i]]; } -}; -exports.fromSso = fromSso; + return out; +} +exports.toHex = toHex; /***/ }), -/***/ 63258: +/***/ 85730: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromStatic = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const fromStatic = ({ token }) => async () => { - if (!token || !token.token) { - throw new property_provider_1.TokenProviderError(`Please pass a valid token to fromStatic`, false); - } - return token; -}; -exports.fromStatic = fromStatic; +exports.getSmithyContext = void 0; +const types_1 = __nccwpck_require__(73998); +const getSmithyContext = (context) => context[types_1.SMITHY_CONTEXT_KEY] || (context[types_1.SMITHY_CONTEXT_KEY] = {}); +exports.getSmithyContext = getSmithyContext; /***/ }), -/***/ 93601: +/***/ 2390: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getNewSsoOidcToken = void 0; -const client_sso_oidc_1 = __nccwpck_require__(54527); -const getSsoOidcClient_1 = __nccwpck_require__(99775); -const getNewSsoOidcToken = (ssoToken, ssoRegion) => { - const ssoOidcClient = (0, getSsoOidcClient_1.getSsoOidcClient)(ssoRegion); - return ssoOidcClient.send(new client_sso_oidc_1.CreateTokenCommand({ - clientId: ssoToken.clientId, - clientSecret: ssoToken.clientSecret, - refreshToken: ssoToken.refreshToken, - grantType: "refresh_token", - })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(85730), exports); +tslib_1.__exportStar(__nccwpck_require__(80149), exports); + + +/***/ }), + +/***/ 80149: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.normalizeProvider = void 0; +const normalizeProvider = (input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; }; -exports.getNewSsoOidcToken = getNewSsoOidcToken; +exports.normalizeProvider = normalizeProvider; /***/ }), -/***/ 99775: +/***/ 94353: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 78556: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); + + +/***/ }), + +/***/ 6392: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 69888: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 74937: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 3546: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 1550: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 87382: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSsoOidcClient = void 0; -const client_sso_oidc_1 = __nccwpck_require__(54527); -const ssoOidcClientsHash = {}; -const getSsoOidcClient = (ssoRegion) => { - if (ssoOidcClientsHash[ssoRegion]) { - return ssoOidcClientsHash[ssoRegion]; - } - const ssoOidcClient = new client_sso_oidc_1.SSOOIDCClient({ region: ssoRegion }); - ssoOidcClientsHash[ssoRegion] = ssoOidcClient; - return ssoOidcClient; -}; -exports.getSsoOidcClient = getSsoOidcClient; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(1550), exports); +tslib_1.__exportStar(__nccwpck_require__(22585), exports); +tslib_1.__exportStar(__nccwpck_require__(37622), exports); + + +/***/ }), + +/***/ 22585: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 37622: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 48734: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 23399: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 58468: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 86361: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 28497: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 73326: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 94074: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 13762: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(86361), exports); +tslib_1.__exportStar(__nccwpck_require__(28497), exports); +tslib_1.__exportStar(__nccwpck_require__(73326), exports); +tslib_1.__exportStar(__nccwpck_require__(56398), exports); +tslib_1.__exportStar(__nccwpck_require__(94074), exports); /***/ }), -/***/ 52843: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 56398: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(85125), exports); -tslib_1.__exportStar(__nccwpck_require__(63258), exports); -tslib_1.__exportStar(__nccwpck_require__(70195), exports); /***/ }), -/***/ 70195: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 5742: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.nodeProvider = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const fromSso_1 = __nccwpck_require__(85125); -const nodeProvider = (init = {}) => (0, property_provider_1.memoize)((0, property_provider_1.chain)((0, fromSso_1.fromSso)(init), async () => { - throw new property_provider_1.TokenProviderError("Could not load token from any providers", false); -}), (token) => token.expiration !== undefined && token.expiration.getTime() - Date.now() < 300000, (token) => token.expiration !== undefined); -exports.nodeProvider = nodeProvider; /***/ }), -/***/ 28418: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 40596: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.validateTokenExpiry = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const constants_1 = __nccwpck_require__(92242); -const validateTokenExpiry = (token) => { - if (token.expiration && token.expiration.getTime() < Date.now()) { - throw new property_provider_1.TokenProviderError(`Token is expired. ${constants_1.REFRESH_MESSAGE}`, false); +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); } + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; }; -exports.validateTokenExpiry = validateTokenExpiry; +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; /***/ }), -/***/ 2488: +/***/ 63089: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.validateTokenKey = void 0; -const property_provider_1 = __nccwpck_require__(74462); -const constants_1 = __nccwpck_require__(92242); -const validateTokenKey = (key, value, forRefresh = false) => { - if (typeof value === "undefined") { - throw new property_provider_1.TokenProviderError(`Value not present for '${key}' in SSO Token${forRefresh ? ". Cannot refresh" : ""}. ${constants_1.REFRESH_MESSAGE}`, false); - } +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(40596); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), + }; }; -exports.validateTokenKey = validateTokenKey; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; +}; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; /***/ }), -/***/ 48552: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 95712: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.writeSSOTokenToFile = void 0; -const shared_ini_file_loader_1 = __nccwpck_require__(67387); -const fs_1 = __nccwpck_require__(57147); -const { writeFile } = fs_1.promises; -const writeSSOTokenToFile = (id, ssoToken) => { - const tokenFilepath = (0, shared_ini_file_loader_1.getSSOTokenFilepath)(id); - const tokenString = JSON.stringify(ssoToken, null, 2); - return writeFile(tokenFilepath, tokenString); -}; -exports.writeSSOTokenToFile = writeSSOTokenToFile; /***/ }), -/***/ 52562: -/***/ ((__unused_webpack_module, exports) => { +/***/ 76332: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(63089), exports); +tslib_1.__exportStar(__nccwpck_require__(95712), exports); +var checksum_1 = __nccwpck_require__(40596); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); /***/ }), -/***/ 26913: +/***/ 67186: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.HttpAuthLocation = void 0; -var HttpAuthLocation; -(function (HttpAuthLocation) { - HttpAuthLocation["HEADER"] = "header"; - HttpAuthLocation["QUERY"] = "query"; -})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); /***/ }), -/***/ 14994: +/***/ 91655: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25502,7 +43606,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 65861: +/***/ 64554: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25512,17 +43616,65 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 76527: -/***/ ((__unused_webpack_module, exports) => { +/***/ 76493: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(91655), exports); +tslib_1.__exportStar(__nccwpck_require__(64554), exports); /***/ }), -/***/ 48470: +/***/ 73998: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(94353), exports); +tslib_1.__exportStar(__nccwpck_require__(78556), exports); +tslib_1.__exportStar(__nccwpck_require__(6392), exports); +tslib_1.__exportStar(__nccwpck_require__(69888), exports); +tslib_1.__exportStar(__nccwpck_require__(74937), exports); +tslib_1.__exportStar(__nccwpck_require__(3546), exports); +tslib_1.__exportStar(__nccwpck_require__(87382), exports); +tslib_1.__exportStar(__nccwpck_require__(48734), exports); +tslib_1.__exportStar(__nccwpck_require__(23399), exports); +tslib_1.__exportStar(__nccwpck_require__(58468), exports); +tslib_1.__exportStar(__nccwpck_require__(13762), exports); +tslib_1.__exportStar(__nccwpck_require__(5742), exports); +tslib_1.__exportStar(__nccwpck_require__(76332), exports); +tslib_1.__exportStar(__nccwpck_require__(67186), exports); +tslib_1.__exportStar(__nccwpck_require__(76493), exports); +tslib_1.__exportStar(__nccwpck_require__(43667), exports); +tslib_1.__exportStar(__nccwpck_require__(55138), exports); +tslib_1.__exportStar(__nccwpck_require__(90095), exports); +tslib_1.__exportStar(__nccwpck_require__(2173), exports); +tslib_1.__exportStar(__nccwpck_require__(50143), exports); +tslib_1.__exportStar(__nccwpck_require__(74835), exports); +tslib_1.__exportStar(__nccwpck_require__(36627), exports); +tslib_1.__exportStar(__nccwpck_require__(87004), exports); +tslib_1.__exportStar(__nccwpck_require__(91422), exports); +tslib_1.__exportStar(__nccwpck_require__(89958), exports); +tslib_1.__exportStar(__nccwpck_require__(87437), exports); +tslib_1.__exportStar(__nccwpck_require__(62433), exports); +tslib_1.__exportStar(__nccwpck_require__(37542), exports); +tslib_1.__exportStar(__nccwpck_require__(73534), exports); +tslib_1.__exportStar(__nccwpck_require__(70696), exports); +tslib_1.__exportStar(__nccwpck_require__(81093), exports); +tslib_1.__exportStar(__nccwpck_require__(96437), exports); +tslib_1.__exportStar(__nccwpck_require__(62209), exports); +tslib_1.__exportStar(__nccwpck_require__(94955), exports); + + +/***/ }), + +/***/ 43667: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25532,31 +43684,29 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 23213: +/***/ 55138: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; /***/ }), -/***/ 30820: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 90095: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(23213), exports); -tslib_1.__exportStar(__nccwpck_require__(76781), exports); -tslib_1.__exportStar(__nccwpck_require__(14515), exports); /***/ }), -/***/ 76781: +/***/ 2173: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25566,7 +43716,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 14515: +/***/ 50143: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25576,7 +43726,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 67736: +/***/ 74835: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25586,7 +43736,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 13268: +/***/ 36627: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25596,23 +43746,17 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 90142: +/***/ 87004: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.HostAddressType = void 0; -var HostAddressType; -(function (HostAddressType) { - HostAddressType["AAAA"] = "AAAA"; - HostAddressType["A"] = "A"; -})(HostAddressType = exports.HostAddressType || (exports.HostAddressType = {})); /***/ }), -/***/ 62338: +/***/ 91422: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25622,23 +43766,17 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 99385: +/***/ 89958: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.EndpointURLScheme = void 0; -var EndpointURLScheme; -(function (EndpointURLScheme) { - EndpointURLScheme["HTTP"] = "http"; - EndpointURLScheme["HTTPS"] = "https"; -})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); /***/ }), -/***/ 37521: +/***/ 87437: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25648,7 +43786,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 61393: +/***/ 62433: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25658,7 +43796,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 51821: +/***/ 37542: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25668,17 +43806,24 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 92635: +/***/ 73534: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); /***/ }), -/***/ 71301: +/***/ 70696: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25688,7 +43833,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 21268: +/***/ 81093: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25698,7 +43843,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 7192: +/***/ 96437: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25708,155 +43853,388 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 10640: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 62209: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(51821), exports); -tslib_1.__exportStar(__nccwpck_require__(92635), exports); -tslib_1.__exportStar(__nccwpck_require__(71301), exports); -tslib_1.__exportStar(__nccwpck_require__(21268), exports); -tslib_1.__exportStar(__nccwpck_require__(7192), exports); /***/ }), -/***/ 89029: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 94955: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(52562), exports); -tslib_1.__exportStar(__nccwpck_require__(26913), exports); -tslib_1.__exportStar(__nccwpck_require__(14994), exports); -tslib_1.__exportStar(__nccwpck_require__(65861), exports); -tslib_1.__exportStar(__nccwpck_require__(76527), exports); -tslib_1.__exportStar(__nccwpck_require__(48470), exports); -tslib_1.__exportStar(__nccwpck_require__(30820), exports); -tslib_1.__exportStar(__nccwpck_require__(67736), exports); -tslib_1.__exportStar(__nccwpck_require__(13268), exports); -tslib_1.__exportStar(__nccwpck_require__(90142), exports); -tslib_1.__exportStar(__nccwpck_require__(62338), exports); -tslib_1.__exportStar(__nccwpck_require__(99385), exports); -tslib_1.__exportStar(__nccwpck_require__(37521), exports); -tslib_1.__exportStar(__nccwpck_require__(61393), exports); -tslib_1.__exportStar(__nccwpck_require__(10640), exports); -tslib_1.__exportStar(__nccwpck_require__(89910), exports); -tslib_1.__exportStar(__nccwpck_require__(36678), exports); -tslib_1.__exportStar(__nccwpck_require__(39931), exports); -tslib_1.__exportStar(__nccwpck_require__(42620), exports); -tslib_1.__exportStar(__nccwpck_require__(89062), exports); -tslib_1.__exportStar(__nccwpck_require__(89546), exports); -tslib_1.__exportStar(__nccwpck_require__(80316), exports); -tslib_1.__exportStar(__nccwpck_require__(57835), exports); -tslib_1.__exportStar(__nccwpck_require__(91678), exports); -tslib_1.__exportStar(__nccwpck_require__(93818), exports); -tslib_1.__exportStar(__nccwpck_require__(51991), exports); -tslib_1.__exportStar(__nccwpck_require__(24296), exports); -tslib_1.__exportStar(__nccwpck_require__(59416), exports); -tslib_1.__exportStar(__nccwpck_require__(92772), exports); -tslib_1.__exportStar(__nccwpck_require__(20134), exports); -tslib_1.__exportStar(__nccwpck_require__(34465), exports); /***/ }), -/***/ 89910: -/***/ ((__unused_webpack_module, exports) => { +/***/ 65053: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AdaptiveRetryStrategy = void 0; +const config_1 = __nccwpck_require__(93435); +const DefaultRateLimiter_1 = __nccwpck_require__(22234); +const StandardRetryStrategy_1 = __nccwpck_require__(48361); +class AdaptiveRetryStrategy { + constructor(maxAttemptsProvider, options) { + this.maxAttemptsProvider = maxAttemptsProvider; + this.mode = config_1.RETRY_MODES.ADAPTIVE; + const { rateLimiter } = options !== null && options !== void 0 ? options : {}; + this.rateLimiter = rateLimiter !== null && rateLimiter !== void 0 ? rateLimiter : new DefaultRateLimiter_1.DefaultRateLimiter(); + this.standardRetryStrategy = new StandardRetryStrategy_1.StandardRetryStrategy(maxAttemptsProvider); + } + async acquireInitialRetryToken(retryTokenScope) { + await this.rateLimiter.getSendToken(); + return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope); + } + async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { + this.rateLimiter.updateClientSendingRate(errorInfo); + return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo); + } + recordSuccess(token) { + this.rateLimiter.updateClientSendingRate({}); + this.standardRetryStrategy.recordSuccess(token); + } +} +exports.AdaptiveRetryStrategy = AdaptiveRetryStrategy; /***/ }), -/***/ 36678: -/***/ ((__unused_webpack_module, exports) => { +/***/ 25689: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ConfiguredRetryStrategy = void 0; +const constants_1 = __nccwpck_require__(66302); +const StandardRetryStrategy_1 = __nccwpck_require__(48361); +class ConfiguredRetryStrategy extends StandardRetryStrategy_1.StandardRetryStrategy { + constructor(maxAttempts, computeNextBackoffDelay = constants_1.DEFAULT_RETRY_DELAY_BASE) { + super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts); + if (typeof computeNextBackoffDelay === "number") { + this.computeNextBackoffDelay = () => computeNextBackoffDelay; + } + else { + this.computeNextBackoffDelay = computeNextBackoffDelay; + } + } + async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { + const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo); + token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount()); + return token; + } +} +exports.ConfiguredRetryStrategy = ConfiguredRetryStrategy; /***/ }), -/***/ 39931: -/***/ ((__unused_webpack_module, exports) => { +/***/ 22234: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.DefaultRateLimiter = void 0; +const service_error_classification_1 = __nccwpck_require__(6375); +class DefaultRateLimiter { + constructor(options) { + var _a, _b, _c, _d, _e; + this.currentCapacity = 0; + this.enabled = false; + this.lastMaxRate = 0; + this.measuredTxRate = 0; + this.requestCount = 0; + this.lastTimestamp = 0; + this.timeWindow = 0; + this.beta = (_a = options === null || options === void 0 ? void 0 : options.beta) !== null && _a !== void 0 ? _a : 0.7; + this.minCapacity = (_b = options === null || options === void 0 ? void 0 : options.minCapacity) !== null && _b !== void 0 ? _b : 1; + this.minFillRate = (_c = options === null || options === void 0 ? void 0 : options.minFillRate) !== null && _c !== void 0 ? _c : 0.5; + this.scaleConstant = (_d = options === null || options === void 0 ? void 0 : options.scaleConstant) !== null && _d !== void 0 ? _d : 0.4; + this.smooth = (_e = options === null || options === void 0 ? void 0 : options.smooth) !== null && _e !== void 0 ? _e : 0.8; + const currentTimeInSeconds = this.getCurrentTimeInSeconds(); + this.lastThrottleTime = currentTimeInSeconds; + this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds()); + this.fillRate = this.minFillRate; + this.maxCapacity = this.minCapacity; + } + getCurrentTimeInSeconds() { + return Date.now() / 1000; + } + async getSendToken() { + return this.acquireTokenBucket(1); + } + async acquireTokenBucket(amount) { + if (!this.enabled) { + return; + } + this.refillTokenBucket(); + if (amount > this.currentCapacity) { + const delay = ((amount - this.currentCapacity) / this.fillRate) * 1000; + await new Promise((resolve) => setTimeout(resolve, delay)); + } + this.currentCapacity = this.currentCapacity - amount; + } + refillTokenBucket() { + const timestamp = this.getCurrentTimeInSeconds(); + if (!this.lastTimestamp) { + this.lastTimestamp = timestamp; + return; + } + const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate; + this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount); + this.lastTimestamp = timestamp; + } + updateClientSendingRate(response) { + let calculatedRate; + this.updateMeasuredRate(); + if ((0, service_error_classification_1.isThrottlingError)(response)) { + const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate); + this.lastMaxRate = rateToUse; + this.calculateTimeWindow(); + this.lastThrottleTime = this.getCurrentTimeInSeconds(); + calculatedRate = this.cubicThrottle(rateToUse); + this.enableTokenBucket(); + } + else { + this.calculateTimeWindow(); + calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds()); + } + const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate); + this.updateTokenBucketRate(newRate); + } + calculateTimeWindow() { + this.timeWindow = this.getPrecise(Math.pow((this.lastMaxRate * (1 - this.beta)) / this.scaleConstant, 1 / 3)); + } + cubicThrottle(rateToUse) { + return this.getPrecise(rateToUse * this.beta); + } + cubicSuccess(timestamp) { + return this.getPrecise(this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate); + } + enableTokenBucket() { + this.enabled = true; + } + updateTokenBucketRate(newRate) { + this.refillTokenBucket(); + this.fillRate = Math.max(newRate, this.minFillRate); + this.maxCapacity = Math.max(newRate, this.minCapacity); + this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity); + } + updateMeasuredRate() { + const t = this.getCurrentTimeInSeconds(); + const timeBucket = Math.floor(t * 2) / 2; + this.requestCount++; + if (timeBucket > this.lastTxRateBucket) { + const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket); + this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth)); + this.requestCount = 0; + this.lastTxRateBucket = timeBucket; + } + } + getPrecise(num) { + return parseFloat(num.toFixed(8)); + } +} +exports.DefaultRateLimiter = DefaultRateLimiter; /***/ }), -/***/ 42620: -/***/ ((__unused_webpack_module, exports) => { +/***/ 48361: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.StandardRetryStrategy = void 0; +const config_1 = __nccwpck_require__(93435); +const constants_1 = __nccwpck_require__(66302); +const defaultRetryBackoffStrategy_1 = __nccwpck_require__(21337); +const defaultRetryToken_1 = __nccwpck_require__(1127); +class StandardRetryStrategy { + constructor(maxAttempts) { + this.maxAttempts = maxAttempts; + this.mode = config_1.RETRY_MODES.STANDARD; + this.capacity = constants_1.INITIAL_RETRY_TOKENS; + this.retryBackoffStrategy = (0, defaultRetryBackoffStrategy_1.getDefaultRetryBackoffStrategy)(); + this.maxAttemptsProvider = typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts; + } + async acquireInitialRetryToken(retryTokenScope) { + return (0, defaultRetryToken_1.createDefaultRetryToken)({ + retryDelay: constants_1.DEFAULT_RETRY_DELAY_BASE, + retryCount: 0, + }); + } + async refreshRetryTokenForRetry(token, errorInfo) { + const maxAttempts = await this.getMaxAttempts(); + if (this.shouldRetry(token, errorInfo, maxAttempts)) { + const errorType = errorInfo.errorType; + this.retryBackoffStrategy.setDelayBase(errorType === "THROTTLING" ? constants_1.THROTTLING_RETRY_DELAY_BASE : constants_1.DEFAULT_RETRY_DELAY_BASE); + const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount()); + const retryDelay = errorInfo.retryAfterHint + ? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType) + : delayFromErrorType; + const capacityCost = this.getCapacityCost(errorType); + this.capacity -= capacityCost; + return (0, defaultRetryToken_1.createDefaultRetryToken)({ + retryDelay, + retryCount: token.getRetryCount() + 1, + retryCost: capacityCost, + }); + } + throw new Error("No retry token available"); + } + recordSuccess(token) { + var _a; + this.capacity = Math.max(constants_1.INITIAL_RETRY_TOKENS, this.capacity + ((_a = token.getRetryCost()) !== null && _a !== void 0 ? _a : constants_1.NO_RETRY_INCREMENT)); + } + getCapacity() { + return this.capacity; + } + async getMaxAttempts() { + try { + return await this.maxAttemptsProvider(); + } + catch (error) { + console.warn(`Max attempts provider could not resolve. Using default of ${config_1.DEFAULT_MAX_ATTEMPTS}`); + return config_1.DEFAULT_MAX_ATTEMPTS; + } + } + shouldRetry(tokenToRenew, errorInfo, maxAttempts) { + const attempts = tokenToRenew.getRetryCount() + 1; + return (attempts < maxAttempts && + this.capacity >= this.getCapacityCost(errorInfo.errorType) && + this.isRetryableError(errorInfo.errorType)); + } + getCapacityCost(errorType) { + return errorType === "TRANSIENT" ? constants_1.TIMEOUT_RETRY_COST : constants_1.RETRY_COST; + } + isRetryableError(errorType) { + return errorType === "THROTTLING" || errorType === "TRANSIENT"; + } +} +exports.StandardRetryStrategy = StandardRetryStrategy; /***/ }), -/***/ 89062: +/***/ 93435: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.DEFAULT_RETRY_MODE = exports.DEFAULT_MAX_ATTEMPTS = exports.RETRY_MODES = void 0; +var RETRY_MODES; +(function (RETRY_MODES) { + RETRY_MODES["STANDARD"] = "standard"; + RETRY_MODES["ADAPTIVE"] = "adaptive"; +})(RETRY_MODES = exports.RETRY_MODES || (exports.RETRY_MODES = {})); +exports.DEFAULT_MAX_ATTEMPTS = 3; +exports.DEFAULT_RETRY_MODE = RETRY_MODES.STANDARD; /***/ }), -/***/ 89546: +/***/ 66302: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.REQUEST_HEADER = exports.INVOCATION_ID_HEADER = exports.NO_RETRY_INCREMENT = exports.TIMEOUT_RETRY_COST = exports.RETRY_COST = exports.INITIAL_RETRY_TOKENS = exports.THROTTLING_RETRY_DELAY_BASE = exports.MAXIMUM_RETRY_DELAY = exports.DEFAULT_RETRY_DELAY_BASE = void 0; +exports.DEFAULT_RETRY_DELAY_BASE = 100; +exports.MAXIMUM_RETRY_DELAY = 20 * 1000; +exports.THROTTLING_RETRY_DELAY_BASE = 500; +exports.INITIAL_RETRY_TOKENS = 500; +exports.RETRY_COST = 5; +exports.TIMEOUT_RETRY_COST = 10; +exports.NO_RETRY_INCREMENT = 1; +exports.INVOCATION_ID_HEADER = "amz-sdk-invocation-id"; +exports.REQUEST_HEADER = "amz-sdk-request"; /***/ }), -/***/ 80316: -/***/ ((__unused_webpack_module, exports) => { +/***/ 21337: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getDefaultRetryBackoffStrategy = void 0; +const constants_1 = __nccwpck_require__(66302); +const getDefaultRetryBackoffStrategy = () => { + let delayBase = constants_1.DEFAULT_RETRY_DELAY_BASE; + const computeNextBackoffDelay = (attempts) => { + return Math.floor(Math.min(constants_1.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); + }; + const setDelayBase = (delay) => { + delayBase = delay; + }; + return { + computeNextBackoffDelay, + setDelayBase, + }; +}; +exports.getDefaultRetryBackoffStrategy = getDefaultRetryBackoffStrategy; /***/ }), -/***/ 57835: -/***/ ((__unused_webpack_module, exports) => { +/***/ 1127: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.createDefaultRetryToken = void 0; +const constants_1 = __nccwpck_require__(66302); +const createDefaultRetryToken = ({ retryDelay, retryCount, retryCost, }) => { + const getRetryCount = () => retryCount; + const getRetryDelay = () => Math.min(constants_1.MAXIMUM_RETRY_DELAY, retryDelay); + const getRetryCost = () => retryCost; + return { + getRetryCount, + getRetryDelay, + getRetryCost, + }; +}; +exports.createDefaultRetryToken = createDefaultRetryToken; /***/ }), -/***/ 91678: -/***/ ((__unused_webpack_module, exports) => { +/***/ 84902: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(65053), exports); +tslib_1.__exportStar(__nccwpck_require__(25689), exports); +tslib_1.__exportStar(__nccwpck_require__(22234), exports); +tslib_1.__exportStar(__nccwpck_require__(48361), exports); +tslib_1.__exportStar(__nccwpck_require__(93435), exports); +tslib_1.__exportStar(__nccwpck_require__(66302), exports); +tslib_1.__exportStar(__nccwpck_require__(75427), exports); /***/ }), -/***/ 93818: +/***/ 75427: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -25866,918 +44244,1237 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 51991: -/***/ ((__unused_webpack_module, exports) => { +/***/ 22094: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Uint8ArrayBlobAdapter = void 0; +const transforms_1 = __nccwpck_require__(82098); +class Uint8ArrayBlobAdapter extends Uint8Array { + static fromString(source, encoding = "utf-8") { + switch (typeof source) { + case "string": + return (0, transforms_1.transformFromString)(source, encoding); + default: + throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`); + } + } + static mutate(source) { + Object.setPrototypeOf(source, Uint8ArrayBlobAdapter.prototype); + return source; + } + transformToString(encoding = "utf-8") { + return (0, transforms_1.transformToString)(this, encoding); + } +} +exports.Uint8ArrayBlobAdapter = Uint8ArrayBlobAdapter; /***/ }), -/***/ 24296: -/***/ ((__unused_webpack_module, exports) => { +/***/ 82098: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.transformFromString = exports.transformToString = void 0; +const util_base64_1 = __nccwpck_require__(75600); +const util_utf8_1 = __nccwpck_require__(41895); +const Uint8ArrayBlobAdapter_1 = __nccwpck_require__(22094); +function transformToString(payload, encoding = "utf-8") { + if (encoding === "base64") { + return (0, util_base64_1.toBase64)(payload); + } + return (0, util_utf8_1.toUtf8)(payload); +} +exports.transformToString = transformToString; +function transformFromString(str, encoding) { + if (encoding === "base64") { + return Uint8ArrayBlobAdapter_1.Uint8ArrayBlobAdapter.mutate((0, util_base64_1.fromBase64)(str)); + } + return Uint8ArrayBlobAdapter_1.Uint8ArrayBlobAdapter.mutate((0, util_utf8_1.fromUtf8)(str)); +} +exports.transformFromString = transformFromString; /***/ }), -/***/ 59416: -/***/ ((__unused_webpack_module, exports) => { +/***/ 23636: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.RequestHandlerProtocol = void 0; -var RequestHandlerProtocol; -(function (RequestHandlerProtocol) { - RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; - RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; - RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; -})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); +exports.getAwsChunkedEncodingStream = void 0; +const stream_1 = __nccwpck_require__(12781); +const getAwsChunkedEncodingStream = (readableStream, options) => { + const { base64Encoder, bodyLengthChecker, checksumAlgorithmFn, checksumLocationName, streamHasher } = options; + const checksumRequired = base64Encoder !== undefined && + checksumAlgorithmFn !== undefined && + checksumLocationName !== undefined && + streamHasher !== undefined; + const digest = checksumRequired ? streamHasher(checksumAlgorithmFn, readableStream) : undefined; + const awsChunkedEncodingStream = new stream_1.Readable({ read: () => { } }); + readableStream.on("data", (data) => { + const length = bodyLengthChecker(data) || 0; + awsChunkedEncodingStream.push(`${length.toString(16)}\r\n`); + awsChunkedEncodingStream.push(data); + awsChunkedEncodingStream.push("\r\n"); + }); + readableStream.on("end", async () => { + awsChunkedEncodingStream.push(`0\r\n`); + if (checksumRequired) { + const checksum = base64Encoder(await digest); + awsChunkedEncodingStream.push(`${checksumLocationName}:${checksum}\r\n`); + awsChunkedEncodingStream.push(`\r\n`); + } + awsChunkedEncodingStream.push(null); + }); + return awsChunkedEncodingStream; +}; +exports.getAwsChunkedEncodingStream = getAwsChunkedEncodingStream; /***/ }), -/***/ 92772: -/***/ ((__unused_webpack_module, exports) => { +/***/ 96607: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(22094), exports); +tslib_1.__exportStar(__nccwpck_require__(23636), exports); +tslib_1.__exportStar(__nccwpck_require__(4515), exports); /***/ }), -/***/ 20134: -/***/ ((__unused_webpack_module, exports) => { +/***/ 4515: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.sdkStreamMixin = void 0; +const node_http_handler_1 = __nccwpck_require__(6123); +const util_buffer_from_1 = __nccwpck_require__(31381); +const stream_1 = __nccwpck_require__(12781); +const util_1 = __nccwpck_require__(73837); +const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; +const sdkStreamMixin = (stream) => { + var _a, _b; + if (!(stream instanceof stream_1.Readable)) { + const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; + throw new Error(`Unexpected stream implementation, expect Stream.Readable instance, got ${name}`); + } + let transformed = false; + const transformToByteArray = async () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + transformed = true; + return await (0, node_http_handler_1.streamCollector)(stream); + }; + return Object.assign(stream, { + transformToByteArray, + transformToString: async (encoding) => { + const buf = await transformToByteArray(); + if (encoding === undefined || Buffer.isEncoding(encoding)) { + return (0, util_buffer_from_1.fromArrayBuffer)(buf.buffer, buf.byteOffset, buf.byteLength).toString(encoding); + } + else { + const decoder = new util_1.TextDecoder(encoding); + return decoder.decode(buf); + } + }, + transformToWebStream: () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + if (stream.readableFlowing !== null) { + throw new Error("The stream has been consumed by other callbacks."); + } + if (typeof stream_1.Readable.toWeb !== "function") { + throw new Error("Readable.toWeb() is not supported. Please make sure you are using Node.js >= 17.0.0, or polyfill is available."); + } + transformed = true; + return stream_1.Readable.toWeb(stream); + }, + }); +}; +exports.sdkStreamMixin = sdkStreamMixin; /***/ }), -/***/ 34465: +/***/ 67461: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODEJS_TIMEOUT_ERROR_CODES = void 0; +exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; /***/ }), -/***/ 2992: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.parseUrl = void 0; -const querystring_parser_1 = __nccwpck_require__(47424); -const parseUrl = (url) => { - if (typeof url === "string") { - return (0, exports.parseUrl)(new URL(url)); - } - const { hostname, pathname, port, protocol, search } = url; - let query; - if (search) { - query = (0, querystring_parser_1.parseQueryString)(search); - } - return { - hostname, - port: port ? parseInt(port) : undefined, - protocol, - path: pathname, - query, - }; -}; -exports.parseUrl = parseUrl; - - -/***/ }), - -/***/ 58444: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 47813: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromBase64 = void 0; -const util_buffer_from_1 = __nccwpck_require__(36010); -const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; -const fromBase64 = (input) => { - if ((input.length * 3) % 4 !== 0) { - throw new TypeError(`Incorrect padding on base64 string.`); - } - if (!BASE64_REGEX.exec(input)) { - throw new TypeError(`Invalid base64 string.`); +exports.getTransformedHeaders = void 0; +const getTransformedHeaders = (headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; } - const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); - return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); + return transformedHeaders; }; -exports.fromBase64 = fromBase64; +exports.getTransformedHeaders = getTransformedHeaders; /***/ }), -/***/ 97727: +/***/ 6123: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(58444), exports); -tslib_1.__exportStar(__nccwpck_require__(63439), exports); +tslib_1.__exportStar(__nccwpck_require__(24687), exports); +tslib_1.__exportStar(__nccwpck_require__(68609), exports); +tslib_1.__exportStar(__nccwpck_require__(87527), exports); /***/ }), -/***/ 63439: +/***/ 24687: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.toBase64 = void 0; -const util_buffer_from_1 = __nccwpck_require__(36010); -const toBase64 = (input) => (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); -exports.toBase64 = toBase64; +exports.NodeHttpHandler = exports.DEFAULT_REQUEST_TIMEOUT = void 0; +const protocol_http_1 = __nccwpck_require__(73070); +const querystring_builder_1 = __nccwpck_require__(1205); +const http_1 = __nccwpck_require__(13685); +const https_1 = __nccwpck_require__(95687); +const constants_1 = __nccwpck_require__(67461); +const get_transformed_headers_1 = __nccwpck_require__(47813); +const set_connection_timeout_1 = __nccwpck_require__(79679); +const set_socket_keep_alive_1 = __nccwpck_require__(83861); +const set_socket_timeout_1 = __nccwpck_require__(67954); +const write_request_body_1 = __nccwpck_require__(7389); +exports.DEFAULT_REQUEST_TIMEOUT = 0; +class NodeHttpHandler { + constructor(options) { + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }) + .catch(reject); + } + else { + resolve(this.resolveDefaultConfig(options)); + } + }); + } + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + requestTimeout: requestTimeout !== null && requestTimeout !== void 0 ? requestTimeout : socketTimeout, + httpAgent: httpAgent || new http_1.Agent({ keepAlive, maxSockets }), + httpsAgent: httpsAgent || new https_1.Agent({ keepAlive, maxSockets }), + }; + } + destroy() { + var _a, _b, _c, _d; + (_b = (_a = this.config) === null || _a === void 0 ? void 0 : _a.httpAgent) === null || _b === void 0 ? void 0 : _b.destroy(); + (_d = (_c = this.config) === null || _c === void 0 ? void 0 : _c.httpsAgent) === null || _d === void 0 ? void 0 : _d.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + return new Promise((_resolve, _reject) => { + var _a, _b; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const queryString = (0, querystring_builder_1.buildQueryString)(request.query || {}); + let auth = undefined; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}`; + } + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const nodeHttpsOptions = { + headers: request.headers, + host: request.hostname, + method: request.method, + path, + port: request.port, + agent: isSSL ? this.config.httpsAgent : this.config.httpAgent, + auth, + }; + const requestFunc = isSSL ? https_1.request : http_1.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(res.headers), + body: res, + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } + else { + reject(err); + } + }); + (0, set_connection_timeout_1.setConnectionTimeout)(req, reject, this.config.connectionTimeout); + (0, set_socket_timeout_1.setSocketTimeout)(req, reject, this.config.requestTimeout); + if (abortSignal) { + abortSignal.onabort = () => { + req.abort(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }; + } + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + (0, set_socket_keep_alive_1.setSocketKeepAlive)(req, { + keepAlive: httpAgent.keepAlive, + keepAliveMsecs: httpAgent.keepAliveMsecs, + }); + } + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, this.config.requestTimeout).catch(_reject); + }); + } + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); + } + httpHandlerConfigs() { + var _a; + return (_a = this.config) !== null && _a !== void 0 ? _a : {}; + } +} +exports.NodeHttpHandler = NodeHttpHandler; /***/ }), -/***/ 89190: +/***/ 48920: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.calculateBodyLength = void 0; -const fs_1 = __nccwpck_require__(57147); -const calculateBodyLength = (body) => { - if (!body) { - return 0; +exports.NodeHttp2ConnectionManager = void 0; +const tslib_1 = __nccwpck_require__(4351); +const http2_1 = tslib_1.__importDefault(__nccwpck_require__(85158)); +const node_http2_connection_pool_1 = __nccwpck_require__(4735); +class NodeHttp2ConnectionManager { + constructor(config) { + this.sessionCache = new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); + } } - if (typeof body === "string") { - return Buffer.from(body).length; + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; + } + } + const session = http2_1.default.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error("Fail to set maxConcurrentStreams to " + + this.config.maxConcurrency + + "when creating new session for " + + requestContext.destination.toString()); + } + }); + } + session.unref(); + const destroySessionCb = () => { + session.destroy(); + this.deleteSession(url, session); + }; + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new node_http2_connection_pool_1.NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; } - else if (typeof body.byteLength === "number") { - return body.byteLength; + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; + } + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); } - else if (typeof body.size === "number") { - return body.size; + release(requestContext, session) { + var _a; + const cacheKey = this.getUrlString(requestContext); + (_a = this.sessionCache.get(cacheKey)) === null || _a === void 0 ? void 0 : _a.offerLast(session); } - else if (typeof body.path === "string" || Buffer.isBuffer(body.path)) { - return (0, fs_1.lstatSync)(body.path).size; + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); + } + this.sessionCache.delete(key); + } } - else if (typeof body.fd === "number") { - return (0, fs_1.fstatSync)(body.fd).size; + setMaxConcurrentStreams(maxConcurrentStreams) { + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); + } + this.config.maxConcurrency = maxConcurrentStreams; } - throw new Error(`Body Length computation failed for ${body}`); -}; -exports.calculateBodyLength = calculateBodyLength; + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; + } + getUrlString(request) { + return request.destination.toString(); + } +} +exports.NodeHttp2ConnectionManager = NodeHttp2ConnectionManager; /***/ }), -/***/ 74147: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 4735: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(89190), exports); +exports.NodeHttp2ConnectionPool = void 0; +class NodeHttp2ConnectionPool { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions !== null && sessions !== void 0 ? sessions : []; + } + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); + } + } + offerLast(session) { + this.sessions.push(session); + } + contains(session) { + return this.sessions.includes(session); + } + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); + } + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); + } + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } + } + } + } +} +exports.NodeHttp2ConnectionPool = NodeHttp2ConnectionPool; /***/ }), -/***/ 36010: +/***/ 68609: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.fromString = exports.fromArrayBuffer = void 0; -const is_array_buffer_1 = __nccwpck_require__(69126); -const buffer_1 = __nccwpck_require__(14300); -const fromArrayBuffer = (input, offset = 0, length = input.byteLength - offset) => { - if (!(0, is_array_buffer_1.isArrayBuffer)(input)) { - throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); +exports.NodeHttp2Handler = void 0; +const protocol_http_1 = __nccwpck_require__(73070); +const querystring_builder_1 = __nccwpck_require__(1205); +const http2_1 = __nccwpck_require__(85158); +const get_transformed_headers_1 = __nccwpck_require__(47813); +const node_http2_connection_manager_1 = __nccwpck_require__(48920); +const write_request_body_1 = __nccwpck_require__(7389); +class NodeHttp2Handler { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new node_http2_connection_manager_1.NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((opts) => { + resolve(opts || {}); + }) + .catch(reject); + } + else { + resolve(options || {}); + } + }); + } + destroy() { + this.connectionManager.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } + } + const { requestTimeout, disableConcurrentStreams } = this.config; + return new Promise((_resolve, _reject) => { + var _a, _b, _c; + let fulfilled = false; + let writeRequestBodyPromise = undefined; + const resolve = async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }; + const reject = async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }; + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request; + let auth = ""; + if (request.username != null || request.password != null) { + const username = (_a = request.username) !== null && _a !== void 0 ? _a : ""; + const password = (_b = request.password) !== null && _b !== void 0 ? _b : ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: (_c = this.config) === null || _c === void 0 ? void 0 : _c.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false, + }); + const rejectWithDestroy = (err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + reject(err); + }; + const queryString = (0, querystring_builder_1.buildQueryString)(query || {}); + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const req = session.request({ + ...request.headers, + [http2_1.constants.HTTP2_HEADER_PATH]: path, + [http2_1.constants.HTTP2_HEADER_METHOD]: method, + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(headers), + body: req, + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (requestTimeout) { + req.setTimeout(requestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + abortSignal.onabort = () => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }; + } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy(new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`)); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, requestTimeout); + }); } - return buffer_1.Buffer.from(input, offset, length); -}; -exports.fromArrayBuffer = fromArrayBuffer; -const fromString = (input, encoding) => { - if (typeof input !== "string") { - throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); + updateHttpClientConfig(key, value) { + this.config = undefined; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value, + }; + }); } - return encoding ? buffer_1.Buffer.from(input, encoding) : buffer_1.Buffer.from(input); -}; -exports.fromString = fromString; + httpHandlerConfigs() { + var _a; + return (_a = this.config) !== null && _a !== void 0 ? _a : {}; + } + destroySession(session) { + if (!session.destroyed) { + session.destroy(); + } + } +} +exports.NodeHttp2Handler = NodeHttp2Handler; /***/ }), -/***/ 79509: +/***/ 79679: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.booleanSelector = exports.SelectorType = void 0; -var SelectorType; -(function (SelectorType) { - SelectorType["ENV"] = "env"; - SelectorType["CONFIG"] = "shared config entry"; -})(SelectorType = exports.SelectorType || (exports.SelectorType = {})); -const booleanSelector = (obj, key, type) => { - if (!(key in obj)) - return undefined; - if (obj[key] === "true") - return true; - if (obj[key] === "false") - return false; - throw new Error(`Cannot load ${type} "${key}". Expected "true" or "false", got ${obj[key]}.`); +exports.setConnectionTimeout = void 0; +const setConnectionTimeout = (request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return; + } + const timeoutId = setTimeout(() => { + request.destroy(); + reject(Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError", + })); + }, timeoutInMs); + request.on("socket", (socket) => { + if (socket.connecting) { + socket.on("connect", () => { + clearTimeout(timeoutId); + }); + } + else { + clearTimeout(timeoutId); + } + }); }; -exports.booleanSelector = booleanSelector; - - -/***/ }), - -/***/ 6168: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(79509), exports); +exports.setConnectionTimeout = setConnectionTimeout; /***/ }), -/***/ 16488: +/***/ 83861: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.IMDS_REGION_PATH = exports.DEFAULTS_MODE_OPTIONS = exports.ENV_IMDS_DISABLED = exports.AWS_DEFAULT_REGION_ENV = exports.AWS_REGION_ENV = exports.AWS_EXECUTION_ENV = void 0; -exports.AWS_EXECUTION_ENV = "AWS_EXECUTION_ENV"; -exports.AWS_REGION_ENV = "AWS_REGION"; -exports.AWS_DEFAULT_REGION_ENV = "AWS_DEFAULT_REGION"; -exports.ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; -exports.DEFAULTS_MODE_OPTIONS = ["in-region", "cross-region", "mobile", "standard", "legacy"]; -exports.IMDS_REGION_PATH = "/latest/meta-data/placement/region"; +exports.setSocketKeepAlive = void 0; +const setSocketKeepAlive = (request, { keepAlive, keepAliveMsecs }) => { + if (keepAlive !== true) { + return; + } + request.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); +}; +exports.setSocketKeepAlive = setSocketKeepAlive; /***/ }), -/***/ 28450: +/***/ 67954: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NODE_DEFAULTS_MODE_CONFIG_OPTIONS = void 0; -const AWS_DEFAULTS_MODE_ENV = "AWS_DEFAULTS_MODE"; -const AWS_DEFAULTS_MODE_CONFIG = "defaults_mode"; -exports.NODE_DEFAULTS_MODE_CONFIG_OPTIONS = { - environmentVariableSelector: (env) => { - return env[AWS_DEFAULTS_MODE_ENV]; - }, - configFileSelector: (profile) => { - return profile[AWS_DEFAULTS_MODE_CONFIG]; - }, - default: "legacy", +exports.setSocketTimeout = void 0; +const setSocketTimeout = (request, reject, timeoutInMs = 0) => { + request.setTimeout(timeoutInMs, () => { + request.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }); }; +exports.setSocketTimeout = setSocketTimeout; /***/ }), -/***/ 74243: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(18238), exports); - - -/***/ }), - -/***/ 18238: +/***/ 36206: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveDefaultsModeConfig = void 0; -const config_resolver_1 = __nccwpck_require__(56153); -const credential_provider_imds_1 = __nccwpck_require__(25898); -const node_config_provider_1 = __nccwpck_require__(87684); -const property_provider_1 = __nccwpck_require__(74462); -const constants_1 = __nccwpck_require__(16488); -const defaultsModeConfig_1 = __nccwpck_require__(28450); -const resolveDefaultsModeConfig = ({ region = (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS), defaultsMode = (0, node_config_provider_1.loadConfig)(defaultsModeConfig_1.NODE_DEFAULTS_MODE_CONFIG_OPTIONS), } = {}) => (0, property_provider_1.memoize)(async () => { - const mode = typeof defaultsMode === "function" ? await defaultsMode() : defaultsMode; - switch (mode === null || mode === void 0 ? void 0 : mode.toLowerCase()) { - case "auto": - return resolveNodeDefaultsModeAuto(region); - case "in-region": - case "cross-region": - case "mobile": - case "standard": - case "legacy": - return Promise.resolve(mode === null || mode === void 0 ? void 0 : mode.toLocaleLowerCase()); - case undefined: - return Promise.resolve("legacy"); - default: - throw new Error(`Invalid parameter for "defaultsMode", expect ${constants_1.DEFAULTS_MODE_OPTIONS.join(", ")}, got ${mode}`); - } -}); -exports.resolveDefaultsModeConfig = resolveDefaultsModeConfig; -const resolveNodeDefaultsModeAuto = async (clientRegion) => { - if (clientRegion) { - const resolvedRegion = typeof clientRegion === "function" ? await clientRegion() : clientRegion; - const inferredRegion = await inferPhysicalRegion(); - if (!inferredRegion) { - return "standard"; - } - if (resolvedRegion === inferredRegion) { - return "in-region"; - } - else { - return "cross-region"; - } - } - return "standard"; -}; -const inferPhysicalRegion = async () => { - var _a; - if (process.env[constants_1.AWS_EXECUTION_ENV] && (process.env[constants_1.AWS_REGION_ENV] || process.env[constants_1.AWS_DEFAULT_REGION_ENV])) { - return (_a = process.env[constants_1.AWS_REGION_ENV]) !== null && _a !== void 0 ? _a : process.env[constants_1.AWS_DEFAULT_REGION_ENV]; +exports.Collector = void 0; +const stream_1 = __nccwpck_require__(12781); +class Collector extends stream_1.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; } - if (!process.env[constants_1.ENV_IMDS_DISABLED]) { - try { - const endpoint = await (0, credential_provider_imds_1.getInstanceMetadataEndpoint)(); - return (await (0, credential_provider_imds_1.httpRequest)({ ...endpoint, path: constants_1.IMDS_REGION_PATH })).toString(); - } - catch (e) { - } + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); } -}; - - -/***/ }), - -/***/ 81809: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.debugId = void 0; -exports.debugId = "endpoints"; +} +exports.Collector = Collector; /***/ }), -/***/ 27617: +/***/ 87527: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(81809), exports); -tslib_1.__exportStar(__nccwpck_require__(46833), exports); +exports.streamCollector = void 0; +const collector_1 = __nccwpck_require__(36206); +const streamCollector = (stream) => new Promise((resolve, reject) => { + const collector = new collector_1.Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function () { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); +}); +exports.streamCollector = streamCollector; /***/ }), -/***/ 46833: -/***/ ((__unused_webpack_module, exports) => { +/***/ 7389: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.toDebugString = void 0; -function toDebugString(input) { - if (typeof input !== "object" || input == null) { - return input; +exports.writeRequestBody = void 0; +const stream_1 = __nccwpck_require__(12781); +const MIN_WAIT_TIME = 1000; +async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { + var _a; + const headers = (_a = request.headers) !== null && _a !== void 0 ? _a : {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let hasError = false; + if (expect === "100-continue") { + await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + clearTimeout(timeoutId); + resolve(); + }); + httpRequest.on("error", () => { + hasError = true; + clearTimeout(timeoutId); + resolve(); + }); + }), + ]); } - if ("ref" in input) { - return `$${toDebugString(input.ref)}`; + if (!hasError) { + writeBody(httpRequest, request.body); } - if ("fn" in input) { - return `${input.fn}(${(input.argv || []).map(toDebugString).join(", ")})`; +} +exports.writeRequestBody = writeRequestBody; +function writeBody(httpRequest, body) { + if (body instanceof stream_1.Readable) { + body.pipe(httpRequest); + } + else if (body) { + httpRequest.end(Buffer.from(body)); + } + else { + httpRequest.end(); } - return JSON.stringify(input, null, 2); } -exports.toDebugString = toDebugString; - - -/***/ }), - -/***/ 13350: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(37482), exports); -tslib_1.__exportStar(__nccwpck_require__(36563), exports); -tslib_1.__exportStar(__nccwpck_require__(57433), exports); /***/ }), -/***/ 46835: +/***/ 43002: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(48079), exports); -tslib_1.__exportStar(__nccwpck_require__(34711), exports); -tslib_1.__exportStar(__nccwpck_require__(37482), exports); +exports.Field = void 0; +const types_1 = __nccwpck_require__(50999); +class Field { + constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + add(value) { + this.values.push(value); + } + set(values) { + this.values = values; + } + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + toString() { + return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); + } + get() { + return this.values; + } +} +exports.Field = Field; /***/ }), -/***/ 48079: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 67010: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isVirtualHostableS3Bucket = void 0; -const isIpAddress_1 = __nccwpck_require__(73442); -const isValidHostLabel_1 = __nccwpck_require__(57373); -const isVirtualHostableS3Bucket = (value, allowSubDomains = false) => { - if (allowSubDomains) { - for (const label of value.split(".")) { - if (!(0, exports.isVirtualHostableS3Bucket)(label)) { - return false; - } - } - return true; +exports.Fields = void 0; +class Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; } - if (!(0, isValidHostLabel_1.isValidHostLabel)(value)) { - return false; + setField(field) { + this.entries[field.name.toLowerCase()] = field; } - if (value.length < 3 || value.length > 63) { - return false; + getField(name) { + return this.entries[name.toLowerCase()]; } - if (value !== value.toLowerCase()) { - return false; + removeField(name) { + delete this.entries[name.toLowerCase()]; } - if ((0, isIpAddress_1.isIpAddress)(value)) { - return false; + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); } - return true; -}; -exports.isVirtualHostableS3Bucket = isVirtualHostableS3Bucket; +} +exports.Fields = Fields; /***/ }), -/***/ 34711: +/***/ 76280: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.parseArn = void 0; -const parseArn = (value) => { - const segments = value.split(":"); - if (segments.length < 6) - return null; - const [arn, partition, service, region, accountId, ...resourceId] = segments; - if (arn !== "arn" || partition === "" || service === "" || resourceId[0] === "") - return null; +exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0; +const getHttpHandlerExtensionConfiguration = (runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; return { - partition, - service, - region, - accountId, - resourceId: resourceId[0].includes("/") ? resourceId[0].split("/") : resourceId, + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + }, }; }; -exports.parseArn = parseArn; +exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration; +const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler(), + }; +}; +exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig; /***/ }), -/***/ 37482: +/***/ 33450: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getUserAgentPrefix = exports.useDefaultPartitionInfo = exports.setPartitionInfo = exports.partition = void 0; const tslib_1 = __nccwpck_require__(4351); -const partitions_json_1 = tslib_1.__importDefault(__nccwpck_require__(95367)); -let selectedPartitionsInfo = partitions_json_1.default; -let selectedUserAgentPrefix = ""; -const partition = (value) => { - const { partitions } = selectedPartitionsInfo; - for (const partition of partitions) { - const { regions, outputs } = partition; - for (const [region, regionData] of Object.entries(regions)) { - if (region === value) { - return { - ...outputs, - ...regionData, - }; - } - } - } - for (const partition of partitions) { - const { regionRegex, outputs } = partition; - if (new RegExp(regionRegex).test(value)) { - return { - ...outputs, - }; - } - } - const DEFAULT_PARTITION = partitions.find((partition) => partition.id === "aws"); - if (!DEFAULT_PARTITION) { - throw new Error("Provided region was not found in the partition array or regex," + - " and default partition with id 'aws' doesn't exist."); - } - return { - ...DEFAULT_PARTITION.outputs, - }; -}; -exports.partition = partition; -const setPartitionInfo = (partitionsInfo, userAgentPrefix = "") => { - selectedPartitionsInfo = partitionsInfo; - selectedUserAgentPrefix = userAgentPrefix; -}; -exports.setPartitionInfo = setPartitionInfo; -const useDefaultPartitionInfo = () => { - (0, exports.setPartitionInfo)(partitions_json_1.default, ""); -}; -exports.useDefaultPartitionInfo = useDefaultPartitionInfo; -const getUserAgentPrefix = () => selectedUserAgentPrefix; -exports.getUserAgentPrefix = getUserAgentPrefix; +tslib_1.__exportStar(__nccwpck_require__(76280), exports); /***/ }), -/***/ 55370: +/***/ 29095: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.booleanEquals = void 0; -const booleanEquals = (value1, value2) => value1 === value2; -exports.booleanEquals = booleanEquals; /***/ }), -/***/ 20767: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 22312: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getAttr = void 0; -const types_1 = __nccwpck_require__(57433); -const getAttrPathList_1 = __nccwpck_require__(81844); -const getAttr = (value, path) => (0, getAttrPathList_1.getAttrPathList)(path).reduce((acc, index) => { - if (typeof acc !== "object") { - throw new types_1.EndpointError(`Index '${index}' in '${path}' not found in '${JSON.stringify(value)}'`); +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; } - else if (Array.isArray(acc)) { - return acc[parseInt(index)]; + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); } - return acc[index]; -}, value); -exports.getAttr = getAttr; + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; + } +} +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} /***/ }), -/***/ 81844: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getAttrPathList = void 0; -const types_1 = __nccwpck_require__(57433); -const getAttrPathList = (path) => { - const parts = path.split("."); - const pathList = []; - for (const part of parts) { - const squareBracketIndex = part.indexOf("["); - if (squareBracketIndex !== -1) { - if (part.indexOf("]") !== part.length - 1) { - throw new types_1.EndpointError(`Path: '${path}' does not end with ']'`); - } - const arrayIndex = part.slice(squareBracketIndex + 1, -1); - if (Number.isNaN(parseInt(arrayIndex))) { - throw new types_1.EndpointError(`Invalid array index: '${arrayIndex}' in path: '${path}'`); - } - if (squareBracketIndex !== 0) { - pathList.push(part.slice(0, squareBracketIndex)); - } - pathList.push(arrayIndex); - } - else { - pathList.push(part); - } +/***/ 15917: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; } - return pathList; -}; -exports.getAttrPathList = getAttrPathList; + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} +exports.HttpResponse = HttpResponse; /***/ }), -/***/ 83188: +/***/ 73070: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.aws = void 0; const tslib_1 = __nccwpck_require__(4351); -exports.aws = tslib_1.__importStar(__nccwpck_require__(46835)); -tslib_1.__exportStar(__nccwpck_require__(55370), exports); -tslib_1.__exportStar(__nccwpck_require__(20767), exports); -tslib_1.__exportStar(__nccwpck_require__(78816), exports); -tslib_1.__exportStar(__nccwpck_require__(57373), exports); -tslib_1.__exportStar(__nccwpck_require__(29692), exports); -tslib_1.__exportStar(__nccwpck_require__(22780), exports); -tslib_1.__exportStar(__nccwpck_require__(55182), exports); -tslib_1.__exportStar(__nccwpck_require__(48305), exports); -tslib_1.__exportStar(__nccwpck_require__(6535), exports); +tslib_1.__exportStar(__nccwpck_require__(33450), exports); +tslib_1.__exportStar(__nccwpck_require__(43002), exports); +tslib_1.__exportStar(__nccwpck_require__(67010), exports); +tslib_1.__exportStar(__nccwpck_require__(29095), exports); +tslib_1.__exportStar(__nccwpck_require__(22312), exports); +tslib_1.__exportStar(__nccwpck_require__(15917), exports); +tslib_1.__exportStar(__nccwpck_require__(11475), exports); +tslib_1.__exportStar(__nccwpck_require__(71805), exports); /***/ }), -/***/ 73442: +/***/ 11475: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isIpAddress = void 0; -const IP_V4_REGEX = new RegExp(`^(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)(?:\\.(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)){3}$`); -const isIpAddress = (value) => IP_V4_REGEX.test(value) || (value.startsWith("[") && value.endsWith("]")); -exports.isIpAddress = isIpAddress; +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; /***/ }), -/***/ 78816: +/***/ 71805: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isSet = void 0; -const isSet = (value) => value != null; -exports.isSet = isSet; /***/ }), -/***/ 57373: -/***/ ((__unused_webpack_module, exports) => { +/***/ 1205: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isValidHostLabel = void 0; -const VALID_HOST_LABEL_REGEX = new RegExp(`^(?!.*-$)(?!-)[a-zA-Z0-9-]{1,63}$`); -const isValidHostLabel = (value, allowSubDomains = false) => { - if (!allowSubDomains) { - return VALID_HOST_LABEL_REGEX.test(value); - } - const labels = value.split("."); - for (const label of labels) { - if (!(0, exports.isValidHostLabel)(label)) { - return false; +exports.buildQueryString = void 0; +const util_uri_escape_1 = __nccwpck_require__(3225); +function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, util_uri_escape_1.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, util_uri_escape_1.escapeUri)(value[i])}`); + } + } + else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, util_uri_escape_1.escapeUri)(value)}`; + } + parts.push(qsEntry); } } - return true; -}; -exports.isValidHostLabel = isValidHostLabel; + return parts.join("&"); +} +exports.buildQueryString = buildQueryString; /***/ }), -/***/ 29692: +/***/ 10689: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.not = void 0; -const not = (value) => !value; -exports.not = not; /***/ }), -/***/ 22780: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 42483: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.parseURL = void 0; -const types_1 = __nccwpck_require__(89029); -const isIpAddress_1 = __nccwpck_require__(73442); -const DEFAULT_PORTS = { - [types_1.EndpointURLScheme.HTTP]: 80, - [types_1.EndpointURLScheme.HTTPS]: 443, -}; -const parseURL = (value) => { - const whatwgURL = (() => { - try { - if (value instanceof URL) { - return value; - } - if (typeof value === "object" && "hostname" in value) { - const { hostname, port, protocol = "", path = "", query = {} } = value; - const url = new URL(`${protocol}//${hostname}${port ? `:${port}` : ""}${path}`); - url.search = Object.entries(query) - .map(([k, v]) => `${k}=${v}`) - .join("&"); - return url; - } - return new URL(value); - } - catch (error) { - return null; - } - })(); - if (!whatwgURL) { - console.error(`Unable to parse ${JSON.stringify(value)} as a whatwg URL.`); - return null; - } - const urlString = whatwgURL.href; - const { host, hostname, pathname, protocol, search } = whatwgURL; - if (search) { - return null; - } - const scheme = protocol.slice(0, -1); - if (!Object.values(types_1.EndpointURLScheme).includes(scheme)) { - return null; - } - const isIp = (0, isIpAddress_1.isIpAddress)(hostname); - const inputContainsDefaultPort = urlString.includes(`${host}:${DEFAULT_PORTS[scheme]}`) || - (typeof value === "string" && value.includes(`${host}:${DEFAULT_PORTS[scheme]}`)); - const authority = `${host}${inputContainsDefaultPort ? `:${DEFAULT_PORTS[scheme]}` : ``}`; - return { - scheme, - authority, - path: pathname, - normalizedPath: pathname.endsWith("/") ? pathname : `${pathname}/`, - isIp, - }; -}; -exports.parseURL = parseURL; +exports.HttpAuthLocation = void 0; +var HttpAuthLocation; +(function (HttpAuthLocation) { + HttpAuthLocation["HEADER"] = "header"; + HttpAuthLocation["QUERY"] = "query"; +})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {})); /***/ }), -/***/ 55182: +/***/ 45621: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.stringEquals = void 0; -const stringEquals = (value1, value2) => value1 === value2; -exports.stringEquals = stringEquals; /***/ }), -/***/ 48305: +/***/ 23408: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.substring = void 0; -const substring = (input, start, stop, reverse) => { - if (start >= stop || input.length < stop) { - return null; - } - if (!reverse) { - return input.substring(start, stop); - } - return input.substring(input.length - stop, input.length - start); -}; -exports.substring = substring; /***/ }), -/***/ 6535: +/***/ 68664: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.uriEncode = void 0; -const uriEncode = (value) => encodeURIComponent(value).replace(/[!*'()]/g, (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`); -exports.uriEncode = uriEncode; /***/ }), -/***/ 36563: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 56179: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveEndpoint = void 0; -const debug_1 = __nccwpck_require__(27617); -const types_1 = __nccwpck_require__(57433); -const utils_1 = __nccwpck_require__(81114); -const resolveEndpoint = (ruleSetObject, options) => { - var _a, _b, _c, _d, _e, _f; - const { endpointParams, logger } = options; - const { parameters, rules } = ruleSetObject; - (_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, `${debug_1.debugId} Initial EndpointParams: ${(0, debug_1.toDebugString)(endpointParams)}`); - const paramsWithDefault = Object.entries(parameters) - .filter(([, v]) => v.default != null) - .map(([k, v]) => [k, v.default]); - if (paramsWithDefault.length > 0) { - for (const [paramKey, paramDefaultValue] of paramsWithDefault) { - endpointParams[paramKey] = (_c = endpointParams[paramKey]) !== null && _c !== void 0 ? _c : paramDefaultValue; - } - } - const requiredParams = Object.entries(parameters) - .filter(([, v]) => v.required) - .map(([k]) => k); - for (const requiredParam of requiredParams) { - if (endpointParams[requiredParam] == null) { - throw new types_1.EndpointError(`Missing required parameter: '${requiredParam}'`); - } - } - const endpoint = (0, utils_1.evaluateRules)(rules, { endpointParams, logger, referenceRecord: {} }); - if ((_d = options.endpointParams) === null || _d === void 0 ? void 0 : _d.Endpoint) { - try { - const givenEndpoint = new URL(options.endpointParams.Endpoint); - const { protocol, port } = givenEndpoint; - endpoint.url.protocol = protocol; - endpoint.url.port = port; - } - catch (e) { - } - } - (_f = (_e = options.logger) === null || _e === void 0 ? void 0 : _e.debug) === null || _f === void 0 ? void 0 : _f.call(_e, `${debug_1.debugId} Resolved endpoint: ${(0, debug_1.toDebugString)(endpoint)}`); - return endpoint; -}; -exports.resolveEndpoint = resolveEndpoint; /***/ }), -/***/ 82605: +/***/ 72394: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.EndpointError = void 0; -class EndpointError extends Error { - constructor(message) { - super(message); - this.name = "EndpointError"; - } -} -exports.EndpointError = EndpointError; /***/ }), -/***/ 21261: +/***/ 67534: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(72394), exports); +tslib_1.__exportStar(__nccwpck_require__(55267), exports); +tslib_1.__exportStar(__nccwpck_require__(80959), exports); + + +/***/ }), + +/***/ 55267: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -26787,7 +45484,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 20312: +/***/ 80959: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -26797,7 +45494,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 56083: +/***/ 92055: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -26807,7 +45504,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 21767: +/***/ 9962: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -26817,24 +45514,23 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 57433: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 54787: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(82605), exports); -tslib_1.__exportStar(__nccwpck_require__(21261), exports); -tslib_1.__exportStar(__nccwpck_require__(20312), exports); -tslib_1.__exportStar(__nccwpck_require__(56083), exports); -tslib_1.__exportStar(__nccwpck_require__(21767), exports); -tslib_1.__exportStar(__nccwpck_require__(41811), exports); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); /***/ }), -/***/ 41811: +/***/ 45734: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -26844,1055 +45540,482 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 65075: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 87024: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.callFunction = void 0; -const tslib_1 = __nccwpck_require__(4351); -const lib = tslib_1.__importStar(__nccwpck_require__(83188)); -const evaluateExpression_1 = __nccwpck_require__(82980); -const callFunction = ({ fn, argv }, options) => { - const evaluatedArgs = argv.map((arg) => ["boolean", "number"].includes(typeof arg) ? arg : (0, evaluateExpression_1.evaluateExpression)(arg, "arg", options)); - return fn.split(".").reduce((acc, key) => acc[key], lib)(...evaluatedArgs); -}; -exports.callFunction = callFunction; /***/ }), -/***/ 77851: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 46158: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.evaluateCondition = void 0; -const debug_1 = __nccwpck_require__(27617); -const types_1 = __nccwpck_require__(57433); -const callFunction_1 = __nccwpck_require__(65075); -const evaluateCondition = ({ assign, ...fnArgs }, options) => { - var _a, _b; - if (assign && assign in options.referenceRecord) { - throw new types_1.EndpointError(`'${assign}' is already defined in Reference Record.`); - } - const value = (0, callFunction_1.callFunction)(fnArgs, options); - (_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `evaluateCondition: ${(0, debug_1.toDebugString)(fnArgs)} = ${(0, debug_1.toDebugString)(value)}`); - return { - result: value === "" ? true : !!value, - ...(assign != null && { toAssign: { name: assign, value } }), - }; -}; -exports.evaluateCondition = evaluateCondition; /***/ }), -/***/ 59169: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 67556: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.evaluateConditions = void 0; -const debug_1 = __nccwpck_require__(27617); -const evaluateCondition_1 = __nccwpck_require__(77851); -const evaluateConditions = (conditions = [], options) => { - var _a, _b; - const conditionsReferenceRecord = {}; - for (const condition of conditions) { - const { result, toAssign } = (0, evaluateCondition_1.evaluateCondition)(condition, { - ...options, - referenceRecord: { - ...options.referenceRecord, - ...conditionsReferenceRecord, - }, - }); - if (!result) { - return { result }; - } - if (toAssign) { - conditionsReferenceRecord[toAssign.name] = toAssign.value; - (_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `assign: ${toAssign.name} := ${(0, debug_1.toDebugString)(toAssign.value)}`); - } - } - return { result: true, referenceRecord: conditionsReferenceRecord }; -}; -exports.evaluateConditions = evaluateConditions; /***/ }), -/***/ 35324: +/***/ 93283: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.evaluateEndpointRule = void 0; -const debug_1 = __nccwpck_require__(27617); -const evaluateConditions_1 = __nccwpck_require__(59169); -const getEndpointHeaders_1 = __nccwpck_require__(88268); -const getEndpointProperties_1 = __nccwpck_require__(34973); -const getEndpointUrl_1 = __nccwpck_require__(23602); -const evaluateEndpointRule = (endpointRule, options) => { - var _a, _b; - const { conditions, endpoint } = endpointRule; - const { result, referenceRecord } = (0, evaluateConditions_1.evaluateConditions)(conditions, options); - if (!result) { - return; - } - const endpointRuleOptions = { - ...options, - referenceRecord: { ...options.referenceRecord, ...referenceRecord }, - }; - const { url, properties, headers } = endpoint; - (_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `Resolving endpoint from template: ${(0, debug_1.toDebugString)(endpoint)}`); - return { - ...(headers != undefined && { - headers: (0, getEndpointHeaders_1.getEndpointHeaders)(headers, endpointRuleOptions), - }), - ...(properties != undefined && { - properties: (0, getEndpointProperties_1.getEndpointProperties)(properties, endpointRuleOptions), - }), - url: (0, getEndpointUrl_1.getEndpointUrl)(url, endpointRuleOptions), - }; -}; -exports.evaluateEndpointRule = evaluateEndpointRule; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(45734), exports); +tslib_1.__exportStar(__nccwpck_require__(87024), exports); +tslib_1.__exportStar(__nccwpck_require__(46158), exports); +tslib_1.__exportStar(__nccwpck_require__(79392), exports); +tslib_1.__exportStar(__nccwpck_require__(67556), exports); /***/ }), -/***/ 12110: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 79392: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.evaluateErrorRule = void 0; -const types_1 = __nccwpck_require__(57433); -const evaluateConditions_1 = __nccwpck_require__(59169); -const evaluateExpression_1 = __nccwpck_require__(82980); -const evaluateErrorRule = (errorRule, options) => { - const { conditions, error } = errorRule; - const { result, referenceRecord } = (0, evaluateConditions_1.evaluateConditions)(conditions, options); - if (!result) { - return; - } - throw new types_1.EndpointError((0, evaluateExpression_1.evaluateExpression)(error, "Error", { - ...options, - referenceRecord: { ...options.referenceRecord, ...referenceRecord }, - })); -}; -exports.evaluateErrorRule = evaluateErrorRule; /***/ }), -/***/ 82980: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 27696: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.evaluateExpression = void 0; -const types_1 = __nccwpck_require__(57433); -const callFunction_1 = __nccwpck_require__(65075); -const evaluateTemplate_1 = __nccwpck_require__(57535); -const getReferenceValue_1 = __nccwpck_require__(68810); -const evaluateExpression = (obj, keyName, options) => { - if (typeof obj === "string") { - return (0, evaluateTemplate_1.evaluateTemplate)(obj, options); - } - else if (obj["fn"]) { - return (0, callFunction_1.callFunction)(obj, options); - } - else if (obj["ref"]) { - return (0, getReferenceValue_1.getReferenceValue)(obj, options); - } - throw new types_1.EndpointError(`'${keyName}': ${String(obj)} is not a string, function or reference.`); -}; -exports.evaluateExpression = evaluateExpression; /***/ }), -/***/ 59738: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 97028: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.evaluateRules = void 0; -const types_1 = __nccwpck_require__(57433); -const evaluateEndpointRule_1 = __nccwpck_require__(35324); -const evaluateErrorRule_1 = __nccwpck_require__(12110); -const evaluateTreeRule_1 = __nccwpck_require__(26587); -const evaluateRules = (rules, options) => { - for (const rule of rules) { - if (rule.type === "endpoint") { - const endpointOrUndefined = (0, evaluateEndpointRule_1.evaluateEndpointRule)(rule, options); - if (endpointOrUndefined) { - return endpointOrUndefined; - } - } - else if (rule.type === "error") { - (0, evaluateErrorRule_1.evaluateErrorRule)(rule, options); - } - else if (rule.type === "tree") { - const endpointOrUndefined = (0, evaluateTreeRule_1.evaluateTreeRule)(rule, options); - if (endpointOrUndefined) { - return endpointOrUndefined; - } - } - else { - throw new types_1.EndpointError(`Unknown endpoint rule: ${rule}`); - } +exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0; +var AlgorithmId; +(function (AlgorithmId) { + AlgorithmId["MD5"] = "md5"; + AlgorithmId["CRC32"] = "crc32"; + AlgorithmId["CRC32C"] = "crc32c"; + AlgorithmId["SHA1"] = "sha1"; + AlgorithmId["SHA256"] = "sha256"; +})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {})); +const getChecksumConfiguration = (runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.SHA256, + checksumConstructor: () => runtimeConfig.sha256, + }); } - throw new types_1.EndpointError(`Rules evaluation failed`); + if (runtimeConfig.md5 != undefined) { + checksumAlgorithms.push({ + algorithmId: () => AlgorithmId.MD5, + checksumConstructor: () => runtimeConfig.md5, + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + }, + }; }; -exports.evaluateRules = evaluateRules; +exports.getChecksumConfiguration = getChecksumConfiguration; +const resolveChecksumRuntimeConfig = (clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}; +exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig; /***/ }), -/***/ 57535: +/***/ 47944: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.evaluateTemplate = void 0; -const lib_1 = __nccwpck_require__(83188); -const evaluateTemplate = (template, options) => { - const evaluatedTemplateArr = []; - const templateContext = { - ...options.endpointParams, - ...options.referenceRecord, +exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0; +const checksum_1 = __nccwpck_require__(97028); +const getDefaultClientConfiguration = (runtimeConfig) => { + return { + ...(0, checksum_1.getChecksumConfiguration)(runtimeConfig), }; - let currentIndex = 0; - while (currentIndex < template.length) { - const openingBraceIndex = template.indexOf("{", currentIndex); - if (openingBraceIndex === -1) { - evaluatedTemplateArr.push(template.slice(currentIndex)); - break; - } - evaluatedTemplateArr.push(template.slice(currentIndex, openingBraceIndex)); - const closingBraceIndex = template.indexOf("}", openingBraceIndex); - if (closingBraceIndex === -1) { - evaluatedTemplateArr.push(template.slice(openingBraceIndex)); - break; - } - if (template[openingBraceIndex + 1] === "{" && template[closingBraceIndex + 1] === "}") { - evaluatedTemplateArr.push(template.slice(openingBraceIndex + 1, closingBraceIndex)); - currentIndex = closingBraceIndex + 2; - } - const parameterName = template.substring(openingBraceIndex + 1, closingBraceIndex); - if (parameterName.includes("#")) { - const [refName, attrName] = parameterName.split("#"); - evaluatedTemplateArr.push((0, lib_1.getAttr)(templateContext[refName], attrName)); - } - else { - evaluatedTemplateArr.push(templateContext[parameterName]); - } - currentIndex = closingBraceIndex + 1; - } - return evaluatedTemplateArr.join(""); }; -exports.evaluateTemplate = evaluateTemplate; +exports.getDefaultClientConfiguration = getDefaultClientConfiguration; +const resolveDefaultRuntimeConfig = (config) => { + return { + ...(0, checksum_1.resolveChecksumRuntimeConfig)(config), + }; +}; +exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig; /***/ }), -/***/ 26587: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 86153: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.evaluateTreeRule = void 0; -const evaluateConditions_1 = __nccwpck_require__(59169); -const evaluateRules_1 = __nccwpck_require__(59738); -const evaluateTreeRule = (treeRule, options) => { - const { conditions, rules } = treeRule; - const { result, referenceRecord } = (0, evaluateConditions_1.evaluateConditions)(conditions, options); - if (!result) { - return; - } - return (0, evaluateRules_1.evaluateRules)(rules, { - ...options, - referenceRecord: { ...options.referenceRecord, ...referenceRecord }, - }); -}; -exports.evaluateTreeRule = evaluateTreeRule; /***/ }), -/***/ 88268: +/***/ 55310: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getEndpointHeaders = void 0; -const types_1 = __nccwpck_require__(57433); -const evaluateExpression_1 = __nccwpck_require__(82980); -const getEndpointHeaders = (headers, options) => Object.entries(headers).reduce((acc, [headerKey, headerVal]) => ({ - ...acc, - [headerKey]: headerVal.map((headerValEntry) => { - const processedExpr = (0, evaluateExpression_1.evaluateExpression)(headerValEntry, "Header value entry", options); - if (typeof processedExpr !== "string") { - throw new types_1.EndpointError(`Header '${headerKey}' value '${processedExpr}' is not a string`); - } - return processedExpr; - }), -}), {}); -exports.getEndpointHeaders = getEndpointHeaders; +exports.AlgorithmId = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(47944), exports); +tslib_1.__exportStar(__nccwpck_require__(86153), exports); +var checksum_1 = __nccwpck_require__(97028); +Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } })); /***/ }), -/***/ 34973: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 72647: +/***/ ((__unused_webpack_module, exports) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getEndpointProperties = void 0; -const getEndpointProperty_1 = __nccwpck_require__(42978); -const getEndpointProperties = (properties, options) => Object.entries(properties).reduce((acc, [propertyKey, propertyVal]) => ({ - ...acc, - [propertyKey]: (0, getEndpointProperty_1.getEndpointProperty)(propertyVal, options), -}), {}); -exports.getEndpointProperties = getEndpointProperties; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.FieldPosition = void 0; +var FieldPosition; +(function (FieldPosition) { + FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; + FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; +})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); /***/ }), -/***/ 42978: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 25670: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getEndpointProperty = void 0; -const types_1 = __nccwpck_require__(57433); -const evaluateTemplate_1 = __nccwpck_require__(57535); -const getEndpointProperties_1 = __nccwpck_require__(34973); -const getEndpointProperty = (property, options) => { - if (Array.isArray(property)) { - return property.map((propertyEntry) => (0, exports.getEndpointProperty)(propertyEntry, options)); - } - switch (typeof property) { - case "string": - return (0, evaluateTemplate_1.evaluateTemplate)(property, options); - case "object": - if (property === null) { - throw new types_1.EndpointError(`Unexpected endpoint property: ${property}`); - } - return (0, getEndpointProperties_1.getEndpointProperties)(property, options); - case "boolean": - return property; - default: - throw new types_1.EndpointError(`Unexpected endpoint property type: ${typeof property}`); - } -}; -exports.getEndpointProperty = getEndpointProperty; /***/ }), -/***/ 23602: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 35539: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getEndpointUrl = void 0; -const types_1 = __nccwpck_require__(57433); -const evaluateExpression_1 = __nccwpck_require__(82980); -const getEndpointUrl = (endpointUrl, options) => { - const expression = (0, evaluateExpression_1.evaluateExpression)(endpointUrl, "Endpoint URL", options); - if (typeof expression === "string") { - try { - return new URL(expression); - } - catch (error) { - console.error(`Failed to construct URL with ${expression}`, error); - throw error; - } - } - throw new types_1.EndpointError(`Endpoint URL must be a string, got ${typeof expression}`); -}; -exports.getEndpointUrl = getEndpointUrl; /***/ }), -/***/ 68810: -/***/ ((__unused_webpack_module, exports) => { +/***/ 40701: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getReferenceValue = void 0; -const getReferenceValue = ({ ref }, options) => { - const referenceRecord = { - ...options.endpointParams, - ...options.referenceRecord, - }; - return referenceRecord[ref]; -}; -exports.getReferenceValue = getReferenceValue; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(25670), exports); +tslib_1.__exportStar(__nccwpck_require__(35539), exports); /***/ }), -/***/ 81114: +/***/ 50999: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(59738), exports); +tslib_1.__exportStar(__nccwpck_require__(10689), exports); +tslib_1.__exportStar(__nccwpck_require__(42483), exports); +tslib_1.__exportStar(__nccwpck_require__(45621), exports); +tslib_1.__exportStar(__nccwpck_require__(23408), exports); +tslib_1.__exportStar(__nccwpck_require__(68664), exports); +tslib_1.__exportStar(__nccwpck_require__(56179), exports); +tslib_1.__exportStar(__nccwpck_require__(67534), exports); +tslib_1.__exportStar(__nccwpck_require__(92055), exports); +tslib_1.__exportStar(__nccwpck_require__(9962), exports); +tslib_1.__exportStar(__nccwpck_require__(54787), exports); +tslib_1.__exportStar(__nccwpck_require__(93283), exports); +tslib_1.__exportStar(__nccwpck_require__(27696), exports); +tslib_1.__exportStar(__nccwpck_require__(55310), exports); +tslib_1.__exportStar(__nccwpck_require__(72647), exports); +tslib_1.__exportStar(__nccwpck_require__(40701), exports); +tslib_1.__exportStar(__nccwpck_require__(61837), exports); +tslib_1.__exportStar(__nccwpck_require__(28659), exports); +tslib_1.__exportStar(__nccwpck_require__(10724), exports); +tslib_1.__exportStar(__nccwpck_require__(42536), exports); +tslib_1.__exportStar(__nccwpck_require__(34866), exports); +tslib_1.__exportStar(__nccwpck_require__(30184), exports); +tslib_1.__exportStar(__nccwpck_require__(87151), exports); +tslib_1.__exportStar(__nccwpck_require__(93992), exports); +tslib_1.__exportStar(__nccwpck_require__(40497), exports); +tslib_1.__exportStar(__nccwpck_require__(39026), exports); +tslib_1.__exportStar(__nccwpck_require__(42017), exports); +tslib_1.__exportStar(__nccwpck_require__(24996), exports); +tslib_1.__exportStar(__nccwpck_require__(46942), exports); +tslib_1.__exportStar(__nccwpck_require__(49051), exports); +tslib_1.__exportStar(__nccwpck_require__(90891), exports); +tslib_1.__exportStar(__nccwpck_require__(79428), exports); +tslib_1.__exportStar(__nccwpck_require__(89043), exports); +tslib_1.__exportStar(__nccwpck_require__(46863), exports); +tslib_1.__exportStar(__nccwpck_require__(14897), exports); + + +/***/ }), + +/***/ 61837: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 1968: +/***/ 28659: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.toHex = exports.fromHex = void 0; -const SHORT_TO_HEX = {}; -const HEX_TO_SHORT = {}; -for (let i = 0; i < 256; i++) { - let encodedByte = i.toString(16).toLowerCase(); - if (encodedByte.length === 1) { - encodedByte = `0${encodedByte}`; - } - SHORT_TO_HEX[i] = encodedByte; - HEX_TO_SHORT[encodedByte] = i; -} -function fromHex(encoded) { - if (encoded.length % 2 !== 0) { - throw new Error("Hex encoded strings must have an even number length"); - } - const out = new Uint8Array(encoded.length / 2); - for (let i = 0; i < encoded.length; i += 2) { - const encodedByte = encoded.slice(i, i + 2).toLowerCase(); - if (encodedByte in HEX_TO_SHORT) { - out[i / 2] = HEX_TO_SHORT[encodedByte]; - } - else { - throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); - } - } - return out; -} -exports.fromHex = fromHex; -function toHex(bytes) { - let out = ""; - for (let i = 0; i < bytes.byteLength; i++) { - out += SHORT_TO_HEX[bytes[i]]; - } - return out; -} -exports.toHex = toHex; +exports.SMITHY_CONTEXT_KEY = void 0; +exports.SMITHY_CONTEXT_KEY = "__smithy_context"; /***/ }), -/***/ 10236: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 10724: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(77776), exports); /***/ }), -/***/ 77776: +/***/ 42536: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.normalizeProvider = void 0; -const normalizeProvider = (input) => { - if (typeof input === "function") - return input; - const promisified = Promise.resolve(input); - return () => promisified; -}; -exports.normalizeProvider = normalizeProvider; /***/ }), -/***/ 66968: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 34866: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.AdaptiveRetryStrategy = void 0; -const config_1 = __nccwpck_require__(6514); -const DefaultRateLimiter_1 = __nccwpck_require__(258); -const StandardRetryStrategy_1 = __nccwpck_require__(43449); -class AdaptiveRetryStrategy { - constructor(maxAttemptsProvider, options) { - this.maxAttemptsProvider = maxAttemptsProvider; - this.mode = config_1.RETRY_MODES.ADAPTIVE; - const { rateLimiter } = options !== null && options !== void 0 ? options : {}; - this.rateLimiter = rateLimiter !== null && rateLimiter !== void 0 ? rateLimiter : new DefaultRateLimiter_1.DefaultRateLimiter(); - this.standardRetryStrategy = new StandardRetryStrategy_1.StandardRetryStrategy(maxAttemptsProvider); - } - async acquireInitialRetryToken(retryTokenScope) { - await this.rateLimiter.getSendToken(); - return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope); - } - async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { - this.rateLimiter.updateClientSendingRate(errorInfo); - return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo); - } - recordSuccess(token) { - this.rateLimiter.updateClientSendingRate({}); - this.standardRetryStrategy.recordSuccess(token); - } -} -exports.AdaptiveRetryStrategy = AdaptiveRetryStrategy; /***/ }), -/***/ 98118: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 30184: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ConfiguredRetryStrategy = void 0; -const constants_1 = __nccwpck_require__(65056); -const StandardRetryStrategy_1 = __nccwpck_require__(43449); -class ConfiguredRetryStrategy extends StandardRetryStrategy_1.StandardRetryStrategy { - constructor(maxAttempts, computeNextBackoffDelay = constants_1.DEFAULT_RETRY_DELAY_BASE) { - super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts); - if (typeof computeNextBackoffDelay === "number") { - this.computeNextBackoffDelay = () => computeNextBackoffDelay; - } - else { - this.computeNextBackoffDelay = computeNextBackoffDelay; - } - } - async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { - const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo); - token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount()); - return token; - } -} -exports.ConfiguredRetryStrategy = ConfiguredRetryStrategy; /***/ }), -/***/ 258: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 87151: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DefaultRateLimiter = void 0; -const service_error_classification_1 = __nccwpck_require__(61921); -class DefaultRateLimiter { - constructor(options) { - var _a, _b, _c, _d, _e; - this.currentCapacity = 0; - this.enabled = false; - this.lastMaxRate = 0; - this.measuredTxRate = 0; - this.requestCount = 0; - this.lastTimestamp = 0; - this.timeWindow = 0; - this.beta = (_a = options === null || options === void 0 ? void 0 : options.beta) !== null && _a !== void 0 ? _a : 0.7; - this.minCapacity = (_b = options === null || options === void 0 ? void 0 : options.minCapacity) !== null && _b !== void 0 ? _b : 1; - this.minFillRate = (_c = options === null || options === void 0 ? void 0 : options.minFillRate) !== null && _c !== void 0 ? _c : 0.5; - this.scaleConstant = (_d = options === null || options === void 0 ? void 0 : options.scaleConstant) !== null && _d !== void 0 ? _d : 0.4; - this.smooth = (_e = options === null || options === void 0 ? void 0 : options.smooth) !== null && _e !== void 0 ? _e : 0.8; - const currentTimeInSeconds = this.getCurrentTimeInSeconds(); - this.lastThrottleTime = currentTimeInSeconds; - this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds()); - this.fillRate = this.minFillRate; - this.maxCapacity = this.minCapacity; - } - getCurrentTimeInSeconds() { - return Date.now() / 1000; - } - async getSendToken() { - return this.acquireTokenBucket(1); - } - async acquireTokenBucket(amount) { - if (!this.enabled) { - return; - } - this.refillTokenBucket(); - if (amount > this.currentCapacity) { - const delay = ((amount - this.currentCapacity) / this.fillRate) * 1000; - await new Promise((resolve) => setTimeout(resolve, delay)); - } - this.currentCapacity = this.currentCapacity - amount; - } - refillTokenBucket() { - const timestamp = this.getCurrentTimeInSeconds(); - if (!this.lastTimestamp) { - this.lastTimestamp = timestamp; - return; - } - const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate; - this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount); - this.lastTimestamp = timestamp; - } - updateClientSendingRate(response) { - let calculatedRate; - this.updateMeasuredRate(); - if ((0, service_error_classification_1.isThrottlingError)(response)) { - const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate); - this.lastMaxRate = rateToUse; - this.calculateTimeWindow(); - this.lastThrottleTime = this.getCurrentTimeInSeconds(); - calculatedRate = this.cubicThrottle(rateToUse); - this.enableTokenBucket(); - } - else { - this.calculateTimeWindow(); - calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds()); - } - const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate); - this.updateTokenBucketRate(newRate); - } - calculateTimeWindow() { - this.timeWindow = this.getPrecise(Math.pow((this.lastMaxRate * (1 - this.beta)) / this.scaleConstant, 1 / 3)); - } - cubicThrottle(rateToUse) { - return this.getPrecise(rateToUse * this.beta); - } - cubicSuccess(timestamp) { - return this.getPrecise(this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate); - } - enableTokenBucket() { - this.enabled = true; - } - updateTokenBucketRate(newRate) { - this.refillTokenBucket(); - this.fillRate = Math.max(newRate, this.minFillRate); - this.maxCapacity = Math.max(newRate, this.minCapacity); - this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity); - } - updateMeasuredRate() { - const t = this.getCurrentTimeInSeconds(); - const timeBucket = Math.floor(t * 2) / 2; - this.requestCount++; - if (timeBucket > this.lastTxRateBucket) { - const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket); - this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth)); - this.requestCount = 0; - this.lastTxRateBucket = timeBucket; - } - } - getPrecise(num) { - return parseFloat(num.toFixed(8)); - } -} -exports.DefaultRateLimiter = DefaultRateLimiter; /***/ }), -/***/ 43449: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 93992: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.StandardRetryStrategy = void 0; -const config_1 = __nccwpck_require__(6514); -const constants_1 = __nccwpck_require__(65056); -const defaultRetryBackoffStrategy_1 = __nccwpck_require__(44763); -const defaultRetryToken_1 = __nccwpck_require__(41360); -class StandardRetryStrategy { - constructor(maxAttempts) { - this.maxAttempts = maxAttempts; - this.mode = config_1.RETRY_MODES.STANDARD; - this.capacity = constants_1.INITIAL_RETRY_TOKENS; - this.retryBackoffStrategy = (0, defaultRetryBackoffStrategy_1.getDefaultRetryBackoffStrategy)(); - this.maxAttemptsProvider = typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts; - } - async acquireInitialRetryToken(retryTokenScope) { - return (0, defaultRetryToken_1.createDefaultRetryToken)({ - retryDelay: constants_1.DEFAULT_RETRY_DELAY_BASE, - retryCount: 0, - }); - } - async refreshRetryTokenForRetry(token, errorInfo) { - const maxAttempts = await this.getMaxAttempts(); - if (this.shouldRetry(token, errorInfo, maxAttempts)) { - const errorType = errorInfo.errorType; - this.retryBackoffStrategy.setDelayBase(errorType === "THROTTLING" ? constants_1.THROTTLING_RETRY_DELAY_BASE : constants_1.DEFAULT_RETRY_DELAY_BASE); - const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount()); - const retryDelay = errorInfo.retryAfterHint - ? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType) - : delayFromErrorType; - const capacityCost = this.getCapacityCost(errorType); - this.capacity -= capacityCost; - return (0, defaultRetryToken_1.createDefaultRetryToken)({ - retryDelay, - retryCount: token.getRetryCount() + 1, - retryCost: capacityCost, - }); - } - throw new Error("No retry token available"); - } - recordSuccess(token) { - var _a; - this.capacity = Math.max(constants_1.INITIAL_RETRY_TOKENS, this.capacity + ((_a = token.getRetryCost()) !== null && _a !== void 0 ? _a : constants_1.NO_RETRY_INCREMENT)); - } - getCapacity() { - return this.capacity; - } - async getMaxAttempts() { - try { - return await this.maxAttemptsProvider(); - } - catch (error) { - console.warn(`Max attempts provider could not resolve. Using default of ${config_1.DEFAULT_MAX_ATTEMPTS}`); - return config_1.DEFAULT_MAX_ATTEMPTS; - } - } - shouldRetry(tokenToRenew, errorInfo, maxAttempts) { - const attempts = tokenToRenew.getRetryCount(); - return (attempts < maxAttempts && - this.capacity >= this.getCapacityCost(errorInfo.errorType) && - this.isRetryableError(errorInfo.errorType)); - } - getCapacityCost(errorType) { - return errorType === "TRANSIENT" ? constants_1.TIMEOUT_RETRY_COST : constants_1.RETRY_COST; - } - isRetryableError(errorType) { - return errorType === "THROTTLING" || errorType === "TRANSIENT"; - } -} -exports.StandardRetryStrategy = StandardRetryStrategy; /***/ }), -/***/ 6514: +/***/ 40497: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DEFAULT_RETRY_MODE = exports.DEFAULT_MAX_ATTEMPTS = exports.RETRY_MODES = void 0; -var RETRY_MODES; -(function (RETRY_MODES) { - RETRY_MODES["STANDARD"] = "standard"; - RETRY_MODES["ADAPTIVE"] = "adaptive"; -})(RETRY_MODES = exports.RETRY_MODES || (exports.RETRY_MODES = {})); -exports.DEFAULT_MAX_ATTEMPTS = 3; -exports.DEFAULT_RETRY_MODE = RETRY_MODES.STANDARD; /***/ }), -/***/ 65056: +/***/ 39026: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.REQUEST_HEADER = exports.INVOCATION_ID_HEADER = exports.NO_RETRY_INCREMENT = exports.TIMEOUT_RETRY_COST = exports.RETRY_COST = exports.INITIAL_RETRY_TOKENS = exports.THROTTLING_RETRY_DELAY_BASE = exports.MAXIMUM_RETRY_DELAY = exports.DEFAULT_RETRY_DELAY_BASE = void 0; -exports.DEFAULT_RETRY_DELAY_BASE = 100; -exports.MAXIMUM_RETRY_DELAY = 20 * 1000; -exports.THROTTLING_RETRY_DELAY_BASE = 500; -exports.INITIAL_RETRY_TOKENS = 500; -exports.RETRY_COST = 5; -exports.TIMEOUT_RETRY_COST = 10; -exports.NO_RETRY_INCREMENT = 1; -exports.INVOCATION_ID_HEADER = "amz-sdk-invocation-id"; -exports.REQUEST_HEADER = "amz-sdk-request"; /***/ }), -/***/ 44763: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 42017: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getDefaultRetryBackoffStrategy = void 0; -const constants_1 = __nccwpck_require__(65056); -const getDefaultRetryBackoffStrategy = () => { - let delayBase = constants_1.DEFAULT_RETRY_DELAY_BASE; - const computeNextBackoffDelay = (attempts) => { - return Math.floor(Math.min(constants_1.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); - }; - const setDelayBase = (delay) => { - delayBase = delay; - }; - return { - computeNextBackoffDelay, - setDelayBase, - }; -}; -exports.getDefaultRetryBackoffStrategy = getDefaultRetryBackoffStrategy; /***/ }), -/***/ 41360: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 24996: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.createDefaultRetryToken = void 0; -const constants_1 = __nccwpck_require__(65056); -const createDefaultRetryToken = ({ retryDelay, retryCount, retryCost, }) => { - const getRetryCount = () => retryCount; - const getRetryDelay = () => Math.min(constants_1.MAXIMUM_RETRY_DELAY, retryDelay); - const getRetryCost = () => retryCost; - return { - getRetryCount, - getRetryDelay, - getRetryCost, - }; -}; -exports.createDefaultRetryToken = createDefaultRetryToken; /***/ }), -/***/ 99395: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 46942: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(66968), exports); -tslib_1.__exportStar(__nccwpck_require__(98118), exports); -tslib_1.__exportStar(__nccwpck_require__(258), exports); -tslib_1.__exportStar(__nccwpck_require__(43449), exports); -tslib_1.__exportStar(__nccwpck_require__(6514), exports); -tslib_1.__exportStar(__nccwpck_require__(65056), exports); -tslib_1.__exportStar(__nccwpck_require__(91318), exports); /***/ }), -/***/ 91318: +/***/ 49051: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RequestHandlerProtocol = void 0; +var RequestHandlerProtocol; +(function (RequestHandlerProtocol) { + RequestHandlerProtocol["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol["TDS_8_0"] = "tds/8.0"; +})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {})); /***/ }), -/***/ 30402: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 90891: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.Uint8ArrayBlobAdapter = void 0; -const transforms_1 = __nccwpck_require__(20285); -class Uint8ArrayBlobAdapter extends Uint8Array { - static fromString(source, encoding = "utf-8") { - switch (typeof source) { - case "string": - return (0, transforms_1.transformFromString)(source, encoding); - default: - throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`); - } - } - static mutate(source) { - Object.setPrototypeOf(source, Uint8ArrayBlobAdapter.prototype); - return source; - } - transformToString(encoding = "utf-8") { - return (0, transforms_1.transformToString)(this, encoding); - } -} -exports.Uint8ArrayBlobAdapter = Uint8ArrayBlobAdapter; /***/ }), -/***/ 20285: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 79428: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.transformFromString = exports.transformToString = void 0; -const util_base64_1 = __nccwpck_require__(97727); -const util_utf8_1 = __nccwpck_require__(2855); -const Uint8ArrayBlobAdapter_1 = __nccwpck_require__(30402); -function transformToString(payload, encoding = "utf-8") { - if (encoding === "base64") { - return (0, util_base64_1.toBase64)(payload); - } - return (0, util_utf8_1.toUtf8)(payload); -} -exports.transformToString = transformToString; -function transformFromString(str, encoding) { - if (encoding === "base64") { - return Uint8ArrayBlobAdapter_1.Uint8ArrayBlobAdapter.mutate((0, util_base64_1.fromBase64)(str)); - } - return Uint8ArrayBlobAdapter_1.Uint8ArrayBlobAdapter.mutate((0, util_utf8_1.fromUtf8)(str)); -} -exports.transformFromString = transformFromString; /***/ }), -/***/ 56374: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 89043: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getAwsChunkedEncodingStream = void 0; -const stream_1 = __nccwpck_require__(12781); -const getAwsChunkedEncodingStream = (readableStream, options) => { - const { base64Encoder, bodyLengthChecker, checksumAlgorithmFn, checksumLocationName, streamHasher } = options; - const checksumRequired = base64Encoder !== undefined && - checksumAlgorithmFn !== undefined && - checksumLocationName !== undefined && - streamHasher !== undefined; - const digest = checksumRequired ? streamHasher(checksumAlgorithmFn, readableStream) : undefined; - const awsChunkedEncodingStream = new stream_1.Readable({ read: () => { } }); - readableStream.on("data", (data) => { - const length = bodyLengthChecker(data) || 0; - awsChunkedEncodingStream.push(`${length.toString(16)}\r\n`); - awsChunkedEncodingStream.push(data); - awsChunkedEncodingStream.push("\r\n"); - }); - readableStream.on("end", async () => { - awsChunkedEncodingStream.push(`0\r\n`); - if (checksumRequired) { - const checksum = base64Encoder(await digest); - awsChunkedEncodingStream.push(`${checksumLocationName}:${checksum}\r\n`); - awsChunkedEncodingStream.push(`\r\n`); - } - awsChunkedEncodingStream.push(null); - }); - return awsChunkedEncodingStream; -}; -exports.getAwsChunkedEncodingStream = getAwsChunkedEncodingStream; /***/ }), -/***/ 77728: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 46863: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(30402), exports); -tslib_1.__exportStar(__nccwpck_require__(56374), exports); -tslib_1.__exportStar(__nccwpck_require__(48545), exports); /***/ }), -/***/ 48545: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 14897: +/***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.sdkStreamMixin = void 0; -const node_http_handler_1 = __nccwpck_require__(68805); -const util_buffer_from_1 = __nccwpck_require__(36010); -const stream_1 = __nccwpck_require__(12781); -const util_1 = __nccwpck_require__(73837); -const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; -const sdkStreamMixin = (stream) => { - var _a, _b; - if (!(stream instanceof stream_1.Readable)) { - const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; - throw new Error(`Unexpected stream implementation, expect Stream.Readable instance, got ${name}`); - } - let transformed = false; - const transformToByteArray = async () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - transformed = true; - return await (0, node_http_handler_1.streamCollector)(stream); - }; - return Object.assign(stream, { - transformToByteArray, - transformToString: async (encoding) => { - const buf = await transformToByteArray(); - if (encoding === undefined || Buffer.isEncoding(encoding)) { - return (0, util_buffer_from_1.fromArrayBuffer)(buf.buffer, buf.byteOffset, buf.byteLength).toString(encoding); - } - else { - const decoder = new util_1.TextDecoder(encoding); - return decoder.decode(buf); - } - }, - transformToWebStream: () => { - if (transformed) { - throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); - } - if (stream.readableFlowing !== null) { - throw new Error("The stream has been consumed by other callbacks."); - } - if (typeof stream_1.Readable.toWeb !== "function") { - throw new Error("Readable.toWeb() is not supported. Please make sure you are using Node.js >= 17.0.0, or polyfill is available."); - } - transformed = true; - return stream_1.Readable.toWeb(stream); - }, - }); -}; -exports.sdkStreamMixin = sdkStreamMixin; /***/ }), -/***/ 15774: +/***/ 87047: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.escapeUriPath = void 0; -const escape_uri_1 = __nccwpck_require__(24652); +const escape_uri_1 = __nccwpck_require__(29491); const escapeUriPath = (uri) => uri.split("/").map(escape_uri_1.escapeUri).join("/"); exports.escapeUriPath = escapeUriPath; /***/ }), -/***/ 24652: +/***/ 29491: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -27906,191 +46029,68 @@ const hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`; /***/ }), -/***/ 57952: +/***/ 3225: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(24652), exports); -tslib_1.__exportStar(__nccwpck_require__(15774), exports); +tslib_1.__exportStar(__nccwpck_require__(29491), exports); +tslib_1.__exportStar(__nccwpck_require__(87047), exports); /***/ }), -/***/ 98095: +/***/ 26174: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.defaultUserAgent = exports.UA_APP_ID_INI_NAME = exports.UA_APP_ID_ENV_NAME = void 0; -const node_config_provider_1 = __nccwpck_require__(87684); -const os_1 = __nccwpck_require__(22037); -const process_1 = __nccwpck_require__(77282); -const is_crt_available_1 = __nccwpck_require__(68390); -exports.UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID"; -exports.UA_APP_ID_INI_NAME = "sdk-ua-app-id"; -const defaultUserAgent = ({ serviceId, clientVersion }) => { - const sections = [ - ["aws-sdk-js", clientVersion], - ["ua", "2.0"], - [`os/${(0, os_1.platform)()}`, (0, os_1.release)()], - ["lang/js"], - ["md/nodejs", `${process_1.versions.node}`], - ]; - const crtAvailable = (0, is_crt_available_1.isCrtAvailable)(); - if (crtAvailable) { - sections.push(crtAvailable); - } - if (serviceId) { - sections.push([`api/${serviceId}`, clientVersion]); - } - if (process_1.env.AWS_EXECUTION_ENV) { - sections.push([`exec-env/${process_1.env.AWS_EXECUTION_ENV}`]); - } - const appIdPromise = (0, node_config_provider_1.loadConfig)({ - environmentVariableSelector: (env) => env[exports.UA_APP_ID_ENV_NAME], - configFileSelector: (profile) => profile[exports.UA_APP_ID_INI_NAME], - default: undefined, - })(); - let resolvedUserAgent = undefined; - return async () => { - if (!resolvedUserAgent) { - const appId = await appIdPromise; - resolvedUserAgent = appId ? [...sections, [`app/${appId}`]] : [...sections]; - } - return resolvedUserAgent; - }; -}; -exports.defaultUserAgent = defaultUserAgent; - - -/***/ }), - -/***/ 68390: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isCrtAvailable = void 0; -const isCrtAvailable = () => { - try { - if ( true && __nccwpck_require__(87578)) { - return ["md/crt-avail"]; - } - return null; - } - catch (e) { - return null; - } -}; -exports.isCrtAvailable = isCrtAvailable; - - -/***/ }), - -/***/ 28172: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.toUtf8 = exports.fromUtf8 = void 0; -const pureJs_1 = __nccwpck_require__(21590); -const whatwgEncodingApi_1 = __nccwpck_require__(89215); -const fromUtf8 = (input) => typeof TextEncoder === "function" ? (0, whatwgEncodingApi_1.fromUtf8)(input) : (0, pureJs_1.fromUtf8)(input); -exports.fromUtf8 = fromUtf8; -const toUtf8 = (input) => typeof TextDecoder === "function" ? (0, whatwgEncodingApi_1.toUtf8)(input) : (0, pureJs_1.toUtf8)(input); -exports.toUtf8 = toUtf8; +exports.escapeUriPath = void 0; +const escape_uri_1 = __nccwpck_require__(60010); +const escapeUriPath = (uri) => uri.split("/").map(escape_uri_1.escapeUri).join("/"); +exports.escapeUriPath = escapeUriPath; /***/ }), -/***/ 21590: +/***/ 60010: /***/ ((__unused_webpack_module, exports) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.toUtf8 = exports.fromUtf8 = void 0; -const fromUtf8 = (input) => { - const bytes = []; - for (let i = 0, len = input.length; i < len; i++) { - const value = input.charCodeAt(i); - if (value < 0x80) { - bytes.push(value); - } - else if (value < 0x800) { - bytes.push((value >> 6) | 0b11000000, (value & 0b111111) | 0b10000000); - } - else if (i + 1 < input.length && (value & 0xfc00) === 0xd800 && (input.charCodeAt(i + 1) & 0xfc00) === 0xdc00) { - const surrogatePair = 0x10000 + ((value & 0b1111111111) << 10) + (input.charCodeAt(++i) & 0b1111111111); - bytes.push((surrogatePair >> 18) | 0b11110000, ((surrogatePair >> 12) & 0b111111) | 0b10000000, ((surrogatePair >> 6) & 0b111111) | 0b10000000, (surrogatePair & 0b111111) | 0b10000000); - } - else { - bytes.push((value >> 12) | 0b11100000, ((value >> 6) & 0b111111) | 0b10000000, (value & 0b111111) | 0b10000000); - } - } - return Uint8Array.from(bytes); -}; -exports.fromUtf8 = fromUtf8; -const toUtf8 = (input) => { - let decoded = ""; - for (let i = 0, len = input.length; i < len; i++) { - const byte = input[i]; - if (byte < 0x80) { - decoded += String.fromCharCode(byte); - } - else if (0b11000000 <= byte && byte < 0b11100000) { - const nextByte = input[++i]; - decoded += String.fromCharCode(((byte & 0b11111) << 6) | (nextByte & 0b111111)); - } - else if (0b11110000 <= byte && byte < 0b101101101) { - const surrogatePair = [byte, input[++i], input[++i], input[++i]]; - const encoded = "%" + surrogatePair.map((byteValue) => byteValue.toString(16)).join("%"); - decoded += decodeURIComponent(encoded); - } - else { - decoded += String.fromCharCode(((byte & 0b1111) << 12) | ((input[++i] & 0b111111) << 6) | (input[++i] & 0b111111)); - } - } - return decoded; -}; -exports.toUtf8 = toUtf8; +exports.escapeUri = void 0; +const escapeUri = (uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode); +exports.escapeUri = escapeUri; +const hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`; /***/ }), -/***/ 89215: -/***/ ((__unused_webpack_module, exports) => { +/***/ 54197: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.toUtf8 = exports.fromUtf8 = void 0; -function fromUtf8(input) { - return new TextEncoder().encode(input); -} -exports.fromUtf8 = fromUtf8; -function toUtf8(input) { - return new TextDecoder("utf-8").decode(input); -} -exports.toUtf8 = toUtf8; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(60010), exports); +tslib_1.__exportStar(__nccwpck_require__(26174), exports); /***/ }), -/***/ 10255: +/***/ 45917: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.fromUtf8 = void 0; -const util_buffer_from_1 = __nccwpck_require__(36010); +const util_buffer_from_1 = __nccwpck_require__(31381); const fromUtf8 = (input) => { const buf = (0, util_buffer_from_1.fromString)(input, "utf8"); return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); @@ -28100,28 +46100,28 @@ exports.fromUtf8 = fromUtf8; /***/ }), -/***/ 2855: +/***/ 41895: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(10255), exports); -tslib_1.__exportStar(__nccwpck_require__(61287), exports); -tslib_1.__exportStar(__nccwpck_require__(12348), exports); +tslib_1.__exportStar(__nccwpck_require__(45917), exports); +tslib_1.__exportStar(__nccwpck_require__(95470), exports); +tslib_1.__exportStar(__nccwpck_require__(99960), exports); /***/ }), -/***/ 61287: +/***/ 95470: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.toUint8Array = void 0; -const fromUtf8_1 = __nccwpck_require__(10255); +const fromUtf8_1 = __nccwpck_require__(45917); const toUint8Array = (data) => { if (typeof data === "string") { return (0, fromUtf8_1.fromUtf8)(data); @@ -28136,30 +46136,30 @@ exports.toUint8Array = toUint8Array; /***/ }), -/***/ 12348: +/***/ 99960: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.toUtf8 = void 0; -const util_buffer_from_1 = __nccwpck_require__(36010); +const util_buffer_from_1 = __nccwpck_require__(31381); const toUtf8 = (input) => (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); exports.toUtf8 = toUtf8; /***/ }), -/***/ 38880: +/***/ 76991: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.createWaiter = void 0; -const poller_1 = __nccwpck_require__(92105); -const utils_1 = __nccwpck_require__(36001); -const waiter_1 = __nccwpck_require__(4996); +const poller_1 = __nccwpck_require__(39033); +const utils_1 = __nccwpck_require__(26000); +const waiter_1 = __nccwpck_require__(79089); const abortTimeout = async (abortSignal) => { return new Promise((resolve) => { abortSignal.onabort = () => resolve({ state: waiter_1.WaiterState.ABORTED }); @@ -28185,28 +46185,28 @@ exports.createWaiter = createWaiter; /***/ }), -/***/ 21627: +/***/ 78011: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(38880), exports); -tslib_1.__exportStar(__nccwpck_require__(4996), exports); +tslib_1.__exportStar(__nccwpck_require__(76991), exports); +tslib_1.__exportStar(__nccwpck_require__(79089), exports); /***/ }), -/***/ 92105: +/***/ 39033: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.runPolling = void 0; -const sleep_1 = __nccwpck_require__(17397); -const waiter_1 = __nccwpck_require__(4996); +const sleep_1 = __nccwpck_require__(62380); +const waiter_1 = __nccwpck_require__(79089); const exponentialBackoffWithJitter = (minDelay, maxDelay, attemptCeiling, attempt) => { if (attempt > attemptCeiling) return maxDelay; @@ -28244,20 +46244,20 @@ exports.runPolling = runPolling; /***/ }), -/***/ 36001: +/***/ 26000: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; Object.defineProperty(exports, "__esModule", ({ value: true })); const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(17397), exports); -tslib_1.__exportStar(__nccwpck_require__(23931), exports); +tslib_1.__exportStar(__nccwpck_require__(62380), exports); +tslib_1.__exportStar(__nccwpck_require__(6594), exports); /***/ }), -/***/ 17397: +/***/ 62380: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -28272,7 +46272,7 @@ exports.sleep = sleep; /***/ }), -/***/ 23931: +/***/ 6594: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -28301,7 +46301,7 @@ exports.validateWaiterOptions = validateWaiterOptions; /***/ }), -/***/ 4996: +/***/ 79089: /***/ ((__unused_webpack_module, exports) => { "use strict"; @@ -28345,214 +46345,6 @@ const checkExceptions = (result) => { exports.checkExceptions = checkExceptions; -/***/ }), - -/***/ 89179: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.Field = void 0; -const types_1 = __nccwpck_require__(19135); -class Field { - constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) { - this.name = name; - this.kind = kind; - this.values = values; - } - add(value) { - this.values.push(value); - } - set(values) { - this.values = values; - } - remove(value) { - this.values = this.values.filter((v) => v !== value); - } - toString() { - return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", "); - } - get() { - return this.values; - } -} -exports.Field = Field; - - -/***/ }), - -/***/ 99242: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.Fields = void 0; -class Fields { - constructor({ fields = [], encoding = "utf-8" }) { - this.entries = {}; - fields.forEach(this.setField.bind(this)); - this.encoding = encoding; - } - setField(field) { - this.entries[field.name.toLowerCase()] = field; - } - getField(name) { - return this.entries[name.toLowerCase()]; - } - removeField(name) { - delete this.entries[name.toLowerCase()]; - } - getByType(kind) { - return Object.values(this.entries).filter((field) => field.kind === kind); - } -} -exports.Fields = Fields; - - -/***/ }), - -/***/ 63206: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); - - -/***/ }), - -/***/ 38746: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.HttpRequest = void 0; -class HttpRequest { - constructor(options) { - this.method = options.method || "GET"; - this.hostname = options.hostname || "localhost"; - this.port = options.port; - this.query = options.query || {}; - this.headers = options.headers || {}; - this.body = options.body; - this.protocol = options.protocol - ? options.protocol.slice(-1) !== ":" - ? `${options.protocol}:` - : options.protocol - : "https:"; - this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; - } - static isInstance(request) { - if (!request) - return false; - const req = request; - return ("method" in req && - "protocol" in req && - "hostname" in req && - "path" in req && - typeof req["query"] === "object" && - typeof req["headers"] === "object"); - } - clone() { - const cloned = new HttpRequest({ - ...this, - headers: { ...this.headers }, - }); - if (cloned.query) - cloned.query = cloneQuery(cloned.query); - return cloned; - } -} -exports.HttpRequest = HttpRequest; -function cloneQuery(query) { - return Object.keys(query).reduce((carry, paramName) => { - const param = query[paramName]; - return { - ...carry, - [paramName]: Array.isArray(param) ? [...param] : param, - }; - }, {}); -} - - -/***/ }), - -/***/ 26322: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.HttpResponse = void 0; -class HttpResponse { - constructor(options) { - this.statusCode = options.statusCode; - this.headers = options.headers || {}; - this.body = options.body; - } - static isInstance(response) { - if (!response) - return false; - const resp = response; - return typeof resp.statusCode === "number" && typeof resp.headers === "object"; - } -} -exports.HttpResponse = HttpResponse; - - -/***/ }), - -/***/ 64418: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -const tslib_1 = __nccwpck_require__(4351); -tslib_1.__exportStar(__nccwpck_require__(89179), exports); -tslib_1.__exportStar(__nccwpck_require__(99242), exports); -tslib_1.__exportStar(__nccwpck_require__(63206), exports); -tslib_1.__exportStar(__nccwpck_require__(38746), exports); -tslib_1.__exportStar(__nccwpck_require__(26322), exports); -tslib_1.__exportStar(__nccwpck_require__(61466), exports); -tslib_1.__exportStar(__nccwpck_require__(19135), exports); - - -/***/ }), - -/***/ 61466: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.isValidHostname = void 0; -function isValidHostname(hostname) { - const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; - return hostPattern.test(hostname); -} -exports.isValidHostname = isValidHostname; - - -/***/ }), - -/***/ 19135: -/***/ ((__unused_webpack_module, exports) => { - -"use strict"; - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.FieldPosition = void 0; -var FieldPosition; -(function (FieldPosition) { - FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER"; - FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER"; -})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {})); - - /***/ }), /***/ 8348: @@ -31654,7 +49446,11 @@ class HttpsProxyAgent extends agent_base_1.Agent { let socket; if (proxy.protocol === 'https:') { debug('Creating `tls.Socket`: %o', this.connectOpts); - socket = tls.connect(this.connectOpts); + const servername = this.connectOpts.servername || this.connectOpts.host; + socket = tls.connect({ + ...this.connectOpts, + servername: servername && net.isIP(servername) ? undefined : servername + }); } else { debug('Creating `net.Socket`: %o', this.connectOpts); @@ -31797,7 +49593,10 @@ function parseProxyResponse(socket) { read(); return; } - const headerParts = buffered.toString('ascii').split('\r\n'); + const headerParts = buffered + .slice(0, endOfHeaders) + .toString('ascii') + .split('\r\n'); const firstLine = headerParts.shift(); if (!firstLine) { socket.destroy(); @@ -33763,11 +51562,11 @@ module.exports = require("util"); /***/ }), -/***/ 25929: +/***/ 9634: /***/ ((module) => { "use strict"; -module.exports = JSON.parse('{"name":"@aws-sdk/client-ecr-public","description":"AWS SDK for JavaScript Ecr Public Client for Node.js, Browser and React Native","version":"3.360.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:docs":"typedoc","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo ecr-public"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"3.0.0","@aws-crypto/sha256-js":"3.0.0","@aws-sdk/client-sts":"3.360.0","@aws-sdk/config-resolver":"3.357.0","@aws-sdk/credential-provider-node":"3.360.0","@aws-sdk/fetch-http-handler":"3.357.0","@aws-sdk/hash-node":"3.357.0","@aws-sdk/invalid-dependency":"3.357.0","@aws-sdk/middleware-content-length":"3.357.0","@aws-sdk/middleware-endpoint":"3.357.0","@aws-sdk/middleware-host-header":"3.357.0","@aws-sdk/middleware-logger":"3.357.0","@aws-sdk/middleware-recursion-detection":"3.357.0","@aws-sdk/middleware-retry":"3.357.0","@aws-sdk/middleware-serde":"3.357.0","@aws-sdk/middleware-signing":"3.357.0","@aws-sdk/middleware-stack":"3.357.0","@aws-sdk/middleware-user-agent":"3.357.0","@aws-sdk/node-config-provider":"3.357.0","@aws-sdk/node-http-handler":"3.360.0","@aws-sdk/smithy-client":"3.360.0","@aws-sdk/types":"3.357.0","@aws-sdk/url-parser":"3.357.0","@aws-sdk/util-base64":"3.310.0","@aws-sdk/util-body-length-browser":"3.310.0","@aws-sdk/util-body-length-node":"3.310.0","@aws-sdk/util-defaults-mode-browser":"3.360.0","@aws-sdk/util-defaults-mode-node":"3.360.0","@aws-sdk/util-endpoints":"3.357.0","@aws-sdk/util-retry":"3.357.0","@aws-sdk/util-user-agent-browser":"3.357.0","@aws-sdk/util-user-agent-node":"3.357.0","@aws-sdk/util-utf8":"3.310.0","@smithy/protocol-http":"^1.0.1","@smithy/types":"^1.0.0","tslib":"^2.5.0"},"devDependencies":{"@aws-sdk/service-client-documentation-generator":"3.310.0","@tsconfig/node14":"1.0.3","@types/node":"^14.14.31","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typedoc":"0.23.23","typescript":"~4.9.5"},"engines":{"node":">=14.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-ecr-public","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-ecr-public"}}'); +module.exports = JSON.parse('{"name":"@aws-sdk/client-ecr-public","description":"AWS SDK for JavaScript Ecr Public Client for Node.js, Browser and React Native","version":"3.418.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:docs":"typedoc","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo ecr-public"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"3.0.0","@aws-crypto/sha256-js":"3.0.0","@aws-sdk/client-sts":"3.418.0","@aws-sdk/credential-provider-node":"3.418.0","@aws-sdk/middleware-host-header":"3.418.0","@aws-sdk/middleware-logger":"3.418.0","@aws-sdk/middleware-recursion-detection":"3.418.0","@aws-sdk/middleware-signing":"3.418.0","@aws-sdk/middleware-user-agent":"3.418.0","@aws-sdk/region-config-resolver":"3.418.0","@aws-sdk/types":"3.418.0","@aws-sdk/util-endpoints":"3.418.0","@aws-sdk/util-user-agent-browser":"3.418.0","@aws-sdk/util-user-agent-node":"3.418.0","@smithy/config-resolver":"^2.0.10","@smithy/fetch-http-handler":"^2.1.5","@smithy/hash-node":"^2.0.9","@smithy/invalid-dependency":"^2.0.9","@smithy/middleware-content-length":"^2.0.11","@smithy/middleware-endpoint":"^2.0.9","@smithy/middleware-retry":"^2.0.12","@smithy/middleware-serde":"^2.0.9","@smithy/middleware-stack":"^2.0.2","@smithy/node-config-provider":"^2.0.12","@smithy/node-http-handler":"^2.1.5","@smithy/protocol-http":"^3.0.5","@smithy/smithy-client":"^2.1.6","@smithy/types":"^2.3.3","@smithy/url-parser":"^2.0.9","@smithy/util-base64":"^2.0.0","@smithy/util-body-length-browser":"^2.0.0","@smithy/util-body-length-node":"^2.1.0","@smithy/util-defaults-mode-browser":"^2.0.10","@smithy/util-defaults-mode-node":"^2.0.12","@smithy/util-retry":"^2.0.2","@smithy/util-utf8":"^2.0.0","tslib":"^2.5.0"},"devDependencies":{"@smithy/service-client-documentation-generator":"^2.0.0","@tsconfig/node14":"1.0.3","@types/node":"^14.14.31","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typedoc":"0.23.23","typescript":"~4.9.5"},"engines":{"node":">=14.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-ecr-public","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-ecr-public"}}'); /***/ }), @@ -33775,15 +51574,7 @@ module.exports = JSON.parse('{"name":"@aws-sdk/client-ecr-public","description": /***/ ((module) => { "use strict"; -module.exports = JSON.parse('{"name":"@aws-sdk/client-ecr","description":"AWS SDK for JavaScript Ecr Client for Node.js, Browser and React Native","version":"3.360.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:docs":"typedoc","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo ecr"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"3.0.0","@aws-crypto/sha256-js":"3.0.0","@aws-sdk/client-sts":"3.360.0","@aws-sdk/config-resolver":"3.357.0","@aws-sdk/credential-provider-node":"3.360.0","@aws-sdk/fetch-http-handler":"3.357.0","@aws-sdk/hash-node":"3.357.0","@aws-sdk/invalid-dependency":"3.357.0","@aws-sdk/middleware-content-length":"3.357.0","@aws-sdk/middleware-endpoint":"3.357.0","@aws-sdk/middleware-host-header":"3.357.0","@aws-sdk/middleware-logger":"3.357.0","@aws-sdk/middleware-recursion-detection":"3.357.0","@aws-sdk/middleware-retry":"3.357.0","@aws-sdk/middleware-serde":"3.357.0","@aws-sdk/middleware-signing":"3.357.0","@aws-sdk/middleware-stack":"3.357.0","@aws-sdk/middleware-user-agent":"3.357.0","@aws-sdk/node-config-provider":"3.357.0","@aws-sdk/node-http-handler":"3.360.0","@aws-sdk/smithy-client":"3.360.0","@aws-sdk/types":"3.357.0","@aws-sdk/url-parser":"3.357.0","@aws-sdk/util-base64":"3.310.0","@aws-sdk/util-body-length-browser":"3.310.0","@aws-sdk/util-body-length-node":"3.310.0","@aws-sdk/util-defaults-mode-browser":"3.360.0","@aws-sdk/util-defaults-mode-node":"3.360.0","@aws-sdk/util-endpoints":"3.357.0","@aws-sdk/util-retry":"3.357.0","@aws-sdk/util-user-agent-browser":"3.357.0","@aws-sdk/util-user-agent-node":"3.357.0","@aws-sdk/util-utf8":"3.310.0","@aws-sdk/util-waiter":"3.357.0","@smithy/protocol-http":"^1.0.1","@smithy/types":"^1.0.0","tslib":"^2.5.0"},"devDependencies":{"@aws-sdk/service-client-documentation-generator":"3.310.0","@tsconfig/node14":"1.0.3","@types/node":"^14.14.31","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typedoc":"0.23.23","typescript":"~4.9.5"},"engines":{"node":">=14.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-ecr","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-ecr"}}'); - -/***/ }), - -/***/ 69722: -/***/ ((module) => { - -"use strict"; -module.exports = JSON.parse('{"name":"@aws-sdk/client-sso-oidc","description":"AWS SDK for JavaScript Sso Oidc Client for Node.js, Browser and React Native","version":"3.360.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:docs":"typedoc","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo sso-oidc"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"3.0.0","@aws-crypto/sha256-js":"3.0.0","@aws-sdk/config-resolver":"3.357.0","@aws-sdk/fetch-http-handler":"3.357.0","@aws-sdk/hash-node":"3.357.0","@aws-sdk/invalid-dependency":"3.357.0","@aws-sdk/middleware-content-length":"3.357.0","@aws-sdk/middleware-endpoint":"3.357.0","@aws-sdk/middleware-host-header":"3.357.0","@aws-sdk/middleware-logger":"3.357.0","@aws-sdk/middleware-recursion-detection":"3.357.0","@aws-sdk/middleware-retry":"3.357.0","@aws-sdk/middleware-serde":"3.357.0","@aws-sdk/middleware-stack":"3.357.0","@aws-sdk/middleware-user-agent":"3.357.0","@aws-sdk/node-config-provider":"3.357.0","@aws-sdk/node-http-handler":"3.360.0","@aws-sdk/smithy-client":"3.360.0","@aws-sdk/types":"3.357.0","@aws-sdk/url-parser":"3.357.0","@aws-sdk/util-base64":"3.310.0","@aws-sdk/util-body-length-browser":"3.310.0","@aws-sdk/util-body-length-node":"3.310.0","@aws-sdk/util-defaults-mode-browser":"3.360.0","@aws-sdk/util-defaults-mode-node":"3.360.0","@aws-sdk/util-endpoints":"3.357.0","@aws-sdk/util-retry":"3.357.0","@aws-sdk/util-user-agent-browser":"3.357.0","@aws-sdk/util-user-agent-node":"3.357.0","@aws-sdk/util-utf8":"3.310.0","@smithy/protocol-http":"^1.0.1","@smithy/types":"^1.0.0","tslib":"^2.5.0"},"devDependencies":{"@aws-sdk/service-client-documentation-generator":"3.310.0","@tsconfig/node14":"1.0.3","@types/node":"^14.14.31","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typedoc":"0.23.23","typescript":"~4.9.5"},"engines":{"node":">=14.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso-oidc","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sso-oidc"}}'); +module.exports = JSON.parse('{"name":"@aws-sdk/client-ecr","description":"AWS SDK for JavaScript Ecr Client for Node.js, Browser and React Native","version":"3.418.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:docs":"typedoc","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo ecr"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"3.0.0","@aws-crypto/sha256-js":"3.0.0","@aws-sdk/client-sts":"3.418.0","@aws-sdk/credential-provider-node":"3.418.0","@aws-sdk/middleware-host-header":"3.418.0","@aws-sdk/middleware-logger":"3.418.0","@aws-sdk/middleware-recursion-detection":"3.418.0","@aws-sdk/middleware-signing":"3.418.0","@aws-sdk/middleware-user-agent":"3.418.0","@aws-sdk/region-config-resolver":"3.418.0","@aws-sdk/types":"3.418.0","@aws-sdk/util-endpoints":"3.418.0","@aws-sdk/util-user-agent-browser":"3.418.0","@aws-sdk/util-user-agent-node":"3.418.0","@smithy/config-resolver":"^2.0.10","@smithy/fetch-http-handler":"^2.1.5","@smithy/hash-node":"^2.0.9","@smithy/invalid-dependency":"^2.0.9","@smithy/middleware-content-length":"^2.0.11","@smithy/middleware-endpoint":"^2.0.9","@smithy/middleware-retry":"^2.0.12","@smithy/middleware-serde":"^2.0.9","@smithy/middleware-stack":"^2.0.2","@smithy/node-config-provider":"^2.0.12","@smithy/node-http-handler":"^2.1.5","@smithy/protocol-http":"^3.0.5","@smithy/smithy-client":"^2.1.6","@smithy/types":"^2.3.3","@smithy/url-parser":"^2.0.9","@smithy/util-base64":"^2.0.0","@smithy/util-body-length-browser":"^2.0.0","@smithy/util-body-length-node":"^2.1.0","@smithy/util-defaults-mode-browser":"^2.0.10","@smithy/util-defaults-mode-node":"^2.0.12","@smithy/util-retry":"^2.0.2","@smithy/util-utf8":"^2.0.0","@smithy/util-waiter":"^2.0.9","tslib":"^2.5.0"},"devDependencies":{"@smithy/service-client-documentation-generator":"^2.0.0","@tsconfig/node14":"1.0.3","@types/node":"^14.14.31","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typedoc":"0.23.23","typescript":"~4.9.5"},"engines":{"node":">=14.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-ecr","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-ecr"}}'); /***/ }), @@ -33791,7 +51582,7 @@ module.exports = JSON.parse('{"name":"@aws-sdk/client-sso-oidc","description":"A /***/ ((module) => { "use strict"; -module.exports = JSON.parse('{"name":"@aws-sdk/client-sso","description":"AWS SDK for JavaScript Sso Client for Node.js, Browser and React Native","version":"3.360.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:docs":"typedoc","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo sso"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"3.0.0","@aws-crypto/sha256-js":"3.0.0","@aws-sdk/config-resolver":"3.357.0","@aws-sdk/fetch-http-handler":"3.357.0","@aws-sdk/hash-node":"3.357.0","@aws-sdk/invalid-dependency":"3.357.0","@aws-sdk/middleware-content-length":"3.357.0","@aws-sdk/middleware-endpoint":"3.357.0","@aws-sdk/middleware-host-header":"3.357.0","@aws-sdk/middleware-logger":"3.357.0","@aws-sdk/middleware-recursion-detection":"3.357.0","@aws-sdk/middleware-retry":"3.357.0","@aws-sdk/middleware-serde":"3.357.0","@aws-sdk/middleware-stack":"3.357.0","@aws-sdk/middleware-user-agent":"3.357.0","@aws-sdk/node-config-provider":"3.357.0","@aws-sdk/node-http-handler":"3.360.0","@aws-sdk/smithy-client":"3.360.0","@aws-sdk/types":"3.357.0","@aws-sdk/url-parser":"3.357.0","@aws-sdk/util-base64":"3.310.0","@aws-sdk/util-body-length-browser":"3.310.0","@aws-sdk/util-body-length-node":"3.310.0","@aws-sdk/util-defaults-mode-browser":"3.360.0","@aws-sdk/util-defaults-mode-node":"3.360.0","@aws-sdk/util-endpoints":"3.357.0","@aws-sdk/util-retry":"3.357.0","@aws-sdk/util-user-agent-browser":"3.357.0","@aws-sdk/util-user-agent-node":"3.357.0","@aws-sdk/util-utf8":"3.310.0","@smithy/protocol-http":"^1.0.1","@smithy/types":"^1.0.0","tslib":"^2.5.0"},"devDependencies":{"@aws-sdk/service-client-documentation-generator":"3.310.0","@tsconfig/node14":"1.0.3","@types/node":"^14.14.31","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typedoc":"0.23.23","typescript":"~4.9.5"},"engines":{"node":">=14.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sso"}}'); +module.exports = JSON.parse('{"name":"@aws-sdk/client-sso","description":"AWS SDK for JavaScript Sso Client for Node.js, Browser and React Native","version":"3.418.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:docs":"typedoc","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo sso"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"3.0.0","@aws-crypto/sha256-js":"3.0.0","@aws-sdk/middleware-host-header":"3.418.0","@aws-sdk/middleware-logger":"3.418.0","@aws-sdk/middleware-recursion-detection":"3.418.0","@aws-sdk/middleware-user-agent":"3.418.0","@aws-sdk/region-config-resolver":"3.418.0","@aws-sdk/types":"3.418.0","@aws-sdk/util-endpoints":"3.418.0","@aws-sdk/util-user-agent-browser":"3.418.0","@aws-sdk/util-user-agent-node":"3.418.0","@smithy/config-resolver":"^2.0.10","@smithy/fetch-http-handler":"^2.1.5","@smithy/hash-node":"^2.0.9","@smithy/invalid-dependency":"^2.0.9","@smithy/middleware-content-length":"^2.0.11","@smithy/middleware-endpoint":"^2.0.9","@smithy/middleware-retry":"^2.0.12","@smithy/middleware-serde":"^2.0.9","@smithy/middleware-stack":"^2.0.2","@smithy/node-config-provider":"^2.0.12","@smithy/node-http-handler":"^2.1.5","@smithy/protocol-http":"^3.0.5","@smithy/smithy-client":"^2.1.6","@smithy/types":"^2.3.3","@smithy/url-parser":"^2.0.9","@smithy/util-base64":"^2.0.0","@smithy/util-body-length-browser":"^2.0.0","@smithy/util-body-length-node":"^2.1.0","@smithy/util-defaults-mode-browser":"^2.0.10","@smithy/util-defaults-mode-node":"^2.0.12","@smithy/util-retry":"^2.0.2","@smithy/util-utf8":"^2.0.0","tslib":"^2.5.0"},"devDependencies":{"@smithy/service-client-documentation-generator":"^2.0.0","@tsconfig/node14":"1.0.3","@types/node":"^14.14.31","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typedoc":"0.23.23","typescript":"~4.9.5"},"engines":{"node":">=14.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sso"}}'); /***/ }), @@ -33799,7 +51590,7 @@ module.exports = JSON.parse('{"name":"@aws-sdk/client-sso","description":"AWS SD /***/ ((module) => { "use strict"; -module.exports = JSON.parse('{"name":"@aws-sdk/client-sts","description":"AWS SDK for JavaScript Sts Client for Node.js, Browser and React Native","version":"3.360.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:docs":"typedoc","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo sts","test":"yarn test:unit","test:unit":"jest"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"3.0.0","@aws-crypto/sha256-js":"3.0.0","@aws-sdk/config-resolver":"3.357.0","@aws-sdk/credential-provider-node":"3.360.0","@aws-sdk/fetch-http-handler":"3.357.0","@aws-sdk/hash-node":"3.357.0","@aws-sdk/invalid-dependency":"3.357.0","@aws-sdk/middleware-content-length":"3.357.0","@aws-sdk/middleware-endpoint":"3.357.0","@aws-sdk/middleware-host-header":"3.357.0","@aws-sdk/middleware-logger":"3.357.0","@aws-sdk/middleware-recursion-detection":"3.357.0","@aws-sdk/middleware-retry":"3.357.0","@aws-sdk/middleware-sdk-sts":"3.357.0","@aws-sdk/middleware-serde":"3.357.0","@aws-sdk/middleware-signing":"3.357.0","@aws-sdk/middleware-stack":"3.357.0","@aws-sdk/middleware-user-agent":"3.357.0","@aws-sdk/node-config-provider":"3.357.0","@aws-sdk/node-http-handler":"3.360.0","@aws-sdk/smithy-client":"3.360.0","@aws-sdk/types":"3.357.0","@aws-sdk/url-parser":"3.357.0","@aws-sdk/util-base64":"3.310.0","@aws-sdk/util-body-length-browser":"3.310.0","@aws-sdk/util-body-length-node":"3.310.0","@aws-sdk/util-defaults-mode-browser":"3.360.0","@aws-sdk/util-defaults-mode-node":"3.360.0","@aws-sdk/util-endpoints":"3.357.0","@aws-sdk/util-retry":"3.357.0","@aws-sdk/util-user-agent-browser":"3.357.0","@aws-sdk/util-user-agent-node":"3.357.0","@aws-sdk/util-utf8":"3.310.0","@smithy/protocol-http":"^1.0.1","@smithy/types":"^1.0.0","fast-xml-parser":"4.2.5","tslib":"^2.5.0"},"devDependencies":{"@aws-sdk/service-client-documentation-generator":"3.310.0","@tsconfig/node14":"1.0.3","@types/node":"^14.14.31","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typedoc":"0.23.23","typescript":"~4.9.5"},"engines":{"node":">=14.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sts","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sts"}}'); +module.exports = JSON.parse('{"name":"@aws-sdk/client-sts","description":"AWS SDK for JavaScript Sts Client for Node.js, Browser and React Native","version":"3.418.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:docs":"typedoc","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo sts","test":"yarn test:unit","test:unit":"jest"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"3.0.0","@aws-crypto/sha256-js":"3.0.0","@aws-sdk/credential-provider-node":"3.418.0","@aws-sdk/middleware-host-header":"3.418.0","@aws-sdk/middleware-logger":"3.418.0","@aws-sdk/middleware-recursion-detection":"3.418.0","@aws-sdk/middleware-sdk-sts":"3.418.0","@aws-sdk/middleware-signing":"3.418.0","@aws-sdk/middleware-user-agent":"3.418.0","@aws-sdk/region-config-resolver":"3.418.0","@aws-sdk/types":"3.418.0","@aws-sdk/util-endpoints":"3.418.0","@aws-sdk/util-user-agent-browser":"3.418.0","@aws-sdk/util-user-agent-node":"3.418.0","@smithy/config-resolver":"^2.0.10","@smithy/fetch-http-handler":"^2.1.5","@smithy/hash-node":"^2.0.9","@smithy/invalid-dependency":"^2.0.9","@smithy/middleware-content-length":"^2.0.11","@smithy/middleware-endpoint":"^2.0.9","@smithy/middleware-retry":"^2.0.12","@smithy/middleware-serde":"^2.0.9","@smithy/middleware-stack":"^2.0.2","@smithy/node-config-provider":"^2.0.12","@smithy/node-http-handler":"^2.1.5","@smithy/protocol-http":"^3.0.5","@smithy/smithy-client":"^2.1.6","@smithy/types":"^2.3.3","@smithy/url-parser":"^2.0.9","@smithy/util-base64":"^2.0.0","@smithy/util-body-length-browser":"^2.0.0","@smithy/util-body-length-node":"^2.1.0","@smithy/util-defaults-mode-browser":"^2.0.10","@smithy/util-defaults-mode-node":"^2.0.12","@smithy/util-retry":"^2.0.2","@smithy/util-utf8":"^2.0.0","fast-xml-parser":"4.2.5","tslib":"^2.5.0"},"devDependencies":{"@smithy/service-client-documentation-generator":"^2.0.0","@tsconfig/node14":"1.0.3","@types/node":"^14.14.31","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typedoc":"0.23.23","typescript":"~4.9.5"},"engines":{"node":">=14.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sts","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sts"}}'); /***/ }), @@ -33807,7 +51598,7 @@ module.exports = JSON.parse('{"name":"@aws-sdk/client-sts","description":"AWS SD /***/ ((module) => { "use strict"; -module.exports = JSON.parse('{"partitions":[{"id":"aws","outputs":{"dnsSuffix":"amazonaws.com","dualStackDnsSuffix":"api.aws","name":"aws","supportsDualStack":true,"supportsFIPS":true},"regionRegex":"^(us|eu|ap|sa|ca|me|af)\\\\-\\\\w+\\\\-\\\\d+$","regions":{"af-south-1":{"description":"Africa (Cape Town)"},"ap-east-1":{"description":"Asia Pacific (Hong Kong)"},"ap-northeast-1":{"description":"Asia Pacific (Tokyo)"},"ap-northeast-2":{"description":"Asia Pacific (Seoul)"},"ap-northeast-3":{"description":"Asia Pacific (Osaka)"},"ap-south-1":{"description":"Asia Pacific (Mumbai)"},"ap-south-2":{"description":"Asia Pacific (Hyderabad)"},"ap-southeast-1":{"description":"Asia Pacific (Singapore)"},"ap-southeast-2":{"description":"Asia Pacific (Sydney)"},"ap-southeast-3":{"description":"Asia Pacific (Jakarta)"},"ap-southeast-4":{"description":"Asia Pacific (Melbourne)"},"aws-global":{"description":"AWS Standard global region"},"ca-central-1":{"description":"Canada (Central)"},"eu-central-1":{"description":"Europe (Frankfurt)"},"eu-central-2":{"description":"Europe (Zurich)"},"eu-north-1":{"description":"Europe (Stockholm)"},"eu-south-1":{"description":"Europe (Milan)"},"eu-south-2":{"description":"Europe (Spain)"},"eu-west-1":{"description":"Europe (Ireland)"},"eu-west-2":{"description":"Europe (London)"},"eu-west-3":{"description":"Europe (Paris)"},"me-central-1":{"description":"Middle East (UAE)"},"me-south-1":{"description":"Middle East (Bahrain)"},"sa-east-1":{"description":"South America (Sao Paulo)"},"us-east-1":{"description":"US East (N. Virginia)"},"us-east-2":{"description":"US East (Ohio)"},"us-west-1":{"description":"US West (N. California)"},"us-west-2":{"description":"US West (Oregon)"}}},{"id":"aws-cn","outputs":{"dnsSuffix":"amazonaws.com.cn","dualStackDnsSuffix":"api.amazonwebservices.com.cn","name":"aws-cn","supportsDualStack":true,"supportsFIPS":true},"regionRegex":"^cn\\\\-\\\\w+\\\\-\\\\d+$","regions":{"aws-cn-global":{"description":"AWS China global region"},"cn-north-1":{"description":"China (Beijing)"},"cn-northwest-1":{"description":"China (Ningxia)"}}},{"id":"aws-us-gov","outputs":{"dnsSuffix":"amazonaws.com","dualStackDnsSuffix":"api.aws","name":"aws-us-gov","supportsDualStack":true,"supportsFIPS":true},"regionRegex":"^us\\\\-gov\\\\-\\\\w+\\\\-\\\\d+$","regions":{"aws-us-gov-global":{"description":"AWS GovCloud (US) global region"},"us-gov-east-1":{"description":"AWS GovCloud (US-East)"},"us-gov-west-1":{"description":"AWS GovCloud (US-West)"}}},{"id":"aws-iso","outputs":{"dnsSuffix":"c2s.ic.gov","dualStackDnsSuffix":"c2s.ic.gov","name":"aws-iso","supportsDualStack":false,"supportsFIPS":true},"regionRegex":"^us\\\\-iso\\\\-\\\\w+\\\\-\\\\d+$","regions":{"aws-iso-global":{"description":"AWS ISO (US) global region"},"us-iso-east-1":{"description":"US ISO East"},"us-iso-west-1":{"description":"US ISO WEST"}}},{"id":"aws-iso-b","outputs":{"dnsSuffix":"sc2s.sgov.gov","dualStackDnsSuffix":"sc2s.sgov.gov","name":"aws-iso-b","supportsDualStack":false,"supportsFIPS":true},"regionRegex":"^us\\\\-isob\\\\-\\\\w+\\\\-\\\\d+$","regions":{"aws-iso-b-global":{"description":"AWS ISOB (US) global region"},"us-isob-east-1":{"description":"US ISOB East (Ohio)"}}},{"id":"aws-iso-e","outputs":{"dnsSuffix":"cloud.adc-e.uk","dualStackDnsSuffix":"cloud.adc-e.uk","name":"aws-iso-e","supportsDualStack":false,"supportsFIPS":true},"regionRegex":"^eu\\\\-isoe\\\\-\\\\w+\\\\-\\\\d+$","regions":{}},{"id":"aws-iso-f","outputs":{"dnsSuffix":"csp.hci.ic.gov","dualStackDnsSuffix":"csp.hci.ic.gov","name":"aws-iso-f","supportsDualStack":false,"supportsFIPS":true},"regionRegex":"^us\\\\-isof\\\\-\\\\w+\\\\-\\\\d+$","regions":{}}],"version":"1.1"}'); +module.exports = JSON.parse('{"partitions":[{"id":"aws","outputs":{"dnsSuffix":"amazonaws.com","dualStackDnsSuffix":"api.aws","implicitGlobalRegion":"us-east-1","name":"aws","supportsDualStack":true,"supportsFIPS":true},"regionRegex":"^(us|eu|ap|sa|ca|me|af|il)\\\\-\\\\w+\\\\-\\\\d+$","regions":{"af-south-1":{"description":"Africa (Cape Town)"},"ap-east-1":{"description":"Asia Pacific (Hong Kong)"},"ap-northeast-1":{"description":"Asia Pacific (Tokyo)"},"ap-northeast-2":{"description":"Asia Pacific (Seoul)"},"ap-northeast-3":{"description":"Asia Pacific (Osaka)"},"ap-south-1":{"description":"Asia Pacific (Mumbai)"},"ap-south-2":{"description":"Asia Pacific (Hyderabad)"},"ap-southeast-1":{"description":"Asia Pacific (Singapore)"},"ap-southeast-2":{"description":"Asia Pacific (Sydney)"},"ap-southeast-3":{"description":"Asia Pacific (Jakarta)"},"ap-southeast-4":{"description":"Asia Pacific (Melbourne)"},"aws-global":{"description":"AWS Standard global region"},"ca-central-1":{"description":"Canada (Central)"},"eu-central-1":{"description":"Europe (Frankfurt)"},"eu-central-2":{"description":"Europe (Zurich)"},"eu-north-1":{"description":"Europe (Stockholm)"},"eu-south-1":{"description":"Europe (Milan)"},"eu-south-2":{"description":"Europe (Spain)"},"eu-west-1":{"description":"Europe (Ireland)"},"eu-west-2":{"description":"Europe (London)"},"eu-west-3":{"description":"Europe (Paris)"},"il-central-1":{"description":"Israel (Tel Aviv)"},"me-central-1":{"description":"Middle East (UAE)"},"me-south-1":{"description":"Middle East (Bahrain)"},"sa-east-1":{"description":"South America (Sao Paulo)"},"us-east-1":{"description":"US East (N. Virginia)"},"us-east-2":{"description":"US East (Ohio)"},"us-west-1":{"description":"US West (N. California)"},"us-west-2":{"description":"US West (Oregon)"}}},{"id":"aws-cn","outputs":{"dnsSuffix":"amazonaws.com.cn","dualStackDnsSuffix":"api.amazonwebservices.com.cn","implicitGlobalRegion":"cn-northwest-1","name":"aws-cn","supportsDualStack":true,"supportsFIPS":true},"regionRegex":"^cn\\\\-\\\\w+\\\\-\\\\d+$","regions":{"aws-cn-global":{"description":"AWS China global region"},"cn-north-1":{"description":"China (Beijing)"},"cn-northwest-1":{"description":"China (Ningxia)"}}},{"id":"aws-us-gov","outputs":{"dnsSuffix":"amazonaws.com","dualStackDnsSuffix":"api.aws","implicitGlobalRegion":"us-gov-west-1","name":"aws-us-gov","supportsDualStack":true,"supportsFIPS":true},"regionRegex":"^us\\\\-gov\\\\-\\\\w+\\\\-\\\\d+$","regions":{"aws-us-gov-global":{"description":"AWS GovCloud (US) global region"},"us-gov-east-1":{"description":"AWS GovCloud (US-East)"},"us-gov-west-1":{"description":"AWS GovCloud (US-West)"}}},{"id":"aws-iso","outputs":{"dnsSuffix":"c2s.ic.gov","dualStackDnsSuffix":"c2s.ic.gov","implicitGlobalRegion":"us-iso-east-1","name":"aws-iso","supportsDualStack":false,"supportsFIPS":true},"regionRegex":"^us\\\\-iso\\\\-\\\\w+\\\\-\\\\d+$","regions":{"aws-iso-global":{"description":"AWS ISO (US) global region"},"us-iso-east-1":{"description":"US ISO East"},"us-iso-west-1":{"description":"US ISO WEST"}}},{"id":"aws-iso-b","outputs":{"dnsSuffix":"sc2s.sgov.gov","dualStackDnsSuffix":"sc2s.sgov.gov","implicitGlobalRegion":"us-isob-east-1","name":"aws-iso-b","supportsDualStack":false,"supportsFIPS":true},"regionRegex":"^us\\\\-isob\\\\-\\\\w+\\\\-\\\\d+$","regions":{"aws-iso-b-global":{"description":"AWS ISOB (US) global region"},"us-isob-east-1":{"description":"US ISOB East (Ohio)"}}},{"id":"aws-iso-e","outputs":{"dnsSuffix":"cloud.adc-e.uk","dualStackDnsSuffix":"cloud.adc-e.uk","implicitGlobalRegion":"eu-isoe-west-1","name":"aws-iso-e","supportsDualStack":false,"supportsFIPS":true},"regionRegex":"^eu\\\\-isoe\\\\-\\\\w+\\\\-\\\\d+$","regions":{}},{"id":"aws-iso-f","outputs":{"dnsSuffix":"csp.hci.ic.gov","dualStackDnsSuffix":"csp.hci.ic.gov","implicitGlobalRegion":"us-isof-south-1","name":"aws-iso-f","supportsDualStack":false,"supportsFIPS":true},"regionRegex":"^us\\\\-isof\\\\-\\\\w+\\\\-\\\\d+$","regions":{}}],"version":"1.1"}'); /***/ })